| Description | chemical-gene interactions curated from literature |
| Measurement | association by literature curation |
| Association | gene-chemical associations by manual literature curation |
| Category | physical interactions |
| Resource | Comparative Toxicogenomics Database |
| Citation(s) | |
| Last Updated |
|
| Stats |
|
| API | |
| Script | |
| Downloads |
Attribute Similarity
Dataset
Gene Similarity
9516 sets of genes/proteins interacting with chemicals from the curated CTD Gene-Chemical Interactions dataset.
| Gene Set | Description |
|---|---|
| 10'(Z),13'(E),15'(E)-heptadecatrienylhydroquinone | |
| Androstenediol | |
| EXP3174 | |
| benzo(j)fluoranthene | A naphthalene that has formula C20H12. |
| desflurane | |
| acetophenazine | |
| kaempferol-3-O-galactoside | |
| NuvaRing | |
| malvidin-3-O-glucoside-4 vinyl | |
| Dendroaspis natriuretic peptide | |
| alpha-naphthyl thiourea | A naphthalene that has formula C11H10N2S. |
| 19-oxo-11-deoxycorticosterone acetate | |
| idelalisib | A member of the class of quinazolines that is 5-fluoro-3-phenylquinazolin-4-one in which the hydrogen at position 2 is replaced by a (1S)-1-(3H-purin-6-ylamino)propyl group. used for for the treatment of refractory indolent non-Hodgkin's lymphoma and relapsed chronic lymphocytic leukemia. |
| telmisartan | |
| methyl 2-cyano-3,12-dioxoolean-1,9-dien-28-oate | |
| lawsone | 1,4-Naphthoquinone carrying a hydroxy function at C-2. It is obtained from the leaves of Lawsonia inermis. |
| Glutathione | |
| devrinol | |
| WEB 2086 | |
| xaliproden | A tetrahydropyridine that has formula C24H22F3N. |
| dimethoxon | |
| 4,4'-dimethylbiphenyl | |
| Cyclic ADP-Ribose | A cyclic purine nucleotide that is synthesised from NAD+ by ADP-ribosyl cyclase; acts as an agonist at ryanodine receptors. |
| Gliclazide | |
| Methylergonovine | |
| 5,7-dihydroxy-6-methoxy-2-phenylchromen-4-one | |
| 3-(hydroxymethyl)phenytoin | |
| 4-cyclohexyloxy-2-(1-(4-(4-methoxy-benzenesulfonyl)piperazin-1-yl)ethyl)quinazoline | |
| HMR 1556 | A 1-benzopyran that has formula C15H20N2O4S. |
| Methacholine Chloride | A quaternary ammonium salt that has formula C8H18NO2.Cl. |
| Folic Acid | An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
| RS 67333 | |
| 2,3,3',4,4'-pentachlorobiphenyl | |
| 2-hydroxychavicol | |
| Gadolinium | A lanthanoid atom that has formula Gd. |
| 2,3,4,5,6-pentachloroaniline | |
| etoperidone | |
| 2,5-dihydroxybenzaldehyde | A dihydroxybenzaldehyde carrying hydroxy groups at positions 2 and 5. |
| Kynurenic Acid | A quinolinemonocarboxylic acid that is quinoline-2-carboxylic acid substituted by a hydroxy group at C-4. |
| eremanthin | A sesquiterpene lactone that has formula C15H18O2. |
| Hydroxyeicosatetraenoic Acids | Any monohydroxylated icosanoid having four double bonds. |
| gamma-valerolactone | A butan-4-olide that is dihydrofuran-2(3H)-one substituted by a methyl group at position 5. It has been found in the urine samples of humans exposed to n-hexane. |
| L 745337 | |
| alanylproline-4-nitroanilide | |
| Nitrogen Mustard Compounds | |
| Mechlorethamine | |
| tyrphostin 47 | |
| 3,7-O-dimethylquercetin | |
| forsterite | |
| Pimozide | |
| Oxadiazoles | |
| nitrosonium tetrafluoroborate | |
| budlein A | A sesquiterpenoid that has formula C20H22O7. |
| Quipazine | |
| Amphetamine | An amphetamine, the parent of the class of amphetamines, having the structure 1-phenylpropan-2-amine. It exists as a racemate. |
| Trapidil | |
| WAY-169916 | |
| tetraoctylammonium bromide | |
| dicrotophos | A dialkyl phosphate that has formula C8H16NO5P. |
| cinacalcet | |
| 7-fluoro-2-oxo-4-(2-(4-(thieno(3,2-c)pyridin-4-yl)piperazin-1-yl)ethyl)-1,2-dihydroquinoline-1-acetamide | |
| Diflubenzuron | A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
| efatutazone | |
| GSK 2324 | |
| n-tetradecane | |
| triphenyltin | |
| naltrindole | An isoquinoline that has formula C26H26N2O3. |
| black widow spider venom | |
| Phenprocoumon | |
| Nortriptyline | An organic tricyclic compound that is 10,11-dihydro-5H-dibenzo[a,d][7]annulene substituted by a 3-(methylamino)propylidene group at position 5. It is an active metabolite of amitriptyline. |
| Butanols | |
| N-(1-methylethyl)-1,1,2-trimethylpropylamine | |
| M50354 | |
| 5(6)-carboxy-2',7'-dichlorofluorescein | |
| Cholera Toxin | |
| Chorionic Gonadotropin | |
| nitrosobenzylmethylamine | |
| 10,11-dihydro-10,11-dihydroxy-5H-dibenzazepine-5-carboxamide | |
| GABA Agents | |
| afimoxifene | A tertiary amino compound that is tamoxifen in which the phenyl group which is in a Z- relationship to the ethyl substituent is hydroxylated at the para- position. It is the active metabolite of tamoxifen. |
| 1-hydroxy-2,3,5-trimethoxyxanthone | |
| Nalbuphine | An organic heteropentacyclic compound that has formula C21H27NO4. |
| asiatic acid | A pentacyclic triterpenoid that is ursane substituted by a carboxy group at position 28 and hydroxy groups at positions 2, 3 and 23 (the 2alpha,3beta stereoisomer). It is isolated from Symplocos lancifolia and Vateria indica and exhibits anti-angiogenic activity. |
| cyclohexyl-(2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl)amine | |
| 5-cholesten-3,25-diol 3-sulfonate | |
| tridecane | A straight chain alkane containing 13 carbon atoms. It forms a component of the essential oils isolated from plants such as Abelmoschus esculentus. |
| sulfoxaflor | |
| 4-tolyl isocyanate | A member of the class of isocyanates comprising a benzene core with isocyanato- and methyl substituents para to each other. |
| Ortho Evra | |
| temocapril hydrochloride | |
| 1-(2-fluorophenyl)-3-(2-(morpholin-2-yl)ethyl)-1,3-dihydro-2,1,3-benzothiadiazole 2,2-dioxide | |
| Dihydroxyacetone Phosphate | |
| bis(tri-n-butyltin)oxide | |
| meloxicam | |
| UH 232 | |
| XP 620 | |
| Testosterone | An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
| phenylhydroquinone | |
| PAPA NONOate | |
| 1,5-dihydroxyisoquinoline | |
| Tiopronin | |
| 2-chloroethylamine | |
| Ferrosoferric Oxide | An iron oxide that has formula Fe3O4. |
| GW2974 | |
| 2-benzoquinone | |
| naloxonazine | |
| Nitrazepam | |
| tris(2-carboxyethyl)phosphine | |
| 2,4-bis(4'-fluorophenethylamino)-6-(3'-(N,N-dimethylamino)propylamino)-1,3,5-triazine | |
| 2-(methylamino)isobutyric acid | |
| 2,4,6-trichlorophenol | A trichlorophenol with phenolic substituents on positions 2, 4 and 6. |
| 6-(N,N-dimethylamino)-2-(naphthalene-1-yl)-4-quinazolinone | |
| Glyceraldehyde 3-Phosphate | An aldotriose phosphate that is the 3-phospho derivative of glyceraldehyde. It is an important metabolic intermediate in several central metabolic pathways in all organisms. |
| Nitroblue Tetrazolium | |
| bisindolylmaleimide | |
| N-Methyl-3,4-methylenedioxyamphetamine | |
| homoorientin | |
| hexacyanoferrate III | |
| NPS R-467 | |
| S-1,2-dichlorovinyl-N-acetylcysteine | |
| 2-phenylaminoadenosine | |
| Hydroxy Acids | Any carboxylic acid with at least one hydroxy group. |
| Floxacillin | |
| 3-anisidine | |
| 1,7-N-heptylene-bis-9,9'-amino-1,2,3,4-tetrahydroacridine | |
| NS 1619 | A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which the hydrogens at positions 1 and 5 are replaced are replaced by 2-hydroxy-5-(trifluoromethyl)phenyl and trifluoromethyl groups, respectively. It is an opener/activator of the large-conductance calcium-activated potassium channel (Bkca). |
| Creosote | |
| prunetin | A hydroxyisoflavone that is genistein in which the hydroxy group at position 7 is replaced by a methoxy group. |
| cinobufagin | A steroid lactone that has formula C26H34O6. |
| kangshuai yizhi | |
| 3-(4-hydroxy-2-methoxybenzylidene)anabaseine | |
| pentanal | A fatty aldehyde composed from five carbons in a straight chain |
| 2,2'-dipyridyl disulfide | |
| mifobate | |
| Skatole | A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
| Estrone | A 17-oxo steroid that is estra-1,3,5(10)-triene substituted by an hydroxy group at position 3 and an oxo group at position 17. |
| harmalol | A harmala alkaloid in which the harman skeleton is hydroxy-substituted at C-7 and has been reduced across the 3,4 bond. |
| seocalcitol | |
| 4-allyl-8-ethyl-7,8-dihydro-2-(3-methoxy-1-methyl-1H-pyrazol-5-yl)-1H-imidazo(2,1-i)purin-5(4H)-one | |
| 5-Methylcytosine | |
| ethylene | |
| Dalteparin | |
| docosapentaenoic acid | Any straight-chain, C22 fatty acid having five C=C double bonds. |
| AR-R 17779 | |
| 1-methylanthracene | |
| lycopene | An acyclic carotene commonly obtained from tomatoes and other red fruits. |
| Acyl Coenzyme A | |
| ferric-adenosine triphosphate complex | |
| niguldipine | A diarylmethane that has formula C36H39N3O6. |
| Flavin-Adenine Dinucleotide | |
| Dianisidine | |
| neoxanthin | An epoxycarotenoid that is 6,7-didehydro-5,5',6,6'-tetrahydro-5',6'-epoxy-beta,beta-carotene which is substituted by hydroxy groups at the 3, 3', and 5 positions. |
| N-ethylmaleimide-S-glutathione | A peptide that has formula C16H22N4O8S. |
| methidathion | An organothiophosphate insecticide that has formula C6H11N2O4PS3. |
| 1-acetonaphthone | |
| 3,7-bis(2-hydroxyethyl)icaritin | |
| brofaromine | |
| Azoxymethane | |
| diallyl disulfide | An organic disulfide where the organic group specified is allyl. It has been isolated from garlic and other species of the genus Allium. |
| bufalin | A 14beta-hydroxy steroid that is bufan-20,22-dienolide having hydroxy substituents at the 5beta- and 14beta-positions. It has been isolated from the skin of the toad Bufo bufo. |
| Naproxen | A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
| 4-ethylguaiacol | |
| Crotalid Venoms | |
| androstan-3-ol | |
| 4-hydroxystilbene | |
| piperophos | A N-acylpiperidine that has formula C14H28NO3PS2. |
| wogonoside | |
| trityl chloride | |
| sulfolithocholic acid | |
| Firemaster 550 | |
| Tetrodotoxin | A quinazoline alkaloid that is a marine toxin isolated from fish such as puffer fish. It has been shown to exhibit potential neutotoxicity due to its ability to block voltage-gated sodium channels. |
| Hazardous Substances | |
| Malondialdehyde | |
| 2-gluthionyl-3,5,6-trichloro-1,4-benzoquinone | |
| tenoxicam | |
| 2-(4-chloro-6-(2,3-dimethylphenylamino)pyrimidin-2-ylthio)octanoic acid | |
| CPU0213 | |
| Impromidine | |
| nomegestrol acetate | |
| oxotremorine M | A quaternary ammonium ion that has formula C11H19N2O. |
| navitoclax | |
| nitrofen | An organic molecular entity that has formula C12H7Cl2NO3. |
| 2-amino-3-(2-amino-2-carboxyethylsulfanyl-mercuricsulfanyl)-propionic acid | |
| OPC 3911 | |
| Sulfinpyrazone | A pyrazolidine that has formula C23H20N2O3S. |
| 5-((4-(2-(1-indolyl)ethoxy)-phenyl)methyl)thiazolidine-2,4-dione | |
| Nicorandil | |
| 3-(3,4-difluorophenyl)-4-(4-(methylsulfonyl)phenyl)-2(5H)-furanone | |
| gyrophoric acid | |
| Ampicillin | A penicillin in which the substituent at position 6 of the penam ring is a 2-amino-2-phenylacetamido group. |
| aflatoxin-albumin adduct | |
| Hexanes | |
| dicarbine | |
| 5-aminoisoquinolinone | |
| Menthol | |
| JHW 015 | |
| Pindolol | A member of the class of indols which is the 2-hydroxy-3-(isopropylamino)propyl ether derivative of 1H-indol-4-ol. |
| isomenthol | |
| Fluconazole | A member of the class of triazoles that is propan-2-ol substituted at position 1 and 3 by 1H-1,2,4-triazol-1-yl groups and at position 2 by a 2,4-difluorophenyl group. It has been shown to exhibit antifungal activity. |
| ferric chloride | |
| 1,4-dihydroxy-2-naphthoic acid | A naphthoic acid that is 2-naphthoic acid substituted by hydroxy groups at positions 1 and 4. |
| antimonite | A trivalent inorganic anion obtained by removal of all three protons from antimonous acid. |
| 4-aminobenzamidine | |
| 4-methylumbelliferyl acetate | An acetate ester consiting of umbelliferone carrying a 7-O-acetyl group. |
| suplatast tosilate | An anilide that has formula C16H26NO4S.C7H7O3S. |
| Ganciclovir | An oxopurine that is guanine substituted by a [(1,3-dihydroxypropan-2-yl)oxy]methyl group at position 9. Ganciclovir is an antiviral drug used to treat or prevent AIDS-related cytomegalovirus infections. |
| Potassium Cyanide | A cyanide salt that has formula CKN. |
| FLB 457 | |
| ND 322 | |
| cadmium telluride | |
| chlornaltrexamine | |
| antimony oxide | |
| Monobactams | Monocyclic, bacterially produced or semisynthetic beta-lactam antibiotic. It lacks the double ring construction of the traditional beta-lactam antibiotics and can be easily synthesized. |
| SB 210661 | |
| 3-(5-(2,3-dichlorophenyl)-1H-tetrazol-1-yl)methylpyridine | |
| lactofen | |
| 4-Acetamido-4'-isothiocyanatostilbene-2,2'-disulfonic Acid | |
| Phenetidine | |
| Cadmium Chloride | |
| Zinc Oxide | A zinc molecular entity that has formula OZn. |
| succinyl-coenzyme A | |
| Fusaric Acid | An aromatic carboxylic acid that has formula C10H13NO2. |
| astin B | |
| LL Z1640-2 | |
| bicinchoninic acid | |
| Asbestos, Amosite | |
| allylpyrocatechol | |
| 3,3',4,5'-tetrahydroxystilbene | |
| Captan | A dicarboximide that is 3a,4,7,7a-tetrahydrophthalimide in which the hydrogen attached to the nitrogen is replaced by a trichloromethyl group. A non-systemic fungicide introduced in the 1950s, it is widely used for the control of fungal diseases in fruits, vegetables, and ornamental crops. |
| bromfenac | Amfenac in which the the hydrogen at the 4 position of the benzoyl group is substituted by bromine. It is used for the management of ocular pain and treatment of postoperative inflammation in patients who have undergone cataract extraction. It was withdrawn from the US market in 1998, following concerns over off-label abuse and hepatic failure. |
| N-benzyladriamycin-14-valerate | |
| Pyrantel Pamoate | An organic molecular entity that has formula C23H16O6.C11H14N2S. |
| bilobalide | A terpenoid trilactone found in extracts of Ginkgo biloba. |
| delta(12)-prostaglandin J(2) | |
| 2-hydroxyquinoline | |
| 2-(1-(4-piperonyl)piperazinyl)benzothiazole | |
| ormeloxifene | |
| PD 161570 | |
| kahweol palmitate | |
| 5-hydroxythalidomide | |
| baicalein | A trihydroxyflavone with the hydroxy groups at positions C-5, -6 and -7. |
| L 703606 | |
| Lignans | |
| aroclor 1260 | |
| Promegestone | |
| Santonin | |
| SIB 1757 | |
| RS 43179 | |
| 5-hydroxymethylcytosine | A nucleobase analogue that is cytosine in which the hydrogen at position 5 is replaced by a hydroxymethyl group. |
| 2-(3-trifluoromethylphenyl)histamine | |
| 3',4'-dimethoxyflavone | |
| 7-benzyloxyquinoline | |
| oxybenzone | A hydroxybenzophenone that is benzophenone which is substituted at the 2- and 4-positions of one of the benzene rings by hydroxy and methoxy groups respectively. |
| 1-(4-carbamoylpyridinium)-4-(4-hydroxyiminomethylpyridinium)but-2-ene | |
| betulin | A pentacyclic triterpenoid that is lupane having a double bond at position 20(29) as well as 3beta-hydroxy and 28-hydroxymethyl substituents. |
| WHI P154 | |
| 2-tert-butyl-4-methylphenol | |
| atrasentan | |
| 1,2-dihydro-1,2-dihydroxy-5-methylchrysene | |
| Digitoxin | |
| N-(deoxyguanosin-8-yl)-1-aminopyrene | |
| lupeol | A pentacyclic triterpenoid that is lupane in which the hydrogen at the 3beta position is substituted by a hydroxy group. It occurs in the skin of lupin seeds, as well as in the latex of fig trees and of rubber plants. It is also found in many edible fruits and vegetables. |
| fexofenadine | A piperidine-based anti-histamine compound. |
| EHT 1864 | |
| 2,6-di-tert-butyl-4-hydroxymethylphenol | |
| aldophosphamide | A nitrogen mustard that has formula C7H15Cl2N2O3P. |
| Emulsions | |
| Chlorthalidone | An isoindole that has formula C14H11ClN2O4S. |
| 4-nitrobenzaldehyde | A C-nitro compound that is benzaldehyde substituted at the para-position with a nitro group. |
| fusaproliferin | |
| Niflumic Acid | |
| demeton-S-methyl | An organothiophosphate insecticide that has formula C6H15O3PS2. |
| pyrrolidine dithiocarbamic acid | |
| captax | |
| TRK 820 | |
| S-Nitrosothiols | |
| Dihydralazine | |
| 2-hydroxy-1-(2-((9-(4-methylcyclohexyl)-9H-pyrido(4',3'-4,5)pyrrolo(2,3-d)pyrimidin-2-yl)amino)-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)ethanone | |
| 1,2,4-trihydroxy-9,10-anthracenedione | |
| fasciculin | |
| Guanine Nucleotides | |
| Hydroxymethylglutaryl-CoA Reductase Inhibitors | A compound that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Pentamidine | A diether compound consisting of pentane-1,5-diol with both hydroxyls bearing 4-amidinophenyl groups. |
| O-demethyltramadol | |
| tin protoporphyrin IX | |
| demethylchlordimeform | |
| tezosentan | |
| dimerumic acid | |
| BMS 961 | |
| actein | A triterpenoid that has formula C37H56O11. |
| 2,4-Dinitrophenol | A dinitrophenol having the nitro groups at the 2- and 4-positions. |
| terephthalic acid | A benzenedicarboxylic acid carrying carboxy groups at positions 1 and 4. One of three possible isomers of benzenedicarboxylic acid, the others being phthalic and isophthalic acids. |
| Isotretinoin | A retinoic acid that is all-trans-retinoic acid in which the double bond which is alpha,beta- to the carboxy group is isomerised to Z configuration. A synthetic retinoid, it is used for the treatment of severe cases of acne and other skin diseases. |
