| Description | Chemical-gene interactions curated from literature |
| Measurement | association by literature curation |
| Association | gene-chemical associations by manual literature curation |
| Category | physical interactions |
| Resource | Comparative Toxicogenomics Database |
| Citation(s) | |
| Last Updated | 2015 Apr 06 |
| Stats |
|
| API | |
| Script | |
| Downloads |
Attribute Similarity
Gene Attribute
Gene Similarity
9516 sets of genes/proteins interacting with chemicals from the curated CTD Gene-Chemical Interactions dataset.
| Gene Set | Description |
|---|---|
| 10'(Z),13'(E),15'(E)-heptadecatrienylhydroquinone | |
| Androstenediol | |
| EXP3174 | |
| benzo(j)fluoranthene | A naphthalene that has formula C20H12. |
| desflurane | |
| acetophenazine | |
| kaempferol-3-O-galactoside | |
| NuvaRing | |
| malvidin-3-O-glucoside-4 vinyl | |
| Dendroaspis natriuretic peptide | |
| alpha-naphthyl thiourea | A naphthalene that has formula C11H10N2S. |
| 19-oxo-11-deoxycorticosterone acetate | |
| idelalisib | A member of the class of quinazolines that is 5-fluoro-3-phenylquinazolin-4-one in which the hydrogen at position 2 is replaced by a (1S)-1-(3H-purin-6-ylamino)propyl group. used for for the treatment of refractory indolent non-Hodgkin's lymphoma and relapsed chronic lymphocytic leukemia. |
| telmisartan | |
| methyl 2-cyano-3,12-dioxoolean-1,9-dien-28-oate | |
| lawsone | 1,4-Naphthoquinone carrying a hydroxy function at C-2. It is obtained from the leaves of Lawsonia inermis. |
| Glutathione | |
| devrinol | |
| WEB 2086 | |
| xaliproden | A tetrahydropyridine that has formula C24H22F3N. |
| dimethoxon | |
| 4,4'-dimethylbiphenyl | |
| Cyclic ADP-Ribose | A cyclic purine nucleotide that is synthesised from NAD+ by ADP-ribosyl cyclase; acts as an agonist at ryanodine receptors. |
| Gliclazide | |
| Methylergonovine | |
| 5,7-dihydroxy-6-methoxy-2-phenylchromen-4-one | |
| 3-(hydroxymethyl)phenytoin | |
| 4-cyclohexyloxy-2-(1-(4-(4-methoxy-benzenesulfonyl)piperazin-1-yl)ethyl)quinazoline | |
| HMR 1556 | A 1-benzopyran that has formula C15H20N2O4S. |
| Methacholine Chloride | A quaternary ammonium salt that has formula C8H18NO2.Cl. |
| Folic Acid | An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
| RS 67333 | |
| 2,3,3',4,4'-pentachlorobiphenyl | |
| 2-hydroxychavicol | |
| Gadolinium | A lanthanoid atom that has formula Gd. |
| 2,3,4,5,6-pentachloroaniline | |
| etoperidone | |
| 2,5-dihydroxybenzaldehyde | A dihydroxybenzaldehyde carrying hydroxy groups at positions 2 and 5. |
| Kynurenic Acid | A quinolinemonocarboxylic acid that is quinoline-2-carboxylic acid substituted by a hydroxy group at C-4. |
| eremanthin | A sesquiterpene lactone that has formula C15H18O2. |
| Hydroxyeicosatetraenoic Acids | Any monohydroxylated icosanoid having four double bonds. |
| gamma-valerolactone | A butan-4-olide that is dihydrofuran-2(3H)-one substituted by a methyl group at position 5. It has been found in the urine samples of humans exposed to n-hexane. |
| L 745337 | |
| alanylproline-4-nitroanilide | |
| Nitrogen Mustard Compounds | |
| Mechlorethamine | |
| tyrphostin 47 | |
| 3,7-O-dimethylquercetin | |
| forsterite | |
| Pimozide | |
| Oxadiazoles | |
| nitrosonium tetrafluoroborate | |
| budlein A | A sesquiterpenoid that has formula C20H22O7. |
| Quipazine | |
| Amphetamine | An amphetamine, the parent of the class of amphetamines, having the structure 1-phenylpropan-2-amine. It exists as a racemate. |
| Trapidil | |
| WAY-169916 | |
| tetraoctylammonium bromide | |
| dicrotophos | A dialkyl phosphate that has formula C8H16NO5P. |
| cinacalcet | |
| 7-fluoro-2-oxo-4-(2-(4-(thieno(3,2-c)pyridin-4-yl)piperazin-1-yl)ethyl)-1,2-dihydroquinoline-1-acetamide | |
| Diflubenzuron | A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
| efatutazone | |
| GSK 2324 | |
| n-tetradecane | |
| triphenyltin | |
| naltrindole | An isoquinoline that has formula C26H26N2O3. |
| black widow spider venom | |
| Phenprocoumon | |
| Nortriptyline | An organic tricyclic compound that is 10,11-dihydro-5H-dibenzo[a,d][7]annulene substituted by a 3-(methylamino)propylidene group at position 5. It is an active metabolite of amitriptyline. |
| Butanols | |
| N-(1-methylethyl)-1,1,2-trimethylpropylamine | |
| M50354 | |
| 5(6)-carboxy-2',7'-dichlorofluorescein | |
| Cholera Toxin | |
| Chorionic Gonadotropin | |
| nitrosobenzylmethylamine | |
| 10,11-dihydro-10,11-dihydroxy-5H-dibenzazepine-5-carboxamide | |
| GABA Agents | |
| afimoxifene | A tertiary amino compound that is tamoxifen in which the phenyl group which is in a Z- relationship to the ethyl substituent is hydroxylated at the para- position. It is the active metabolite of tamoxifen. |
| 1-hydroxy-2,3,5-trimethoxyxanthone | |
| Nalbuphine | An organic heteropentacyclic compound that has formula C21H27NO4. |
| asiatic acid | A pentacyclic triterpenoid that is ursane substituted by a carboxy group at position 28 and hydroxy groups at positions 2, 3 and 23 (the 2alpha,3beta stereoisomer). It is isolated from Symplocos lancifolia and Vateria indica and exhibits anti-angiogenic activity. |
| cyclohexyl-(2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl)amine | |
| 5-cholesten-3,25-diol 3-sulfonate | |
| tridecane | A straight chain alkane containing 13 carbon atoms. It forms a component of the essential oils isolated from plants such as Abelmoschus esculentus. |
| sulfoxaflor | |
| 4-tolyl isocyanate | A member of the class of isocyanates comprising a benzene core with isocyanato- and methyl substituents para to each other. |
| Ortho Evra | |
| temocapril hydrochloride | |
| 1-(2-fluorophenyl)-3-(2-(morpholin-2-yl)ethyl)-1,3-dihydro-2,1,3-benzothiadiazole 2,2-dioxide | |
| Dihydroxyacetone Phosphate | |
| bis(tri-n-butyltin)oxide | |
| meloxicam | |
| UH 232 | |
| XP 620 | |
| Testosterone | An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
| phenylhydroquinone | |
| PAPA NONOate | |
| 1,5-dihydroxyisoquinoline | |
| Tiopronin | |
| 2-chloroethylamine | |
| Ferrosoferric Oxide | An iron oxide that has formula Fe3O4. |
| GW2974 | |
| 2-benzoquinone | |
| naloxonazine | |
| Nitrazepam | |
| tris(2-carboxyethyl)phosphine | |
| 2,4-bis(4'-fluorophenethylamino)-6-(3'-(N,N-dimethylamino)propylamino)-1,3,5-triazine | |
| 2-(methylamino)isobutyric acid | |
| 2,4,6-trichlorophenol | A trichlorophenol with phenolic substituents on positions 2, 4 and 6. |
| 6-(N,N-dimethylamino)-2-(naphthalene-1-yl)-4-quinazolinone | |
| Glyceraldehyde 3-Phosphate | An aldotriose phosphate that is the 3-phospho derivative of glyceraldehyde. It is an important metabolic intermediate in several central metabolic pathways in all organisms. |
| Nitroblue Tetrazolium | |
| bisindolylmaleimide | |
| N-Methyl-3,4-methylenedioxyamphetamine | |
| homoorientin | |
| hexacyanoferrate III | |
| NPS R-467 | |
| S-1,2-dichlorovinyl-N-acetylcysteine | |
| 2-phenylaminoadenosine | |
| Hydroxy Acids | Any carboxylic acid with at least one hydroxy group. |
| Floxacillin | |
| 3-anisidine | |
| 1,7-N-heptylene-bis-9,9'-amino-1,2,3,4-tetrahydroacridine | |
| NS 1619 | A member of the class of benzimidazoles that is 1,3-dihydro-2H-benzimidazol-2-one in which the hydrogens at positions 1 and 5 are replaced are replaced by 2-hydroxy-5-(trifluoromethyl)phenyl and trifluoromethyl groups, respectively. It is an opener/activator of the large-conductance calcium-activated potassium channel (Bkca). |
| Creosote | |
| prunetin | A hydroxyisoflavone that is genistein in which the hydroxy group at position 7 is replaced by a methoxy group. |
| cinobufagin | A steroid lactone that has formula C26H34O6. |
| kangshuai yizhi | |
| 3-(4-hydroxy-2-methoxybenzylidene)anabaseine | |
| pentanal | A fatty aldehyde composed from five carbons in a straight chain |
| 2,2'-dipyridyl disulfide | |
| mifobate | |
| Skatole | A methylindole carrying a methyl substituent at position 3. It is produced during the anoxic metabolism of L-tryptophan in the mammalian digestive tract. |
| Estrone | A 17-oxo steroid that is estra-1,3,5(10)-triene substituted by an hydroxy group at position 3 and an oxo group at position 17. |
| harmalol | A harmala alkaloid in which the harman skeleton is hydroxy-substituted at C-7 and has been reduced across the 3,4 bond. |
| seocalcitol | |
| 4-allyl-8-ethyl-7,8-dihydro-2-(3-methoxy-1-methyl-1H-pyrazol-5-yl)-1H-imidazo(2,1-i)purin-5(4H)-one | |
| 5-Methylcytosine | |
| ethylene | |
| Dalteparin | |
| docosapentaenoic acid | Any straight-chain, C22 fatty acid having five C=C double bonds. |
| AR-R 17779 | |
| 1-methylanthracene | |
| lycopene | An acyclic carotene commonly obtained from tomatoes and other red fruits. |
| Acyl Coenzyme A | |
| ferric-adenosine triphosphate complex | |
| niguldipine | A diarylmethane that has formula C36H39N3O6. |
| Flavin-Adenine Dinucleotide | |
| Dianisidine | |
| neoxanthin | An epoxycarotenoid that is 6,7-didehydro-5,5',6,6'-tetrahydro-5',6'-epoxy-beta,beta-carotene which is substituted by hydroxy groups at the 3, 3', and 5 positions. |
| N-ethylmaleimide-S-glutathione | A peptide that has formula C16H22N4O8S. |
| methidathion | An organothiophosphate insecticide that has formula C6H11N2O4PS3. |
| 1-acetonaphthone | |
| 3,7-bis(2-hydroxyethyl)icaritin | |
| brofaromine | |
| Azoxymethane | |
| diallyl disulfide | An organic disulfide where the organic group specified is allyl. It has been isolated from garlic and other species of the genus Allium. |
| bufalin | A 14beta-hydroxy steroid that is bufan-20,22-dienolide having hydroxy substituents at the 5beta- and 14beta-positions. It has been isolated from the skin of the toad Bufo bufo. |
| Naproxen | A methoxynaphthalene that is 2-methoxynaphthalene substituted by a carboxy ethyl group at position 6. Naproxen is a non-steroidal anti-inflammatory drug commonly used for the reduction of pain, fever, inflammation and stiffness caused by conditions such as osteoarthritis, kidney stones, rheumatoid arthritis, psoriatic arthritis, gout, ankylosing spondylitis, menstrual cramps, tendinitis, bursitis, and for the treatment of primary dysmenorrhea. It works by inhibiting both the COX-1 and COX-2 enzymes. |
| 4-ethylguaiacol | |
| Crotalid Venoms | |
| androstan-3-ol | |
| 4-hydroxystilbene | |
| piperophos | A N-acylpiperidine that has formula C14H28NO3PS2. |
| wogonoside | |
| trityl chloride | |
| sulfolithocholic acid | |
| Firemaster 550 | |
| Tetrodotoxin | A quinazoline alkaloid that is a marine toxin isolated from fish such as puffer fish. It has been shown to exhibit potential neutotoxicity due to its ability to block voltage-gated sodium channels. |
| Hazardous Substances | |
| Malondialdehyde | |
| 2-gluthionyl-3,5,6-trichloro-1,4-benzoquinone | |
| tenoxicam | |
| 2-(4-chloro-6-(2,3-dimethylphenylamino)pyrimidin-2-ylthio)octanoic acid | |
| CPU0213 | |
| Impromidine | |
| nomegestrol acetate | |
| oxotremorine M | A quaternary ammonium ion that has formula C11H19N2O. |
| navitoclax | |
| nitrofen | An organic molecular entity that has formula C12H7Cl2NO3. |
| 2-amino-3-(2-amino-2-carboxyethylsulfanyl-mercuricsulfanyl)-propionic acid | |
| OPC 3911 | |
| Sulfinpyrazone | A pyrazolidine that has formula C23H20N2O3S. |
| 5-((4-(2-(1-indolyl)ethoxy)-phenyl)methyl)thiazolidine-2,4-dione | |
| Nicorandil | |
| 3-(3,4-difluorophenyl)-4-(4-(methylsulfonyl)phenyl)-2(5H)-furanone | |
| gyrophoric acid | |
| Ampicillin | A penicillin in which the substituent at position 6 of the penam ring is a 2-amino-2-phenylacetamido group. |
| aflatoxin-albumin adduct | |
| Hexanes | |
| dicarbine | |
| 5-aminoisoquinolinone | |
| Menthol | |
| JHW 015 | |
| Pindolol | A member of the class of indols which is the 2-hydroxy-3-(isopropylamino)propyl ether derivative of 1H-indol-4-ol. |
| isomenthol | |
| Fluconazole | A member of the class of triazoles that is propan-2-ol substituted at position 1 and 3 by 1H-1,2,4-triazol-1-yl groups and at position 2 by a 2,4-difluorophenyl group. It has been shown to exhibit antifungal activity. |
| ferric chloride | |
| 1,4-dihydroxy-2-naphthoic acid | A naphthoic acid that is 2-naphthoic acid substituted by hydroxy groups at positions 1 and 4. |
| antimonite | A trivalent inorganic anion obtained by removal of all three protons from antimonous acid. |
| 4-aminobenzamidine | |
| 4-methylumbelliferyl acetate | An acetate ester consiting of umbelliferone carrying a 7-O-acetyl group. |
| suplatast tosilate | An anilide that has formula C16H26NO4S.C7H7O3S. |
| Ganciclovir | An oxopurine that is guanine substituted by a [(1,3-dihydroxypropan-2-yl)oxy]methyl group at position 9. Ganciclovir is an antiviral drug used to treat or prevent AIDS-related cytomegalovirus infections. |
| Potassium Cyanide | A cyanide salt that has formula CKN. |
| FLB 457 | |
| ND 322 | |
| cadmium telluride | |
| chlornaltrexamine | |
| antimony oxide | |
| Monobactams | Monocyclic, bacterially produced or semisynthetic beta-lactam antibiotic. It lacks the double ring construction of the traditional beta-lactam antibiotics and can be easily synthesized. |
| SB 210661 | |
| 3-(5-(2,3-dichlorophenyl)-1H-tetrazol-1-yl)methylpyridine | |
| lactofen | |
| 4-Acetamido-4'-isothiocyanatostilbene-2,2'-disulfonic Acid | |
| Phenetidine | |
| Cadmium Chloride | |
| Zinc Oxide | A zinc molecular entity that has formula OZn. |
| succinyl-coenzyme A | |
| Fusaric Acid | An aromatic carboxylic acid that has formula C10H13NO2. |
| astin B | |
| LL Z1640-2 | |
| bicinchoninic acid | |
| Asbestos, Amosite | |
| allylpyrocatechol | |
| 3,3',4,5'-tetrahydroxystilbene | |
| Captan | A dicarboximide that is 3a,4,7,7a-tetrahydrophthalimide in which the hydrogen attached to the nitrogen is replaced by a trichloromethyl group. A non-systemic fungicide introduced in the 1950s, it is widely used for the control of fungal diseases in fruits, vegetables, and ornamental crops. |
| bromfenac | Amfenac in which the the hydrogen at the 4 position of the benzoyl group is substituted by bromine. It is used for the management of ocular pain and treatment of postoperative inflammation in patients who have undergone cataract extraction. It was withdrawn from the US market in 1998, following concerns over off-label abuse and hepatic failure. |
| N-benzyladriamycin-14-valerate | |
| Pyrantel Pamoate | An organic molecular entity that has formula C23H16O6.C11H14N2S. |
| bilobalide | A terpenoid trilactone found in extracts of Ginkgo biloba. |
| delta(12)-prostaglandin J(2) | |
| 2-hydroxyquinoline | |
| 2-(1-(4-piperonyl)piperazinyl)benzothiazole | |
| ormeloxifene | |
| PD 161570 | |
| kahweol palmitate | |
| 5-hydroxythalidomide | |
| baicalein | A trihydroxyflavone with the hydroxy groups at positions C-5, -6 and -7. |
| L 703606 | |
| Lignans | |
| aroclor 1260 | |
| Promegestone | |
| Santonin | |
| SIB 1757 | |
| RS 43179 | |
| 5-hydroxymethylcytosine | A nucleobase analogue that is cytosine in which the hydrogen at position 5 is replaced by a hydroxymethyl group. |
| 2-(3-trifluoromethylphenyl)histamine | |
| 3',4'-dimethoxyflavone | |
| 7-benzyloxyquinoline | |
| oxybenzone | A hydroxybenzophenone that is benzophenone which is substituted at the 2- and 4-positions of one of the benzene rings by hydroxy and methoxy groups respectively. |
| 1-(4-carbamoylpyridinium)-4-(4-hydroxyiminomethylpyridinium)but-2-ene | |
| betulin | A pentacyclic triterpenoid that is lupane having a double bond at position 20(29) as well as 3beta-hydroxy and 28-hydroxymethyl substituents. |
| WHI P154 | |
| 2-tert-butyl-4-methylphenol | |
| atrasentan | |
| 1,2-dihydro-1,2-dihydroxy-5-methylchrysene | |
| Digitoxin | |
| N-(deoxyguanosin-8-yl)-1-aminopyrene | |
| lupeol | A pentacyclic triterpenoid that is lupane in which the hydrogen at the 3beta position is substituted by a hydroxy group. It occurs in the skin of lupin seeds, as well as in the latex of fig trees and of rubber plants. It is also found in many edible fruits and vegetables. |
| fexofenadine | A piperidine-based anti-histamine compound. |
| EHT 1864 | |
| 2,6-di-tert-butyl-4-hydroxymethylphenol | |
| aldophosphamide | A nitrogen mustard that has formula C7H15Cl2N2O3P. |
| Emulsions | |
| Chlorthalidone | An isoindole that has formula C14H11ClN2O4S. |
| 4-nitrobenzaldehyde | A C-nitro compound that is benzaldehyde substituted at the para-position with a nitro group. |
| fusaproliferin | |
| Niflumic Acid | |
| demeton-S-methyl | An organothiophosphate insecticide that has formula C6H15O3PS2. |
| pyrrolidine dithiocarbamic acid | |
| captax | |
| TRK 820 | |
| S-Nitrosothiols | |
| Dihydralazine | |
| 2-hydroxy-1-(2-((9-(4-methylcyclohexyl)-9H-pyrido(4',3'-4,5)pyrrolo(2,3-d)pyrimidin-2-yl)amino)-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)ethanone | |
| 1,2,4-trihydroxy-9,10-anthracenedione | |
| fasciculin | |
| Guanine Nucleotides | |
| Hydroxymethylglutaryl-CoA Reductase Inhibitors | A compound that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Pentamidine | A diether compound consisting of pentane-1,5-diol with both hydroxyls bearing 4-amidinophenyl groups. |
| O-demethyltramadol | |
| tin protoporphyrin IX | |
| demethylchlordimeform | |
| tezosentan | |
| dimerumic acid | |
| BMS 961 | |
| actein | A triterpenoid that has formula C37H56O11. |
| 2,4-Dinitrophenol | A dinitrophenol having the nitro groups at the 2- and 4-positions. |
| terephthalic acid | A benzenedicarboxylic acid carrying carboxy groups at positions 1 and 4. One of three possible isomers of benzenedicarboxylic acid, the others being phthalic and isophthalic acids. |
| Isotretinoin | A retinoic acid that is all-trans-retinoic acid in which the double bond which is alpha,beta- to the carboxy group is isomerised to Z configuration. A synthetic retinoid, it is used for the treatment of severe cases of acne and other skin diseases. |
| Glutethimide | |
| trichloroacetaldehyde | An organochlorine compound that consists of acetaldehyde where all the methyl hydrogens are replaced by chloro groups. |
| adiphenine | |
| GYPGKF-NH(2) | |
| cinitapride | |
| 16-ketoestrone | A 3-hydroxy steroid that has formula C18H20O3. |
| PI 540 | |
| Chitin | An aminoglycan consisting of beta-(1->4)-linked N-acetyl-D-glucosamine residues. |
| 1-hydroxy-2-oxo-3,3-bis(2-aminoethyl)-1-triazene | |
| 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-4-((5-(4-fluorophenyl)-3-pyridinyl)methyl)piperazine | |
| dibromodiphenyl ether | |
| phorbol 12-phenylacetate 13-acetate 20-homovanillate | |
| methoxy-morpholinyl-doxorubicin | |
| 1-(4-(benzothiazol-2-yloxy)benzyl)piperidine-4-carboxylic acid | |
| Staphylococcal Protein A | |
| Amiodarone | A member of the class of 1-benzofurans that is 1-benzofuran substituted by a butyl group at position 2 and a 4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl group at position 3. It is a cardiovascular drug used for the treatment of cardiac dysrhythmias. |
| 2-amino-6-(2-(cyclopropylmethoxy)-6-hydroxyphenyl)-4-piperidin-4-yl nicotinonitrile | |
| rosuvastatin | |
| 2,4-diaminotoluene | An aminotoluene that is para-toluidine with an additional amino group at position 2. |
| benazepril | A benzazepine that has formula C24H28N2O5. |
| alpha-MSH | |
| eucalyptol | |
| puag-haad | |
| Carnosine | |
| di-n-propylphthalate | |
| diphenyltin | |
| 7-(2-(cyclopropylmethoxy)-6-hydroxyphenyl)-5-(3-piperidinyl)-1,4-dihydro-2H-pyrido(2,3-d)(1,3)oxazin-2-one | |
| Isoxsuprine | |
| 1,2-diacylglycerol | |
| 1-phenyl-3-dimethylamino-1,2,3,4-tetrahydronaphthalene | |
| selenium-cisplatin conjugate | |
| 3-hydroxybenzylhydrazine | |
| decamethonium | A quaternary ammonium ion that is a depolarising muscle relaxant whose structure comprises a decane-1,10-diamine core in which each amino group carries three methyl substituents. |
| Guanethidine | |
| N-tert-butylisoquine | |
| 2,3,4-tri-O-acetylarabinopyranosyl isothiocyanate | |
| benzimidazolone | |
| Chrysenes | |
| 3-mercaptopicolinic acid | |
| Zinc Acetate | An acetate salt in which the cationic component is zinc(2+). |
| kamebakaurin | |
| fenbuconazole | A racemate comprising equimolar amounts of (R)- and (S)-fenbuconazole. A fungicide used to control a range of diseases including powdery mildew, black rot and scab. |
| dihydrexidine | |
| eupafolin | |
| methyl iodide | |
| alpha-hydroxyglutarate | |
| domoic acid | A L-proline derivative that is L-proline substituted by a carboxymethyl group at position 3 and a 6-carboxyhepta-2,4-dien-2-yl group at position 4. It is an analog of kainic acid and is the neurotoxin associated with the amnesic shellfish poisoning (ASP). |
| WeiJia | |
| Glyceraldehyde | An aldotriose comprising propanal having hydroxy groups at the 2- and 3-positions. It plays role in the formation of advanced glycation end-products (AGEs), a deleterious accompaniment to ageing. |
| Isoflavones | Any isoflavonoid with a 3-aryl-1-benzopyran-4-one (3-aryl-4H-chromen-4-one) skeleton and its substituted derivatives. |
| Bemegride | |
| Roxarsone | An organoarsonic acid where the organyl group is 4-hydroxy-3-nitrophenyl. |
| n-pentanol | |
| Aspirin | |
| SCH 23390 | A benzazepine that is 2,3,4,5-tetrahydro-3-benzazepine bearing a phenyl substituent at position 1, a methyl substituent at position 3, a chloro substituent at position 7 and a hydroxy substituent at position 8. |
| dimethylstilbestrol | A stilbenoid that has formula C16H16O2. |
| SR 59119A | |
| Chlorides | |
| 9-amino-6-chloro-2-methoxyacridine | |
| Diglycerides | A glyceride in which any two of the R groups (positions not specified) are acyl groups while the remaining R group can be either H or an alkyl group. |
| Voriconazole | A triazole-based antifungal agent used for the treatment of esophageal candidiasis, invasive pulmonary aspergillosis, and serious fungal infections caused by Scedosporium apiospermum and Fusarium spp. It is an inhibitor of cytochrome P450 2C9 (CYP2C9) and CYP3A4. |
| lewisite | |
| nonachlor | |
| 7-methylbenzanthracene | |
| 1-stearoyl-2-arachidonoylglycerol | A 1,2-diglyceride in which the acyl groups at positions 1 and 2 are specifed as stearoyl and arachidonoyl respectively. |
| jasplakinolide | |
| RS 100329 | |
| petrosaspongiolide m | |
| N-(7-(4-nitrobenzo-2-oxa-1,3-diazole))-6-aminocaproyl sphingosine | Sphingosine with the amino nitrogen converted into a 6-{[N-(7-nitrobenzo-2,1,3-oxadiazol-4-yl)amino]}hexananamido group. |
| salvianolic acid A | A stilbenoid that has formula C26H22O10. |
| salvianolic acid B | |
| tert-Butylhydroperoxide | An alkyl hydroperoxide in which the alkyl group is tert-butyl. It is widely used in a variety of oxidation processes. |
| acetophenone | A methyl ketone that is acetone in which one of the hydrogens of the methyl group has been replaced by a phenyl group. |
| 1L-6-hydroxymethyl-chiro-inositol 2(R)-2-O-methyl-3-O-octadecylcarbonate | |
| Acrylonitrile | A nitrile that is hydrogen cyanide in which the hydrogen has been replaced by an ethenyl group. |
| Hycanthone | A thioxanthen-9-one compound having a hydroxymethyl substituent at the 1-position and a 2-[(diethylamino)ethyl]amino substituent at the 4-position. It was formerly used (particularly as the monomethanesulfonic acid salt) as a schistosomicide for individual or mass treatement of infection with Schistosoma haematobium and S. mansoni, but due to its toxicity and concern about possible carcinogenicity, it has been replaced by other drugs such as praziquantel. |
| levistolide A | |
| 4-methylimidazole | Imidazole substituted at position 4 by a methyl group. |
| pitavastatin | |
| estragole | An olefinic compound that has formula C10H12O. |
| triptycene | |
| Vaccines | |
| tetrachlorophenol | A chlorophenol that is phenol in which four of the hydrogens attached to the benzene ring are replaced by chlorines. |
| 27-hydroxy-4-cholesten-3-one | |
| Cyclosporins | |
| carbazole | |
| 4-hydroxymidazolam | |
| schizandrol B | |
| Aminocaproic Acid | |
| 4,4'-cyclohexylidenebisphenol | |
| 2-iodobenzenamine | |
| diapocynin | |
| prinomastat | |
| betadex | |
| Linagliptin | |
| technetium 99m (HYNIC-3PRGD(2))(tricine)(TPPTS) | |
| S 2238 | |
| carbetapentane | |
| prostaglandin A1 | A prostaglandins A that has formula C20H32O4. |
| apicidin | |
| dong quai | |
| pinitol | A cyclitol ether formed by etherification of the 3-hydroxy group of chiro-inositol. It is plant metabolite isolated from the leaves of Sutherlandia frutescens. |
| cobalt(II) acetate | |
| alpha-methyldopamine | |
| 2,2',4,4'-tetrabromodiphenyl ether | An organobromine compound that has formula C12H6Br4O. |
| Phenformin | |
| titanium nitride | |
| Benzoates | A monocarboxylic acid anion obtained by deprotonation of the carboxy group of any benzoic acid. |
| 6,7-dihydro-1,1,2,3,3-pentamethyl-4-(5H)indanone | |
| ginsenoside Rg2 | A ginsenoside found in Panax species that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions, in which the hydroxy group at position 6 has been converted to the corresponding alpha-L-rhamnopyranosyl-(1->2)-beta-D-glucopyranoside, and in which a double bond has been introduced at the 24-25 position. |
| octachlorostyrene | An organochlorine compound that has formula C8Cl8. |
| Reactive Nitrogen Species | A family of nitrogen molecular entities which are highly reactive and derived from nitric oxide (.NO) and superoxide (O2.(-)) produced via the enzymatic activity of inducible nitric oxide synthase 2 (NOS2) and NADPH oxidase respectively. |
| Catechin | |
| EGFR tyrosine kinase inhibitor 324674 | |
| fenproporex | |
| ethylcholine aziridinium | |
| 4-phenyl-2-propionamidotetraline | |
| trabectedin | A tetrahydroisoquinoline alkaloid obtained from a Caribbean tunicate Ecteinascidia turbinata. Used for the treatment of soft tissue sarcoma and relapsed ovarian cancer. |
| Domperidone | |
| benzene oxide | |
| Calcium, Dietary | |
| beta-glycerophosphoric acid | |
| ioxitalamic acid | |
| Aromatase Inhibitors | An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| Aclarubicin | |
| copper bis(3,5-diisopropylsalicylate) | |
| 4-aminobenzhydrazide | |
| Halothane | A haloalkane comprising ethane having three flouro substituents at the 1-position as well as bromo- and chloro substituents at the 2-position. |
| ethoprophos | An organothiophosphate insecticide that has formula C8H19O2PS2. |
| 2-methoxy-4-aminoazobenzene | |
| Pantothenic Acid | A member of the class of pantothenic acids that is an amide formed from pantoic acid and beta-alanine. |
| decane | A straight-chain alkane with 10 carbon atoms. |
| tryptamine | An aminoalkylindole consisting of indole having a 2-aminoethyl group at the 3-position. |
| mecobalamin | |
| Saccharin | A 1,2-benzisothiazole having a keto-group at the 3-position and two oxo substituents at the 1-position. It is used as an artificial sweetening agent. |
| Zimeldine | |
| resolvin D1 | A very long-chain fatty acid that has formula C22H32O5. |
| resolvin D2 | A very long-chain fatty acid that has formula C22H32O5. |
| bafilomycin A | |
| Fenthion | An organic thiophosphate that is O,O-dimethyl hydrogen phosphorothioate in which the hydrogen atom of the hydroxy group is replaced by a 3-methyl-4-(methylsulfanyl)phenyl group. It exhibits acaricidal and insecticidal activities. |