| Glutethimide | |
| trichloroacetaldehyde | An organochlorine compound that consists of acetaldehyde where all the methyl hydrogens are replaced by chloro groups. |
| adiphenine | |
| GYPGKF-NH(2) | |
| cinitapride | |
| 16-ketoestrone | A 3-hydroxy steroid that has formula C18H20O3. |
| PI 540 | |
| Chitin | An aminoglycan consisting of beta-(1->4)-linked N-acetyl-D-glucosamine residues. |
| 1-hydroxy-2-oxo-3,3-bis(2-aminoethyl)-1-triazene | |
| 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-((5-(4-fluorophenyl)-3-pyridinyl)methyl)piperazine | |
| dibromodiphenyl ether | |
| phorbol 12-phenylacetate 13-acetate 20-homovanillate | |
| methoxy-morpholinyl-doxorubicin | |
| 1-(4-(benzothiazol-2-yloxy)benzyl)piperidine-4-carboxylic acid | |
| Staphylococcal Protein A | |
| Amiodarone | A member of the class of 1-benzofurans that is 1-benzofuran substituted by a butyl group at position 2 and a 4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl group at position 3. It is a cardiovascular drug used for the treatment of cardiac dysrhythmias. |
| 2-amino-6-(2-(cyclopropylmethoxy)-6-hydroxyphenyl)-4-piperidin-4-yl nicotinonitrile | |
| rosuvastatin | |
| 2,4-diaminotoluene | An aminotoluene that is para-toluidine with an additional amino group at position 2. |
| benazepril | A benzazepine that has formula C24H28N2O5. |
| alpha-MSH | |
| eucalyptol | |
| puag-haad | |
| Carnosine | |
| di-n-propylphthalate | |
| diphenyltin | |
| 7-(2-(cyclopropylmethoxy)-6-hydroxyphenyl)-5-(3-piperidinyl)-1,4-dihydro-2H-pyrido(2,3-d)(1,3)oxazin-2-one | |
| Isoxsuprine | |
| 1,2-diacylglycerol | |
| 1-phenyl-3-dimethylamino-1,2,3,4-tetrahydronaphthalene | |
| selenium-cisplatin conjugate | |
| 3-hydroxybenzylhydrazine | |
| decamethonium | A quaternary ammonium ion that is a depolarising muscle relaxant whose structure comprises a decane-1,10-diamine core in which each amino group carries three methyl substituents. |
| Guanethidine | |
| N-tert-butylisoquine | |
| 2,3,4-tri-O-acetylarabinopyranosyl isothiocyanate | |
| benzimidazolone | |
| Chrysenes | |
| 3-mercaptopicolinic acid | |
| Zinc Acetate | An acetate salt in which the cationic component is zinc(2+). |
| kamebakaurin | |
| fenbuconazole | A racemate comprising equimolar amounts of (R)- and (S)-fenbuconazole. A fungicide used to control a range of diseases including powdery mildew, black rot and scab. |
| dihydrexidine | |
| eupafolin | |
| methyl iodide | |
| alpha-hydroxyglutarate | |
| domoic acid | A L-proline derivative that is L-proline substituted by a carboxymethyl group at position 3 and a 6-carboxyhepta-2,4-dien-2-yl group at position 4. It is an analog of kainic acid and is the neurotoxin associated with the amnesic shellfish poisoning (ASP). |
| WeiJia | |
| Glyceraldehyde | An aldotriose comprising propanal having hydroxy groups at the 2- and 3-positions. It plays role in the formation of advanced glycation end-products (AGEs), a deleterious accompaniment to ageing. |
| Isoflavones | Any isoflavonoid with a 3-aryl-1-benzopyran-4-one (3-aryl-4H-chromen-4-one) skeleton and its substituted derivatives. |
| Bemegride | |
| Roxarsone | An organoarsonic acid where the organyl group is 4-hydroxy-3-nitrophenyl. |
| n-pentanol | |
| Aspirin | |
| SCH 23390 | A benzazepine that is 2,3,4,5-tetrahydro-3-benzazepine bearing a phenyl substituent at position 1, a methyl substituent at position 3, a chloro substituent at position 7 and a hydroxy substituent at position 8. |
| dimethylstilbestrol | A stilbenoid that has formula C16H16O2. |
| SR 59119A | |
| Chlorides | |
| 9-amino-6-chloro-2-methoxyacridine | |
| Diglycerides | A glyceride in which any two of the R groups (positions not specified) are acyl groups while the remaining R group can be either H or an alkyl group. |
| Voriconazole | A triazole-based antifungal agent used for the treatment of esophageal candidiasis, invasive pulmonary aspergillosis, and serious fungal infections caused by Scedosporium apiospermum and Fusarium spp. It is an inhibitor of cytochrome P450 2C9 (CYP2C9) and CYP3A4. |
| lewisite | |
| nonachlor | |
| 7-methylbenzanthracene | |
| 1-stearoyl-2-arachidonoylglycerol | A 1,2-diglyceride in which the acyl groups at positions 1 and 2 are specifed as stearoyl and arachidonoyl respectively. |
| jasplakinolide | |
| RS 100329 | |
| petrosaspongiolide m | |
| N-(7-(4-nitrobenzo-2-oxa-1,3-diazole))-6-aminocaproyl sphingosine | Sphingosine with the amino nitrogen converted into a 6-{[N-(7-nitrobenzo-2,1,3-oxadiazol-4-yl)amino]}hexananamido group. |
| salvianolic acid A | A stilbenoid that has formula C26H22O10. |
| salvianolic acid B | |
| tert-Butylhydroperoxide | An alkyl hydroperoxide in which the alkyl group is tert-butyl. It is widely used in a variety of oxidation processes. |
| acetophenone | A methyl ketone that is acetone in which one of the hydrogens of the methyl group has been replaced by a phenyl group. |
| 1L-6-hydroxymethyl-chiro-inositol 2(R)-2-O-methyl-3-O-octadecylcarbonate | |
| Acrylonitrile | A nitrile that is hydrogen cyanide in which the hydrogen has been replaced by an ethenyl group. |
| Hycanthone | A thioxanthen-9-one compound having a hydroxymethyl substituent at the 1-position and a 2-[(diethylamino)ethyl]amino substituent at the 4-position. It was formerly used (particularly as the monomethanesulfonic acid salt) as a schistosomicide for individual or mass treatement of infection with Schistosoma haematobium and S. mansoni, but due to its toxicity and concern about possible carcinogenicity, it has been replaced by other drugs such as praziquantel. |
| levistolide A | |
| 4-methylimidazole | Imidazole substituted at position 4 by a methyl group. |
| pitavastatin | |
| estragole | An olefinic compound that has formula C10H12O. |
| triptycene | |
| Vaccines | |
| tetrachlorophenol | A chlorophenol that is phenol in which four of the hydrogens attached to the benzene ring are replaced by chlorines. |
| 27-hydroxy-4-cholesten-3-one | |
| Cyclosporins | |
| carbazole | |
| 4-hydroxymidazolam | |
| schizandrol B | |
| Aminocaproic Acid | |
| 4,4'-cyclohexylidenebisphenol | |
| 2-iodobenzenamine | |
| diapocynin | |
| prinomastat | |
| betadex | |
| Linagliptin | |
| technetium 99m (HYNIC-3PRGD(2))(tricine)(TPPTS) | |
| S 2238 | |
| carbetapentane | |
| prostaglandin A1 | A prostaglandins A that has formula C20H32O4. |
| apicidin | |
| dong quai | |
| pinitol | A cyclitol ether formed by etherification of the 3-hydroxy group of chiro-inositol. It is plant metabolite isolated from the leaves of Sutherlandia frutescens. |
| cobalt(II) acetate | |
| alpha-methyldopamine | |
| 2,2',4,4'-tetrabromodiphenyl ether | An organobromine compound that has formula C12H6Br4O. |
| Phenformin | |
| titanium nitride | |
| Benzoates | A monocarboxylic acid anion obtained by deprotonation of the carboxy group of any benzoic acid. |
| 6,7-dihydro-1,1,2,3,3-pentamethyl-4-(5H)indanone | |
| ginsenoside Rg2 | A ginsenoside found in Panax species that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions, in which the hydroxy group at position 6 has been converted to the corresponding alpha-L-rhamnopyranosyl-(1->2)-beta-D-glucopyranoside, and in which a double bond has been introduced at the 24-25 position. |
| octachlorostyrene | An organochlorine compound that has formula C8Cl8. |
| Reactive Nitrogen Species | A family of nitrogen molecular entities which are highly reactive and derived from nitric oxide (.NO) and superoxide (O2.(-)) produced via the enzymatic activity of inducible nitric oxide synthase 2 (NOS2) and NADPH oxidase respectively. |
| Catechin | |
| EGFR tyrosine kinase inhibitor 324674 | |
| fenproporex | |
| ethylcholine aziridinium | |
| 4-phenyl-2-propionamidotetraline | |
| trabectedin | A tetrahydroisoquinoline alkaloid obtained from a Caribbean tunicate Ecteinascidia turbinata. Used for the treatment of soft tissue sarcoma and relapsed ovarian cancer. |
| Domperidone | |
| benzene oxide | |
| Calcium, Dietary | |
| beta-glycerophosphoric acid | |
| ioxitalamic acid | |
| Aromatase Inhibitors | An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Aclarubicin | |
| copper bis(3,5-diisopropylsalicylate) | |
| 4-aminobenzhydrazide | |
| Halothane | A haloalkane comprising ethane having three flouro substituents at the 1-position as well as bromo- and chloro substituents at the 2-position. |
| ethoprophos | An organothiophosphate insecticide that has formula C8H19O2PS2. |
| 2-methoxy-4-aminoazobenzene | |
| Pantothenic Acid | A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
| decane | A straight-chain alkane with 10 carbon atoms. |
| tryptamine | An aminoalkylindole consisting of indole having a 2-aminoethyl group at the 3-position. |
| mecobalamin | |
| Saccharin | A 1,2-benzisothiazole having a keto-group at the 3-position and two oxo substituents at the 1-position. It is used as an artificial sweetening agent. |
| Zimeldine | |
| resolvin D1 | A very long-chain fatty acid that has formula C22H32O5. |
| resolvin D2 | A very long-chain fatty acid that has formula C22H32O5. |
| bafilomycin A | |
| Fenthion | An organic thiophosphate that is O,O-dimethyl hydrogen phosphorothioate in which the hydrogen atom of the hydroxy group is replaced by a 3-methyl-4-(methylsulfanyl)phenyl group. It exhibits acaricidal and insecticidal activities. |
| Propantheline | |
| 1,3,7,8-tetrachlorodibenzo-4-dioxin | |
| Gold Sodium Thiomalate | |
| Benzopyrans | |
| coralyne | |
| 3,4-di-O-caffeoylquinic acid | |
| 12-ketoendrin | |
| Sulfides | |
| 3-(2-ethylphenoxy)-1-(1,2,3,4-tetrahydronaphth-1-ylamino)-2-propanol oxalate | |
| Anti-Retroviral Agents | |
| 1,3-dichlorobenzene | A dichlorobenzene carrying chloro substituents at positions 1 and 3. |
| madecassoside | A triterpenoid saponin that is a trisaccharide derivative of madecassic acid. Isolated from Centella asiatica, it exhibits anti-inflammatory, antioxidant and antirheumatic activities. |
| Biopterin | A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins. |
| cinnamyl-3,4-dihydroxycyanocinnamate | |
| FdUMP(10) | |
| Desoxycorticosterone Acetate | |
| 4-methylcyclohexyl-1,6-dicarboxylic acid anhydride | |
| tryptamine-4,5-dione | |
| wogonin | A dihydroxy- and monomethoxy-flavone in which the hydroxy groups are positioned at C-5 and C-7 and the methoxy group is at C-8. |
| Dynorphins | |
| Mitomycin | |
| Propylene Glycol | |
| timosaponin AIII | A triterpenoid that has formula C39H64O13. |
| 1-hydroxy-3-amino-2-pyrrolidone | |
| NS 004 | |
| Mestranol | |
| isoimperatorin | A member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 5. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. |
| 1-(4-chlorobenzoyl)-5-methoxy-2-1H-indole-3-acetic acid 3-(nitrooxymethyl)phenyl ester | |
| 667 coumate | |
| quercetin 3-arabinopyranoside | |
| 5H-benzo(4,5)cyclohepta(1,2-b)pyridin-5-one | |
| 9,10-Dimethyl-1,2-benzanthracene | |
| Pyridazines | |
| clorophene | |
| farnesal | A farnesane sesquiterpenoid that has formula C15H24O. |
| tetrabutylammonium | A quaternary ammonium ion that has formula C16H36N. |
| 4-hydroxyphenylacetone | |
| tris(4-methyl-1-pyrazolyl)borohydride | |
| methylbenzethonium | |
| isopropyl thioxanthone | |
| NSC 303530 | |
| cylindrospermopsin | |
| p-Chloromercuribenzoic Acid | A mercuribenzoic acid that has formula C7H5ClHgO2. |
| arctiin | A lignan that has formula C27H34O11. |
| stannous chloride | |
| myricitrin | A glycosyloxyflavone that consists of myricetin attached to a alpha-L-rhamnopyranosyl residue at position 3 via a glycosidic linkage. Isolated from Myrica cerifera, it exhibits anti-allergic activity. |
| 2-((2,6-dichlorophenyl)amino)benzeneacetic acid 4-(3H-1,2-dithiol-3-thione-5-yl)phenyl ester | |
| LHRH, Leu(6)-des-Et-GlyNH2(10)- | |
| cyclohexanecarboxylic acid (3-(2,5-dimethylbenzyloxy)-4-(methanesulfonylmethylamino)phenyl)amide | |
| Uridine Diphosphate Glucuronic Acid | |
| technetium Tc 99m mebrofenin | |
| tenidap | A thiophene that has formula C14H9ClN2O3S. |
| Tolazoline | |
| L 689065 | |
| surfactin peptide | |
| neurotensin NT79 | |
| manganese(III) acetate dihydrate | |
| Fibric Acids | |
| SN50 peptide | |
| geraniol | A monoterpenoid consisting of two prenyl units linked head-to-tail and functionalised with a hydroxy group at its tail end. |
| Angiotensin II | |
| Creatinine | |
| N-(2-aminoethyl)-4-(5-(4-tolyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide | |
| 1-aminobenzotriazole | |
| dronedarone | |
| zomepirac glucuronide | |
| vitamin K1 oxide | |
| adapalene | An adamantane that has formula C28H28O3. |
| butenafine | |
| methylcholine | |
| 16 alpha,17-epoxyprogesterone | |
| 5-methoxypsoralen | |
| 11-keto-boswellic acid | |
| ethyl pyruvate | |
| 12-hydroxy-5,8,10-heptadecatrienoic acid | |
| Ryanodine | An insecticide alkaloid isolated from South American plant Ryania speciosa. |
| dragon's blood | |
| fraxinellone | |
| buthionine sulfoximine ethyl ester | |
| 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine | A tetrahydropyridine that is 1,2,3,6-tetrahydropyridine substituted by a methyl group at position 1 and a phenyl group at position 4. |
| cloflucarban | |
| Norfloxacin | A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
| Proanthocyanidins | A flavonoid oligomer obtained by the the condensation of two or more units of hydroxyflavans. |
| 3-(2-(4-(3-chloro-2-methylphenyl)1-piperazinyl)ethyl)5,6-dimethoxy-1-(4-imidazolylmethyl)-1H-indazol dihydrochloride 3.5 hydrate | |
| anethole | |
| 1,24,25-trihydroxyvitamin D3 | |
| NPC 15437 | |
| 4-methylthioamphetamine | |
| Chlorisondamine | |
| NF157 compound | |
| 4-amidino-2-nitrophenyl 4'-anisate | |
| Benzoxazines | |
| Daunorubicin | A natural product found in Actinomadura roseola. |
| 4-oxoretinol | |
| isocaproaldehyde | |
| crystal violet lactone | |
| 5-chlorouracil | An organochlorine compound consisting of uracil having an chloro substituent at the 5-position. |
| Glycodeoxycholic Acid | A bile acid glycine conjugate of deoxycholic acid. |
| carfentanil | |
| idoxifene | |
| Fenfluramine | |
| geranylgeranylacetone | |
| Glycochenodeoxycholic Acid | A bile acid glycine conjugate having 3alpha,7alpha-dihydroxy-5beta-cholan-24-oyl as the bile acid component. |
| N-nitrosodiethanolamine | A nitroso compound that has formula C4H10N2O3. |
| Morpholines | Any compound containing morpholine as part of its structure. |
| Ouabain | |
| Paraquat | An organic cation that consists of 4,4'-bipyridine bearing two N-methyl substituents loctated at the 1- and 1'-positions. |
| Sodium Chloride | An inorganic chloride salt having sodium(1+) as the counterion. |
| cholestane-3,5,6-triol | |
| enterotoxin F, Staphylococcal | |
| N-(3-(4-chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl)-2-methyl-2-((5-(trifluoromethyl)pyridin-2-yl)oxy)propanamide | |
| Praziquantel | A pyrazinoisoquinoline that has formula C19H24N2O2. |
| Tolperisone | |
| selenaproline | |
| ammonium metavanadate | |
| Clotrimazole | A member of the class of imidazoles that is 1H-imidazole in which the hydrogen attached to a nitrogen is replaced by a monochlorotrityl group. |
| 1-chloro-4-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-3-(methylsulfonyl)benzene | |
| hexyl cinnamic aldehyde | |
| lauroyl-coenzyme A | |
| diethyl phthalate | |
| Dithioerythritol | The meso-diastereomer of 1,4-dimercaptobutane-2,3-diol; a sulfur-containing sugar derived from the monosaccharide erythrose; and an epimer of dithiothreitol. |
| liensinine | |
| dehydroeburicoic acid | A bile acid that has formula C31H48O3. |
| moxestrol | A 3-hydroxy steroid that has formula C21H26O3. |
| rofecoxib | |
| acetyl tert-butyl dimethylindan | |
| 5-dihydrodeoxycorticosterone | |
| 4,17 beta-dihydroxy-4-androstene-3-one | |
| 1-methylbenz(a)anthracene | |
| Oviol | |
| DAA 1097 | |
| Ethylenebis(dithiocarbamates) | |
| Prostaglandin D2 | A member of the class of prostaglandins D that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9 and 15 and an oxo group at position 11 (the 5Z,9alpha,13E,15S- stereoisomer). |
| fructus schizandrae, radix ginseng, radix ophiopogonis drug combination | |
| N-acetylpropargylglycine | |
| N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide | |
| Acrylamides | An enamide which is acrylamide or a derivative of acrylamide obtained by replacement of one or more of its hydrogens. |
| nitroflurbiprofen | A carboxylic ester obtained by formal condensation of the carboxy group of flurbiprofen with the free hydroxy group of 4-(nitrooxy)butanol. It is a non-steroidal anti-inflammatory agent showing inhibitory effects against the cyclooxygenases COX1 and COX2. |
| Toximul MP8 | |
| idraparinux | |
| 5-methoxyindoleacetic acid | |
| 4-tosylcyclonovobiocic acid | |
| Ribomunyl | |
| deoxynivalenol-3-glucuronide | |
| plumbagin | A naphthoquinone that is 1,4-naphthoquinone in which the hydrogens at positions 2 and 5 are substituted by methyl and hydroxy groups, respectively. |
| mono-n-octyl phthalate | |