| Propantheline | |
| 1,3,7,8-tetrachlorodibenzo-4-dioxin | |
| Gold Sodium Thiomalate | |
| Benzopyrans | |
| coralyne | |
| 3,4-di-O-caffeoylquinic acid | |
| 12-ketoendrin | |
| Sulfides | |
| 3-(2-ethylphenoxy)-1-(1,2,3,4-tetrahydronaphth-1-ylamino)-2-propanol oxalate | |
| Anti-Retroviral Agents | |
| 1,3-dichlorobenzene | A dichlorobenzene carrying chloro substituents at positions 1 and 3. |
| madecassoside | A triterpenoid saponin that is a trisaccharide derivative of madecassic acid. Isolated from Centella asiatica, it exhibits anti-inflammatory, antioxidant and antirheumatic activities. |
| Biopterin | A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins. |
| cinnamyl-3,4-dihydroxycyanocinnamate | |
| FdUMP(10) | |
| Desoxycorticosterone Acetate | |
| 4-methylcyclohexyl-1,6-dicarboxylic acid anhydride | |
| tryptamine-4,5-dione | |
| wogonin | A dihydroxy- and monomethoxy-flavone in which the hydroxy groups are positioned at C-5 and C-7 and the methoxy group is at C-8. |
| Dynorphins | |
| Mitomycin | |
| Propylene Glycol | |
| timosaponin AIII | A triterpenoid that has formula C39H64O13. |
| 1-hydroxy-3-amino-2-pyrrolidone | |
| NS 004 | |
| Mestranol | |
| isoimperatorin | A member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 5. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. |
| 1-(4-chlorobenzoyl)-5-methoxy-2-1H-indole-3-acetic acid 3-(nitrooxymethyl)phenyl ester | |
| 667 coumate | |
| quercetin 3-arabinopyranoside | |
| 5H-benzo(4,5)cyclohepta(1,2-b)pyridin-5-one | |
| 9,10-Dimethyl-1,2-benzanthracene | |
| Pyridazines | |
| clorophene | |
| farnesal | A farnesane sesquiterpenoid that has formula C15H24O. |
| tetrabutylammonium | A quaternary ammonium ion that has formula C16H36N. |
| 4-hydroxyphenylacetone | |
| tris(4-methyl-1-pyrazolyl)borohydride | |
| methylbenzethonium | |
| isopropyl thioxanthone | |
| NSC 303530 | |
| cylindrospermopsin | |
| p-Chloromercuribenzoic Acid | A mercuribenzoic acid that has formula C7H5ClHgO2. |
| arctiin | A lignan that has formula C27H34O11. |
| stannous chloride | |
| myricitrin | A glycosyloxyflavone that consists of myricetin attached to a alpha-L-rhamnopyranosyl residue at position 3 via a glycosidic linkage. Isolated from Myrica cerifera, it exhibits anti-allergic activity. |
| 2-((2,6-dichlorophenyl)amino)benzeneacetic acid 4-(3H-1,2-dithiol-3-thione-5-yl)phenyl ester | |
| LHRH, Leu(6)-des-Et-GlyNH2(10)- | |
| cyclohexanecarboxylic acid (3-(2,5-dimethylbenzyloxy)-4-(methanesulfonylmethylamino)phenyl)amide | |
| Uridine Diphosphate Glucuronic Acid | |
| technetium Tc 99m mebrofenin | |
| tenidap | A thiophene that has formula C14H9ClN2O3S. |
| Tolazoline | |
| L 689065 | |
| surfactin peptide | |
| neurotensin NT79 | |
| manganese(III) acetate dihydrate | |
| Fibric Acids | |
| SN50 peptide | |
| geraniol | A monoterpenoid consisting of two prenyl units linked head-to-tail and functionalised with a hydroxy group at its tail end. |
| Angiotensin II | |
| Creatinine | |
| N-(2-aminoethyl)-4-(5-(4-tolyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide | |
| 1-aminobenzotriazole | |
| dronedarone | |
| zomepirac glucuronide | |
| vitamin K1 oxide | |
| adapalene | An adamantane that has formula C28H28O3. |
| butenafine | |
| methylcholine | |
| 16 alpha,17-epoxyprogesterone | |
| 5-methoxypsoralen | |
| 11-keto-boswellic acid | |
| ethyl pyruvate | |
| 12-hydroxy-5,8,10-heptadecatrienoic acid | |
| Ryanodine | An insecticide alkaloid isolated from South American plant Ryania speciosa. |
| dragon's blood | |
| fraxinellone | |
| buthionine sulfoximine ethyl ester | |
| 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine | A tetrahydropyridine that is 1,2,3,6-tetrahydropyridine substituted by a methyl group at position 1 and a phenyl group at position 4. |
| cloflucarban | |
| Norfloxacin | A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
| Proanthocyanidins | A flavonoid oligomer obtained by the the condensation of two or more units of hydroxyflavans. |
| 3-(2-(4-(3-chloro-2-methylphenyl)1-piperazinyl)ethyl)5,6-dimethoxy-1-(4-imidazolylmethyl)-1H-indazol dihydrochloride 3.5 hydrate | |
| anethole | |
| 1,24,25-trihydroxyvitamin D3 | |
| NPC 15437 | |
| 4-methylthioamphetamine | |
| Chlorisondamine | |
| NF157 compound | |
| 4-amidino-2-nitrophenyl 4'-anisate | |
| Benzoxazines | |
| Daunorubicin | A natural product found in Actinomadura roseola. |
| 4-oxoretinol | |
| isocaproaldehyde | |
| crystal violet lactone | |
| 5-chlorouracil | An organochlorine compound consisting of uracil having an chloro substituent at the 5-position. |
| Glycodeoxycholic Acid | A bile acid glycine conjugate of deoxycholic acid. |
| carfentanil | |
| idoxifene | |
| Fenfluramine | |
| geranylgeranylacetone | |
| Glycochenodeoxycholic Acid | A bile acid glycine conjugate having 3alpha,7alpha-dihydroxy-5beta-cholan-24-oyl as the bile acid component. |
| N-nitrosodiethanolamine | A nitroso compound that has formula C4H10N2O3. |
| Morpholines | Any compound containing morpholine as part of its structure. |
| Ouabain | |
| Paraquat | An organic cation that consists of 4,4'-bipyridine bearing two N-methyl substituents loctated at the 1- and 1'-positions. |
| Sodium Chloride | An inorganic chloride salt having sodium(1+) as the counterion. |
| cholestane-3,5,6-triol | |
| enterotoxin F, Staphylococcal | |
| N-(3-(4-chlorophenyl)-2-(3-cyanophenyl)-1-methylpropyl)-2-methyl-2-((5-(trifluoromethyl)pyridin-2-yl)oxy)propanamide | |
| Praziquantel | A pyrazinoisoquinoline that has formula C19H24N2O2. |
| Tolperisone | |
| selenaproline | |
| ammonium metavanadate | |
| Clotrimazole | A member of the class of imidazoles that is 1H-imidazole in which the hydrogen attached to a nitrogen is replaced by a monochlorotrityl group. |
| 1-chloro-4-(2,2-dichloro-1-(4-chlorophenyl)ethenyl)-3-(methylsulfonyl)benzene | |
| hexyl cinnamic aldehyde | |
| lauroyl-coenzyme A | |
| diethyl phthalate | |
| Dithioerythritol | The meso-diastereomer of 1,4-dimercaptobutane-2,3-diol; a sulfur-containing sugar derived from the monosaccharide erythrose; and an epimer of dithiothreitol. |
| liensinine | |
| dehydroeburicoic acid | A bile acid that has formula C31H48O3. |
| moxestrol | A 3-hydroxy steroid that has formula C21H26O3. |
| rofecoxib | |
| acetyl tert-butyl dimethylindan | |
| 5-dihydrodeoxycorticosterone | |
| 4,17 beta-dihydroxy-4-androstene-3-one | |
| 1-methylbenz(a)anthracene | |
| Oviol | |
| DAA 1097 | |
| Ethylenebis(dithiocarbamates) | |
| Prostaglandin D2 | A member of the class of prostaglandins D that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9 and 15 and an oxo group at position 11 (the 5Z,9alpha,13E,15S- stereoisomer). |
| fructus schizandrae, radix ginseng, radix ophiopogonis drug combination | |
| N-acetylpropargylglycine | |
| N-(2,4-di-tert-butyl-5-hydroxyphenyl)-4-oxo-1,4-dihydroquinoline-3-carboxamide | |
| Acrylamides | An enamide which is acrylamide or a derivative of acrylamide obtained by replacement of one or more of its hydrogens. |
| nitroflurbiprofen | A carboxylic ester obtained by formal condensation of the carboxy group of flurbiprofen with the free hydroxy group of 4-(nitrooxy)butanol. It is a non-steroidal anti-inflammatory agent showing inhibitory effects against the cyclooxygenases COX1 and COX2. |
| Toximul MP8 | |
| idraparinux | |
| 5-methoxyindoleacetic acid | |
| 4-tosylcyclonovobiocic acid | |
| Ribomunyl | |
| deoxynivalenol-3-glucuronide | |
| plumbagin | A naphthoquinone that is 1,4-naphthoquinone in which the hydrogens at positions 2 and 5 are substituted by methyl and hydroxy groups, respectively. |
| mono-n-octyl phthalate | |
| 2'-(4-fluorophenyl)-21-fluoro-20-oxo-11beta,17alpha-dihydroxy-pregn-4-eno(3,2-c)pyrazole | |
| 7-hydroxystaurosporine | |
| 1-hydroxy-2-naphthoic acid | A 2-naphthoic acid carrying a hydroxy substituent at the 1-position. It is a xenobiotic metabolite produced by the biodegradation of phenanthrene by microorganisms. |
| BAY 60-6583 | |
| BGP 15 | |
| oxodiperoxo(pyridine-2-carboxylate)vanadate(V) | |
| Ruthenium Red | A ruthenium coordination entity that has formula H42N14O2Ru3.6Cl. |
| propachlor | An anilide that consists of 2-chloroacetanilide bearing an N-isopropyl substituent. |
| Clindamycin | A carbohydrate-containing antibiotic that is the semisynthetic derivative of lincomycin, a natural antibiotic. |
| Vitamin K 3 | |
| Vitamin K 1 | |
| hydroxycamptothecinum | |
| N-(3,5-bis(trifluoromethyl)phenyl)-5-chloro-2-hydroxybenzamide | |
| PAR-1-activating peptide | |
| fluazifop-butyl | An aromatic ether that has formula C19H20F3NO4. |
| Pinacidil | |
| W 7 | |
| Sumatriptan | A sulfonamide that consists of N,N-dimethyltryptamine bearing an additional (N-methylsulfamoyl)methyl substituent at position 5. Selective agonist for a vascular 5-HT1 receptor subtype (probably a member of the 5-HT1D family). |
| 4-(4'-chlorobenzyloxy)benzyl nicotinate | |
| Fluocinonide | |
| nalmefene | |
| Indapamide | |
| swinholide A | |
| Alizarin Red S | |
| Tyramine | |
| LE-Cl2MDP | |
| 4-nitrophenyloctanoate | |
| bufuralol | A benzofuran that has formula C16H23NO2. |
| HhAntag691 | |
| LE 540 | |
| picropodophyllin | |
| deoxyelephantopin | A sesquiterpenoid that has formula C19H20O6. |
| 2'-cyano-2'-deoxyarabinofuranosylcytosine | |
| menatetrenone | |
| dichlozolinate | |
| triethylenediamine | |
| A 771726 | |
| deoxynivalenol-15-glucuronide | |
| stearic acid | A C18 straight-chain saturated fatty acid component of many animal and vegetable lipids. As well as in the diet, it is used in hardening soaps, softening plastics and in making cosmetics, candles and plastics. |
| diphenylacetic acid | A monocarboxylic acid that is acetic acid where the methyl hydrogens have been replaced by two phenyl groups respectively. |
| arsenic disulfide | |
| Merbromin | |
| Betamethasone | A glucocorticoid that has formula C22H29FO5. |
| etiracetam | |
| Carnitine | |
| Chalcone | A member of the class of chalcones that is acetophenone in which one of the methyl hydrogens has been replaced by a benzylidene group. |
| ST 679 | |
| 4-vinylcyclohexene | A cyclic olefin that has formula C8H12. |
| eumelanin | |
| linoleoyl-coenzyme A | |
| SC 41930 | |
| brilliant green | |
| Enkephalins | |
| Soil Pollutants | |
| 1-UFT protocol | |
| Dihematoporphyrin Ether | |
| salmeterol | |
| J 113397 | |
| robinin | A flavonoid that has formula C33H40O19. |
| 3-(3-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)acrylamide | |
| tulobuterol | |
| retinylamine | |
| Methyldimethylaminoazobenzene | |
| 2,3-bis(3'-hydroxybenzyl)butane-1,4-diol | |
| ICI 192605 | |
| naringenin-7-O-glucoside | |
| acetochlor | A monocarboxylic acid amide that is N-phenylacetamide carrying an ethyl and a methyl group at positions 2 and 6 respectively on the benzene ring while one of the methyl hydrogens as well as the hydrogen attached to the nitrogen atom have been replaced by a chloro and an ethoxymethyl group respectively. |
| nilvadipine | |
| Triazines | Compounds based on a triazine skeleton. |
| N-substituted Glycines | |
| phenylalanyl-prolyl-arginine methyl chloride | |
| N(6),N(6)-dimethyladenine | Adenine substituted at N-6 by geminal methyl groups. |
| Thiadiazoles | |
| 6-ethylchenodeoxycholic acid | A cholanoid that has formula C26H44O4. |
| 25-methoxyldammarane-3,12,20-triol | |
| Cysteinyldopa | A catecholamine that has formula C12H16N2O6S. |
| fluridone | A phenylpyridine that has formula C19H14F3NO. |
| phenanthrene | A polycyclic aromatic hydrocarbon composed of three fused benzene rings which takes its name from the two terms 'phenyl' and 'anthracene.' |
| anacardic acid | A hydroxybenzoic acid that has formula C22H36O3. |
| guanylin | |
| dihydroxy-vitamin D3 | |
| Semustine | An organochlorine compound that is urea in which the two hydrogens on one of the amino groups are replaced by nitroso and 2-chloroethyl groups and one hydrogen from the other amino group is replaced by a 4-methylcyclohexyl group. |
| Tetrachlorvinphos | An alkenyl phosphate that has formula C10H9Cl4O4P. |
| Methimazole | A member of the class of imidazoles that it imidazole-2-thione in which a methyl group replaces the hydrogen which is attached to a nitrogen. |
| 2',3'-dideoxycytidine 5'-triphosphate | |
| ethyl 6-(N-(2-chloro-4-fluorophenyl)sulfamoyl)cyclohex-1-ene-1-carboxylate | |
| mercuric oxide | |
| Dehydroepiandrosterone Sulfate | A steroid sulfate that is the 3-sulfate of dehydroepiandrosterone. |
| ONO-LB 457 | |
| aripiprazole | A quinolone that has formula C23H27Cl2N3O2. |
| Melatonin | A member of the class of acetamides that is acetamide in which one of the hydrogens attached to the nitrogen atom is replaced by a 2-(5-methoxy-1H-indol-3-yl)ethyl group. It is a hormone secreted by the pineal gland in humans. |
| malaoxon | A dicarboxylic acid that has formula C10H19O7PS. |
| Cromolyn Sodium | |
| Phycocyanin | |
| 8-prenylnaringenin | |
| Chromium Alloys | |
| 1-(5-fluoropentyl)-3-(1-naphthoyl)indole | |
| decan-4-olide | |
| 4,4'-(carbonylbis(imino-3,1-phenylenecarbonylimino-3,1-(4-methylphenylene)carbonylimino))bis(1,3-xylene-alpha,alpha'-diphosphonic acid) | |
| Oxazolone | |
| atorvastatin | A dihydroxy monocarboxylic acid that is a member of the drug class known as statins, used primarily for lowering blood cholesterol and for preventing cardiovascular diseases. |
| Metyrapone | |
| pyridoxal phosphate gamma-aminobutyric acid | |