| 2'-(4-fluorophenyl)-21-fluoro-20-oxo-11beta,17alpha-dihydroxy-pregn-4-eno(3,2-c)pyrazole | |
| 7-hydroxystaurosporine | |
| 1-hydroxy-2-naphthoic acid | A 2-naphthoic acid carrying a hydroxy substituent at the 1-position. It is a xenobiotic metabolite produced by the biodegradation of phenanthrene by microorganisms. |
| BAY 60-6583 | |
| BGP 15 | |
| oxodiperoxo(pyridine-2-carboxylate)vanadate(V) | |
| Ruthenium Red | A ruthenium coordination entity that has formula H42N14O2Ru3.6Cl. |
| propachlor | An anilide that consists of 2-chloroacetanilide bearing an N-isopropyl substituent. |
| Clindamycin | A carbohydrate-containing antibiotic that is the semisynthetic derivative of lincomycin, a natural antibiotic. |
| Vitamin K 3 | |
| Vitamin K 1 | |
| hydroxycamptothecinum | |
| N-(3,5-bis(trifluoromethyl)phenyl)-5-chloro-2-hydroxybenzamide | |
| PAR-1-activating peptide | |
| fluazifop-butyl | An aromatic ether that has formula C19H20F3NO4. |
| Pinacidil | |
| W 7 | |
| Sumatriptan | A sulfonamide that consists of N,N-dimethyltryptamine bearing an additional (N-methylsulfamoyl)methyl substituent at position 5. Selective agonist for a vascular 5-HT1 receptor subtype (probably a member of the 5-HT1D family). |
| 4-(4'-chlorobenzyloxy)benzyl nicotinate | |
| Fluocinonide | |
| nalmefene | |
| Indapamide | |
| swinholide A | |
| Alizarin Red S | |
| Tyramine | |
| LE-Cl2MDP | |
| 4-nitrophenyloctanoate | |
| bufuralol | A benzofuran that has formula C16H23NO2. |
| HhAntag691 | |
| LE 540 | |
| picropodophyllin | |
| deoxyelephantopin | A sesquiterpenoid that has formula C19H20O6. |
| 2'-cyano-2'-deoxyarabinofuranosylcytosine | |
| menatetrenone | |
| dichlozolinate | |
| triethylenediamine | |
| A 771726 | |
| deoxynivalenol-15-glucuronide | |
| stearic acid | A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
| diphenylacetic acid | A monocarboxylic acid that is acetic acid where the methyl hydrogens have been replaced by two phenyl groups respectively. |
| arsenic disulfide | |
| Merbromin | |
| Betamethasone | A glucocorticoid that has formula C22H29FO5. |
| etiracetam | |
| Carnitine | |
| Chalcone | A member of the class of chalcones that is acetophenone in which one of the methyl hydrogens has been replaced by a benzylidene group. |
| ST 679 | |
| 4-vinylcyclohexene | A cyclic olefin that has formula C8H12. |
| eumelanin | |
| linoleoyl-coenzyme A | |
| SC 41930 | |
| brilliant green | |
| Enkephalins | |
| Soil Pollutants | |
| 1-UFT protocol | |
| Dihematoporphyrin Ether | |
| salmeterol | |
| J 113397 | |
| robinin | A flavonoid that has formula C33H40O19. |
| 3-(3-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)acrylamide | |
| tulobuterol | |
| retinylamine | |
| Methyldimethylaminoazobenzene | |
| 2,3-bis(3'-hydroxybenzyl)butane-1,4-diol | |
| ICI 192605 | |
| naringenin-7-O-glucoside | |
| acetochlor | A monocarboxylic acid amide that is N-phenylacetamide carrying an ethyl and a methyl group at positions 2 and 6 respectively on the benzene ring while one of the methyl hydrogens as well as the hydrogen attached to the nitrogen atom have been replaced by a chloro and an ethoxymethyl group respectively. |
| nilvadipine | |
| Triazines | Compounds based on a triazine skeleton. |
| N-substituted Glycines | |
| phenylalanyl-prolyl-arginine methyl chloride | |
| N(6),N(6)-dimethyladenine | Adenine substituted at N-6 by geminal methyl groups. |
| Thiadiazoles | |
| 6-ethylchenodeoxycholic acid | A cholanoid that has formula C26H44O4. |
| 25-methoxyldammarane-3,12,20-triol | |
| Cysteinyldopa | A catecholamine that has formula C12H16N2O6S. |
| fluridone | A phenylpyridine that has formula C19H14F3NO. |
| phenanthrene | A polycyclic aromatic hydrocarbon composed of three fused benzene rings which takes its name from the two terms 'phenyl' and 'anthracene.' |
| anacardic acid | A hydroxybenzoic acid that has formula C22H36O3. |
| guanylin | |
| dihydroxy-vitamin D3 | |
| Semustine | An organochlorine compound that is urea in which the two hydrogens on one of the amino groups are replaced by nitroso and 2-chloroethyl groups and one hydrogen from the other amino group is replaced by a 4-methylcyclohexyl group. |
| Tetrachlorvinphos | An alkenyl phosphate that has formula C10H9Cl4O4P. |
| Methimazole | A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
| 2',3'-dideoxycytidine 5'-triphosphate | |
| ethyl 6-(N-(2-chloro-4-fluorophenyl)sulfamoyl)cyclohex-1-ene-1-carboxylate | |
| mercuric oxide | |
| Dehydroepiandrosterone Sulfate | A steroid sulfate that is the 3-sulfate of dehydroepiandrosterone. |
| ONO-LB 457 | |
| aripiprazole | A quinolone that has formula C23H27Cl2N3O2. |
| Melatonin | A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen atom is replaced by a 2-(5-methoxy-1H-indol-3-yl)ethyl group. It is a hormone secreted by the pineal gland in humans. |
| malaoxon | A dicarboxylic acid that has formula C10H19O7PS. |
| Cromolyn Sodium | |
| Phycocyanin | |
| 8-prenylnaringenin | |
| Chromium Alloys | |
| 1-(5-fluoropentyl)-3-(1-naphthoyl)indole | |
| decan-4-olide | |
| 4,4'-(carbonylbis(imino-3,1-phenylenecarbonylimino-3,1-(4-methylphenylene)carbonylimino))bis(1,3-xylene-alpha,alpha'-diphosphonic acid) | |
| Oxazolone | |
| atorvastatin | A dihydroxy monocarboxylic acid that is a member of the drug class known as statins, used primarily for lowering blood cholesterol and for preventing cardiovascular diseases. |
| Metyrapone | |
| pyridoxal phosphate gamma-aminobutyric acid | |
| benserazide, levodopa drug combination | |
| desmethylmisonidazole | |
| zearalenol | |
| (3-(4-(bis(2-chloroethyl)amino)phenyl)-3-propyl)carbamic acid 2-(6-(17-hydroxy-13-methyl-3-oxo-2,3,6,7,8,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta(a)phenanthren-11-yl)hexylamino)ethyl ester | |
| 8-(4-sulfophenyl)theophylline | |
| satraplatin | |
| bensulide | A benzene that has formula C14H24NO4PS3. |
| Pregnanolone | |
| arsenic trisulfide | |
| Ketoprofen | An oxo monocarboxylic acid that consists of propionic acid substituted by a 3-benzoylphenyl group at position 2. |
| Ethylmaleimide | |
| protocatechuic acid | |
| cyanopindolol | |
| Octoxynol | |
| Succinates | |
| Polyamines | |
| Histone Deacetylase Inhibitors | An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| propyleneimine | An aziridine that has formula C3H7N. |
| methylarsine oxide | |
| pyridoxal phosphate-6-azophenyl-2',4'-disulfonic acid | An azo compound that has formula C14H14N3O12PS2. |
| Idoxuridine | |
| prostaglandin G2 | A prostaglandins G that has formula C20H32O6. |
| Azathioprine | A thiopurine that is 6-mercaptopurine in which the mercapto hydrogen is replaced by a 1-methyl-4-nitroimidazol-5-yl group. It is a prodrug for mercaptopurine and is used as an immunosuppressant, prescribed for the treatment of inflammatory conditions and after organ transplantation and also for treatment of Crohn's didease and MS. |
| Metaproterenol | A phenylethanolamine that has formula C11H17NO3. |
| bergamottin | A furanocoumarin that has formula C21H22O4. |
| indenestrol | |
| 2,5-di-(2-phenethyl)pyrrolidine | |
| N(6)-methyl-2'-deoxyadenosine 3',5'-diphosphate | |
| single bond | |
| FR 167653 | |
| malonic acid | An alpha,omega-dicarboxylic acid in which the two carboxy groups are separated by a single methylene group. |
| 4-(isopropylamino)-2-(2-pyridyl)-2-phenylbutyramide | |
| Glucosides | |
| Coumaphos | An organothiophosphate insecticide that has formula C14H16ClO5PS. |
| methylphosphonic difluoride | |
| indomethacin phenethylamide | |
| chlorobenzilate | A diarylmethane that has formula C16H14Cl2O3. |
| CPS 49 | |
| chloroquine diphosphate | |
| Propofol | A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
| N-methyl-1-(1,3-benzodioxol-5-yl)-2-butanamine | |
| avobenzone | |
| Terfenadine | |
| ginsenoside 20S-protopanaxatriol | |
| obacunone | A limonoid that has formula C26H30O7. |
| trans-1,2-dihydro-1,2-naphthalenediol | |
| 4,5,7a,8,9,10,11,11a-octohydro-7H-10-methylindolol(1,7bc)(2,6)-napthyridine | |
| 4-(2-aminoethyl)benzenesulfonylfluoride | |
| acenaphthene-1-ol | |
| Ofloxacin | An oxazinoquinolone carrying carboxy, fluoro, methyl and 4-methylpiperazino substituents. A synthetic fluoroquinolone antibacterial agent, it inhibits the supercoiling activity of bacterial DNA gyrase, halting DNA replication. |
| 2',3-dimethyl-4-aminobiphenyl | |
| pelargonic acid | |
| 2,2',3,4,4',5',6-heptabromodiphenyl ether | An organobromine compound that has formula C12H3Br7O. |
| Chondroitin Sulfate Proteoglycans | |
| tetrabromobisphenol A-bisallylether | |
| spiruchostatin A | |
| spiruchostatin B | |
| ezetimibe | A beta-lactam that is azetidin-2-one which is substituted at 1, 3, and 4 by p-fluorophenyl, 3-(p-fluorophenyl)-3-hydroxypropyl, and 4-hydroxyphenyl groups, respectively (the 3R,3'S,4S enantiomer). |
| benzo(a)pyrene diolepoxide I | An epoxide that has formula C20H14O3. |
| peroxyvanadate | |
| tri-(2-chloroisopropyl)phosphate | |
| TH 302 | |
| 3-methoxycatechol | |
| Air Pollutants, Occupational | |
| Benzoyl Peroxide | |
| Thioguanine | |
| Cefmetazole | |
| androstane-3,17-diol dipropionate | A steroid ester that has formula C25H40O4. |
| NS 1652 | |
| 2,4,5-trichlorophenol | A trichlorophenol carrying chloro groups at positions 2, 4 and 5. |
| Phosphatidylinositol 4,5-Diphosphate | |
| 7-chlorokynurenic acid | A quinolinemonocarboxylic acid that is quinaldic acid which is substituted by a hydroxy group at position 4 and by a chlorine at position 7. It is a potent NMDA glutamate receptor antagonist which antagonizes the strychnine-insensitive glycine site of the NMDA receptor. It also prevents neurodegeneration produced by quinolinic acid. |
| 5,6-dimethoxy-3-methyl-N-phenyl-N-(3-(piperidin-1-yl)propyl)benzofuran-2-carboxamide | |
| 3-methylchrysene | A carbopolycyclic compound that has formula C19H14. |
| TG 003 | |
| caffeoylquinic acid | |
| n-hexadecane | |
| Lovastatin | A fatty acid ester that is mevastatin carrying an additional methyl group on the carbobicyclic skeleton. It is used in as a antilipemic drug and has been found in fungal species such as Aspergillus terreus and Pleurotus ostreatus (oyster mushroom). |
| oleoyl-coenzyme A | |
| alpha helical corticotropin-releasing hormone | |
| LDN 193189 | |
| tesmilifene | |
| chromium oxide | |
| Dithionitrobenzoic Acid | |
| Cholesterol, HDL | |
| remifentanil | A piperidinecarboxylate ester that is methyl piperidine-4-carboxylate in which the hydrogen attached to the nitrogen is substituted by a 3-methoxy-3-oxopropyl group and the hydrogen at position 4 is substituted the nitrogen of N-propanoylaniline. |
| gatifloxacin | |
| 2-((((2-chloroethyl)nitrosoamino)carbonyl)amino)propanamide | |
| 3-phenoxybenzoic acid | A phenoxybenzoic acid in which the phenoxy group is meta to the carboxy group. It is a metabolite of pyrethroid insecticides. |
| ferrous chloride | |
| 3-phenylpropanol-1 | |
| 4-Aminobenzoic Acid | An aminobenzoic acid in which the amino substituent is at position 4 of the benzoic acid. |
| ferulinolol | |
| N-((5-((2-amino-4-oxo-4,7-dihydro-3H-pyrrolo(2,3-d)pyrimidin-6-yl)propyl)thiophen-2-yl)carbonyl)glutamic acid | |
| triclocarban | A member of the class of ureas that is urea substituted by a 4-chlorophenyl and a 3,4-dichlorophenyl group at positions 1 and 3 respectively. |
| SK&F 77434 | |
| RU 58668 | |
| carboprostacyclin | |
| (4-(m-Chlorophenylcarbamoyloxy)-2-butynyl)trimethylammonium Chloride | |
| Aldrin | An organochlorine compound resulting from the Diels-Alder reaction of hexachlorocyclopentadiene with norbornadiene. It was widely used as an insecticide before being banned in the 1970s as a persistent organic pollutant. |
| cysteinyl-leukotriene | |
| 1,4-dihydroxyanthraquinone | |
| coumaran | |
| Thrombin | |
| purmorphamine | Purine substituted at C-2 by a 1-naphthyloxy group, at C-4 by a 4-morpholinophenylamino group, and at N-9 by a cyclohexyl group. |
| CRA1000 | |
| ottelione A | |
| Yohimbine | An indole alkaloid with alpha2-adrenoceptor antagonist activity. It is produced by Corynanthe johimbe and Rauwolfia serpentina. |
| 4,5-Dihydro-1-(3-(trifluoromethyl)phenyl)-1H-pyrazol-3-amine | |
| Itraconazole | A dioxolane that has formula C35H38Cl2N8O4. |
| Hexoses | |
| 1,2,3,4,7,8-hexachlorodibenzofuran | A chlorin that has formula C12H2Cl6O. |
| Quartz | |
| tebuconazole | A racemate composed of equimolar amounts of (R)- and (S)-tebuconazole. A fungicide effective against various smut and bunt diseases in cereals and other field crops. |
| Amides | An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. |
| sorbinil | An azaspiro compound having a monofluoro-substituted chromane skeleton spiro-linked to an imidazolidinedione ring. |
| tesaglitazar | |
| MitoTEMPO | |
| risedronic acid | A pyridine that has formula C7H11NO7P2. |
| 3-xylene | |
| 7-hydroxyellipticine | |
| 4-tert-butylcyclohexanol | |
| BIM 23206 | |
| KNK 437 | |
| HS 1183 | |
| propionylthiocholine | |
| N-(4-(3-chloro-4-fluorophenylamino)quinazolin-6-yl)acrylamide | |
| vasotocin, (beta-mercapto-beta,beta-cyclopentamethylenepropionic acid)-O-methyl-Tyr(2)-Thr(4)-Orn(8)-Tyr(9)-NH2 | |
| Maharishi Amrit Kalash | |
| Acitretin | |
| FK 409 | |
| physostigmine heptyl | |
| Aminosalicylic Acids | |
| Sodium Fluoride | A metal fluoride salt with a Na(+) counterion. |
| SR 140333 | |
| LDN 57444 | |
| Pentetic Acid | A pentacarboxylic acid that has formula C14H23N3O10. |
| mecoprop | A racemate comprising equimolar amounts of (R)- and (S)-mecoprop. |
| propazine | A diamino-1,3,5-triazine that is N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine substituted by a chloro group at position 6. |
| icaritin | |
| Butadienes | |
| ankaflavin | |
| methyl 6,7-dimethoxy-4-ethyl-beta-carboline-3-carboxylate | |
| Triprolidine | |
| hyperforin | A sesquarterpenoid that has formula C35H52O4. |
| ferrous oxide | |
| 4-fluorochalcone oxide | |
| chrysene,2-diol-3,4-epoxide-1 | |
| 2-methylquinoline | |
| 4-amino-2-hydroxytoluene | |
| staurosporine aglycone | |
| oxibendazole | |
| digoxin-like factors | |
| 8,9-dichloro-2,3,4,4a-tetrahydro-1H-pyrazino(1,2-a)quinoxalin-5(6H)-one | |
| OSW 1 | |
| Betahistine | |
| quercetin 3-O-beta-(2''-galloyl)-rhamnopyranoside | |
| bolinaquinone | |
| ethyl salicylate | |
| tylophorine | An organic heteropentacyclic compound that has formula C24H27NO4. |
| 2-(4-acetoxyphenyl)-2-chloro-N-methylethylamine | |
| oleoylethanolamide | An N-(long-chain-acyl)ethanolamine that is the ethanolamide of oleic acid. The monounsaturated analogue of the endocannabinoid anandamide |
| chromium nicotinic acid complex | |
| 1,2,3,7,8-pentachlorodibenzo-p-dioxin | A dibenzodioxine that has formula C12H3Cl5O2. |
| 2-Acetylaminofluorene | |
| 2-(2-cresyl)-4H-1-3-2-benzodioxaphosphorin-2-oxide | |
| thamira parpam | |
| Indolinone A | |
| Lactulose | A synthetic galactosylfructose disaccharide used in the treatment of constipation and hepatic encephalopathy. |
| phthalimide | A dicarboximide that is 2,3-dihydro-1H-isoindole substituted by oxo groups at positions 1 and 3. |
| 7-amino-4-chloromethylcoumarin | |
| MCS-18 | |
| 8-azidoadenosine 5'-triphosphate | |
| isotocin | |
| carvacrol | A phenol that is a natural monoterpene derivative of cymene. An inhibitor of bacterial growth, it is used as a food additive. Potent activator of the human ion channels transient receptor potential V3 (TRPV3) and A1 (TRPA1). |
| tetraconazole | A racemate comprising equal amounts of (R)- and (S)-tetraconazole. A fungicide used to control a range of fungal infections including powdery mildew, rusts, bunt, loose smut and scab. |
| 7-hydroxy-2-N,N-dipropylaminotetralin | |
| 1,3-dihydroxy-4,4,5,5-tetramethyl-2-(4-carboxyphenyl)tetrahydroimidazole | |
| vorozole | |
| nitecapone | |
| Melitten | |
| Bezafibrate | |
| amarogentin | A secoiridoid glycoside that consists of (4aS,5R,6R)-5-ethenyl-6-hydroxy-4,4a,5,6-tetrahydro-1H,3H-pyrano[3,4-c]pyran-1-one having a 2-O-[(3,3',5-trihydroxybiphenyl-2-yl)carbonyl]-beta-D-glucopyranosyl group attached at position 6 via a glycosidic linkage. |
| 2-chloro-N(6)cyclopentyladenosine | |
| isorhamnetin 3-O-glucoside | |
| erythritol anhydride | |
| sodium thiocyanate | An organic sodium salt which is the monosodium salt of thiocyanic acid. |
| palomid 529 | |
| 2-methyl-c-5-(4-(5-methyl-2-(4-methylphenyl)-4-oxazolyl)butyl)-1,3-dioxane-r-2-carboxylic acid | |
| INCB018424 | |
| nickel acetate | |
| Carcinogens | A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| sevelamer | |
| Vecuronium Bromide | The organic bromide salt of a 5alpha-androstane compound having 3alpha-acetoxy-, 17beta-acetoxy-, 2beta-piperidinino- and 16beta-N-methylpiperidinium substituents. |
| Peptides | Amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another with formal loss of water. The term is usually applied to structures formed from alpha-amino acids, but it includes those derived from any amino carboxylic acid. X = OH, OR, NH2, NHR, etc. |
| Glu-P-2 | An imidazopyridine that has formula C10H8N4. |
| 2,5-dimethyl-1,4-benzoquinonediamine | |
| cetilistat | |
| flavanone | The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
| Spider Venoms | |
| Amino Acids, Peptides, and Proteins | |
| isoangustone A | |
| 5-chloro-2-methyl-4-isothiazolin-3-one | |
| GW 4869 | |
| atomoxetine | A secondary amino compound having methyl and 3-(2-methylphenoxy)-3-phenylpropan-1-yl substituents. |
| Digitonin | A spirostanyl glycoside that has formula C56H92O29. |
| BGC945 | |
| acetylleucyl-leucyl-norleucinal | A tripeptide composed of N-acetylleucyl, leucyl and norleucinyl residues joined in sequence. |
| pasireotide | |
| 2-methoxy-1,4-naphthoquinone | A naphthoquinone that is naphthalene-1,4-dione substituted by a methoxy group at position 2. It has been isolated from the roots of Rubia yunnanensis. |
| Biofuels | |
| dimethoxy-4-indophenyl-2-aminopropane | |
| Isothiocyanates | An organosulfur compound with the general formula R-N=C=S. |
| Homocysteine | A sulfur-containing amino acid consisting of a glycine core with a 2-mercaptoethyl side-chain. |
| PAK 104P | |
| Vinblastine | |
| OSU 03012 | |
| dichloro(4-cymene)ruthenium(II) | |
| hibifolin | |
| Neopterin | A member of the neopterins that has formula C9H11N5O4. |
| caffeic acid | A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
| Oseltamivir | |
| benzo(b)fluorene | A fluorene that has formula C17H12. |
| Rhodium | A cobalt group element atom that has formula Rh. |
| methylbromfenvinphos | |
| Fluorouracil | |
| Mibefradil | |
| 2-aminothiophenol | |
| 20-hydroxy-5,8,11,14-eicosatetraenoic acid | |
| MEN 11270 | |
| decabromobiphenyl ether | |
| Monomethylhydrazine | |
| 2-cyano-3,12-dioxooleana-1,9(11)-dien-28-oic acid methyl amide | |
| 2-pentenal | An enal consisting of pent-2-ene having an oxo group at the 1-position |
| Interleukin 1 Receptor Antagonist Protein | |
| guanosine 5'-O-(2-thiodiphosphate) | |
| GC 1 compound | |
| OSU-HDAC42 compound | |
| diethyl-1,3,6,8-tetrahydro-1,3,6,8-tetraoxobenzo(lmn)(3,8)phenanthroline-2,7-diacetate | |
| aflatoxin B1-2,3-oxide | |
| 1-(4-hydroxyiminomethylpyridinium)-3-(carbamoylpyridinium) propane dibromide | |
| 5-(dimethylamino)-N-(3,4-dimethyl-5-isoxazolyl)-1-naphthalenesulfonamide | |
| Cetirizine | A member of the class of piperazines that is piperazine in which the hydrogens attached to nitrogen are replaced by a (4-chlorophenyl)(phenyl)methyl and a 2-(carboxymethoxy)ethyl group respectively. |
| HX 630 | |
| lead chromate | |
| Adrenocorticotropic Hormone | |
| cytosterone | |
| FSL-1 lipoprotein, synthetic | |
| Norfenfluramine | |
| Oxamic Acid | The monoamide of oxalic acid. |
| ethyl 4-nitrophenyl methylphosphonate | |
| Ethylenethiourea | An imidazolidine that has formula C3H6N2S. |
| 3-methylsulfonyl-4-piperidinobenzoyl guanidine | |
| 8-hydroxy-2-(N-n-propyl-N-(3'-iodo-2'-propenyl)amino)tetralin | |
| thiodicarb | An organic sulfide that has formula C10H18N4O4S3. |
| 1,5-bis(2,3-dimethoxyphenyl)penta-1,4-dien-3-one | |
| 2,3,7,8-tetrabromodibenzo-4-dioxin | |
| eniporide | |
| Carbamazepine | A dibenzoazepine that is 5H-dibenzo[b,f]azepine carrying a carbamoyl substituent at the azepine nitrogen, used as an anticonvulsant. |
| 2,3-dimethoxy-1,4-naphthoquinone | A naphthoquinone that is 1,4-naphthoquinone bearing two methoxy substituents at positions 2 and 3. Redox-cycling agent that induces intracellular superoxide anion formation and, depending on the concentration, induces cell proliferation, apoptosis or necrosis. Used to study the role of ROS in cell toxicity, apoptosis, and necrosis. |
| Diterpenes | A C20 terpene. |
| Anthralin | |
| 2-(4-((dimethylamino)methyl)benzylidene)-5,6-dimethoxy-2,3-dihydroinden-1-one | |
| 2-octyl-4H-1,3,2-benzodioxaphosphorin-2-oxide | |
| picene | An ortho-fused polycyclic arene consisting of five fused benzene rings. It is obtained during the distillation of petroleum. |
| Cholecalciferol | |
| Leuprolide | An oligopeptide comprising pyroglutamyl, histidyl, tryptophyl, seryl, tyrosyl, D-leucyl, leucyl, arginyl, and N-ethylprolinamide residues joined in sequence. It is a synthetic nonapeptide analogue of gonadotropin-releasing hormone, and is used as a subcutaneous hydrogel implant (particularly as the acetate salt) for the treatment of prostate cancer and for the suppression of gonadal sex hormone production in children with central precocious puberty. |
| 6-(N-(7-nitro-2,1,3-benzoxadiazol-4-yl)amino)hexanoyl-glucosylceramide | |
| S 18523 | |
| Paraoxon | An aryl dialkyl phosphate where both the alkyl groups are ethyl and the aryl group is 4-nitrophenyl. |
| mitemcinal | |
| Puromycin Aminonucleoside | |
| 5-butyl-6-hydroxy-10-chlorobenzo(c)quinolizinium chloride | |
| glaucocalyxin A | |
| menthofuran | |
| triethyllead | |
| Enalapril | A dicarboxylic acid monoester that is ethyl 4-phenylbutanoate in which a hydrogen alpha to the carboxy group is substituted by the amino group of L-alanyl-L-proline (S-configuration). |
| pyridafenthion | |
| SC-203048 | |
| azidopine | A benzamide that has formula C27H26F3N5O5. |
| carvedilol | A member of the class of carbazoles that is an adrenergic antagonist with non-selective beta- and alpha-1 receptor blocking properties which helps in the management of congestive heart failure. |
| Tritolyl Phosphates | |
| deacylcortivazol | |
| cyclovirobuxine D | |
| Naled | A dialkyl phosphate that has formula C4H7Br2Cl2O4P. |
| avermectin | Any of the macrolides obtained as fermentation products from the bacterium Streptomyces avermitilis and consisting of a 16-membered macrocyclic backbone that is fused both benzofuran and spiroketal functions and contains a disaccharide substituent. They have significant anthelmintic and insecticidal properties. |
| 3-(2-(pyrrolidinyl)methoxy)pyridine | |
| Dihydroxydihydrobenzopyrenes | |
| Deoxycholic Acid | A dihydroxy-5beta-cholanic acid that has formula C24H40O4. |
| dehydrocostus lactone | An organic heterotricyclic compound and guaianolide sesquiterpene lactone that is acrylic acid which is substituted at position 2 by a 4-hydroxy-3,8-bis(methylene)decahydoazulen-5-yl group and in which the hydroxy group and the carboxy group have undergone formal condensation to afford the corresponding gamma-lactone. |
| EMD 53998 | |
| Aurothioglucose | |
| N-(4-chloro-2-((1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl)phenyl)-2-hydroxybenzamide | |
| tributyrin | A triglyceride obtained by formal acylation of the three hydroxy groups of glycerol by butyric acid. |
| Suppressor Factors, Immunologic | |
| tetrandrine | An isoquinoline that has formula C38H42N2O6. |
| 1-hydroxymethylmidazolam | |
| Phycoerythrin | |
| midecamycin | |
| fumagillin | A meroterpenoid resulting from the formal condensation of the hydroxy group of fumagillol with the carboxylic acid group of (all-E)-deca-2,4,6,8-tetraenedioic acid. Originally isolated from the fungus Aspergillus fumigatus, it is used for the control of Nosema infection in honey bees. |
| Chlorpromazine | A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
| butylbenzyl phthalate | A 2-hydroxyisophthalic acid that has formula C19H20O4. |
| peroben | |
| Thiobarbituric Acid Reactive Substances | |
| (2-(trimethylammonium)ethyl)methanethiosulfonate | |
| prucalopride | |
| farrerol | An organic molecular entity that has formula C17H16O5. |
| Croton Oil | |
| N-(2-hydroxyethyl)retinamide | |
| Oxygen | A chalcogen that has formula O. |
| calmidazolium | An imidazolium ion that is imidazolium cation substituted by a bis(4-chlorophenyl)methyl group at position 1 and a 2-[(2,4-dichlorobenzyl)oxy]-2-(2,4-dichlorophenyl)ethyl group at position 3. It acts as an inhibitor of calmodulin, a calcium binding messenger protein. |
| telenzepine | |
| YSNSG cyclopeptide | |
| Lecithins | |
| UVI 3003 | |
| tetramethylthiourea | |
| 1-phenyl-1,2-propanedione | An alpha-diketone that consists of 1-phenylpropane bearing keto substituents at positions 1 and 2. It is found in coffee. |
| Iron | |
| Ammonium Hydroxide | |
| N-((3-(aminomethyl)phenyl)methyl)ethanimidamide | |
| iloperidone | |
| didecyldimethylammonium | |
| 3-hydroxylup-20(29)-ene-27,28-dioic acid dimethyl ester | |
| JBT-3002 | |
| 10-methoxy-2,2-dimethyl-2,6-dihydropyrano(3,2-c)quinolin-5-one | |
| serpentine (alkaloid) | |
| 10-(fluoroethoxyphosphinyl)-N-(biotinamidopentyl)decanamide | |
| fenoxycarb | A carbamate ester that is the O-ethyl carbamate of 2-(4-phenoxyphenoxy)ethylamine. |
| O(2)-(2,4-dinitrophenyl) 1-(4-(N,N-diethylcarboxamido)piperazin-1-yl)diazen-1-ium 1,2-diolate | |
| Nitroglycerin | A nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain. |
| 4-fluoro-2-(4-(4-(2-hydroxypropan-2-yl)pyrrolidin-3-ylamino)-6,7-dimethoxyquinazolin-2-yl)phenol | |
| Estranes | |
| endothall | |
| Diflunisal | An organofluorine compound comprising salicylic acid having a 2,4-difluorophenyl group at the 5-position. |
| adrenosterone | A 3-hydroxy steroid that has formula C19H24O3. |
| LY 344864 | |
| Polyurethanes | |
| isosteviol | |
| rubitecan | |
| NAD | |
| Leptophos | An organic thiophosphate that has formula C13H10BrCl2O3PS. |
| ceramide 1-phosphate | A ceramide phosphate compound having the phosphate group in the 1-position and an unspecified acyl group atached to the nitrogen atom. |
| chlorobenzene | The simplest member of the class of monochlorobenzenes, that is benzene in which a single hydrogen has been substituted by a chlorine. |
| ziyuglycoside II | |
| tyrphostin 25 | |
| Ketoconazole | A N-carbonylpiperazine that has formula C26H28Cl2N4O4. |
| benzarone | |
| neotame | A dipeptide composed of N-(3,3-dimethylbutyl)-L-aspartic acid and methyl L-phenylalanate units joined by a peptide linkage. |
| 4-chlorobenzyltetrahydroberberine | |
| fusarielin A | |
| N-(3-chloro-7-indolyl)-1,4-benzenedisulphonamide | |
| N-acetyl glycine cysteine amide | |
| Pheniramine | |
| Chloralose | A dioxolane that has formula C8H11Cl3O6. |
| orcinol | A 5-alkylresorcinol in which the alkyl group is specified as methyl. |
| Calcitriol | A hydroxycalciol that is calcidiol in which the pro-S hydrogen of calcidiol is replaced by a hydroxy group. It is the active form of vitamin D3, produced fom calciol via hydoxylation in the liver to form calcidiol, which is subsequently oxidised in the kidney to give calcitriol. |
| antalarmin | |
| Lobeline | |
| perfluorooctanoic acid | A fluoroalkanoic acid that is perfluorinated octanoic acid. |
| A 69024 | |
| ergocryptine | |
| diazoxon | An organic phosphate that is diethyl hydrogen phosphate in which the hydrogen of the hydroxy group has been replaced by a 6-methyl-2-(propan-2-yl)pyrimidin-4-yl group. It is a metabolite of the pesticide diazinon. |
| aluminum sulfate | |
| MC1568 | |
| gallium nitrate | |
| olaquindox | |
| furfuryl alcohol | A member of the class of furans bearing a hydroxymethyl substituent at the 2-position. |
| Sodium Nitrite | |
| dimethyl phthalate | A 2-hydroxyisophthalic acid that has formula C10H10O4. |
| 2,2'-azobis(2-amidinopropane) | |
| rivastigmine | |
| monascin | An organic heterotricyclic compound that is 3a,4,8,9a-tetrahydro-2H-furo[3,2-g][2]benzopyran-2,9(3H)-dione that is substituted at positions 3, 6, and 9a by hexanoyl, (1E)-prop-1-en-1-yl and methyl groups, respectively (the 3S,3aR,9aR diastereoisomer). One of the azaphilonoid pigments in extracts of Monascus pilosus-fermented rice (red-mould rice), it is a potent inhibitor of carcinogenesis measured against chemical- or UV-initiated, phorbol-promoted mouse skin tumours. |
| curdlan | |
| N-methyl-N-(6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-ylmethyl)aminomethylcarboxylic acid | |
| ramiprilat | A dipeptide that is the active metabolite of ramipril. An angiotensin-converting enzyme (ACE) inhibitor, used to treat high blood pressure and congestive heart failure. |
| calcein AM | An organooxygen compound that has formula C46H46N2O23. |
| SC 791 | |
| 3,3',5-triiodothyroacetic acid | |
| Imipenem | |
| 3-methylbenzyl alcohol | A methylbenzyl alcohol that has formula C8H10O. |
| 2,4,4',5-tetrachlorobiphenyl | |
| Trifluridine | |
| naphtho(1,2-a)pyrene | |
| Methacholine Compounds | |
| zardaverine | A pyridazinone derivative in which pyridazin-3(2H)-one is substituted at C-6 with a 4-(difluoromethoxy)-3-methoxyphenyl group. It is a phosphodiesterase inhibitor, selective for PDE3 and 4. |
| KR-31612 | |
| 4-tert-octylphenol | An alkylbenzene that has formula C14H22O. |
| Ro 24-4736 | |
| prostaglandin E3 | A prostaglandins E that has formula C20H30O5. |
| alizapride | |
| 7-hydroxyflavone | A hydroxyflavonoid that has formula C15H10O3. |
| Linseed Oil | |
| atractylenolide I | |
| Electrolytes | |
| methylene diisocyanate | |
| Clorgyline | An aromatic ether that is the 2,4-dichlorophenyl ether of 3-aminopropan-1-ol in which the nitrogen is substituted by a methyl group and a prop-1-yn-3-yl group. A monoamine oxidase inhibitor, it was formerly used as an antidepressant. |
| BMS 181101 | |
| 5-methoxyindole | |
| torcetrapib | A (trifluoromethyl)benzene that has formula C26H25F9N2O4. |
| Ly-364947 | |
| chlorofluoroacetic acid | |
| Palmitoylcarnitine | |
| Omite | |
| zinc deuteroporphyrin IX 2,4-bis(glycol) | |
| PD 81723 | |
| 5-((1,5-bis(4-methoxyphenyl)pyrazol-3-yl)dimethoxymethyl)-2-chlorobenzamide | |
| suillin | |
| Dinoprost | |
| magnolialide | |
| PF 5168899 | |
| methylhistaprodifen | |
| 7,8-benzoquinoline | |
| lipopolysaccharide, E. coli 026-B6 | |
| anhydrotetrodotoxin | |
| Megestrol | A 3-oxo Delta(4)-steroid that is pregna-4,6-diene-3,20-dione substituted by a hydroxy group at position 17. |
| lipoxin A4 | A C20 hydroxy fatty acid having (5S)-, (6R)- and (15S)-hydroxy groups as well as (7E)- (9E)-, (11Z)- and (13E)-double bonds. |
| sinigrin | An alkenylglucosinolic acid that consists of 1-thio-beta-D-glucopyranose having a 4-[(sulfooxy)imino]but-1-en-4-yl group attached to the anomeric sulfur. |
| t-butyloxycarbonyl-methionyl-leucyl-phenylalanine | |
| Perphenazine | A member of the class of phenothiazines that is phenothiazine having a chloro substituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. |
| di-n-hexyl phthalate | A 2-hydroxyisophthalic acid that has formula C20H30O4. |
| pyrimidine | The parent compound of the pyrimidines; a diazine having the two nitrogens at the 1- and 3-positions. |
| apigetrin | |
| N'-(11H-indolo(3,2-c)quinolin-6-yl)-N,N-dimethylethane-1,2-diamine | |
| 2-nitrophenyl selenocyanic acid | |
| Pentanols | |
| Ferric Compounds | |
| N'-(10H-indolo(3,2-b)quinolin-11-yl)-N,N-dimethylpropane-1,3-diamine | |
| copper protoporphyrin IX | |
| vanadium dioxide | A vanadium oxide that has formula O2V. |
| mycophenolic acid glucuronide | |
| P(1),P(5)-di(adenosine-5'-)pentaphosphate | |
| glucobrassicin | An indolylmethylglucosinolic acid that is 1-thio-beta-D-glucopyranose having a 2-(1H-indol-3-yl)-N-(sulfooxy)ethanimidoyl group attached to the anomeric sulfur. |
| (R)-N-cycloheptyl-6-((((tetrahydro-2-furyl)methyl)amino)methyl)thieno(2,3-d)pyrimidin-4-ylamine | |
| Dibucaine | |
| 1,2,3-trichloropropane | An organochlorine compound that has formula C3H5Cl3. |
| Dermatan Sulfate | Any of a group of glycosaminoglycans with repeating units consisting of variously sulfated beta1->4-linked L-iduronyl-(beta1->3)-N-acetyl-D-galactosamine units. |
| citronellol | A monoterpenoid that is oct-6-ene substituted by a hydroxy group at position 1 and methyl groups at positions 3 and 7. |
| 2-methoxybenzoic acid | A methoxybenzoic acid that is the methyl ether of salicylic acid. |
| dasatinib | |
| 2-(4-(3-quinolin-6-ylmethyl-3H-(1,2,3)triazolo(4,5-b)pyrazin-5-yl)pyrazol-1-yl)ethanol | |
| PD 169316 | |
| NNC 112 | |
| alanyl-4-methoxy-2-naphthylamide | |
| Dimaprit | An imidothiocarbamic ester that has formula C6H15N3S. |
| N-(2-(7-(cyclohexylmethyl)-1,6-dihydro-2H-indeno(5,4-b)furan-8-yl)ethyl)acetamide | |
| beta-funaltrexamine | A morphinane alkaloid that has formula C25H30N2O6. |
| 9,10-phenanthrenequinone | |
| Glycyrrhizic Acid | |
| phytoene | An acyclic carotene that has formula C40H64. |
| 4-(4-(3-adamantan-1-ylureido)cyclohexyloxy)benzoic acid | |
| 13-oxo-9,11-octadecadienoic acid | |
| 5-methylfurtrethonium | |
| 3-aminopyridine-2-carboxaldehyde thiosemicarbazone | |
| icariin | A member of the class of flavonols that is kaempferol which is substituted at position 8 by a 3-methylbut-2-en-1-yl group and in which the hydroxy groups at positions 3, 4', and 7 have been converted to the corresponding 6-deoxy-alpha-L-mannopyranoside, methyl ether, and beta-D-glucopyranoside, respectively. A phoshphodiesterase-5 inhibitor, it is obtained from several species of plants in the genus Epimedium and is thought to be the main active ingredient of the Chinese herbal medicine Herba Epimedii (yinyanghuo). |
| cyclopropapyrroloindole | |
| ERB 041 | |
| hypsiziprenol A9 | |
| Aspartame | |
| indioside D | |
| adenosine-3',5'-cyclic phosphorothioate | |
| 3-deazaguanine | |
| Nitrofurans | |
| isovaleric acid | A C5, branched-chain saturated fatty acid. |
| rEV576 protein, tick | |
| Coumarins | |
| diethyl malate | |
| Formaldehyde | The simplest aldehyde. |
| methylnaltrexone | |
| 2-((R)-2-methylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide | |
| HLo 7 | An organic molecular entity that has formula C15H17N5O4.2I. |
| indan | |
| benzaldehyde | |
| ferumoxides | |
| phthalic acid | A benzenedicarboxylic acid cosisting of two carboxy groups at ortho positions. |
| lucidenic acid P | |
| cyclorphan | |
| tributyl phosphate | |
| dechloroethylcyclophosphamide | A phosphorodiamide that has formula C5H12ClN2O2P. |
| Camptothecin | A pyranoindolizinoquinoline that has formula C20H16N2O4. |
| heptelidic acid | |
| lonidamine | A member of the class of indazoles that is 1H-indazole that is substituted at positions 1 and 3 by 2,4-dichlorobenzyl and carboxy groups, respectively. |
| 7-hydroxymethotrexate | |
| Ketotifen | |
| 1-amino-4-hydroxyanthraquinone | |
| Dichloroethylenes | |
| zinc bis(histidinate) | |
| Testicular Hormones | |
| Cefadroxil | A cephalosporin bearing methyl and (2R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
| Nle(1)-AngIV | |
| Doxylamine | A tertiary amine that has formula C17H22N2O. |
| phosphoramide mustard | A phosphorodiamide that has formula C4H11Cl2N2O2P. |
| Mesoridazine | |
| 6-O-angeloylenolin | |
| CL 218872 | |
| apratastat | |
| tamarixetin | A monomethoxyflavone that is quercetin methylated at position O-4'. Isolated from Cyperus teneriffae. |
| gambierol | |
| 16 alpha-iodoestradiol | |
| phosphoryl chloride | |
| ethyl tert-butyl ether | |
| Gonadotropin-Releasing Hormone | |
| BL1521 | |
| N(6)-(delta(2)-isopentenyl)adenine | |
| lipostabil | |
| trequinsin | |
| methionine selenoxide | |
| polyethylene glycol-superoxide dismutase | |
| CB 1093 | |
| Iron, Dietary | |
| purpurin | A trihydroxyanthraquinone derived from anthracene by substitution with oxo groups at C-9 and C-10 and with hydroxy groups at C-1, C-2 and C-4. |
| Copper | |
| GQ1b ganglioside | |
| benzoylecgonine | |
| Water Pollutants | |
| Steroids | Any of naturally occurring compounds and synthetic analogues, based on the cyclopenta[a]phenanthrene carbon skeleton, partially or completely hydrogenated; there are usually methyl groups at C-10 and C-13, and often an alkyl group at C-17. By extension, one or more bond scissions, ring expansions and/or ring contractions of the skeleton may have occurred. Natural steroids are derived biogenetically from triterpenoids. |
| 4-methyl-N1-(3-phenylpropyl)benzene-1,2-diamine | |
| terbacil | An organohalogen compound that has formula C9H13ClN2O2. |
| hydroxyhydroquinone | |
| azamulin | |
| Triamcinolone Acetonide | A synthetic glucocorticoid that is the 16,17-acetonide of triamcinolone. Used to treat various skin infections. |
| blebbistatin | A pyrroloquinoline that is 1,2,3,3a-tetrahydro-H-pyrrolo[2,3-b]quinolin-4-one substituted by a hydroxy group at position 3a, a methyl group at position 6 and a phenyl group at position 1. It acts as an inhibitor of ATPase activity of non-muscle myosin II. |
| tetrathiomolybdate | |
| hexylglutathione | |
| 4-aminobenzonitrile | |
| allyl cyanide | |
| oleoyl-estrone | |
| cinerubine A | |
| cinerubine B | |
| Troleandomycin | |
| Lisuride | |
| 3,4-Methylenedioxyamphetamine | |
| LBT 613 | |
| S,S'-1,4-phenylene-bis(1,2-ethanediyl)bis-isothiourea | |
| N-(1-methyl-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea | |
| 5,6-dichlorobenzimidazole | |
| Ambroxol | |
| GR 113808 | An indolyl carboxylate ester obtained by formal condensation between the carboxy group of 1-methylindole-3-carboxylic acid with the hydroxy group of N-{2-[4-(hydroxymethyl)piperidin-1-yl]ethyl}methanesulfonamide. |
| prothiophos | |
| ergocristine | Ergotaman bearing benzyl, hydroxy, and isopropyl groups at the 5', 12' and 2' positions, respectively, and oxo groups at positions 3', 6', and 18. It is a natural ergot alkaloid. |
| 1,2-dioleoyl-sn-glycero-3-phosphoglycerol | A 1,2-diacyl-sn-glycero-3-phospho-(1'-sn-glycerol) in which both acyl groups are specified as oleoyl. |
| Malathion | A diester that is butanedioate substituted by a (dimethoxyphosphorothioyl)sulfanediyl group at position 2. |
| phenanthridone | A member of the class of phenanthridines that is phenanthridine with an oxo substituent at position 6. A poly(ADP-ribose) polymerase (PARP) inhibitor, it has been shown to exhibit immunosuppressive activity. |
| 2,7-diaminomitosene | |
| 1,25(OH)2-16-ene-23-yne-26,27-hexafluoro-19-nor-D3 | |
| Apazone | |
| Misoprostol | A diastereoisomeric mixture composed of approximately equal amounts of a double racemate of four of the sixteen possible diastereoisomers of methyl (13E)-11,16-dihydroxy-16-methyl-9-oxoprost-13-en-1-oate that is racemic prostaglandin E1 which is lacking the hydroxy group at position 15, but which has an additional hydroxy group at position 16. It is a synthetic prostaglandin E1 analogue, used in the treatment of gastric and duodenal ulcers. A weak abortifacient, it is also used for cervical ripening prior to surgical termination of pregnancy. The (11R,16S)-diastereoisomer is the pharmacologically active form. |
| 5-hydroxyflavone | |
| DCB-SLE1 | |
| 1-deazaadenosine | |
| N-Acetylneuraminic Acid | An N-acylneuraminic acid where the N-acyl group is specified as acetyl. |
| cisplatin-DNA adduct | |
| cupric oxide | |
| (3Z)-3-(1H-pyrrol-2-yl)-methyllidene)-1-(1-(piperidylmethyl)-1,3-dihydro-2H-indol-2-one mesylate | |
| isocarbophos | A salicylate that has formula C11H16NO4PS. |
| benzoyl chloride | A benzoic acid that has formula C7H5ClO. |
| 2-n-butyl-9-methyl-8-(1,2,3)triazol-2-yl-9H-purin-6-ylamine | |
| Bandrowski's base | A quinone imine having amino substituents in the 2- and 5-positions and 4-aminophenyl substituents on both of the imine nitrogens. It is a trimer formed from 1,4-phenylenediamine. |
| acetone phenylhydrazone | |
| protein-bound polysaccharide K, Basidiomycetes | |
| Curcumin | A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
| lipid mobilizing substance | |
| Ethylmercury Compounds | |
| 6 beta-hydroxycortisol | |
| 1-nitronaphthalene | A mononitronaphthalene substituted by a nitro group at position 1. |
| Prostaglandin H2 | A prostaglandins H that has formula C20H32O5. |
| 5-(N-benzyl-N-methylaminomethyl)-1--(2,6-difluorobenzyl)-6-(4-(3-methoxyureido)phenyl)-3-phenylthieno(2,3-d)pyrimidine-2,4(1H,3H)-dione | |
| psi-tectorigenin | |
| nafenopin-coenzyme A | |
| polysaccharide peptide | |
| spirapril | |
| ethoxyacetic acid | |
| 1,1,1-trichloroethane | A member of the class of chloroethanes carrying three chloro substituents at position 1. |
| Chloroform | |
| 1-amino-1,3-dicarboxycyclopentane | |
| 10,10-bis(4-pyridinylmethyl)-9(10H)-anthracenone | |
| 4-nitrobenzylthioinosine | |
| PF-2341066 | |
| phosalone | A member of the class of 1,3-benzoxazoles carrying a [(diethoxyphosphorothioyl)sulfanyl]methyl group at the nitrogen atom, an oxo group at position 2 and a chloro group at position 6. It is an organothiophosphate insecticide. |
| Nigericin | A polyether antibiotic which affects ion transport and ATPase activity in mitochondria. It is produced by Streptomyces hygroscopicus. |
| 1-Methyl-4-phenylpyridinium | A pyridinium ion having a phenyl substituent at the 4-position. |
| Fucose | Any deoxygalactose that is deoxygenated at the 6-position. |
| Guanylyl Imidodiphosphate | |
| pimaric acid | A diterpenoid that has formula C20H30O2. |
| trimethylarsine oxide | An arsine oxide that has formula C3H9AsO. |
| Practolol | |
| N-acetyldopamine | |
| ranolazine | |
| Measles-Mumps-Rubella Vaccine | |
| terameprocol | |
| 3-fluoro-4-(4-((2-(3-fluorophenyl)pyrrolidin-1-yl)methyl)phenoxy)benzamide | |
| pazopanib | |
| resorcinol | A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
| Oxalic Acid | An alpha,omega-dicarboxylic acid that is ethane substituted by carboxyl groups at positions 1 and 2. |
| beta-Aminoethyl Isothiourea | |
| Diethylcarbamazine | |
| 4-anisidine | |
| Piperonyl Butoxide | A benzodioxole that has formula C19H30O5. |
| parecoxib | |
| ganirelix | |
| 9-((2-phosphonylmethoxy)ethyl)guanine | A phosphoethanolamine that has formula C8H12N5O5P. |
| ganglioside, GD1a | |
| 2,3,4,7,8-pentachlorodibenzofuran | A chlorin that has formula C12H3Cl5O. |
| ZD 7155 | |
| dipropyl sulfide | |
| Methiothepin | A dibenzothiepine that is 10,11-dihydrodibenzo[b,f]thiepine bearing additional methylthio and 4-methylpiperazin-1-yl substituents at positions 8 and 10 respectively. Potent 5-HT2 antagonist, also active as 5-HT1 antagonist. Differentiates 5-HT1D sub-types. Also displays affinity for rodent 5-HT5B, 5-HT5A, 5-HT7 and 5-HT6 receptors (pK1 values are 6.6, 7.0, 8.4 and 8.7 respectively). |
| MRK 003 | |
| Lasofoxifene | |
| 5-iodo-3-(2-azetidinylmethoxy)pyridine | |
| alpha-phenyl-1-(2-phenylethyl)-4-piperidinemethanol | |
| Etidronic Acid | A 1,1-bis(phosphonic acid) that is (ethane-1,1-diyl)bis(phosphonic acid) having a hydroxy substituent at the 1-position. It inhibits the formation, growth, and dissolution of hydroxyapatite crystals by chemisorption to calcium phosphate surfaces. |
| phytofluene | An acyclic carotene that has formula C40H62. |
| Riluzole | |
| isopropyl 4,4'-dibromobenzilate | |
| 5-methylurapidil | |
| salvin | |
| 1-(propoxymethyl)maleimide | |
| bis(4-acetamidophenyl) 1-prolylpyrrolidine-2-phosphonate | |
| fluvastatin | |
| 3-methyleneindolenine | An indole that consists of 3H-indole bearing a methylene substituent at position 3. |
| phloxine | |
| 3-hydroxy-2-naphthoic acid | |
| Flunitrazepam | |
| 2,4-di-tert-butylphenol | |
| 2',5'-oligoadenylate | |
| Calcium Ionophores | |
| N-(1-fluoro-3-phenylpropan-2-yl)-N-methylprop-2-yn-1-amine | |
| 2-keto-4-methylthiobutyric acid | |
| Unithiol | |
| pyridoxal phosphate gamma-glutamyl hydrazone | |
| Hexanols | |
| zerumbone | A sesquiterpenoid and cyclic ketone that is (1E,4E,8E)-alpha-humulene which is substituted by an oxo group at the carbon atom attached to two double bonds. It is obtained by steam distillation from a type of edible ginger, Zingiber zerumbet Smith, grown particularly in southeast Asia. |
| Cholates | A bile acid salt having cholate as the anionic component. |
| Org 31710 | |
| NCX 6560 | |
| styrene oxide | An epoxide of styrene. |
| Mannans | |
| 2,2-bis(bromomethyl)-1,3-propanediol | |
| SB 290157 | |
| alpha-(4-pyridyl-1-oxide)-N-tert-butylnitrone | |
| efletirizine | |
| fluorescein 5-maleimide | |
| Flame Retardants | Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| verlukast | |
| 5'-deoxy-5-fluorocytidine | A N-glycosyl compound that has formula C9H12FN3O4. |
| Enkephalin, Ala(2)-MePhe(4)-Gly(5)- | |
| 4,5-dichlorocatechol | |
| 3-chlorophenol | A monochlorophenol carrying the chloro substituent at position 3. |
| Benzalkonium Compounds | |
| Pyridoxal | |
| E 3330 | |
| vofopitant | |
| 3-(2-(4-chlorophenylsulfanyl)phenyl)-N-(4-dimethylaminobutyl)acrylamide | |
| potassium persulfate | |
| naphtholphthalein | |
| CJY compound | |
| 1H-benzotriazole-5-carboxylic acid | |
| N-(2-(methylamino)ethyl)-5-isoquinolinesulfonamide | |
| diphenyldiselenide | |
| benzotrichloride | A benzene that has formula C7H5Cl3. |
| 2,4-heptadienal | |
| MRS 1191 | |
| Phenylenediamines | |
| BHTOH-QM | |
| ethiprole | A pyrazole that has formula C13H9Cl2F3N4OS. |
| 9-deoxy-delta-9-prostaglandin D2 | |
| copolymer 1 | |
| 4-((2'-O-acetylrhamnosyloxy)benzyl)isothiocyanate | |
| sesamin | A lignan that consists of tetrahydro-1H,3H-furo[3,4-c]furan substituted by 1,3-benzodioxole groups at positions 1 and 4 (the 1S,3aR,4S,6aR stereoisomer). Isolated from Cinnamomum camphora, it exhibits cytotoxic activity. |
| VI-14 flavonoid | |
| M 50367 | |
| triisopropyl phosphate | |
| 2,4,2',4'-tetrachlorobiphenyl | |
| captafol | A dicarboximide that captan in which the trichloromethyl group is replaced by a 1,1,2,2-tetrachloroethyl group. A broad-spectrum fungicide used to control diseases in fruit and potatoes, it is no longer approved for use in the European Community. |
| Antioxidants | A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. |
| Calcimycin | An aminobenzoic acid that has formula C29H37N3O6. |
| diallyl sulfone | |
| WP 631 | |
| oleandrin | A steroid saponin that consists of oleandrigenin having a 3-O-methyl-alpha-L-arabino-hexopyranosyl residue attached at position 3. |
| naphtho(2,3-a)pyrene | |
| 1-(3-(4-phenoxyphenoxy)-2-oxopropyl)indole-5-carboxylic acid | |
| Benperidol | |
| 7-ethoxy-4-trifluoromethylcoumarin | |
| AZD 1480 | |
| physostigmine salicylate | An azaheterocycle salicylate salt that has formula C22H27N3O5. |
| S-(N,N-diethylaminoethyl) isobutyl methylphosphothiolate | |
| delphinidin | An anthocyanidin cation consisting of benzopyrylium with hydroxy substituents at the 3-, 5- and 7-positions and a 3,4,5-trihydroxyphenyl group at the 2-position. It is a plant pigment resposible for the colours of the plants of the genera Viola and Delphinium. |
| CD4528 | |
| MY 5445 | |
| 3-chloro-3'-((2-cyclopentyl-3-oxo-2,3-dihydrobenzo(d)isothiazol-6-yloxy)methyl)biphenyl-4-carboxylic acid | |
| isoliquiritigenin 2'-methyl ether | |
| 2-naphthol | A naphthol carrying a hydroxy group at position 2. |
| ropivacaine | The piperidinecarboxamide obtained by the formal condensation of N-propylpipecolic acid and 2,6-dimethylaniline. |
| Ceramides | |
| 8-(3-chlorostyryl)caffeine | Caffeine substituted at its 8-position by an (E)-3-chlorostyryl group. |
| Perylene | An ortho- and peri-fused polycyclic arene comprising of five benzene rings that is anthracene in which the d,e and k,l sides are fused to benzene rings. |
| befunolol | |
| phenidone | |
| purpurogallin | A cyclic ketone that is 5H-benzocycloheptene bearing an oxo group at position 5 and hydroxy groups at positions 2, 3, 4 and 6. |
| Chlormadinone Acetate | A corticosteroid hormone that has formula C23H29ClO4. |
| Benzopyrenes | |
| (5-(2,4-bis((3S)-3-methylmorpholin-4-yl)pyrido(2,3-d)pyrimidin-7-yl)-2-methoxyphenyl)methanol | |
| 4-methoxy-3-phenylenediamine | |
| monoethylglycinexylidide | Amino acid amide formed from 2,6-dimethylaniline and N-ethylglycine components; an active metabolite of lidocaine, formed by oxidative deethylation. Used as an indicator of hepatic function. |
| (S)-2-methylbutyronitrile | |
| 6-chloroacetyl-2-dimethylaminonaphthalene | |
| Isoflurophate | |
| beta Carotene | A cyclic carotene obtained by dimerisation of all-trans-retinol. A strongly-coloured red-orange pigment abundant in plants and fruit and the most active and important provitamin A carotenoid. |
| 2,2',4,6,6'-pentachlorobiphenyl | |
| 4-hydroxyclomiphene | |
| Oxytetracycline | A tetracycline used for treatment of infections caused by a variety of Gram positive and Gram negative microorganisms including Mycoplasma pneumoniae, Pasteurella pestis, Escherichia coli, Haemophilus influenzae (respiratory infections), and Diplococcus pneumoniae. |
| 3-(4-bromophenyl)-2-(ethylsulfonyl)-6-methylquinoxaline-1,4-dioxide | |
| OMDM-1 cpd | |
| sunitinib | A pyrrole that has formula C22H27FN4O2. |
| Cyclohexylamines | |
| pramanicin | |
| diferuloylputrescine | |
| A 68930 | |
| Lorazepam | |
| Liuwei Dihuang Decoction | |
| valdecoxib | |
| amorphigenin | |
| taleranol | |
| indoxyl acetate | |
| beta-hydroxyisovalerylshikonin | |
| Glycocholic Acid | A bile acid glycine conjugate having cholic acid as the bile acid component. |
| N-isobutyl-N-(4-methoxyphenylsulfonyl)glycylhydroxamic acid | |
| azelaic acid | An alpha,omega-dicarboxylic acid that is heptane substituted at positions 1 and 7 by carboxy groups. |
| polylactic acid-polyglycolic acid copolymer | |
| robalzotan | |
| Polyethyleneimine | A polymer composed of repeating ethylamine units. |
| 3-ketocholanoic acid | |
| monobenzone | |
| N-(4-((4,5-dichloro-2-fluorophenyl)amino)quinazolin-6-yl)acrylamide | |
| 1-O-hexadecyl-2-arachidonyl-sn-glycero-3-phosphocholine | |
| 6-hydroxymelatonin | A member of the class of tryptamines that is melatonin with a hydroxy group substituent at position 6. |
| Centchroman | |
| J 104132 | |
| 2,3-Diphosphoglycerate | |
| 1-((4-methylsulfonyl)phenyl)-3-trifluoromethyl-5-(4-fluorophenyl)pyrazole | |
| 1-(2-(1-adamantyl)ethyl)-1-pentyl-3-(3-(4-pyridyl)propyl)urea | |
| Carbon Disulfide | An organosulfur compound that has formula CS2. |
| cyclohexanone | A cyclic ketone that consists of cyclohexane bearing a single oxo substituent. |
| AG 127 | |
| biphenylylacetic acid | |
| Sucralfate | |
| Doxazosin | A member of the class of quinazolines that is quinazoline substituted by an amino group at position 4, methoxy groups at positions 6 and 7 and a piperazin-1-yl group at position 2 which in turn is substituted by a 2,3-dihydro-1,4-benzodioxin-2-ylcarbonyl group at position 4. An antihypertensive agent, it is used in the treatment of high blood pressure. |
| Fish Oils | |
| neurotensin 69L | |
| Guanabenz | |
| proxymetacaine | |
| Abscisic Acid | |
| pendimethalin | A member of the class of substituted anilines that is N-(pentan-3-yl)aniline bearing two additional nitro substituents at positions 2 and 6 as well as two methyl substituents at positions 3 and 4. A herbicide used to control most annual grasses and many annual broad-leaved weeds. |
| fucosterol | A 3beta-sterol consisting of stigmastan-3beta-ol with double bonds at positions 5 and 24(28). |