| benserazide, levodopa drug combination | |
| desmethylmisonidazole | |
| zearalenol | |
| (3-(4-(bis(2-chloroethyl)amino)phenyl)-3-propyl)carbamic acid 2-(6-(17-hydroxy-13-methyl-3-oxo-2,3,6,7,8,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta(a)phenanthren-11-yl)hexylamino)ethyl ester | |
| 8-(4-sulfophenyl)theophylline | |
| satraplatin | |
| bensulide | A benzene that has formula C14H24NO4PS3. |
| Pregnanolone | |
| arsenic trisulfide | |
| Ketoprofen | An oxo monocarboxylic acid that consists of propionic acid substituted by a 3-benzoylphenyl group at position 2. |
| Ethylmaleimide | |
| protocatechuic acid | |
| cyanopindolol | |
| Octoxynol | |
| Succinates | |
| Polyamines | |
| Histone Deacetylase Inhibitors | An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| propyleneimine | An aziridine that has formula C3H7N. |
| methylarsine oxide | |
| pyridoxal phosphate-6-azophenyl-2',4'-disulfonic acid | An azo compound that has formula C14H14N3O12PS2. |
| Idoxuridine | |
| prostaglandin G2 | A prostaglandins G that has formula C20H32O6. |
| Azathioprine | A thiopurine that is 6-mercaptopurine in which the mercapto hydrogen is replaced by a 1-methyl-4-nitroimidazol-5-yl group. It is a prodrug for mercaptopurine and is used as an immunosuppressant, prescribed for the treatment of inflammatory conditions and after organ transplantation and also for treatment of Crohn's didease and MS. |
| Metaproterenol | A phenylethanolamine that has formula C11H17NO3. |
| bergamottin | A furanocoumarin that has formula C21H22O4. |
| indenestrol | |
| 2,5-di-(2-phenethyl)pyrrolidine | |
| N(6)-methyl-2'-deoxyadenosine 3',5'-diphosphate | |
| single bond | |
| FR 167653 | |
| malonic acid | An alpha,omega-dicarboxylic acid in which the two carboxy groups are separated by a single methylene group. |
| 4-(isopropylamino)-2-(2-pyridyl)-2-phenylbutyramide | |
| Glucosides | |
| Coumaphos | An organothiophosphate insecticide that has formula C14H16ClO5PS. |
| methylphosphonic difluoride | |
| indomethacin phenethylamide | |
| chlorobenzilate | A diarylmethane that has formula C16H14Cl2O3. |
| CPS 49 | |
| chloroquine diphosphate | |
| Propofol | A phenol resulting from the formal substitution of the hydrogen at the 2 position of 1,3-diisopropylbenzene by a hydroxy group. |
| N-methyl-1-(1,3-benzodioxol-5-yl)-2-butanamine | |
| avobenzone | |
| Terfenadine | |
| ginsenoside 20S-protopanaxatriol | |
| obacunone | A limonoid that has formula C26H30O7. |
| trans-1,2-dihydro-1,2-naphthalenediol | |
| 4,5,7a,8,9,10,11,11a-octohydro-7H-10-methylindolol(1,7bc)(2,6)-napthyridine | |
| 4-(2-aminoethyl)benzenesulfonylfluoride | |
| acenaphthene-1-ol | |
| Ofloxacin | An oxazinoquinolone carrying carboxy, fluoro, methyl and 4-methylpiperazino substituents. A synthetic fluoroquinolone antibacterial agent, it inhibits the supercoiling activity of bacterial DNA gyrase, halting DNA replication. |
| 2',3-dimethyl-4-aminobiphenyl | |
| pelargonic acid | |
| 2,2',3,4,4',5',6-heptabromodiphenyl ether | An organobromine compound that has formula C12H3Br7O. |
| Chondroitin Sulfate Proteoglycans | |
| tetrabromobisphenol A-bisallylether | |
| spiruchostatin A | |
| spiruchostatin B | |
| ezetimibe | A beta-lactam that is azetidin-2-one which is substituted at 1, 3, and 4 by p-fluorophenyl, 3-(p-fluorophenyl)-3-hydroxypropyl, and 4-hydroxyphenyl groups, respectively (the 3R,3'S,4S enantiomer). |
| benzo(a)pyrene diolepoxide I | An epoxide that has formula C20H14O3. |
| peroxyvanadate | |
| tri-(2-chloroisopropyl)phosphate | |
| TH 302 | |
| 3-methoxycatechol | |
| Air Pollutants, Occupational | |
| Benzoyl Peroxide | |
| Thioguanine | |
| Cefmetazole | |
| androstane-3,17-diol dipropionate | A steroid ester that has formula C25H40O4. |
| NS 1652 | |
| 2,4,5-trichlorophenol | A trichlorophenol carrying chloro groups at positions 2, 4 and 5. |
| Phosphatidylinositol 4,5-Diphosphate | |
| 7-chlorokynurenic acid | A quinolinemonocarboxylic acid that is quinaldic acid which is substituted by a hydroxy group at position 4 and by a chlorine at position 7. It is a potent NMDA glutamate receptor antagonist which antagonizes the strychnine-insensitive glycine site of the NMDA receptor. It also prevents neurodegeneration produced by quinolinic acid. |
| 5,6-dimethoxy-3-methyl-N-phenyl-N-(3-(piperidin-1-yl)propyl)benzofuran-2-carboxamide | |
| 3-methylchrysene | A carbopolycyclic compound that has formula C19H14. |
| TG 003 | |
| caffeoylquinic acid | |
| n-hexadecane | |
| Lovastatin | A fatty acid ester that is mevastatin carrying an additional methyl group on the carbobicyclic skeleton. It is used in as a antilipemic drug and has been found in fungal species such as Aspergillus terreus and Pleurotus ostreatus (oyster mushroom). |
| oleoyl-coenzyme A | |
| alpha helical corticotropin-releasing hormone | |
| LDN 193189 | |
| tesmilifene | |
| chromium oxide | |
| Dithionitrobenzoic Acid | |
| Cholesterol, HDL | |
| remifentanil | A piperidinecarboxylate ester that is methyl piperidine-4-carboxylate in which the hydrogen attached to the nitrogen is substituted by a 3-methoxy-3-oxopropyl group and the hydrogen at position 4 is substituted the nitrogen of N-propanoylaniline. |
| gatifloxacin | |
| 2-((((2-chloroethyl)nitrosoamino)carbonyl)amino)propanamide | |
| 3-phenoxybenzoic acid | A phenoxybenzoic acid in which the phenoxy group is meta to the carboxy group. It is a metabolite of pyrethroid insecticides. |
| ferrous chloride | |
| 3-phenylpropanol-1 | |
| 4-Aminobenzoic Acid | An aminobenzoic acid in which the amino substituent is at position 4 of the benzoic acid. |
| ferulinolol | |
| N-((5-((2-amino-4-oxo-4,7-dihydro-3H-pyrrolo(2,3-d)pyrimidin-6-yl)propyl)thiophen-2-yl)carbonyl)glutamic acid | |
| triclocarban | A member of the class of ureas that is urea substituted by a 4-chlorophenyl and a 3,4-dichlorophenyl group at positions 1 and 3 respectively. |
| SK&F 77434 | |
| RU 58668 | |
| carboprostacyclin | |
| (4-(m-Chlorophenylcarbamoyloxy)-2-butynyl)trimethylammonium Chloride | |
| Aldrin | An organochlorine compound resulting from the Diels-Alder reaction of hexachlorocyclopentadiene with norbornadiene. It was widely used as an insecticide before being banned in the 1970s as a persistent organic pollutant. |
| cysteinyl-leukotriene | |
| 1,4-dihydroxyanthraquinone | |
| coumaran | |
| Thrombin | Thrombin is a trypsin-like serine protease protein that in humans is encoded by the F2 gene.[2][3] Prothrombin (coagulation factor II) is proteolytically cleaved to form thrombin in the coagulation cascade, which ultimately results in the stemming of blood loss. Thrombin in turn acts as a serine protease that converts soluble fibrinogen into insoluble strands of fibrin, as well as catalyzing many other coagulation-related reactions. |
| purmorphamine | Purine substituted at C-2 by a 1-naphthyloxy group, at C-4 by a 4-morpholinophenylamino group, and at N-9 by a cyclohexyl group. |
| CRA1000 | |
| ottelione A | |
| Yohimbine | An indole alkaloid with alpha2-adrenoceptor antagonist activity. It is produced by Corynanthe johimbe and Rauwolfia serpentina. |
| 4,5-Dihydro-1-(3-(trifluoromethyl)phenyl)-1H-pyrazol-3-amine | |
| Itraconazole | A dioxolane that has formula C35H38Cl2N8O4. |
| Hexoses | |
| 1,2,3,4,7,8-hexachlorodibenzofuran | A chlorin that has formula C12H2Cl6O. |
| Quartz | |
| tebuconazole | A racemate composed of equimolar amounts of (R)- and (S)-tebuconazole. A fungicide effective against various smut and bunt diseases in cereals and other field crops. |
| Amides | An amide is a derivative of an oxoacid RkE(=O)l(OH)m (l =/= 0) in which an acidic hydroxy group has been replaced by an amino or substituted amino group. |
| sorbinil | An azaspiro compound having a monofluoro-substituted chromane skeleton spiro-linked to an imidazolidinedione ring. |
| tesaglitazar | |
| MitoTEMPO | |
| risedronic acid | A pyridine that has formula C7H11NO7P2. |
| 3-xylene | |
| 7-hydroxyellipticine | |
| 4-tert-butylcyclohexanol | |
| BIM 23206 | |
| KNK 437 | |
| HS 1183 | |
| propionylthiocholine | |
| N-(4-(3-chloro-4-fluorophenylamino)quinazolin-6-yl)acrylamide | |
| vasotocin, (beta-mercapto-beta,beta-cyclopentamethylenepropionic acid)-O-methyl-Tyr(2)-Thr(4)-Orn(8)-Tyr(9)-NH2 | |
| Maharishi Amrit Kalash | |
| Acitretin | |
| FK 409 | |
| physostigmine heptyl | |
| Aminosalicylic Acids | |
| Sodium Fluoride | A metal fluoride salt with a Na(+) counterion. |
| SR 140333 | |
| LDN 57444 | |
| Pentetic Acid | A pentacarboxylic acid that has formula C14H23N3O10. |
| mecoprop | A racemate comprising equimolar amounts of (R)- and (S)-mecoprop. |
| propazine | A diamino-1,3,5-triazine that is N,N'-di(propan-2-yl)-1,3,5-triazine-2,4-diamine substituted by a chloro group at position 6. |
| icaritin | |
| Butadienes | |
| ankaflavin | |
| methyl 6,7-dimethoxy-4-ethyl-beta-carboline-3-carboxylate | |
| Triprolidine | |
| hyperforin | A sesquarterpenoid that has formula C35H52O4. |
| ferrous oxide | |
| 4-fluorochalcone oxide | |
| chrysene,2-diol-3,4-epoxide-1 | |
| 2-methylquinoline | |
| 4-amino-2-hydroxytoluene | |
| staurosporine aglycone | |
| oxibendazole | |
| digoxin-like factors | |
| 8,9-dichloro-2,3,4,4a-tetrahydro-1H-pyrazino(1,2-a)quinoxalin-5(6H)-one | |
| OSW 1 | |
| Betahistine | |
| quercetin 3-O-beta-(2''-galloyl)-rhamnopyranoside | |
| bolinaquinone | |
| ethyl salicylate | |
| tylophorine | An organic heteropentacyclic compound that has formula C24H27NO4. |
| 2-(4-acetoxyphenyl)-2-chloro-N-methylethylamine | |
| oleoylethanolamide | An N-(long-chain-acyl)ethanolamine that is the ethanolamide of oleic acid. The monounsaturated analogue of the endocannabinoid anandamide |
| chromium nicotinic acid complex | |
| 1,2,3,7,8-pentachlorodibenzo-p-dioxin | A dibenzodioxine that has formula C12H3Cl5O2. |
| 2-Acetylaminofluorene | |
| 2-(2-cresyl)-4H-1-3-2-benzodioxaphosphorin-2-oxide | |
| thamira parpam | |
| Indolinone A | |
| Lactulose | A synthetic galactosylfructose disaccharide used in the treatment of constipation and hepatic encephalopathy. |
| phthalimide | A dicarboximide that is 2,3-dihydro-1H-isoindole substituted by oxo groups at positions 1 and 3. |
| 7-amino-4-chloromethylcoumarin | |
| MCS-18 | |
| 8-azidoadenosine 5'-triphosphate | |
| isotocin | |
| carvacrol | A phenol that is a natural monoterpene derivative of cymene. An inhibitor of bacterial growth, it is used as a food additive. Potent activator of the human ion channels transient receptor potential V3 (TRPV3) and A1 (TRPA1). |
| tetraconazole | A racemate comprising equal amounts of (R)- and (S)-tetraconazole. A fungicide used to control a range of fungal infections including powdery mildew, rusts, bunt, loose smut and scab. |
| 7-hydroxy-2-N,N-dipropylaminotetralin | |
| 1,3-dihydroxy-4,4,5,5-tetramethyl-2-(4-carboxyphenyl)tetrahydroimidazole | |
| vorozole | |
| nitecapone | |
| Melitten | |
| Bezafibrate | |
| amarogentin | A secoiridoid glycoside that consists of (4aS,5R,6R)-5-ethenyl-6-hydroxy-4,4a,5,6-tetrahydro-1H,3H-pyrano[3,4-c]pyran-1-one having a 2-O-[(3,3',5-trihydroxybiphenyl-2-yl)carbonyl]-beta-D-glucopyranosyl group attached at position 6 via a glycosidic linkage. |
| 2-chloro-N(6)cyclopentyladenosine | |
| isorhamnetin 3-O-glucoside | |
| erythritol anhydride | |
| sodium thiocyanate | An organic sodium salt which is the monosodium salt of thiocyanic acid. |
| palomid 529 | |
| 2-methyl-c-5-(4-(5-methyl-2-(4-methylphenyl)-4-oxazolyl)butyl)-1,3-dioxane-r-2-carboxylic acid | |
| INCB018424 | |
| nickel acetate | |
| Carcinogens | A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| sevelamer | |
| Vecuronium Bromide | The organic bromide salt of a 5alpha-androstane compound having 3alpha-acetoxy-, 17beta-acetoxy-, 2beta-piperidinino- and 16beta-N-methylpiperidinium substituents. |
| Peptides | Amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another with formal loss of water. The term is usually applied to structures formed from alpha-amino acids, but it includes those derived from any amino carboxylic acid. X = OH, OR, NH2, NHR, etc. |
| Glu-P-2 | An imidazopyridine that has formula C10H8N4. |
| 2,5-dimethyl-1,4-benzoquinonediamine | |
| cetilistat | |
| flavanone | The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
| Spider Venoms | |
| Amino Acids, Peptides, and Proteins | |
| isoangustone A | |
| 5-chloro-2-methyl-4-isothiazolin-3-one | |
| GW 4869 | |
| atomoxetine | A secondary amino compound having methyl and 3-(2-methylphenoxy)-3-phenylpropan-1-yl substituents. |
| Digitonin | A spirostanyl glycoside that has formula C56H92O29. |
| BGC945 | |
| acetylleucyl-leucyl-norleucinal | A tripeptide composed of N-acetylleucyl, leucyl and norleucinyl residues joined in sequence. |
| pasireotide | |
| 2-methoxy-1,4-naphthoquinone | A naphthoquinone that is naphthalene-1,4-dione substituted by a methoxy group at position 2. It has been isolated from the roots of Rubia yunnanensis. |
| Biofuels | |
| dimethoxy-4-indophenyl-2-aminopropane | |
| Isothiocyanates | An organosulfur compound with the general formula R-N=C=S. |
| Homocysteine | A sulfur-containing amino acid consisting of a glycine core with a 2-mercaptoethyl side-chain. |
| PAK 104P | |
| Vinblastine | |
| OSU 03012 | |
| dichloro(4-cymene)ruthenium(II) | |
| hibifolin | |
| Neopterin | A member of the neopterins that has formula C9H11N5O4. |
| caffeic acid | A hydroxycinnamic acid that is cinnamic acid in which the phenyl ring is substituted by hydroxy groups at positions 3 and 4. It exists in cis and trans forms; the latter is the more common. |