| 1-cyano-2-hydroxy-3-butene | |
| lycium barbarum polysaccharide | |
| danthron | |
| 3-biphenyl-4-yl-4-(2-fluorophenyl)-5-isopropyl-4H-1,2,4-triazole | |
| 7,7-diphenyl-2-(1-imino-2-(2-methoxyphenyl)ethyl)perhydroisoindol-4-one | |
| p38alpha inhibitor CMPD1 | |
| Methoxsalen | |
| zileuton | |
| 3-ethylphenol | A phenol that has formula C8H10O. |
| capseal I | |
| phosphoramidon | A dipeptide isolated from the cultures of Streptomyces tanashiensis. |
| 2-(allylthio)pyrazine | |
| pantogab | |
| Zoxazolamine | A benzoxazole that has formula C7H5ClN2O. |
| monobutyl phthalate | |
| RV 538 | |
| prodan | |
| ganglioside, GD3 | |
| 3,7-dimethyl-1-propargylxanthine | |
| malabaricone B | |
| malabaricone C | A butanone that has formula C21H26O5. |
| CV 6504 | |
| bromoform | A bromomethane that has formula CHBr3. |
| nylestriol | |
| 2',5'-dihydroxychalcone | |
| HIV Envelope Protein gp120 | |
| conotoxin alpha-RgIA, Conus regius | |
| Weichang'an | |
| tri-o-cresyl phosphate | |
| 1,4-dioxane | A dioxane with oxygen atoms at positions 1 and 4. |
| 4-cyano-N-(2-(1-cyclohexen-1-yl)-4-(1-((dimethylamino)acetyl)-4-piperidinyl)phenyl)-1H-imidazole-2-carboxamide | |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)-1,4,6-heptatrien-3-one | |
| Aminoglycosides | |
| tetrakis(N-methyl-4-pyridiniumyl)porphine manganese(III) complex | |
| selenomethylselenocysteine | |
| 19-epi-okadaic acid | |
| Puromycin | An aminonucleoside antibiotic, derived from the Streptomyces alboniger bacterium, that causes premature chain termination during translation taking place in the ribosome. |
| N-(3-fluoro-4-nitronaphthyl)-5-norbornene-2,3-dicarboxylic imide | |
| haloperidol decanoate | |
| phenyl valerate | |
| Cytokines | |
| 1,4-dibromobenzene | A dibromobenzene that has formula C6H4Br2. |
| methylmercuric chloride | |
| Styrene | A vinylarene that is benzene carrying a vinyl group. It has been isolated from the benzoin resin produced by Styrax species. |
| perfluorododecanoic acid | |
| 6-ethyl-6-(4-((phenylthio)methyl)phenyl)-6,7-dihydrobenzo(b)pyrrolo(1,2-d)(1,4)oxazepin-7-one | |
| Androstane-3,17-diol | A 17-hydroxy steroid that has formula C19H32O2. |
| falcarindiol | An organic molecular entity that has formula C17H24O2. |
| CP 105696 | |
| Selenomethionine | |
| Piroxicam | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. |
| Poly C | A polynucleotide comprised of cytidine units connected via 3'->5' phosphodiester linkages. |
| 5-(3-(3-hydroxyphenoxy)azetidin-1-yl)-5-methyl-2,2-diphenylhexanamide | |
| TGX 221 | |
| tiliroside | |
| plY protein, Streptococcus pneumoniae | |
| diphenyltin chloride | |
| zoniporide | |
| dexbrompheniramine | The (pharmacologically active) (S)-(+)-enantiomer of brompheniramine. A histamine H1 receptor antagonist, it is used (commonly as its maleate salt) for the symptomatic relief of allergic conditions, including rhinitis and conjunctivitis. |
| Sulfonamides | An amide of a sulfonic acid RS(=O)2NR'2. |
| Thiamylal | A member of the class of barbiturates that is 2-thioxodihydropyrimidine-4,6(1H,5H)-dione substituted by a pentan-2-yl and prop-2-en-1-yl group at position 5. |
| sudan III | An azobenzene that has formula C22H16N4O. |
| 1-phenylazo-2-naphthol | |
| etonitazene | |
| ICI 211965 | |
| p-hydroxycinnamaldehyde | |
| N-(4-(3-chloro-4-(2-pyridinylmethoxy)anilino)-3-cyano-7-ethoxy-6-quinolyl)-4-(dimethylamino)-2-butenamide | |
| batimastat | |
| 11-(dansylamino)undecanoic acid | |
| N,N-dimethylethylamine | |
| Allylamine | |
| hispidulin | A monomethoxyflavone that is scutellarein methylated at position 6. |
| bis((2-oxindol-3-ylimino)-2-(2-aminoethyl)pyridine-N,N')copper(II) | |
| Plant Extracts | |
| Phospholipids | |
| Methiocarb | A carbamate ester obtained by the formal condensation of the phenolic group of 3,5-dimethyl-4-(methylsulfanyl)phenol with the carboxy group of methylcarbamic acid. |
| etonogestrel | |
| Carthamus yellow | |
| 1-(2-(3-methoxyphenyl)ethyl)phenoxy-3-(dimethylamino)-2-propanol | |
| fucoidan | |
| perfluorodecalin | A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
| Plant Oils | |
| Diphtheria-Tetanus-acellular Pertussis Vaccines | |
| S-hydroxymethylglutathione | Conjugate base of S-(hydroxymethyl)glutathione. |
| yessotoxin | |
| eugenol, zinc oxide dental cavity lining | |
| enterotoxin A, Staphylococcal | |
| Diacetyl | |
| 4-cumylphenol | |
| tin mesoporphyrin | |
| Ambenonium Chloride | A symmetrical oxalamide-based bis-quaternary ammonium salt having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
| 1,6-bis(cyclohexyloximinocarbonyl)hexane | |
| Antigens, Bacterial | |
| 6,7-dimethoxy-3-phenylquinoxaline | |
| N-(2-pyridone-6-yl)-N',N'-di-n-propylformamidine | |
| 3,5-dihydroxyphenylglycine | |
| Sweetening Agents | |
| Vitamin U | |
| Lactose | |
| 2,3-dimethoxy-6,6-dimethyl-5,6-dihydrobenzo(7,8)indolizino (2,3-b)quinoxaline | |
| losigame | |
| Vitamin A | A group of fat-soluble retinoids produced via metabolism of provitamin A carotenoids. Vitamin A is involved in immune function, vision, reproduction, and cellular communication. |
| benoxaprofen | A monocarboxylic acid that is propionic acid substituted at position 2 by a 2-(4-chlorophenyl)-1,3-benzoxazol-5-yl group. It was used as a non-steroidal anti-inflammatory drug until 1982 when it was withdrawn from the market due to adverse side-effects including liver necrosis, photosensitivity, and carcinogenicity in animals. |
| Guanosine | A purine nucleoside in which guanine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
| Vitamin E | A chromanol that is chroman-6-ol which is substituted at position 2 by a methyl group and (also at position 2) either a saturated or a triply-unsaturated hydrocarbon chain consisting of three isoprenoid units. |
| Vitamin D | Vitamin D is a group of fat-soluble prohormones, which can be obtained from sun exposure, food and supplements. Vitamin D is biologically inactive and converted to the biologically active calcitriol via double hydroxylation in the body. |
| Vitamin K | A fat-soluble vitamin required for the synthesis of prothrombin and certain other blood coagulation factors. |
| kaempferol | A flavonol that has formula C15H10O6. |
| Water Pollutants, Chemical | |
| 2-(8-quinolinoxy)propionic acid | |
| formestane | |
| N,N-dipropylcarboxamidotryptamine | |
| Propiolactone | |
| Am 580 | |
| trimethylamine | A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
| Biological Products | |
| ethyl(E,E,E)-7-(2-n-propoxy-5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-naphthalen-3-yl)-6-fluorp-3-methylocta-2,4,6-trienoate | |
| 4-hydroxy-2',4',6'-trichlorobiphenyl | |
| benzoylcarbonyl-aspartyl-glutamyl-valyl-aspartyl-fluoromethyl ketone | |
| N-(2-hydroxypropyl)methacrylamide co-polymer-doxorubicin conjugate | |
| Streptonigrin | Complex cytotoxic antibiotic obtained from Streptomyces flocculus or S. rufochronmogenus. It is used in advanced carcinoma and causes leukopenia. |
| Fatty Acids, Omega-6 | |
| FPEPIR regimen | |
| 1,2,4-trichlorobenzene | A trichlorobenzene with chloro substituents at positions 1, 2 and 4. |
| paxilline | An organooxygen compound that has formula C27H33NO4. |
| ergosterol-5,8-peroxide | |
| 4-amino-1,8-naphthalimide | A benzoisoquinoline that has formula C12H8N2O2. |
| imiquimod | An imidazoquinoline that has formula C14H16N4. |
| N-desmethyltamoxifen | A stilbenoid that has formula C25H27NO. |
| indole-3-carbinol | |
| benzohydrol | |
| tiotropium | |
| thiocholchicine | |
| SCIO-469 | |
| Polyenes | An olefin that contains more than one carbon-carbon double bond. |
| 4557 W | |
| bohemine | |
| Phytic Acid | |
| Acetone | |
| astressin B | |
| flavokawain A | |
| Safrole | A member of the class of benzodioxoles that is 1,3-benzodioxole which is substituted by an allyl group at position 5. It is found in several plants, including black pepper, cinnamon and nutmeg, and is present in several essential oils, notably that of sassafras. It has insecticidal properties and has been used as a topical antiseptic. Although not thought to pose a significant carcinogenic risk to humans, findings of weak carcinogenicity in rats have resulted in the banning of its (previously widespread) use in perfumes and soaps, and as a food additive. |
| Ethidium | The fluorescent compound widely used in experimental cell biology and biochemistry to reveal double-stranded DNA and RNA. |
| Furans | Compounds containing at least one furan ring. |
| Pyrazoles | |
| hydroxyapatite-beta tricalcium phosphate | |
| AZD 6244 | |
| chlorfluazuron | A benzoylurea insecticide that has formula C20H9Cl3F5N3O3. |
| lamotrigine | A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
| bis(2-hydroxybenzylidene)acetone | |
| Methylnitronitrosoguanidine | |
| 4-amylcinnamoylanthranilic acid | |
| Fluoxymesterone | An anabolic androgenic steroid that has formula C20H29FO3. |
| 4-dimethylaminocinnamaldehyde | |
| Cacodylic Acid | |
| alpha-cyano-(3,4-dihydroxy)-N-benzylcinnamide | |
| beta-thujone | |
| epiallopregnanolone sulfate | |
| 1,2-dimethylnaphthalene | A dimethylnaphthalene carrying methyl groups at positions 1 and 2. |
| KT 5823 | |
| ethyl vanillin | |
| titanium citrate | |
| broxaterol | |
| 2-hydroxypropyl-beta-cyclodextrin | |
| soyasaponin I | A triterpenoid saponin that is composed of soyasapogenol B having an alpha-L-rhamnopyranosyl-(1->2)-beta-D-galactopyranosyl-(1->2)-beta-D-glucopyranosiduronic acid moiety attached at the 3-position via a glycosidic linkage. |
| butyrylcholine | |
| N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide | An aromatic amide resulting from the formal condensation of the carboxy group of 1-methylcyclohexanecarboxylic acid with the amino group of 4-amino-2,3-dichlorophenol. |
| mestanolone | |
| 4-benzoylpyridine | |
| mevalonolactone | |
| bicyclol | |
| eleostearic acid | |
| 16-hydroxycleroda-3,13(14)-dien-15,16-olide | |
| bitertanol | A diastereoisomeric mixture composed of the enantiomeric pair (1R,2S)- and (1S,2R)-bitertanol in a 4:1 ratio with the enantiomeric pair (1R,2R)- and (1S,2S)-bitertanol. A fungicide used to control a range of diseases including scab, powder mildew, rusts and blackspot. It is moderately toxic to most animal and insect species but is non-toxic to honeybees. |
| 1,3-dipropyl-8-(4-sulfophenyl)xanthine | |
| S-nitro-N-acetylpenicillamine | |
| R116010 | |
| indirubin | |
| S-pentachlorobuta-1,3-dien-yl-cysteine | |
| thallium acetate | |
| Cardiotonic Agents | |
| Naphthalenes | Any benzenoid aromatic compound having a skeleton composed of two ortho-fused benzene rings. |
| iprodione | An imidazolidine-2,4-dione in which the nitrogen at position 1 is substituted by an N-(isopropyl)carboxamide group while that at position 3 is substituted by a 3,5-dichlorophenyl group. A contact fungicide, it blocks the growth of the fungal mycelium and inhibits the germination of fungal spores. It is used on fruit and vegetable crops affected by various fungal diseases. It is also used as a nematicide. |
| antibiotic G 418 | |
| chloropropylate | An organochlorine acaricide that has formula C17H16Cl2O3. |
| octylphenol | |
| certoparin | |
| 3,4-epoxy-1-butene | |
| mepazine | |
| phenethylcymserine | |
| acetaldehyde oxime | An aldoxime derived from acetaldehyde. |
| 2-((2-piperidin-1-ylethyl)thio)quinazolin-4(3H)-one | |
| isophorone diisocyanate | A diisocyanate in which the two isocyanate groups are linked by an isophorone substituent. |
| Biphenyl Compounds | |
| tri-(2-ethylhexyl)trimellitate | |
| triflusal | |
| resiquimod | An imidazoquinoline that has formula C17H22N4O2. |
| dimethyl-N-acetylmuramyl-alanylglutamate | |
| EEDQ | |
| alexidine | An amphipathic bisbiguanide with a structure consisting of two (2-ethylhexyl)guanide units linked by a hexamethylene bridge. |
| CP-471,358 | |
| Thiazolidines | |
| carbohydrazide | A hydrazide consisting of hydrazine carrying one or more carboacyl groups. |
| Budesonide | A glucocorticoid steroid having a highly oxygenated pregna-1,4-diene structure. It is used mainly in the treatment of asthma and non-infectious rhinitis and for treatment and prevention of nasal polyposis. |
| 1,2-dioleoyloxy-3-(trimethylammonium)propane | |
| 5-phenyl-5-(4-hydroxyphenyl)hydantoin glucuronide | |
| CP 55244 | |
| Clarithromycin | The 6-O-methyl ether of erythromycin A, clarithromycin is a macrolide antibiotic used in the treatment of respiratory-tract, skin and soft-tissue infections. It is also used to eradicate Helicobacter pylori in the treatment of peptic ulcer disease. It prevents bacteria from growing by interfering with their protein synthesis. |
| indapamide, perindopril drug combination | |
| bradykinin, Lys-Leu(8)-desArg(9)- | |
| H 2545 | |
| Bupivacaine | A racemate composed of equimolar amounts of dextrobupivacaine and levobupivacaine. Used (in the form of its hydrochloride hydrate) as a local anaesthetic. |
| Sodium Selenite | |
| Pyridinium Compounds | |
| HMR 3339 | |
| Fatty Acids, Volatile | |
| Tolmetin | |
| cholest-5-ene-3,4-diol | |
| dazomet | A dithiocarbamic ester that is 1,3,5-thiadiazinane with a thione moiety at position 2 and in which the hydrogens attached to the nitrogens are replaced by methyl groups. A fungicide, herbicide and nematicide, it is used prior to sowing or planting for the control of soil fungi, nematodes, bacteria and germinating weeds, and as fumigant for poultry litter and eggs to control Salmonella. It is a non-ozone-depleting alternative to methyl bromide. |
| Reactive Oxygen Species | Molecules or ions formed by the incomplete one-electron reduction of oxygen. They contribute to the microbicidal activity of phagocytes, regulation of signal transduction and gene expression, and the oxidative damage to biopolymers. |
| saikosaponin | |
| chlormethoxynil | |
| 1-hydroxyvitamin D5 | |
| PF 00477736 | |
| pyrene | An ortho- and peri-fused polycyclic arene consisting of four fused benzene rings, resulting in a flat aromatic system. |
| tert-butylbicyclo-2-benzoate | |
| 2-bromopalmitate | |
| Diatrizoate | |
| 2,7-dinitrofluorene | |
| lavendustin A | |
| azaspiracid | |
| Gonadal Steroid Hormones | |
| Anisomycin | An antibiotic isolated from various Streptomyces species. It interferes with protein and DNA synthesis by inhibiting peptidyl transferase or the 80S ribosome system. |
| NVP-BKM120 | |
| ZK 164015 | |
| phenacyl bromide | An alpha-bromoketone that has formula C8H7BrO. |
| SB 239063 | |
| 4-nitro-3-phenylphenol | |
| norkurarinol | |
| N-(2-methyl-3-(4-(4-(4-(trifluoromethoxy)benzyloxy)piperidin-1-yl)-1,3,5-triazin-2-ylamino)phenyl)acetamide | |
| chebulinic acid | A tannin that has formula C41H32O27. |
| Epitestosterone | An androstanoid that is the C-17 epimer of testosterone. |
| tertiary-amyl methyl ether | |
| GSK 8470 | |
| ciglitazone | An aromatic ether that consists of 1,3-thiazolidine-2,4-dione with position 5 substituted by a 4-[(1-methylcyclohexyl)methoxy]benzyl group. A selective PPARgamma agonist. |
| 2-amino-1,7-dimethylimidazo(4,5-g)quinoxaline | |
| cycloprothrin | A carboxylic ester having 2,2-dichloro-1-phenylcyclopropanecarboxylic acid as the acid component and hydroxy(3-phenoxyphenyl)acetonitrile as the alcohol component. |
| 1-butyrylglycerol | |
| Cytidine | A pyrimidine nucleoside in which cytosine is attached to ribofuranose via a beta-N(1)-glycosidic bond. |
| diphenylditelluride | |
| estradiol 17 beta-cypionate | |
| 8-oxo-7-hydrodeoxyguanosine | |
| Calcium Carbonate | A carbonate salt that has formula CO3.Ca. |
| 2-methylene-19-nor-(20S)-1 alpha-hydroxy-bishomopregnacalciferol | |
| bisperoxovanadium | |
| Iodides | |
| p-aminophenylarsine oxide | |
| mono(2-ethyl-5-hydroxyhexyl) phthalate | |
| JNJ 10397049 | |
| sanglifehrin A | |
| Isatin | The 2,3-diketo derivative of indole. |
| 9-anthroic acid | An anthroic acid carrying the carboxy substituent at position 9. |
| norlevorphanol | |
| tetra(4-N-methylpyridyl)porphine | |
| toloxatone | |
| Amitrole | A member of the class of triazoles that is 1H-1,2,4-triazole substituted by an amino group at position 3. |
| Glutarates | |
| CX157 | |
| acetovanillone | |
| KC 400 | |
| pamidronate | |
| diniconazole | A racemate comprising equimolar amounts of (R)- and (S)-diniconazole. A fungicide used to control a range of diseases including mildew, bunts and smuts. |
| Tolnaftate | |
| indirubin-3'-monoxime | |
| Methyl Parathion | |
| PF 232798 | |
| 3,5,3',4',5'-pentamethoxystilbene | |
| ultra-high molecular weight polyethylene | |
| monoisoamyl-2,3-dimercaptosuccinate | |
| metoprolol succinate | |
| actinidine | A member of the class of cyclopentapyridines that is 6,7-dihydrocyclopenta[c]pyridine bearing two methyl substituents at positions 4 and 7. |
| androsterone glucuronide | |
| 20-hydroxyeicosa-6(Z),15(Z)-dienoic acid | |
| butachlor | An anilide that has formula C17H26ClNO2. |
| X 910279 | |
| 5-methoxyindole-2-carboxylic acid | |
| Magnesium Sulfate | A magnesium salt having sulfate as the counterion. |
| profenamine | |
| Obidoxime Chloride | |
| (2E)-decenal | |
| n-decyl alcohol | |
| gusperimus | |
| N-benzyl-N-ethyl-2-(7,8-dihydro-7-methyl-8-oxo-2-phenyl-9H-purin-9-yl)acetamide | |
| SB 269970 | |
| psicose | A ketohexose that is the C-3 epimer of fructose. |
| propionaldehyde | An aldehyde that consists of ethane bearing a formyl substituent. The parent of the class of propanals. |
| 2,3,6,7-tetrachlorobiphenylene | |
| capsazepine | A benzazepine that is 2,3,4,5-tetrahydro-1H-2-benzazepine which is substituted by hydroxy groups at positions 7 and 8 and on the nitrogen atom by a 2-(p-chlorophenyl)ethylaminothiocarbonyl group. A synthetic analogue of capsaicin, it was the first reported capsaicin receptor antagonist. |
| S-ethyl glutathione | |
| 15-ketoprostaglandin E2 | |
| felbamate | |
| protopanaxatriol | A tetracyclic triterpenoid sapogenin (isolated from ginseng and notoginseng) that is that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions and in which a double bond has been introduced at the 24-25 position. |
| tricaine | A benzoate ester that has formula C9H11NO2. |
| coproporphyrinogen III | A coproporphyrinogen that has formula C36H44N4O8. |
| 4-hydroxyestrone | |
| norfluoxetine | |
| clinofibrate | |
| alyssin | |
| 9,10-dihydroxy-12-octadecenoic acid | |
| methotrexate-alpha glutamate | |
| Toluene | The simplest member of the class toluenes consisting of a benzene core which bears a single methyl substituent. |
| 2,4-difluoro-N-(2-(methyloxy)-5-(4-(4-pyridazinyl)-6-quinolinyl)-3-pyridinyl)benzenesulfonamide | |
| Endocrine Disruptors | |
| arsenotriglutathione | |
| tranilast | |
| Ketone Bodies | A carbonyl compound produced as a water-soluble byproduct when fatty acids are broken down for energy in the liver. There are three endogenous ketone bodies: acetone, acetoacetic acid, and (R)-3-hydroxybutyric acid; others may be produced as a result of the metabolism of synthetic triglycerides. |
| mipafox | A phosphoramide that has formula C6H16FN2OP. |
| Hydroxyurea | A member of the class of ureas that is urea in which one of the hydrogens is replaced by a hydroxy group. An antineoplastic used in the treatment of chronic myeloid leukaemia as well as for sickle-cell disease. |
| NAADP | |
| dofetilide | |
| 7H-dibenzo(c,g)carbazole | A carbazole that has formula C20H13N. |
| SK&F 104078 | |
| tris(chloroethyl)phosphate | |
| 1,2-Dihydroxybenzene-3,5-Disulfonic Acid Disodium Salt | |
| anemonin | A butenolide that has formula C10H8O4. |
| Stavudine | A nucleoside analogue obtained by formal dehydration across positions 2 and 3 of thymidine. An inhibitor of HIV-1 reverse transcriptase |
| Pentaerythritol Tetranitrate | A pentaerythritol nitrate in which all four hydroxy groups of pentaerythritol have been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to those of glyceryl trinitrate, but with a more prolonged duration of action, and is used for treatment of angina pectoris. It is also one of the most powerful high explosives known and is a component of the plastic explosive known as Semtex. |
| prostaglandin I3 | |
| Butyrates | |
| nabumetone | |
| Rhamnose | A deoxymannose sugar that is the 6-deoxy derivative of hexose. |
| apaziquone | |
| RB 101 | |
| Ytterbium | A lanthanoid atom that has formula Yb. |
| Geraniin | A tannin that has formula C41H28O27. |
| A 61603 | |
| 5,7-Dihydroxytryptamine | |
| tautomycin | A carboxylic ester that has formula C41H66O13. |
| mono-n-hexyl phthalate | |
| Aflatoxin M1 | A member of the class of aflatoxins that is aflatoxin B1 in which the hydrogen at position 9a is replaced by a hydroxy group. |
| 15-keto-5,8,11,13-eicosatetraenoic acid | |
| mono-N-demethyladinazolam | |
| cirazoline | |
| Bupropion | A propanone that is propan-1-one substituted by a tert-butylamino group at position 2 and a 3-chlorophenyl group at position 1. |
| aspartyl-glutamyl-valyl-aspartal | |
| lucidenic acid N | A tetracyclic triterpenoid that is 25,26,27-trinorlanost-8-en-24-oic acid substituted by hydroxy groups at positions 3 and 7 and oxo groups at positions 11 and 15 respectively (the 3beta,5alpha,7beta stereoisomer). Isolated from the fruiting bodies of Ganoderma lucidum, it exhibits cytotoxicity against tumour cells. |
| Ethoxyquin | A quinoline that is 1,2-dihydroquinoline bearing three methyl substituents at position 2, 2 and 4 as well as an ethoxy substituent at position 6. |
| benzo(c)chrysene | |
| lucidenic acid Q | |
| Acenocoumarol | |
| 7-dehydrocholesterol | |
| 2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | |
| 2-methoxyidazoxan | A benzodioxine that is idazoxan substituted at position 2 by a methoxy group. |
| deslorelin | |
| Mercury | |
| indolo(3,2-b)carbazole | |
| Sotalol | A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is sustituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
| Nalorphine | A morphinane alkaloid that has formula C19H21NO3. |
| Dimethyl Sulfoxide | A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
| traxoprodil mesylate | |
| Oxidopamine | A benzenetriol that is phenethylamine in which the hydrogens at positions 2, 4, and 5 on the phenyl ring are replaced by hydroxy groups. It occurs naturally in human urine, but is also produced as a metabolite of the drug DOPA (used for the treatment of Parkinson's disease). |
| Glyoxal | |
| rostafuroxin | |
| Pesticides | |
| Dmt-NMe-Ala-Aba-Gly-NH2 | |
| aceanthrylene | An ortho- and peri-fused polycyclic arene that has formula C16H10. |
| propargyl alcohol | |
| 3-O-tert-butoxycarbonylspectaline | |
| Antigens | Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| Antipsychotic Agents | Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| 2'-hydroxychalcone | A member of the class of chalcones that is trans-chalcone substituted by a hydroxy group at position 2'. |
| ceftazidime monobactam | |
| Hypolipidemic Agents | A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| (4-amidinophenyl)methanesulfonyl fluoride | |
| chromium hexavalent ion | |
| Etazolate | |
| Sodium Dodecyl Sulfate | An alkyl sulfate that has formula C12H25NaO4S. |
| 3-methyl-N-phenyl-N-(3-(piperidin-1-yl)propyl)benzofuran-2-carboxamide | |
| Pyridoxal Phosphate | |
| 1-((3-benzyl-3-methyl-2,3-dihydro-1-benzofuran-6-yl)carbonyl)piperidine | |
| 1-pentyl-3-(1-naphthoyl)indole | |
| Aflatoxins | Any of a group of related and highly toxic secondary metabolites (mycotoxins) whose main structural feature is a fused coumarin-bis(dihydrofuran) ring system and which are produced by strains of the moulds Aspergillus flavus or A. parasiticus, together with further metabolites of these mycotoxins |
| Luteolin | A 3'-hydroxyflavonoid which is thought to play an important role in the human body as an antioxidant, a free radical scavenger, an agent in the prevention of inflammation, a promoter of carbohydrate metabolism, and an immune system modulator. |
| fexaramine | A biphenyl that has formula C32H36N2O3. |
| dextrallorphan | |
| 4-chloro-N-((4-(1,1-dimethylethyl)phenyl)methyl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide | |
| 4-(4-(bis(4-fluorophenyl)methyl)piperazin-1-ylbut-2-enyloxy)acetic acid | |
| methyl demeton | |
| Tobramycin | A amino cyclitol glycoside that is kanamycin B lacking the 3-hydroxy substituent from the 2,6-diaminoglucose ring. |
| 9-methoxycamptothecin | |
| trimethobenzamide | The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
| heparin-sepharose | |
| Sodium | |
| eburnamonine | An alkaloid that has formula C19H22N2O. |
| Phosphorous Acids | |
| AAL 881 | |
| Clomiphene | A tertiary amine that has formula C26H28ClNO. |
| piclamilast | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 3-(cyclopentyloxy)-4-methoxybenzoic acid with the primary amino group of 3,5-dichloropyridin-4-amine. |
| thymoquinone | |
| 1,7-diphenyl-5-heptene-3-one | |
| xyloglucan | A glucan that consists of a backbone of alpha-(1->4)-linked glucose residues, most of which are substituted with (1->6)-linked xylose side-chains. |
| bisindolylmaleimide I | An indole that has formula C25H24N4O2. |
| ZD 2574 | |
| trimethyloxamine | |
| Corticosterone | A 21-hydroxy steroid that is consists of pregn-4-ene substituted by hydroxy groups at positions 11 and 21 and oxo groups at positions 3 and 20. Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands. |
| kaempferol-7-methyl ether | |
| (Cr(salprn)(H2O)2)ClO4 | |
| cyclohexyl methylphosphonofluoridate | |
| heme arginate | |
| Sodium, Dietary | |
| Excitatory Amino Acid Antagonists | Any substance which inhibits the action of receptors for excitatory amino acids. |
| Epoprostenol | |
| CFM 1 | |
| 1-(5-isoquinolinylsulfonyl)-3-methylpiperazine | |
| BAG956 | |
| solifenacin | |
| polydatin | |
| Anions | |
| desethylamodiaquine | |
| 1-benzylimidazole | |
| zymosterol | A 3beta-sterol that has formula C27H44O. |
| Halogenated Diphenyl Ethers | |
| Pentoxifylline | |
| 5-amino-7-(2-phenylethyl)-2-(2-furyl)pyrazolo(4,3-e)-1,2,4-triazolo(1,5-c)pyrimidine | |
| L-826266 | |
| coenzyme Q10 | A ubiquinone having a side chain of 10 isoprenoid units. In the naturally-occurring isomer, all isoprenyl double bonds are in the E- configuration. |
| N-acetylsphingosine | A N-acylsphingosine that has formula C20H39NO3. |
| telithromycin | |
| 2-(2-(2-dimethylaminothiazol-5-yl)ethenyl)-6-(2-(fluoro)ethoxy)benzoxazole | |
| TAPI-2 | |
| digallic acid | A gallate ester that has formula C14H10O9. |
| Neomycin | A broad-spectrum highly toxic antibiotic or mixture of antibiotics produced by a streptomyces (Streptomyces fradiae) and used medically especially to treat local infections. |
| Acetylcarnitine | |
| 4-hydroxyequilenin-o-quinone | |
| 4-nitroaniline | A nitroaniline carrying a nitro group at position 4. |
| 4-benzyloxy-3,5-dimethoxy-N-(1-(dimethylaminocyclopently)methyl)benzamide | |
| gluconic acid | |
| microcrystalline cellulose | |
| 6-hydroxybenzbromarone | |
| gliquidone | |
| N-(2-thiolethyl)-2-(2-(N'-(2,6-dichlorophenyl)amino) phenyl)acetamide | |
| Pertussis Toxin | |
| exenatide | |
| Shuangling Fuzheng anticancer preparation | |
| piperidine | An azacycloalkane that is cyclohexane in which one of the carbons is replaced by a nitrogen. It is a metabolite of cadaverine, a polyamine found in the human intestine. |
| asperulosidic acid | |
| casiopeina II | |
| heptenophos | A trialkyl phosphate that has formula C9H12ClO4P. |
| SB 277011 | |
| isobavachin | |
| (2E,4E,6E,10E)-3,7,11,15-tetramethyl-2,4,6,10,14-hexadecapentaenoic acid | |
| Hydrochloric Acid | |
| olopatadine | |
| proanthocyanidin | A flavonoid oligomer obtained by the the condensation of two or more units of hydroxyflavans. |
| 4-methylhistamine | An aralkylamino compound that is histamine bearing a methyl substituent at the 5 position on the ring. |
| entacapone | |
| hecogenin | A triterpenoid that has formula C27H42O4. |
| BeKm-1 toxin | |
| MT19c compound | |
| Firemaster BP-6 | |
| IMMU-110 | |
| 2-methyl-5-isopropenylcyclohex-2-enone oxime | |
| 1,5-bis(2-bromophenyl)penta-1,4-dien-3-one | |
| KB R7785 | |
| rhodioloside | |
| 4-methylumbelliferyl beta-D-ribopyranoside | |
| di-n-octyl phthalate | A 2-hydroxyisophthalic acid that has formula C24H38O4. |
| Tetrahydropapaveroline | |
| valilactone | |
| sinensetin | A flavonoid that has formula C20H20O7. |
| 4,4'-(1,2-dimethyl-1,2-ethanediyl)bis-2,6-piperazinedione | |
| aniline | A primary arylamine in which an amino functional group is substituted for one of the benzene hydrogens. |
| LM11A-31 | |
| 10-propargyl-10-deazaaminopterin | |
| embelin | A hydroxybenzoquinone that is 1,4-benzoquinone substituted by hydroxy groups at positions 2 and 5 and an undecyl group at position 3. Isolated from, Lysimachia punctata and Embelia ribes, it exhibits antimicrobial, antineoplastic and inhibitory activity towards hepatitis C protease. |
| Technetium | A manganese group element atom that has formula Tc. |
| O,O-diisopropyl-S-benzylthiophosphate | |
| Rolipram | |
| lithocholic acid acetate | |
| dibenzo(a,l)pyrene diol epoxide | |
| 2,6-xylenol | |
| 4-vinylpyridine | |
| rimabotulinumtoxinB | |
| nickel sulfide | |
| abrine | |
| inositol-1,3,4,5,6-pentakisphosphate | |
| Tropicamide | |
| RES 701-1 | |
| botulinum toxin type E | |
| Strontium | An alkaline earth metal atom that has formula Sr. |
| HS 1030 | |
| 2,3-dimethylhydroquinone | |
| norgestimate, ethinyl estradiol drug combination | |
| xanomeline | A tetrahydropyridine that has formula C14H23N3OS. |
| 4-nitrophenyl 2-propylmethylphosphonate | |
| 1,2-didecanoylglycerol | A 1,2-diglyceride that has formula C23H44O5. |
| gamma-sitosterol | |
| Zearalenone | A macrolide comprising a fourteen-membered lactone fused to 1,3-dihydroxybenzene; a potent estrogenic metabolite produced by some Giberella species. |
| anthra(1,9-cd)pyrazol-6(2H)-one | |
| norverapamil | |
| tiaprofenic acid | An aromatic ketone that is thiophene substituted at C-2 by benzoyl and at C-4 by a 1-carboxyethyl group. |
| Pyrazines | |
| pranlukast | |
| Meperidine | |
| Clofazimine | |
| 4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-3H-cyclopenta(c)quinoline | |
| EMD 534085 | |
| Azepines | |
| 2-azido-3-iodo-7,8-dibromodibenzo-1,4-dioxin | |
| CB 3717 | A N-acyl-L-glutamic acid that has formula C24H23N5O6. |
| 3,3',5,5'-tetrahydroxystilbene | |
| muraglitazar | |
| 5-(4-(2-(2-ethyl-4-methyl-6-oxo-1,6-dihydro-1-pyrimidinyl)ethoxy)phenylmethyl)thiazolidine-2,4-dione | |
| befloxatone | |
| procyanidin | |
| (3,4-dihydroxyphenylamino)-2-imidazoline | |
| 4-Chloromercuribenzenesulfonate | |
| N-(3-(aminomethyl)benzyl)acetamidine | |
| alpha-viniferin | A nine-membered macrocycle that incorporates three 6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuranyl moieties as part of the cyclic skeleton. It is isolated from Caragana chamlague Lamarck and exhibits significant inhibitory effect towards the enzyme acetylcholinesterase (EC 3.1.1.7). |
| AM 251 | |
| Diazinon | A member of the class of pyrimidines that is pyrimidine carrying an isopropyl group at position 2, a methyl group at position 6 and a (diethoxyphosphorothioyl)oxy group at position 4. |
| Silicon Compounds | |
| 5-hydroxymethylfurfural | A member of the class of furans that is furan which is substituted at positions 2 and 5 by formyl and hydroxymethyl substituents, respectively. Virtually absent from fresh foods, it is naturally generated in sugar-containing foods during storage, and especially by drying or cooking. It is the causative component in honey that affects the presystemic metabolism and pharmacokinetics of GZ in-vivo. |
| drospirenone | |
| resiniferatoxin | A diterpenoid that has formula C37H40O9. |
| Sulfaphenazole | A sulfonamide that is sulfanilamide in which the sulfonamide nitrogen is substituted by a 1-phenyl-1H-pyrazol-5-yl group. It is a selective inhibitor of cytochrome P450 (CYP) 2C9 isozyme, and antibacterial agent. |
| Buprenorphine | A morphinane alkaloid that is 7,8-dihydromorphine 6-O-methyl ether in which positions 6 and 14 are joined by a -CH2CH2- bridge, one of the hydrogens of the N-methyl group is substituted by cyclopropyl, and a hydrogen at position 7 is substituted by a 2-hydroxy-3,3-dimethylbutan-2-yl group. |
| sodium metasilicate | |
| Contraceptives, Oral | |
| 5-(4-methylpiperazin-1-yl)-2-(2'-(3,4-dimethoxyphenyl)-5'-benzimidazolyl)benzimidazole | |
| Epichlorohydrin | An epoxide that is 1,2-epoxypropene in which one of the methyl hydrogens is substituted by chlorine. |
| Methyl n-Butyl Ketone | |
| Ozone | An elemental molecule with formula O3. An explosive, pale blue gas (b.p. -112degreeC) that has a characteristic, pleasant odour, it is continuously produced in the upper atmosphere by the action of solar ultraviolet radiation on atmospheric oxygen. It is an antimicrobial agent used in the production of bottled water, as well as in the treatment of meat, poultry and other foodstuffs. |
| copper pyruvaldehyde bis(N(4)-methylthiosemicarbazone) complex | |
| aldosterone 18-glucuronide | |
| Cholesterol | |
| Cholecystokinin | |
| 1,2,7,8-tetrachlorodibenzofuran | |
| flosulide | |
| Noscapine | |
| 18-hydroxydeoxycorticosterone | |
| juzentaihoto | |
| bisacurone | |
| CHF 5022 | |
| alternariol monomethyl ether | An organic molecular entity that has formula C15H24O5. |
| Dibenz(b,f)(1,4)oxazepine-10(11H)-carboxylic acid, 8-chloro-, 2-acetylhydrazide | |
| lovastatin-niacin combination | |
| Platinum | A nickel group element atom that has formula Pt. |
| ruboxistaurin | |
| pentrinitrol | |
| Aminooxyacetic Acid | |
| Phosphatidylinositols | |
| Harmine | A harmala alkaloid in which the harman skeleton is methoxy-substituted at C-7. |
| Indoles | Any compound containing an indole skeleton. |
| homochlorocyclizine | |
| Porphobilinogen | A dicarboxylic acid that is pyrole bearing aminomethyl, carboxymethyl and 2-carboxyethyl substituents at positions 2, 3 and 4 respectively. |
| N-(3-fluorophenyl)-1-((4-(((3S)-3-methyl-1-piperazinyl)methyl)phenyl)acetyl)-4-piperidinamine | |
| 5,10,15,20-(etra(N-methyl-3-pyridyl))-26,28-diselenasapphyrin chloride | |
| 2-amino-3,8-dimethylimidazo(4,5-f)quinoxaline | |
| icajine | |