| Oseltamivir | |
| benzo(b)fluorene | A fluorene that has formula C17H12. |
| Rhodium | A cobalt group element atom that has formula Rh. |
| methylbromfenvinphos | |
| Fluorouracil | |
| Mibefradil | |
| 2-aminothiophenol | |
| 20-hydroxy-5,8,11,14-eicosatetraenoic acid | |
| MEN 11270 | |
| decabromobiphenyl ether | |
| Monomethylhydrazine | |
| 2-cyano-3,12-dioxooleana-1,9(11)-dien-28-oic acid methyl amide | |
| 2-pentenal | An enal consisting of pent-2-ene having an oxo group at the 1-position |
| Interleukin 1 Receptor Antagonist Protein | |
| guanosine 5'-O-(2-thiodiphosphate) | |
| GC 1 compound | |
| OSU-HDAC42 compound | |
| diethyl-1,3,6,8-tetrahydro-1,3,6,8-tetraoxobenzo(lmn)(3,8)phenanthroline-2,7-diacetate | |
| aflatoxin B1-2,3-oxide | |
| 1-(4-hydroxyiminomethylpyridinium)-3-(carbamoylpyridinium) propane dibromide | |
| 5-(dimethylamino)-N-(3,4-dimethyl-5-isoxazolyl)-1-naphthalenesulfonamide | |
| Cetirizine | A member of the class of piperazines that is piperazine in which the hydrogens attached to nitrogen are replaced by a (4-chlorophenyl)(phenyl)methyl and a 2-(carboxymethoxy)ethyl group respectively. |
| HX 630 | |
| lead chromate | |
| Adrenocorticotropic Hormone | |
| cytosterone | |
| FSL-1 lipoprotein, synthetic | |
| Norfenfluramine | |
| Oxamic Acid | The monoamide of oxalic acid. |
| ethyl 4-nitrophenyl methylphosphonate | |
| Ethylenethiourea | An imidazolidine that has formula C3H6N2S. |
| 3-methylsulfonyl-4-piperidinobenzoyl guanidine | |
| 8-hydroxy-2-(N-n-propyl-N-(3'-iodo-2'-propenyl)amino)tetralin | |
| thiodicarb | An organic sulfide that has formula C10H18N4O4S3. |
| 1,5-bis(2,3-dimethoxyphenyl)penta-1,4-dien-3-one | |
| 2,3,7,8-tetrabromodibenzo-4-dioxin | |
| eniporide | |
| Carbamazepine | A dibenzoazepine that is 5H-dibenzo[b,f]azepine carrying a carbamoyl substituent at the azepine nitrogen, used as an anticonvulsant. |
| 2,3-dimethoxy-1,4-naphthoquinone | A naphthoquinone that is 1,4-naphthoquinone bearing two methoxy substituents at positions 2 and 3. Redox-cycling agent that induces intracellular superoxide anion formation and, depending on the concentration, induces cell proliferation, apoptosis or necrosis. Used to study the role of ROS in cell toxicity, apoptosis, and necrosis. |
| Diterpenes | A C20 terpene. |
| Anthralin | |
| 2-(4-((dimethylamino)methyl)benzylidene)-5,6-dimethoxy-2,3-dihydroinden-1-one | |
| 2-octyl-4H-1,3,2-benzodioxaphosphorin-2-oxide | |
| picene | An ortho-fused polycyclic arene consisting of five fused benzene rings. It is obtained during the distillation of petroleum. |
| Cholecalciferol | |
| Leuprolide | An oligopeptide comprising pyroglutamyl, histidyl, tryptophyl, seryl, tyrosyl, D-leucyl, leucyl, arginyl, and N-ethylprolinamide residues joined in sequence. It is a synthetic nonapeptide analogue of gonadotropin-releasing hormone, and is used as a subcutaneous hydrogel implant (particularly as the acetate salt) for the treatment of prostate cancer and for the suppression of gonadal sex hormone production in children with central precocious puberty. |
| 6-(N-(7-nitro-2,1,3-benzoxadiazol-4-yl)amino)hexanoyl-glucosylceramide | |
| S 18523 | |
| Paraoxon | An aryl dialkyl phosphate where both the alkyl groups are ethyl and the aryl group is 4-nitrophenyl. |
| mitemcinal | |
| Puromycin Aminonucleoside | |
| 5-butyl-6-hydroxy-10-chlorobenzo(c)quinolizinium chloride | |
| glaucocalyxin A | |
| menthofuran | |
| triethyllead | |
| Enalapril | A dicarboxylic acid monoester that is ethyl 4-phenylbutanoate in which a hydrogen alpha to the carboxy group is substituted by the amino group of L-alanyl-L-proline (S-configuration). |
| pyridafenthion | |
| SC-203048 | |
| azidopine | A benzamide that has formula C27H26F3N5O5. |
| carvedilol | A member of the class of carbazoles that is an adrenergic antagonist with non-selective beta- and alpha-1 receptor blocking properties which helps in the management of congestive heart failure. |
| Tritolyl Phosphates | |
| deacylcortivazol | |
| cyclovirobuxine D | |
| Naled | A dialkyl phosphate that has formula C4H7Br2Cl2O4P. |
| avermectin | Any of the macrolides obtained as fermentation products from the bacterium Streptomyces avermitilis and consisting of a 16-membered macrocyclic backbone that is fused both benzofuran and spiroketal functions and contains a disaccharide substituent. They have significant anthelmintic and insecticidal properties. |
| 3-(2-(pyrrolidinyl)methoxy)pyridine | |
| Dihydroxydihydrobenzopyrenes | |
| Deoxycholic Acid | A dihydroxy-5beta-cholanic acid that has formula C24H40O4. |
| dehydrocostus lactone | An organic heterotricyclic compound and guaianolide sesquiterpene lactone that is acrylic acid which is substituted at position 2 by a 4-hydroxy-3,8-bis(methylene)decahydoazulen-5-yl group and in which the hydroxy group and the carboxy group have undergone formal condensation to afford the corresponding gamma-lactone. |
| EMD 53998 | |
| Aurothioglucose | |
| N-(4-chloro-2-((1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl)phenyl)-2-hydroxybenzamide | |
| tributyrin | A triglyceride obtained by formal acylation of the three hydroxy groups of glycerol by butyric acid. |
| Suppressor Factors, Immunologic | |
| tetrandrine | An isoquinoline that has formula C38H42N2O6. |
| 1-hydroxymethylmidazolam | |
| Phycoerythrin | |
| midecamycin | |
| fumagillin | A meroterpenoid resulting from the formal condensation of the hydroxy group of fumagillol with the carboxylic acid group of (all-E)-deca-2,4,6,8-tetraenedioic acid. Originally isolated from the fungus Aspergillus fumigatus, it is used for the control of Nosema infection in honey bees. |
| Chlorpromazine | A substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropanamine moiety. |
| butylbenzyl phthalate | A 2-hydroxyisophthalic acid that has formula C19H20O4. |
| peroben | |
| Thiobarbituric Acid Reactive Substances | |
| (2-(trimethylammonium)ethyl)methanethiosulfonate | |
| prucalopride | |
| farrerol | An organic molecular entity that has formula C17H16O5. |
| Croton Oil | |
| N-(2-hydroxyethyl)retinamide | |
| Oxygen | A chalcogen that has formula O. |
| calmidazolium | An imidazolium ion that is imidazolium cation substituted by a bis(4-chlorophenyl)methyl group at position 1 and a 2-[(2,4-dichlorobenzyl)oxy]-2-(2,4-dichlorophenyl)ethyl group at position 3. It acts as an inhibitor of calmodulin, a calcium binding messenger protein. |
| telenzepine | |
| YSNSG cyclopeptide | |
| Lecithins | |
| UVI 3003 | |
| tetramethylthiourea | |
| 1-phenyl-1,2-propanedione | An alpha-diketone that consists of 1-phenylpropane bearing keto substituents at positions 1 and 2. It is found in coffee. |
| Iron | |
| Ammonium Hydroxide | |
| N-((3-(aminomethyl)phenyl)methyl)ethanimidamide | |
| iloperidone | |
| didecyldimethylammonium | |
| 3-hydroxylup-20(29)-ene-27,28-dioic acid dimethyl ester | |
| JBT-3002 | |
| 10-methoxy-2,2-dimethyl-2,6-dihydropyrano(3,2-c)quinolin-5-one | |
| serpentine (alkaloid) | |
| 10-(fluoroethoxyphosphinyl)-N-(biotinamidopentyl)decanamide | |
| fenoxycarb | A carbamate ester that is the O-ethyl carbamate of 2-(4-phenoxyphenoxy)ethylamine. |
| O(2)-(2,4-dinitrophenyl) 1-(4-(N,N-diethylcarboxamido)piperazin-1-yl)diazen-1-ium 1,2-diolate | |
| Nitroglycerin | A nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain. |
| 4-fluoro-2-(4-(4-(2-hydroxypropan-2-yl)pyrrolidin-3-ylamino)-6,7-dimethoxyquinazolin-2-yl)phenol | |
| Estranes | |
| endothall | |
| Diflunisal | An organofluorine compound comprising salicylic acid having a 2,4-difluorophenyl group at the 5-position. |
| adrenosterone | A 3-hydroxy steroid that has formula C19H24O3. |
| LY 344864 | |
| Polyurethanes | |
| isosteviol | |
| rubitecan | |
| NAD | |
| Leptophos | An organic thiophosphate that has formula C13H10BrCl2O3PS. |
| ceramide 1-phosphate | A ceramide phosphate compound having the phosphate group in the 1-position and an unspecified acyl group atached to the nitrogen atom. |
| chlorobenzene | The simplest member of the class of monochlorobenzenes, that is benzene in which a single hydrogen has been substituted by a chlorine. |
| ziyuglycoside II | |
| tyrphostin 25 | |
| Ketoconazole | A N-carbonylpiperazine that has formula C26H28Cl2N4O4. |
| benzarone | |
| neotame | A dipeptide composed of N-(3,3-dimethylbutyl)-L-aspartic acid and methyl L-phenylalanate units joined by a peptide linkage. |
| 4-chlorobenzyltetrahydroberberine | |
| fusarielin A | |
| N-(3-chloro-7-indolyl)-1,4-benzenedisulphonamide | |
| N-acetyl glycine cysteine amide | |
| Pheniramine | |
| Chloralose | A dioxolane that has formula C8H11Cl3O6. |
| orcinol | A 5-alkylresorcinol in which the alkyl group is specified as methyl. |
| Calcitriol | A hydroxycalciol that is calcidiol in which the pro-S hydrogen of calcidiol is replaced by a hydroxy group. It is the active form of vitamin D3, produced fom calciol via hydoxylation in the liver to form calcidiol, which is subsequently oxidised in the kidney to give calcitriol. |
| antalarmin | |
| Lobeline | |
| perfluorooctanoic acid | A fluoroalkanoic acid that is perfluorinated octanoic acid. |
| A 69024 | |
| ergocryptine | |
| diazoxon | An organic phosphate that is diethyl hydrogen phosphate in which the hydrogen of the hydroxy group has been replaced by a 6-methyl-2-(propan-2-yl)pyrimidin-4-yl group. It is a metabolite of the pesticide diazinon. |
| aluminum sulfate | |
| MC1568 | |
| gallium nitrate | |
| olaquindox | |
| furfuryl alcohol | A member of the class of furans bearing a hydroxymethyl substituent at the 2-position. |
| Sodium Nitrite | |
| dimethyl phthalate | A 2-hydroxyisophthalic acid that has formula C10H10O4. |
| 2,2'-azobis(2-amidinopropane) | |
| rivastigmine | |
| monascin | An organic heterotricyclic compound that is 3a,4,8,9a-tetrahydro-2H-furo[3,2-g][2]benzopyran-2,9(3H)-dione that is substituted at positions 3, 6, and 9a by hexanoyl, (1E)-prop-1-en-1-yl and methyl groups, respectively (the 3S,3aR,9aR diastereoisomer). One of the azaphilonoid pigments in extracts of Monascus pilosus-fermented rice (red-mould rice), it is a potent inhibitor of carcinogenesis measured against chemical- or UV-initiated, phorbol-promoted mouse skin tumours. |
| curdlan | |
| N-methyl-N-(6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalen-2-ylmethyl)aminomethylcarboxylic acid | |
| ramiprilat | A dipeptide that is the active metabolite of ramipril. An angiotensin-converting enzyme (ACE) inhibitor, used to treat high blood pressure and congestive heart failure. |
| calcein AM | An organooxygen compound that has formula C46H46N2O23. |
| SC 791 | |
| 3,3',5-triiodothyroacetic acid | |
| Imipenem | |
| 3-methylbenzyl alcohol | A methylbenzyl alcohol that has formula C8H10O. |
| 2,4,4',5-tetrachlorobiphenyl | |
| Trifluridine | |
| naphtho(1,2-a)pyrene | |
| Methacholine Compounds | |
| zardaverine | A pyridazinone derivative in which pyridazin-3(2H)-one is substituted at C-6 with a 4-(difluoromethoxy)-3-methoxyphenyl group. It is a phosphodiesterase inhibitor, selective for PDE3 and 4. |
| KR-31612 | |
| 4-tert-octylphenol | An alkylbenzene that has formula C14H22O. |
| Ro 24-4736 | |
| prostaglandin E3 | A prostaglandins E that has formula C20H30O5. |
| alizapride | |
| 7-hydroxyflavone | A hydroxyflavonoid that has formula C15H10O3. |
| Linseed Oil | |
| atractylenolide I | |
| Electrolytes | |
| methylene diisocyanate | |
| Clorgyline | An aromatic ether that is the 2,4-dichlorophenyl ether of 3-aminopropan-1-ol in which the nitrogen is substituted by a methyl group and a prop-1-yn-3-yl group. A monoamine oxidase inhibitor, it was formerly used as an antidepressant. |
| BMS 181101 | |
| 5-methoxyindole | |
| torcetrapib | A (trifluoromethyl)benzene that has formula C26H25F9N2O4. |
| Ly-364947 | |
| chlorofluoroacetic acid | |
| Palmitoylcarnitine | |
| Omite | |
| zinc deuteroporphyrin IX 2,4-bis(glycol) | |
| PD 81723 | |
| 5-((1,5-bis(4-methoxyphenyl)pyrazol-3-yl)dimethoxymethyl)-2-chlorobenzamide | |
| suillin | |
| Dinoprost | |
| magnolialide | |
| PF 5168899 | |
| methylhistaprodifen | |
| 7,8-benzoquinoline | |
| lipopolysaccharide, E. coli 026-B6 | |
| anhydrotetrodotoxin | |
| Megestrol | A 3-oxo Delta(4)-steroid that is pregna-4,6-diene-3,20-dione substituted by a hydroxy group at position 17. |
| lipoxin A4 | A C20 hydroxy fatty acid having (5S)-, (6R)- and (15S)-hydroxy groups as well as (7E)- (9E)-, (11Z)- and (13E)-double bonds. |
| sinigrin | An alkenylglucosinolic acid that consists of 1-thio-beta-D-glucopyranose having a 4-[(sulfooxy)imino]but-1-en-4-yl group attached to the anomeric sulfur. |
| t-butyloxycarbonyl-methionyl-leucyl-phenylalanine | |
| Perphenazine | A member of the class of phenothiazines that is phenothiazine having a chloro substituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. |
| di-n-hexyl phthalate | A 2-hydroxyisophthalic acid that has formula C20H30O4. |
| pyrimidine | The parent compound of the pyrimidines; a diazine having the two nitrogens at the 1- and 3-positions. |
| apigetrin | |
| N'-(11H-indolo(3,2-c)quinolin-6-yl)-N,N-dimethylethane-1,2-diamine | |
| 2-nitrophenyl selenocyanic acid | |
| Pentanols | |
| Ferric Compounds | |
| N'-(10H-indolo(3,2-b)quinolin-11-yl)-N,N-dimethylpropane-1,3-diamine | |
| copper protoporphyrin IX | |
| vanadium dioxide | A vanadium oxide that has formula O2V. |
| mycophenolic acid glucuronide | |
| P(1),P(5)-di(adenosine-5'-)pentaphosphate | |
| glucobrassicin | An indolylmethylglucosinolic acid that is 1-thio-beta-D-glucopyranose having a 2-(1H-indol-3-yl)-N-(sulfooxy)ethanimidoyl group attached to the anomeric sulfur. |
| (R)-N-cycloheptyl-6-((((tetrahydro-2-furyl)methyl)amino)methyl)thieno(2,3-d)pyrimidin-4-ylamine | |
| Dibucaine | |
| 1,2,3-trichloropropane | An organochlorine compound that has formula C3H5Cl3. |
| Dermatan Sulfate | Any of a group of glycosaminoglycans with repeating units consisting of variously sulfated beta1->4-linked L-iduronyl-(beta1->3)-N-acetyl-D-galactosamine units. |
| citronellol | A monoterpenoid that is oct-6-ene substituted by a hydroxy group at position 1 and methyl groups at positions 3 and 7. |
| 2-methoxybenzoic acid | A methoxybenzoic acid that is the methyl ether of salicylic acid. |
| dasatinib | |
| 2-(4-(3-quinolin-6-ylmethyl-3H-(1,2,3)triazolo(4,5-b)pyrazin-5-yl)pyrazol-1-yl)ethanol | |
| PD 169316 | |
| NNC 112 | |
| alanyl-4-methoxy-2-naphthylamide | |
| Dimaprit | An imidothiocarbamic ester that has formula C6H15N3S. |
| N-(2-(7-(cyclohexylmethyl)-1,6-dihydro-2H-indeno(5,4-b)furan-8-yl)ethyl)acetamide | |
| beta-funaltrexamine | A morphinane alkaloid that has formula C25H30N2O6. |
| 9,10-phenanthrenequinone | |
| Glycyrrhizic Acid | |
| phytoene | An acyclic carotene that has formula C40H64. |
| 4-(4-(3-adamantan-1-ylureido)cyclohexyloxy)benzoic acid | |
| 13-oxo-9,11-octadecadienoic acid | |
| 5-methylfurtrethonium | |
| 3-aminopyridine-2-carboxaldehyde thiosemicarbazone | |
| icariin | A member of the class of flavonols that is kaempferol which is substituted at position 8 by a 3-methylbut-2-en-1-yl group and in which the hydroxy groups at positions 3, 4', and 7 have been converted to the corresponding 6-deoxy-alpha-L-mannopyranoside, methyl ether, and beta-D-glucopyranoside, respectively. A phoshphodiesterase-5 inhibitor, it is obtained from several species of plants in the genus Epimedium and is thought to be the main active ingredient of the Chinese herbal medicine Herba Epimedii (yinyanghuo). |
| cyclopropapyrroloindole | |
| ERB 041 | |
| hypsiziprenol A9 | |
| Aspartame | |
| indioside D | |
| adenosine-3',5'-cyclic phosphorothioate | |
| 3-deazaguanine | |
| Nitrofurans | |
| isovaleric acid | A C5, branched-chain saturated fatty acid. |
| rEV576 protein, tick | |
| Coumarins | |
| diethyl malate | |
| Formaldehyde | The simplest aldehyde. |
| methylnaltrexone | |
| 2-((R)-2-methylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide | |
| HLo 7 | An organic molecular entity that has formula C15H17N5O4.2I. |
| indan | |
| benzaldehyde | |
| ferumoxides | |
| phthalic acid | A benzenedicarboxylic acid cosisting of two carboxy groups at ortho positions. |
| lucidenic acid P | |
| cyclorphan | |
| tributyl phosphate | |
| dechloroethylcyclophosphamide | A phosphorodiamide that has formula C5H12ClN2O2P. |
| Camptothecin | A pyranoindolizinoquinoline that has formula C20H16N2O4. |
| heptelidic acid | |
| lonidamine | A member of the class of indazoles that is 1H-indazole that is substituted at positions 1 and 3 by 2,4-dichlorobenzyl and carboxy groups, respectively. |
| 7-hydroxymethotrexate | |
| Ketotifen | |
| 1-amino-4-hydroxyanthraquinone | |
| Dichloroethylenes | |
| zinc bis(histidinate) | |
| Testicular Hormones | |
| Cefadroxil | A cephalosporin bearing methyl and (2R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
| Nle(1)-AngIV | |
| Doxylamine | A tertiary amine that has formula C17H22N2O. |
| phosphoramide mustard | A phosphorodiamide that has formula C4H11Cl2N2O2P. |
| Mesoridazine | |
| 6-O-angeloylenolin | |
| CL 218872 | |
| apratastat | |
| tamarixetin | A monomethoxyflavone that is quercetin methylated at position O-4'. Isolated from Cyperus teneriffae. |
| gambierol | |
| 16 alpha-iodoestradiol | |
| phosphoryl chloride | |
| ethyl tert-butyl ether | |
| Gonadotropin-Releasing Hormone | |
| BL1521 | |
| N(6)-(delta(2)-isopentenyl)adenine | |
| lipostabil | |
| trequinsin | |
| methionine selenoxide | |
| polyethylene glycol-superoxide dismutase | |
| CB 1093 | |
| Iron, Dietary | |
| purpurin | A trihydroxyanthraquinone derived from anthracene by substitution with oxo groups at C-9 and C-10 and with hydroxy groups at C-1, C-2 and C-4. |
| Copper | |
| GQ1b ganglioside | |
| benzoylecgonine | |
| Water Pollutants | |
| Steroids | Any of naturally occurring compounds and synthetic analogues, based on the cyclopenta[a]phenanthrene carbon skeleton, partially or completely hydrogenated; there are usually methyl groups at C-10 and C-13, and often an alkyl group at C-17. By extension, one or more bond scissions, ring expansions and/or ring contractions of the skeleton may have occurred. Natural steroids are derived biogenetically from triterpenoids. |
| 4-methyl-N1-(3-phenylpropyl)benzene-1,2-diamine | |
| terbacil | An organohalogen compound that has formula C9H13ClN2O2. |
| hydroxyhydroquinone | |
| azamulin | |
| Triamcinolone Acetonide | A synthetic glucocorticoid that is the 16,17-acetonide of triamcinolone. Used to treat various skin infections. |
| blebbistatin | A pyrroloquinoline that is 1,2,3,3a-tetrahydro-H-pyrrolo[2,3-b]quinolin-4-one substituted by a hydroxy group at position 3a, a methyl group at position 6 and a phenyl group at position 1. It acts as an inhibitor of ATPase activity of non-muscle myosin II. |
| tetrathiomolybdate | |
| hexylglutathione | |
| 4-aminobenzonitrile | |
| allyl cyanide | |
| oleoyl-estrone | |
| cinerubine A | |
| cinerubine B | |
| Troleandomycin | |
| Lisuride | |
| 3,4-Methylenedioxyamphetamine | |
| LBT 613 | |
| S,S'-1,4-phenylene-bis(1,2-ethanediyl)bis-isothiourea | |
| N-(1-methyl-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea | |
| 5,6-dichlorobenzimidazole | |
| Ambroxol | |
| GR 113808 | An indolyl carboxylate ester obtained by formal condensation between the carboxy group of 1-methylindole-3-carboxylic acid with the hydroxy group of N-{2-[4-(hydroxymethyl)piperidin-1-yl]ethyl}methanesulfonamide. |
| prothiophos | |
| ergocristine | Ergotaman bearing benzyl, hydroxy, and isopropyl groups at the 5', 12' and 2' positions, respectively, and oxo groups at positions 3', 6', and 18. It is a natural ergot alkaloid. |
| 1,2-dioleoyl-sn-glycero-3-phosphoglycerol | A 1,2-diacyl-sn-glycero-3-phospho-(1'-sn-glycerol) in which both acyl groups are specified as oleoyl. |
| Malathion | A diester that is butanedioate substituted by a (dimethoxyphosphorothioyl)sulfanediyl group at position 2. |
| phenanthridone | A member of the class of phenanthridines that is phenanthridine with an oxo substituent at position 6. A poly(ADP-ribose) polymerase (PARP) inhibitor, it has been shown to exhibit immunosuppressive activity. |
| 2,7-diaminomitosene | |
| 1,25(OH)2-16-ene-23-yne-26,27-hexafluoro-19-nor-D3 | |
| Apazone | |
| Misoprostol | A diastereoisomeric mixture composed of approximately equal amounts of a double racemate of four of the sixteen possible diastereoisomers of methyl (13E)-11,16-dihydroxy-16-methyl-9-oxoprost-13-en-1-oate that is racemic prostaglandin E1 which is lacking the hydroxy group at position 15, but which has an additional hydroxy group at position 16. It is a synthetic prostaglandin E1 analogue, used in the treatment of gastric and duodenal ulcers. A weak abortifacient, it is also used for cervical ripening prior to surgical termination of pregnancy. The (11R,16S)-diastereoisomer is the pharmacologically active form. |
| 5-hydroxyflavone | |
| DCB-SLE1 | |
| 1-deazaadenosine | |
| N-Acetylneuraminic Acid | An N-acylneuraminic acid where the N-acyl group is specified as acetyl. |
| cisplatin-DNA adduct | |
| cupric oxide | |
| (3Z)-3-(1H-pyrrol-2-yl)-methyllidene)-1-(1-(piperidylmethyl)-1,3-dihydro-2H-indol-2-one mesylate | |
| isocarbophos | A salicylate that has formula C11H16NO4PS. |
| benzoyl chloride | A benzoic acid that has formula C7H5ClO. |
| 2-n-butyl-9-methyl-8-(1,2,3)triazol-2-yl-9H-purin-6-ylamine | |
| Bandrowski's base | A quinone imine having amino substituents in the 2- and 5-positions and 4-aminophenyl substituents on both of the imine nitrogens. It is a trimer formed from 1,4-phenylenediamine. |
| acetone phenylhydrazone | |
| protein-bound polysaccharide K, Basidiomycetes | |
| Curcumin | A beta-diketone that is methane in which two of the hydrogens are substituted by feruloyl groups. A natural dyestuff found in the root of Curcuma longa. |
| lipid mobilizing substance | |
| Ethylmercury Compounds | |
| 6 beta-hydroxycortisol | |
| 1-nitronaphthalene | A mononitronaphthalene substituted by a nitro group at position 1. |
| Prostaglandin H2 | A prostaglandins H that has formula C20H32O5. |
| 5-(N-benzyl-N-methylaminomethyl)-1--(2,6-difluorobenzyl)-6-(4-(3-methoxyureido)phenyl)-3-phenylthieno(2,3-d)pyrimidine-2,4(1H,3H)-dione | |
| psi-tectorigenin | |
| nafenopin-coenzyme A | |
| polysaccharide peptide | |
| spirapril | |
| ethoxyacetic acid | |
| 1,1,1-trichloroethane | A member of the class of chloroethanes carrying three chloro substituents at position 1. |
| Chloroform | |
| 1-amino-1,3-dicarboxycyclopentane | |
| 10,10-bis(4-pyridinylmethyl)-9(10H)-anthracenone | |
| 4-nitrobenzylthioinosine | |
| PF-2341066 | |
| phosalone | A member of the class of 1,3-benzoxazoles carrying a [(diethoxyphosphorothioyl)sulfanyl]methyl group at the nitrogen atom, an oxo group at position 2 and a chloro group at position 6. It is an organothiophosphate insecticide. |
| Nigericin | A polyether antibiotic which affects ion transport and ATPase activity in mitochondria. It is produced by Streptomyces hygroscopicus. |
| 1-Methyl-4-phenylpyridinium | A pyridinium ion having a phenyl substituent at the 4-position. |
| Fucose | Any deoxygalactose that is deoxygenated at the 6-position. |
| Guanylyl Imidodiphosphate | |
| pimaric acid | A diterpenoid that has formula C20H30O2. |
| trimethylarsine oxide | An arsine oxide that has formula C3H9AsO. |
| Practolol | |
| N-acetyldopamine | |
| ranolazine | |
| Measles-Mumps-Rubella Vaccine | |
| terameprocol | |
| 3-fluoro-4-(4-((2-(3-fluorophenyl)pyrrolidin-1-yl)methyl)phenoxy)benzamide | |
| pazopanib | |
| resorcinol | A benzenediol that is benzene dihydroxylated at positions 1 and 3. |
| Oxalic Acid | An alpha,omega-dicarboxylic acid that is ethane substituted by carboxyl groups at positions 1 and 2. |
| beta-Aminoethyl Isothiourea | |
| Diethylcarbamazine | |
| 4-anisidine | |
| Piperonyl Butoxide | A benzodioxole that has formula C19H30O5. |
| parecoxib | |
| ganirelix | |
| 9-((2-phosphonylmethoxy)ethyl)guanine | A phosphoethanolamine that has formula C8H12N5O5P. |
| ganglioside, GD1a | |
| 2,3,4,7,8-pentachlorodibenzofuran | A chlorin that has formula C12H3Cl5O. |
| ZD 7155 | |
| dipropyl sulfide | |
| Methiothepin | A dibenzothiepine that is 10,11-dihydrodibenzo[b,f]thiepine bearing additional methylthio and 4-methylpiperazin-1-yl substituents at positions 8 and 10 respectively. Potent 5-HT2 antagonist, also active as 5-HT1 antagonist. Differentiates 5-HT1D sub-types. Also displays affinity for rodent 5-HT5B, 5-HT5A, 5-HT7 and 5-HT6 receptors (pK1 values are 6.6, 7.0, 8.4 and 8.7 respectively). |
| MRK 003 | |
| Lasofoxifene | |
| 5-iodo-3-(2-azetidinylmethoxy)pyridine | |
| alpha-phenyl-1-(2-phenylethyl)-4-piperidinemethanol | |
| Etidronic Acid | A 1,1-bis(phosphonic acid) that is (ethane-1,1-diyl)bis(phosphonic acid) having a hydroxy substituent at the 1-position. It inhibits the formation, growth, and dissolution of hydroxyapatite crystals by chemisorption to calcium phosphate surfaces. |
| phytofluene | An acyclic carotene that has formula C40H62. |
| Riluzole | |
| isopropyl 4,4'-dibromobenzilate | |
| 5-methylurapidil | |
| salvin | |
| 1-(propoxymethyl)maleimide | |
| bis(4-acetamidophenyl) 1-prolylpyrrolidine-2-phosphonate | |
| fluvastatin | |
| 3-methyleneindolenine | An indole that consists of 3H-indole bearing a methylene substituent at position 3. |
| phloxine | |
| 3-hydroxy-2-naphthoic acid | |
| Flunitrazepam | |
| 2,4-di-tert-butylphenol | |
| 2',5'-oligoadenylate | |
| Calcium Ionophores | |
| N-(1-fluoro-3-phenylpropan-2-yl)-N-methylprop-2-yn-1-amine | |
| 2-keto-4-methylthiobutyric acid | |
| Unithiol | |
| pyridoxal phosphate gamma-glutamyl hydrazone | |
| Hexanols | |
| zerumbone | A sesquiterpenoid and cyclic ketone that is (1E,4E,8E)-alpha-humulene which is substituted by an oxo group at the carbon atom attached to two double bonds. It is obtained by steam distillation from a type of edible ginger, Zingiber zerumbet Smith, grown particularly in southeast Asia. |
| Cholates | A bile acid salt having cholate as the anionic component. |
| Org 31710 | |
| NCX 6560 | |
| styrene oxide | An epoxide of styrene. |
| Mannans | |
| 2,2-bis(bromomethyl)-1,3-propanediol | |
| SB 290157 | |
| alpha-(4-pyridyl-1-oxide)-N-tert-butylnitrone | |
| efletirizine | |
| fluorescein 5-maleimide | |
| Flame Retardants | Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| verlukast | |
| 5'-deoxy-5-fluorocytidine | A N-glycosyl compound that has formula C9H12FN3O4. |
| Enkephalin, Ala(2)-MePhe(4)-Gly(5)- | |
| 4,5-dichlorocatechol | |
| 3-chlorophenol | A monochlorophenol carrying the chloro substituent at position 3. |
| Benzalkonium Compounds | |
| Pyridoxal | |
| E 3330 | |
| vofopitant | |
| 3-(2-(4-chlorophenylsulfanyl)phenyl)-N-(4-dimethylaminobutyl)acrylamide | |
| potassium persulfate | |
| naphtholphthalein | |
| CJY compound | |
| 1H-benzotriazole-5-carboxylic acid | |
| N-(2-(methylamino)ethyl)-5-isoquinolinesulfonamide | |
| diphenyldiselenide | |
| benzotrichloride | A benzene that has formula C7H5Cl3. |