| Dicofol | A tertiary alcohol that is DDT in which the benzylic hydrogen has been replaced by a hydroxy group. |
| 4-hydroxypropranolol | |
| Ribonucleosides | |
| GW 501516 | An aromatic ether that is phenoxyacetic acid in which the phenyl group is substituted at position 2 by a methyl group and at position 4 by a (1,3-thiazol-5-ylmethyl)sulfanediyl group, and in which the 1,3-thiazolyl group is substituted at positions 2 and 4 by p-trifluoromethylphenyl and methyl groups, respectively. |
| 8-bromocyclic GMP | |
| D-161 compound | |
| Adrenergic beta-Antagonists | |
| AST 120 | |
| benzyloxyresorufin | |
| Androgens | |
| ethion | An organic thiophosphate that is S,S'-methanediyl bis[dihydrogen (phosphorodithioate)] in which all the hydroxy groups have been converted to their corresponding ethyl esters respectively. Ethion is an organophosphate insecticide with inhibitory activity towards the enzyme acetylcholinesterase ( EC 3.1.1.7). |
| 8-Bromo Cyclic Adenosine Monophosphate | |
| Cyclohexenes | |
| liarozole | |
| 4-(4-bromophenyl)-2,3-dihydro-N,3-bis(3,4,5-trimethoxyphenyl)-2-oxoidmi-dazole-1-carboxamide | |
| Thromboxane A2 | A thromboxane which is produced by activated platelets and has prothrombotic properties: it stimulates activation of new platelets as well as increases platelet aggregation. |
| SU 6656 | |
| F2-Isoprostanes | |
| G(M3) Ganglioside | |
| 8-isoprostaglandin E2 | |
| isobutyl alcohol | |
| withaferin A | A withanolide that is 5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione substituted by hydroxy groups at positions 4 and 27 (the 4beta,5beta,6beta,22R stereoisomer). Isolated from Physalis longifolia, it exhibits cytotoxic activity. |
| Carbapenems | The class of beta-lactam antibiotics that whose members have a carbapenem skeleton which is variously substituted at positions 3, 4, and 6. |
| acetyl-aspartyl-glutamyl-valyl-aspartic acid p-nitroanilide | |
| 6-anilino-5,8-quinolinedione | A quinolone that is quinoline-5,8-dione in which the hydrogen at position 6 is replaced by an anilino group. |
| brassinin | A dithiocarbamic ester that has formula C11H12N2S2. |
| 3-hydroxypregn-4-en-20-one | |
| AL-10 compound | |
| amlodipine, atorvastatin drug combination | |
| Phosphoenolpyruvate | A monocarboxylic acid anion resuting from selective deprotonation of the carboxy group of phosphoenolpyruvic acid. |
| 4-propylphenol | An alkylbenzene that has formula C9H12O. |
| virodhamine | |
| benzidine | A biphenyl that has formula C12H12N2. |
| hydroxymethylbilane | |
| N-(2-(4-((3-chloro-4-(3-(trifluoromethyl)phenoxy)phenyl)amino)-5H-pyrrolo(3,2-d)pyrimidin-5-yl)ethyl)-3-hydroxy-3-methylbutanamide | |
| IMOL S-140 | |
| methyleugenol | |
| Carmustine | |
| Calcium | |
| corexit 9500 | |
| O-(chloroacetylcarbamoyl)fumagillol | |
| tetrakis(4-benzoic acid)porphyrin | |
| nociceptin (1-13)-NH2, Phe(1)-psi(CH2-NH)-Gly(2)- | |
| sarpogrelate | |
| ethylene glycol monohexyl ether | |
| Hydrocarbons, Brominated | |
| 1,4-bis(4-hydroxyiminomethylpyridinium)butane dibromide | |
| dihydrosanguinarine | A benzophenanthridine alkaloid obtained by selective hydrogenation of the 13,14-position of sanguinarine. |
| 2,3-dimethoxy-5-methyl-6-decyl-1,4-benzoquinone | |
| N(1), N(12)-diethylspermine | |
| 2-cyano-3-hydroxy-N-(4-(trifluoromethyl)phenyl)-2-hepten-6-ynamide | |
| Flufenamic Acid | |
| 7-hydroxy-4-trifluoromethylcoumarin | |
| spiroxamine | The spiroketal resulting from the formal condensation of 4-tert-butylcyclohexanone with 3-[ethyl(propyl)amino]propane-1,2-diol. An inhibitor of ergosterol synthesis, it is a broad spectrum agricultural fungicide used particularly against powdery mildew in the production of cereals, bananas and grapes. |
| 3-caffeoyl-4-dicaffeoylquinic acid | |
| bathophenanthroline | |
| HOE 140, desArg(10)- | |
| VX680 | |
| inecalcitol | |
| Humic Substances | |
| ammonium trichloro(dioxoethylene-O,O'-)tellurate | |
| 3-oxocholan-24-oic acid | |
| CP-470711 | |
| butamifos | A C-nitro compound that has formula C13H21N2O4PS. |
| Chlorophyllides | Chlorophylls lacking the terpenoid side chain such as phytyl or farnesyl. |
| glucoraphanin | A glucosinolic acid that consists of 1-thio-beta-D-glucopyranose attached to a 5-(methylsulfinyl)-N-(sulfooxy)pentanimidoyl group at the anomeric sulfur. |
| 3-nitroperylene | A phenanthrene that has formula C20H11NO2. |
| dexpanthenol | |
| 2-arachidonylglycerol | |
| diacetyldiphenylurea bisguanylhydrazone | |
| Diazooxonorleucine | |
| 3-hydroxydesloratadine | |
| SL 327 | |
| atazanavir | |
| estradiol sulfate | |
| Dimethylnitrosamine | |
| Iodocyanopindolol | An indole that is 1H-indole substituted at positions 2, 3 and 7 by cyano, iodo and 3-(tert-butylamino)-2-hydroxypropoxy groups respectively. |
| tanshinone II A sodium sulfonate | |
| limonene | |
| Carbon Dioxide | A one-carbon compound with formula CO2 in which the carbon is attached to each oxygen atom by a double bond. A colourless, odourless gas under normal conditions, it is produced during respiration by all animals, fungi and microorganisms that depend directly or indirectly on living or decaying plants for food. |
| L 655238 | |
| Sterigmatocystin | An organic heteropentacyclic compound whose skeleton comprises a xanthene ring system ortho-fused to a dihydrofuranofuran moiety. The parent of the class of sterigmatocystins. |
| lomeguatrib | |
| carveol | A limonene monoterpenoid that is cyclohex-2-en-1-ol substituted by a methyl group at position 2 and a prop-1-en-2-yl group at position 5. |
| Diminazene | A triazene derivative that is triazene in which each of the terminal nitrogens is substituted by a 4-carbamimidoylphenyl group. |
| mequitazine | |
| daidzin | |
| Naloxone | A morphinane alkaloid that has formula C19H21NO4. |
| phorbol-12-myristate | |
| N-(3-furylmethyl)eicosa-5,8,11,14-tetraenamide | |
| 17-benzyl-5-androstane-3,17-diol | |
| nitroaspirin | |
| 1-(beta-naphthylmethyl)-6,7-dihydroxy-1,2,3,4-tetra-hydroisoquinoline | |
| azetidine-2,4-dicarboxylic acid | |
| Ethyl Methanesulfonate | A methanesulfonate ester resulting from the formal condensation of methanesulfonic acid with ethanol. |
| N2 Dental Cement | |
| 2-(4-(2-(3,4-dichlorophenyl)ethyl)phenylamino)benzoic acid | |
| 2,4-nonadienal | |
| bullatacin | A polyketide that has formula C37H66O7. |
| 4-(2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl)benzoic acid | |
| thorium nitrate | |
| Erythrosine | |
| dithiol | |
| spiro(imidazo-(1,2-a)pyridine-3,2-indan)-2(3H)-one | |
| Guaiacol | |
| Trinitrobenzenesulfonic Acid | |
| methoxyamine | |
| Polyglutamic Acid | |
| ABT-100 | |
| Digitoxigenin | A 5beta-cardenolide having hydroxy substituents at the 3beta- and 14beta-positions. |
| hexaarginine amide | |
| propylparaben | |
| roflumilast N-oxide | |
| CDP 840 | |
| cypermethrin | A carboxylic ester resulting from the formal condensation between 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and the alcoholic hydroxy group of hydroxy(3-phenoxyphenyl)acetonitrile. |
| gemcitabine | A 2'-deoxycytidine having geminal fluoro substituents in the 2'-position. An inhibitor of ribonucleotide reductase, gemcitabine is used in the treatment of various carcinomas, particularly non-small cell lung cancer, pancreatic cancer, bladder cancer and breast cancer. |
| N3-(4-(4-morpholinocyclohexyl)phenyl)-1-(pyridin-2-yl)-1H-1,2,4-triazole-3,5-diamine | |
| phenylpropylene oxide | |
| cholesterol alpha-oxide | |
| Trifluperidol | |
| styrofoam | |
| Cisapride | The amide resulting from formal condensation of 4-amino-5-chloro-2-methoxybenzoic acid with cis-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-amine. It has been used (as its monohydrate or as its tartrate) for the treatment of gastro-oesophageal reflux disease and for non-ulcer dyspepsia, but its propensity to cause cardiac arrhythmias resulted in its complete withdrawal from many countries, including the U.K., and restrictions on its use elsewhere. |
| 4,4-difluoro-4-bora-3a,4a-diaza-s-indacene | A BODIPY compound that has formula C9H7BF2N2. |
| N-methylhistamine | |
| cholest-5-en-3 beta,7 alpha-diol | |
| O(2)-vinyl-1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate | |
| di-n-butyltin | |
| D-JNKI-1 | |
| palladium chloride | |
| 18-methoxycoronaridine | |
| 9-fluorenone | |
| Cetylpyridinium | A pyridinium ion that has formula C21H38N. |
| Quaternary Ammonium Compounds | Derivatives of ammonium compounds, (NH4(+))Y(-), in which all four of the hydrogens bonded to nitrogen have been replaced with univalent (usually hydrocarbyl) groups. |
| nonanal | A fatty aldehyde formally arising from reduction of nonanoic acis. Metabolite observed in cancer metabolism. |
| 1,3-butadiene | |
| alpha-cobratoxin | |
| Thiotepa | |
| 7-methoxy-4-(aminomethyl)coumarin | |
| berbamine | An isoquinoline that has formula C37H40N2O6. |
| bis(12)-hupyridone | |
| Pyridoxine | A hydroxymethylpyridine with hydroxymethyl groups at positions 4 and 5, a hydroxy group at position 3 and a methyl group at position 2. |
| netoglitazone | |
| 3,7,11-trimethyldodeca-2,6,10-trienoic acid hexadecylamide | |
| n-propylbenzene | |
| Maleic Hydrazide | A pyridazinone that has formula C4H4N2O2. |
| Porfiromycin | |
| 4-aminobenzamide | |
| 4-(4-dimethylaminostyryl)-1-methylpyridinium | |
| lysophosphatidylglycerol | |
| Carticaine | |
| tauromuricholic acid | |
| 1,2-cyclohexanediamine | |
| raltegravir | |
| Cephaloridine | |
| calycopterin | |
| pretilachlor | An anilide that has formula C17H26ClNO2. |
| iodoresiniferatoxin | |
| Procyclidine | |
| chromium dinicocysteinate | |
| 4,4'-dinitro-2,2'-stilbenedisulfonic acid | |
| 4-((3-bromophenyl)amino)-6,7-dimethoxyquinazoline | |
| 3,3'-Dichlorobenzidine | A biphenyl that has formula C12H10Cl2N2. |
| benzo(a)pyrene-7,8-dihydrodiol-9,10-epoxide-DNA | |
| Delavirdine | |
| sodium selenide | An inorganic sodium salt having selenide as the counterion. |
| SD-208 | |
| 2-methylphenanthrene | |
| 1,2,3,4,6,7,8-heptachlorodibenzofuran | A chlorin that has formula C12HCl7O. |
| 4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-anthracenyl)benzoic acid | |
| toxin II (Anemonia sulcata) | |
| 5-methoxy-1-methyl-2-(n-propylamino)tetralin | |
| cyclopenta(c,d)pyrene | A pyrene that has formula C18H10. |
| Menhaden oil | |
| Hydrazines | Hydrazine (diazane) and its substituted derivatives. |
| N-acetyl-4-benzoquinoneimine | |
| PS1145 | |
| norathyriol | A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 6 and 7. Isolated from Garcinia mangostana and Maclura pomifera, it exhibits inhibitory activity against protein kinase C. |
| ponkoranol | |
| n-dodecane | |
| 4'-hydroxywarfarin | |
| naphthoresorcinol | |
| Thyronines | |
| 2-phenyl-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide | |
| chromium (D-Phenylalanine)3 | |
| Fructose | A ketohexose that is an isomer of glucose. |
| Bromocriptine | An indole alkaloid that has formula C32H40BrN5O5. |
| butyl phosphorotrithioate | |
| 6-hydroxytaxol | |
| melamine | A trimer of cyanamide, with a 1,3,5-triazine skeleton. |
| Uracil | |
| gedunin | A pentacyclic triterpenoid natural product found particularly in Azadirachta indica and Cedrela odorata. |
| thymeleatoxin | |
| 1,8-diaminonaphthalene | |
| Aminoquinolines | |
| N-methyl-N-benzylnitrosamine | |
| 3-(3-chloro-4-hydroxyphenylamino)-4-(4-nitrophenyl)-1H-pyrrole-2,5-dione | |
| sphingosine 1-phosphate | A phosphosphingolipid that consists of sphingosine having a phospho group attached at position 1 |
| mono-(2-ethylhexyl)phthalate | The mono(2-ethylhexyl) ester of benzene-1,2-dicarboxylic acid. |
| N-(4-aminobutyl)-5-chloro-2-naphthalenesulfonamide | |
| Indocyanine Green | A benzoindole that has formula C43H47N2NaO6S2. |
| 1-methyl-4-phenyl-2,3-dihydropyridinium | |
| Hypoxanthine | A purine nucleobase that consists of purine bearing an oxo substituent at position 6. |
| Tretinoin | |
| nilutamide | |
| mesulergine | A member of the class of ergot alkaloids that is known to act on serotonin and dopamine receptors. |
| Ethylnitrosourea | |
| phenyl biguanide | A member of the class of biguanides that is biguanide in which one of the terminal nitrogen atoms is substituted by a phenyl group. |
| alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic Acid | |
| ponceau 4R | |
| 3',4',7-trihydroxyisoflavone | A 7-hydroxyisoflavone that is daidzein substituted by a hydroxy group at position 3'. |
| arachidin-1 | |
| ethanolamine O-sulfate | |
| 2-Propanol | |
| estradiol, norethindrone drug combination | |
| hydroxyoctadecadienoic acid | |
| mulberroside A | |
| Folic Acid Antagonists | An antimetabolite that impairs the action of folic acids |
| Ranitidine | A member of the class of furans used to treat peptic ulcer disease (PUD) and gastroesophageal reflux disease. |
| Thalidomide | |
| 1-(2-methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine | |
| 4',5'-bis(1,3,2-dithioarsolan-2-yl)fluorescein | |
| macrophage stimulatory lipopeptide 2 | |
| PBOX-6 | |
| pheomelanin | |
| isomalathion | |
| perfluorodecanoic acid | A fluoroalkanoic acid that is perfluorinated decanoic acid. |
| Graphite | An allotropic form of the element carbon consisting of layers of hexagonally arranged carbon atoms in a planar condensed ring system (graphene layers). The layers are stacked parallel to each other in a three-dimensional crystalline long-range order. There are two allotropic forms with different stacking arrangements, hexagonal and rhombohedral. The chemical bonds within the layers are covalent with sp(2) hybridization and with a C--C distance of 141.7 pm. The weak bonds between the layers are metallic with a strength comparable to van der Waals bonding only. |
| 4-ethynylbiphenyl | |
| tandospirone | |
| mafosfamide | |
| Sulpiride | |
| Tetraisopropylpyrophosphamide | |
| DDMS | |
| flunisolide | A cyclic ketal that has formula C24H31FO6. |
| naphthol AS-E phosphate | |
| indenoindole | |
| 3,5-bis(2-fluorobenzylidene)piperidin-4-one | |
| methyllycaconitine | A diterpenoid that has formula C37H50N2O10. |
| 2-acetylphenothiazine | |
| olomoucine | |
| 11,14,15-trihydroxyeicosa-5,8,12-trienoic acid | |
| Metanephrine | |
| HMR 1098 | |
| Melphalan | A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring. |
| U 40481 | |
| 4-mercuribenzoate | |
| methyl 2,5-dihydroxycinnamate | |
| 1,4,5,8-naphthalenetetracarboxylic diimide | |
| Heroin | |
| idobenzamide | |
| N-(2-aminoethyl)-5-chloroisoquinoline-8-sulfonamide | A member of the class of isoquinolines that is isoquinoline-8-sulfonamide which is substituted by chlorine at position 5 and in which the sulfonamide nitrogen is substituted by a 2-aminoethyl group. It is an inhibitor of casein kinase I. |
| 2,3,4,2',3',4'-hexachlorobiphenyl | |
| brilliant blue | An organic molecular entity that has formula C37H34N2Na2O9S3. |
| 4-oxo-2-nonenal | |
| (N-(1-(((cyanoimino)(5-quinolinylamino) methyl) amino)-2,2-dimethylpropyl)-2-(3,4-dimethoxyphenyl)acetamide) | |
| glycoursodeoxycholic acid | |
| vinyl bromide | |
| neoechinulin | |
| Hesperidin | A disaccharide derivative that consists of hesperetin substituted by a 6-O-(alpha-L-rhamnopyranosyl)-beta-D-glucopyranosyl moiety at position 7 via a glycosidic linkage. |
| Riboflavin | D-Ribitol in which the hydroxy group at position 5 is substituted by a 7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl moiety. It is a nutritional factor found in milk, eggs, malted barley, liver, kidney, heart, and leafy vegetables, but the richest natural source is yeast. The free form occurs only in the retina of the eye, in whey, and in urine; its principal forms in tissues and cells are as flavin mononucleotide and flavin-adenine dinucleotide. |
| tPA stop | |
| pinosylvin | A stilbenol that has formula C14H12O2. |
| OXT-328 | |
| N-ethyl-3-toluamide | |
| 2',7'-bis(carboxyethyl)-5(6)-carboxyfluorescein | |
| pregnanediol-3 alpha-glucuronide | |
| Dicamba | A methoxybenzoic acid that is O-methylsalicylic acid substituted by chloro groups at positions 3 and 6. |
| rhodostomin | |
| Polychlorinated Biphenyls | |
| 4,4'-diphenylmethane diisocyanate | |
| benzo(a)pyrene-7,8,9,10-tetrol | |
| laquinimod | |
| 2-amino-1-methyl-6-(4-hydroxyphenyl)imidazo(4,5-b)pyridine | |
| Polylysine | A poly(amide) polymer, composed of poly(lysine) macromolecules. |
| 11-dehydro-thromboxane B2 | A thromboxane obtained by formal oxidation of the hemiacetal hydroxy function of thromboxane B2. |
| 6alpha-ethyl-23(S)-methylcholic acid | |
| cabergoline | An N-acylurea that is (8R)-ergoline-8-carboxamide in which the hydrogen attached to the piperidine nitrogen (position 6) is substituted by an allyl group and the hydrogens attached to the carboxamide nitrogen are substituted by a 3-(dimethylamino)propyl group and an N-ethylcarbamoyl group. A dopamine D2 receptor agonist, cabergoline is used in the management of Parkinson's disease and of disorders associated with hyperprolactinaemia. |
| imatinib | |
| 3-azibutanol | |
| piplartine | A cinnamamide that has formula C17H19NO5. |
| Trioxsalen | |
| broussochalcone A | |
| salubrinal | |
| Gossypol | A polyphenol that has formula C30H30O8. |
| Procaine |