| 2,4-heptadienal | |
| MRS 1191 | |
| Phenylenediamines | |
| BHTOH-QM | |
| ethiprole | A pyrazole that has formula C13H9Cl2F3N4OS. |
| 9-deoxy-delta-9-prostaglandin D2 | |
| copolymer 1 | |
| 4-((2'-O-acetylrhamnosyloxy)benzyl)isothiocyanate | |
| sesamin | A lignan that consists of tetrahydro-1H,3H-furo[3,4-c]furan substituted by 1,3-benzodioxole groups at positions 1 and 4 (the 1S,3aR,4S,6aR stereoisomer). Isolated from Cinnamomum camphora, it exhibits cytotoxic activity. |
| VI-14 flavonoid | |
| M 50367 | |
| triisopropyl phosphate | |
| 2,4,2',4'-tetrachlorobiphenyl | |
| captafol | A dicarboximide that captan in which the trichloromethyl group is replaced by a 1,1,2,2-tetrachloroethyl group. A broad-spectrum fungicide used to control diseases in fruit and potatoes, it is no longer approved for use in the European Community. |
| Antioxidants | A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. In European countries, E-numbers for permitted antioxidant food additives are from E 300 to E 324. |
| Calcimycin | An aminobenzoic acid that has formula C29H37N3O6. |
| diallyl sulfone | |
| WP 631 | |
| oleandrin | A steroid saponin that consists of oleandrigenin having a 3-O-methyl-alpha-L-arabino-hexopyranosyl residue attached at position 3. |
| naphtho(2,3-a)pyrene | |
| 1-(3-(4-phenoxyphenoxy)-2-oxopropyl)indole-5-carboxylic acid | |
| Benperidol | |
| 7-ethoxy-4-trifluoromethylcoumarin | |
| AZD 1480 | |
| physostigmine salicylate | An azaheterocycle salicylate salt that has formula C22H27N3O5. |
| S-(N,N-diethylaminoethyl) isobutyl methylphosphothiolate | |
| delphinidin | An anthocyanidin cation consisting of benzopyrylium with hydroxy substituents at the 3-, 5- and 7-positions and a 3,4,5-trihydroxyphenyl group at the 2-position. It is a plant pigment resposible for the colours of the plants of the genera Viola and Delphinium. |
| CD4528 | |
| MY 5445 | |
| 3-chloro-3'-((2-cyclopentyl-3-oxo-2,3-dihydrobenzo(d)isothiazol-6-yloxy)methyl)biphenyl-4-carboxylic acid | |
| isoliquiritigenin 2'-methyl ether | |
| 2-naphthol | A naphthol carrying a hydroxy group at position 2. |
| ropivacaine | The piperidinecarboxamide obtained by the formal condensation of N-propylpipecolic acid and 2,6-dimethylaniline. |
| Ceramides | |
| 8-(3-chlorostyryl)caffeine | Caffeine substituted at its 8-position by an (E)-3-chlorostyryl group. |
| Perylene | An ortho- and peri-fused polycyclic arene comprising of five benzene rings that is anthracene in which the d,e and k,l sides are fused to benzene rings. |
| befunolol | |
| phenidone | |
| purpurogallin | A cyclic ketone that is 5H-benzocycloheptene bearing an oxo group at position 5 and hydroxy groups at positions 2, 3, 4 and 6. |
| Chlormadinone Acetate | A corticosteroid hormone that has formula C23H29ClO4. |
| Benzopyrenes | |
| (5-(2,4-bis((3S)-3-methylmorpholin-4-yl)pyrido(2,3-d)pyrimidin-7-yl)-2-methoxyphenyl)methanol | |
| 4-methoxy-3-phenylenediamine | |
| monoethylglycinexylidide | Amino acid amide formed from 2,6-dimethylaniline and N-ethylglycine components; an active metabolite of lidocaine, formed by oxidative deethylation. Used as an indicator of hepatic function. |
| (S)-2-methylbutyronitrile | |
| 6-chloroacetyl-2-dimethylaminonaphthalene | |
| Isoflurophate | |
| beta Carotene | A cyclic carotene obtained by dimerisation of all-trans-retinol. A strongly-coloured red-orange pigment abundant in plants and fruit and the most active and important provitamin A carotenoid. |
| 2,2',4,6,6'-pentachlorobiphenyl | |
| 4-hydroxyclomiphene | |
| Oxytetracycline | A tetracycline used for treatment of infections caused by a variety of Gram positive and Gram negative microorganisms including Mycoplasma pneumoniae, Pasteurella pestis, Escherichia coli, Haemophilus influenzae (respiratory infections), and Diplococcus pneumoniae. |
| 3-(4-bromophenyl)-2-(ethylsulfonyl)-6-methylquinoxaline-1,4-dioxide | |
| OMDM-1 cpd | |
| sunitinib | A pyrrole that has formula C22H27FN4O2. |
| Cyclohexylamines | |
| pramanicin | |
| diferuloylputrescine | |
| A 68930 | |
| Lorazepam | |
| Liuwei Dihuang Decoction | |
| valdecoxib | |
| amorphigenin | |
| taleranol | |
| indoxyl acetate | |
| beta-hydroxyisovalerylshikonin | |
| Glycocholic Acid | A bile acid glycine conjugate having cholic acid as the bile acid component. |
| N-isobutyl-N-(4-methoxyphenylsulfonyl)glycylhydroxamic acid | |
| azelaic acid | An alpha,omega-dicarboxylic acid that is heptane substituted at positions 1 and 7 by carboxy groups. |
| polylactic acid-polyglycolic acid copolymer | |
| robalzotan | |
| Polyethyleneimine | A polymer composed of repeating ethylamine units. |
| 3-ketocholanoic acid | |
| monobenzone | |
| N-(4-((4,5-dichloro-2-fluorophenyl)amino)quinazolin-6-yl)acrylamide | |
| 1-O-hexadecyl-2-arachidonyl-sn-glycero-3-phosphocholine | |
| 6-hydroxymelatonin | A member of the class of tryptamines that is melatonin with a hydroxy group substituent at position 6. |
| Centchroman | |
| J 104132 | |
| 2,3-Diphosphoglycerate | |
| 1-((4-methylsulfonyl)phenyl)-3-trifluoromethyl-5-(4-fluorophenyl)pyrazole | |
| 1-(2-(1-adamantyl)ethyl)-1-pentyl-3-(3-(4-pyridyl)propyl)urea | |
| Carbon Disulfide | An organosulfur compound that has formula CS2. |
| cyclohexanone | A cyclic ketone that consists of cyclohexane bearing a single oxo substituent. |
| AG 127 | |
| biphenylylacetic acid | |
| Sucralfate | |
| Doxazosin | A member of the class of quinazolines that is quinazoline substituted by an amino group at position 4, methoxy groups at positions 6 and 7 and a piperazin-1-yl group at position 2 which in turn is substituted by a 2,3-dihydro-1,4-benzodioxin-2-ylcarbonyl group at position 4. An antihypertensive agent, it is used in the treatment of high blood pressure. |
| Fish Oils | |
| neurotensin 69L | |
| Guanabenz | |
| proxymetacaine | |
| Abscisic Acid | |
| pendimethalin | A member of the class of substituted anilines that is N-(pentan-3-yl)aniline bearing two additional nitro substituents at positions 2 and 6 as well as two methyl substituents at positions 3 and 4. A herbicide used to control most annual grasses and many annual broad-leaved weeds. |
| fucosterol | A 3beta-sterol consisting of stigmastan-3beta-ol with double bonds at positions 5 and 24(28). |
| 1-cyano-2-hydroxy-3-butene | |
| lycium barbarum polysaccharide | |
| danthron | |
| 3-biphenyl-4-yl-4-(2-fluorophenyl)-5-isopropyl-4H-1,2,4-triazole | |
| 7,7-diphenyl-2-(1-imino-2-(2-methoxyphenyl)ethyl)perhydroisoindol-4-one | |
| p38alpha inhibitor CMPD1 | |
| Methoxsalen | |
| zileuton | |
| 3-ethylphenol | A phenol that has formula C8H10O. |
| capseal I | |
| phosphoramidon | A dipeptide isolated from the cultures of Streptomyces tanashiensis. |
| 2-(allylthio)pyrazine | |
| pantogab | |
| Zoxazolamine | A benzoxazole that has formula C7H5ClN2O. |
| monobutyl phthalate | |
| RV 538 | |
| prodan | |
| ganglioside, GD3 | |
| 3,7-dimethyl-1-propargylxanthine | |
| malabaricone B | |
| malabaricone C | A butanone that has formula C21H26O5. |
| CV 6504 | |
| bromoform | A bromomethane that has formula CHBr3. |
| nylestriol | |
| 2',5'-dihydroxychalcone | |
| HIV Envelope Protein gp120 | |
| conotoxin alpha-RgIA, Conus regius | |
| Weichang'an | |
| tri-o-cresyl phosphate | |
| 1,4-dioxane | A dioxane with oxygen atoms at positions 1 and 4. |
| 4-cyano-N-(2-(1-cyclohexen-1-yl)-4-(1-((dimethylamino)acetyl)-4-piperidinyl)phenyl)-1H-imidazole-2-carboxamide | |
| 1,7-bis(4-hydroxy-3-methoxyphenyl)-1,4,6-heptatrien-3-one | |
| Aminoglycosides | |
| tetrakis(N-methyl-4-pyridiniumyl)porphine manganese(III) complex | |
| selenomethylselenocysteine | |
| 19-epi-okadaic acid | |
| Puromycin | An aminonucleoside antibiotic, derived from the Streptomyces alboniger bacterium, that causes premature chain termination during translation taking place in the ribosome. |
| N-(3-fluoro-4-nitronaphthyl)-5-norbornene-2,3-dicarboxylic imide | |
| haloperidol decanoate | |
| phenyl valerate | |
| Cytokines | |
| 1,4-dibromobenzene | A dibromobenzene that has formula C6H4Br2. |
| methylmercuric chloride | |
| Styrene | A vinylarene that is benzene carrying a vinyl group. It has been isolated from the benzoin resin produced by Styrax species. |
| perfluorododecanoic acid | |
| 6-ethyl-6-(4-((phenylthio)methyl)phenyl)-6,7-dihydrobenzo(b)pyrrolo(1,2-d)(1,4)oxazepin-7-one | |
| Androstane-3,17-diol | A 17-hydroxy steroid that has formula C19H32O2. |
| falcarindiol | An organic molecular entity that has formula C17H24O2. |
| CP 105696 | |
| Selenomethionine | |
| Piroxicam | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic acid 1,1-dioxide with the exocyclic nitrogen of 2-aminopyridine. |
| Poly C | A polynucleotide comprised of cytidine units connected via 3'->5' phosphodiester linkages. |
| 5-(3-(3-hydroxyphenoxy)azetidin-1-yl)-5-methyl-2,2-diphenylhexanamide | |
| TGX 221 | |
| tiliroside | |
| plY protein, Streptococcus pneumoniae | |
| diphenyltin chloride | |
| zoniporide | |
| dexbrompheniramine | The (pharmacologically active) (S)-(+)-enantiomer of brompheniramine. A histamine H1 receptor antagonist, it is used (commonly as its maleate salt) for the symptomatic relief of allergic conditions, including rhinitis and conjunctivitis. |
| Sulfonamides | An amide of a sulfonic acid RS(=O)2NR'2. |
| Thiamylal | A member of the class of barbiturates that is 2-thioxodihydropyrimidine-4,6(1H,5H)-dione substituted by a pentan-2-yl and prop-2-en-1-yl group at position 5. |
| sudan III | An azobenzene that has formula C22H16N4O. |
| 1-phenylazo-2-naphthol | |
| etonitazene | |
| ICI 211965 | |
| p-hydroxycinnamaldehyde | |
| N-(4-(3-chloro-4-(2-pyridinylmethoxy)anilino)-3-cyano-7-ethoxy-6-quinolyl)-4-(dimethylamino)-2-butenamide | |
| batimastat | |
| 11-(dansylamino)undecanoic acid | |
| N,N-dimethylethylamine | |
| Allylamine | |
| hispidulin | A monomethoxyflavone that is scutellarein methylated at position 6. |
| bis((2-oxindol-3-ylimino)-2-(2-aminoethyl)pyridine-N,N')copper(II) | |
| Plant Extracts | |
| Phospholipids | |
| Methiocarb | A carbamate ester obtained by the formal condensation of the phenolic group of 3,5-dimethyl-4-(methylsulfanyl)phenol with the carboxy group of methylcarbamic acid. |
| etonogestrel | |
| Carthamus yellow | |
| 1-(2-(3-methoxyphenyl)ethyl)phenoxy-3-(dimethylamino)-2-propanol | |
| fucoidan | |
| perfluorodecalin | A fluorocarbon that is decalin in which every hydrogen is replaced by fluorine. Capable of dissolving large quantities of oxygen, it has been used as the basis of an artificial blood substitute. |
| Plant Oils | |
| Diphtheria-Tetanus-acellular Pertussis Vaccines | |
| S-hydroxymethylglutathione | Conjugate base of S-(hydroxymethyl)glutathione. |
| yessotoxin | |
| eugenol, zinc oxide dental cavity lining | |
| enterotoxin A, Staphylococcal | |
| Diacetyl | |
| 4-cumylphenol | |
| tin mesoporphyrin | |
| Ambenonium Chloride | A symmetrical oxalamide-based bis-quaternary ammonium salt having ethyl and 2-chlorobenzyl groups attached to the nitrogens. |
| 1,6-bis(cyclohexyloximinocarbonyl)hexane | |
| Antigens, Bacterial | |
| 6,7-dimethoxy-3-phenylquinoxaline | |
| N-(2-pyridone-6-yl)-N',N'-di-n-propylformamidine | |
| 3,5-dihydroxyphenylglycine | |
| Sweetening Agents | |
| Vitamin U | |
| Lactose | |
| 2,3-dimethoxy-6,6-dimethyl-5,6-dihydrobenzo(7,8)indolizino (2,3-b)quinoxaline | |
| losigame | |
| Vitamin A | A group of fat-soluble retinoids produced via metabolism of provitamin A carotenoids. Vitamin A is involved in immune function, vision, reproduction, and cellular communication. |
| benoxaprofen | A monocarboxylic acid that is propionic acid substituted at position 2 by a 2-(4-chlorophenyl)-1,3-benzoxazol-5-yl group. It was used as a non-steroidal anti-inflammatory drug until 1982 when it was withdrawn from the market due to adverse side-effects including liver necrosis, photosensitivity, and carcinogenicity in animals. |
| Guanosine | A purine nucleoside in which guanine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
| Vitamin E | A chromanol that is chroman-6-ol which is substituted at position 2 by a methyl group and (also at position 2) either a saturated or a triply-unsaturated hydrocarbon chain consisting of three isoprenoid units. |
| Vitamin D | Vitamin D is a group of fat-soluble prohormones, which can be obtained from sun exposure, food and supplements. Vitamin D is biologically inactive and converted to the biologically active calcitriol via double hydroxylation in the body. |
| Vitamin K | A fat-soluble vitamin required for the synthesis of prothrombin and certain other blood coagulation factors. |
| kaempferol | A flavonol that has formula C15H10O6. |
| Water Pollutants, Chemical | |
| 2-(8-quinolinoxy)propionic acid | |
| formestane | |
| N,N-dipropylcarboxamidotryptamine | |
| Propiolactone | |
| Am 580 | |
| trimethylamine | A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
| Biological Products | |
| ethyl(E,E,E)-7-(2-n-propoxy-5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-naphthalen-3-yl)-6-fluorp-3-methylocta-2,4,6-trienoate | |
| 4-hydroxy-2',4',6'-trichlorobiphenyl | |
| benzoylcarbonyl-aspartyl-glutamyl-valyl-aspartyl-fluoromethyl ketone | |
| N-(2-hydroxypropyl)methacrylamide co-polymer-doxorubicin conjugate | |
| Streptonigrin | Complex cytotoxic antibiotic obtained from Streptomyces flocculus or S. rufochronmogenus. It is used in advanced carcinoma and causes leukopenia. |
| Fatty Acids, Omega-6 | |
| FPEPIR regimen | |
| 1,2,4-trichlorobenzene | A trichlorobenzene with chloro substituents at positions 1, 2 and 4. |
| paxilline | An organooxygen compound that has formula C27H33NO4. |
| ergosterol-5,8-peroxide | |
| 4-amino-1,8-naphthalimide | A benzoisoquinoline that has formula C12H8N2O2. |
| imiquimod | An imidazoquinoline that has formula C14H16N4. |
| N-desmethyltamoxifen | A stilbenoid that has formula C25H27NO. |
| indole-3-carbinol | |
| benzohydrol | |
| tiotropium | |
| thiocholchicine | |
| SCIO-469 | |
| Polyenes | An olefin that contains more than one carbon-carbon double bond. |
| 4557 W | |
| bohemine | |
| Phytic Acid | |
| Acetone | |
| astressin B | |
| flavokawain A | |
| Safrole | A member of the class of benzodioxoles that is 1,3-benzodioxole which is substituted by an allyl group at position 5. It is found in several plants, including black pepper, cinnamon and nutmeg, and is present in several essential oils, notably that of sassafras. It has insecticidal properties and has been used as a topical antiseptic. Although not thought to pose a significant carcinogenic risk to humans, findings of weak carcinogenicity in rats have resulted in the banning of its (previously widespread) use in perfumes and soaps, and as a food additive. |
| Ethidium | The fluorescent compound widely used in experimental cell biology and biochemistry to reveal double-stranded DNA and RNA. |
| Furans | Compounds containing at least one furan ring. |
| Pyrazoles | |
| hydroxyapatite-beta tricalcium phosphate | |
| AZD 6244 | |
| chlorfluazuron | A benzoylurea insecticide that has formula C20H9Cl3F5N3O3. |
| lamotrigine | A member of the class of 1,2,4-triazines in which the triazene skeleton is substituted by amino groups at positions 3 and 5, and by a 2,3-dichlorophenyl group at position 6. |
| bis(2-hydroxybenzylidene)acetone | |
| Methylnitronitrosoguanidine | |
| 4-amylcinnamoylanthranilic acid | |
| Fluoxymesterone | An anabolic androgenic steroid that has formula C20H29FO3. |
| 4-dimethylaminocinnamaldehyde | |
| Cacodylic Acid | |
| alpha-cyano-(3,4-dihydroxy)-N-benzylcinnamide | |
| beta-thujone | |
| epiallopregnanolone sulfate | |
| 1,2-dimethylnaphthalene | A dimethylnaphthalene carrying methyl groups at positions 1 and 2. |
| KT 5823 | |
| ethyl vanillin | |
| titanium citrate | |
| broxaterol | |
| 2-hydroxypropyl-beta-cyclodextrin | |
| soyasaponin I | A triterpenoid saponin that is composed of soyasapogenol B having an alpha-L-rhamnopyranosyl-(1->2)-beta-D-galactopyranosyl-(1->2)-beta-D-glucopyranosiduronic acid moiety attached at the 3-position via a glycosidic linkage. |
| butyrylcholine | |
| N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide | An aromatic amide resulting from the formal condensation of the carboxy group of 1-methylcyclohexanecarboxylic acid with the amino group of 4-amino-2,3-dichlorophenol. |
| mestanolone | |
| 4-benzoylpyridine | |
| mevalonolactone | |
| bicyclol | |
| eleostearic acid | |
| 16-hydroxycleroda-3,13(14)-dien-15,16-olide | |
| bitertanol | A diastereoisomeric mixture composed of the enantiomeric pair (1R,2S)- and (1S,2R)-bitertanol in a 4:1 ratio with the enantiomeric pair (1R,2R)- and (1S,2S)-bitertanol. A fungicide used to control a range of diseases including scab, powder mildew, rusts and blackspot. It is moderately toxic to most animal and insect species but is non-toxic to honeybees. |
| 1,3-dipropyl-8-(4-sulfophenyl)xanthine | |
| S-nitro-N-acetylpenicillamine | |
| R116010 | |
| indirubin | |
| S-pentachlorobuta-1,3-dien-yl-cysteine | |
| thallium acetate | |
| Cardiotonic Agents | |
| Naphthalenes | Any benzenoid aromatic compound having a skeleton composed of two ortho-fused benzene rings. |
| iprodione | An imidazolidine-2,4-dione in which the nitrogen at position 1 is substituted by an N-(isopropyl)carboxamide group while that at position 3 is substituted by a 3,5-dichlorophenyl group. A contact fungicide, it blocks the growth of the fungal mycelium and inhibits the germination of fungal spores. It is used on fruit and vegetable crops affected by various fungal diseases. It is also used as a nematicide. |
| antibiotic G 418 | |
| chloropropylate | An organochlorine acaricide that has formula C17H16Cl2O3. |
| octylphenol | |
| certoparin | |
| 3,4-epoxy-1-butene | |
| mepazine | |
| phenethylcymserine | |
| acetaldehyde oxime | An aldoxime derived from acetaldehyde. |
| 2-((2-piperidin-1-ylethyl)thio)quinazolin-4(3H)-one | |
| isophorone diisocyanate | A diisocyanate in which the two isocyanate groups are linked by an isophorone substituent. |
| Biphenyl Compounds | |
| tri-(2-ethylhexyl)trimellitate | |
| triflusal | |
| resiquimod | An imidazoquinoline that has formula C17H22N4O2. |
| dimethyl-N-acetylmuramyl-alanylglutamate | |
| EEDQ | |
| alexidine | An amphipathic bisbiguanide with a structure consisting of two (2-ethylhexyl)guanide units linked by a hexamethylene bridge. |
| CP-471,358 | |
| Thiazolidines | |
| carbohydrazide | A hydrazide consisting of hydrazine carrying one or more carboacyl groups. |
| Budesonide | A glucocorticoid steroid having a highly oxygenated pregna-1,4-diene structure. It is used mainly in the treatment of asthma and non-infectious rhinitis and for treatment and prevention of nasal polyposis. |
| 1,2-dioleoyloxy-3-(trimethylammonium)propane | |
| 5-phenyl-5-(4-hydroxyphenyl)hydantoin glucuronide | |
| CP 55244 | |
| Clarithromycin | The 6-O-methyl ether of erythromycin A, clarithromycin is a macrolide antibiotic used in the treatment of respiratory-tract, skin and soft-tissue infections. It is also used to eradicate Helicobacter pylori in the treatment of peptic ulcer disease. It prevents bacteria from growing by interfering with their protein synthesis. |
| indapamide, perindopril drug combination | |
| bradykinin, Lys-Leu(8)-desArg(9)- | |
| H 2545 | |
| Bupivacaine | A racemate composed of equimolar amounts of dextrobupivacaine and levobupivacaine. Used (in the form of its hydrochloride hydrate) as a local anaesthetic. |
| Sodium Selenite | |
| Pyridinium Compounds | |
| HMR 3339 | |
| Fatty Acids, Volatile | |
| Tolmetin | |
| cholest-5-ene-3,4-diol | |
| dazomet | A dithiocarbamic ester that is 1,3,5-thiadiazinane with a thione moiety at position 2 and in which the hydrogens attached to the nitrogens are replaced by methyl groups. A fungicide, herbicide and nematicide, it is used prior to sowing or planting for the control of soil fungi, nematodes, bacteria and germinating weeds, and as fumigant for poultry litter and eggs to control Salmonella. It is a non-ozone-depleting alternative to methyl bromide. |
| Reactive Oxygen Species | Molecules or ions formed by the incomplete one-electron reduction of oxygen. They contribute to the microbicidal activity of phagocytes, regulation of signal transduction and gene expression, and the oxidative damage to biopolymers. |
| saikosaponin | |
| chlormethoxynil | |
| 1-hydroxyvitamin D5 | |
| PF 00477736 | |
| pyrene | An ortho- and peri-fused polycyclic arene consisting of four fused benzene rings, resulting in a flat aromatic system. |
| tert-butylbicyclo-2-benzoate | |
| 2-bromopalmitate | |
| Diatrizoate | |
| 2,7-dinitrofluorene | |
| lavendustin A | |
| azaspiracid | |
| Gonadal Steroid Hormones | |
| Anisomycin | An antibiotic isolated from various Streptomyces species. It interferes with protein and DNA synthesis by inhibiting peptidyl transferase or the 80S ribosome system. |
| NVP-BKM120 | |
| ZK 164015 | |
| phenacyl bromide | An alpha-bromoketone that has formula C8H7BrO. |
| SB 239063 | |
| 4-nitro-3-phenylphenol | |
| norkurarinol | |
| N-(2-methyl-3-(4-(4-(4-(trifluoromethoxy)benzyloxy)piperidin-1-yl)-1,3,5-triazin-2-ylamino)phenyl)acetamide | |
| chebulinic acid | A tannin that has formula C41H32O27. |
| Epitestosterone | An androstanoid that is the C-17 epimer of testosterone. |
| tertiary-amyl methyl ether | |
| GSK 8470 | |
| ciglitazone | An aromatic ether that consists of 1,3-thiazolidine-2,4-dione with position 5 substituted by a 4-[(1-methylcyclohexyl)methoxy]benzyl group. A selective PPARgamma agonist. |
| 2-amino-1,7-dimethylimidazo(4,5-g)quinoxaline | |
| cycloprothrin | A carboxylic ester having 2,2-dichloro-1-phenylcyclopropanecarboxylic acid as the acid component and hydroxy(3-phenoxyphenyl)acetonitrile as the alcohol component. |
| 1-butyrylglycerol | |
| Cytidine | A pyrimidine nucleoside in which cytosine is attached to ribofuranose via a beta-N(1)-glycosidic bond. |
| diphenylditelluride | |
| estradiol 17 beta-cypionate | |
| 8-oxo-7-hydrodeoxyguanosine | |
| Calcium Carbonate | A carbonate salt that has formula CO3.Ca. |
| 2-methylene-19-nor-(20S)-1 alpha-hydroxy-bishomopregnacalciferol | |
| bisperoxovanadium | |
| Iodides | |
| p-aminophenylarsine oxide | |
| mono(2-ethyl-5-hydroxyhexyl) phthalate | |
| JNJ 10397049 | |
| sanglifehrin A | |
| Isatin | The 2,3-diketo derivative of indole. |
| 9-anthroic acid | An anthroic acid carrying the carboxy substituent at position 9. |
| norlevorphanol | |
| tetra(4-N-methylpyridyl)porphine | |
| toloxatone | |
| Amitrole | A member of the class of triazoles that is 1H-1,2,4-triazole substituted by an amino group at position 3. |
| Glutarates | |
| CX157 | |
| acetovanillone | |
| KC 400 | |
| pamidronate | |
| diniconazole | A racemate comprising equimolar amounts of (R)- and (S)-diniconazole. A fungicide used to control a range of diseases including mildew, bunts and smuts. |
| Tolnaftate | |
| indirubin-3'-monoxime | |
| Methyl Parathion | |
| PF 232798 | |
| 3,5,3',4',5'-pentamethoxystilbene | |
| ultra-high molecular weight polyethylene | |
| monoisoamyl-2,3-dimercaptosuccinate | |
| metoprolol succinate | |
| actinidine | A member of the class of cyclopentapyridines that is 6,7-dihydrocyclopenta[c]pyridine bearing two methyl substituents at positions 4 and 7. |
| androsterone glucuronide | |
| 20-hydroxyeicosa-6(Z),15(Z)-dienoic acid | |
| butachlor | An anilide that has formula C17H26ClNO2. |
| X 910279 | |
| 5-methoxyindole-2-carboxylic acid | |
| Magnesium Sulfate | A magnesium salt having sulfate as the counterion. |
| profenamine | |
| Obidoxime Chloride | |
| (2E)-decenal | |
| n-decyl alcohol | |
| gusperimus | |
| N-benzyl-N-ethyl-2-(7,8-dihydro-7-methyl-8-oxo-2-phenyl-9H-purin-9-yl)acetamide | |
| SB 269970 | |
| psicose | A ketohexose that is the C-3 epimer of fructose. |
| propionaldehyde | An aldehyde that consists of ethane bearing a formyl substituent. The parent of the class of propanals. |
| 2,3,6,7-tetrachlorobiphenylene | |
| capsazepine | A benzazepine that is 2,3,4,5-tetrahydro-1H-2-benzazepine which is substituted by hydroxy groups at positions 7 and 8 and on the nitrogen atom by a 2-(p-chlorophenyl)ethylaminothiocarbonyl group. A synthetic analogue of capsaicin, it was the first reported capsaicin receptor antagonist. |
| S-ethyl glutathione | |
| 15-ketoprostaglandin E2 | |
| felbamate | |
| protopanaxatriol | A tetracyclic triterpenoid sapogenin (isolated from ginseng and notoginseng) that is that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions and in which a double bond has been introduced at the 24-25 position. |
| tricaine | A benzoate ester that has formula C9H11NO2. |
| coproporphyrinogen III | A coproporphyrinogen that has formula C36H44N4O8. |
| 4-hydroxyestrone | |
| norfluoxetine | |
| clinofibrate | |
| alyssin | |
| 9,10-dihydroxy-12-octadecenoic acid | |
| methotrexate-alpha glutamate | |
| Toluene | The simplest member of the class toluenes consisting of a benzene core which bears a single methyl substituent. |
| 2,4-difluoro-N-(2-(methyloxy)-5-(4-(4-pyridazinyl)-6-quinolinyl)-3-pyridinyl)benzenesulfonamide | |
| Endocrine Disruptors | |
| arsenotriglutathione | |
| tranilast | |
| Ketone Bodies | A carbonyl compound produced as a water-soluble byproduct when fatty acids are broken down for energy in the liver. There are three endogenous ketone bodies: acetone, acetoacetic acid, and (R)-3-hydroxybutyric acid; others may be produced as a result of the metabolism of synthetic triglycerides. |
| mipafox | A phosphoramide that has formula C6H16FN2OP. |
| Hydroxyurea | A member of the class of ureas that is urea in which one of the hydrogens is replaced by a hydroxy group. An antineoplastic used in the treatment of chronic myeloid leukaemia as well as for sickle-cell disease. |
| NAADP | |
| dofetilide | |
| 7H-dibenzo(c,g)carbazole | A carbazole that has formula C20H13N. |
| SK&F 104078 | |
| tris(chloroethyl)phosphate | |
| 1,2-Dihydroxybenzene-3,5-Disulfonic Acid Disodium Salt | |
| anemonin | A butenolide that has formula C10H8O4. |
| Stavudine | A nucleoside analogue obtained by formal dehydration across positions 2 and 3 of thymidine. An inhibitor of HIV-1 reverse transcriptase |
| Pentaerythritol Tetranitrate | A pentaerythritol nitrate in which all four hydroxy groups of pentaerythritol have been converted to the corresponding nitrate ester. It is a vasodilator with properties similar to those of glyceryl trinitrate, but with a more prolonged duration of action, and is used for treatment of angina pectoris. It is also one of the most powerful high explosives known and is a component of the plastic explosive known as Semtex. |
| prostaglandin I3 | |
| Butyrates | |
| nabumetone | |
| Rhamnose | A deoxymannose sugar that is the 6-deoxy derivative of hexose. |
| apaziquone | |
| RB 101 | |
| Ytterbium | A lanthanoid atom that has formula Yb. |
| Geraniin | A tannin that has formula C41H28O27. |
| A 61603 | |
| 5,7-Dihydroxytryptamine | |
| tautomycin | A carboxylic ester that has formula C41H66O13. |
| mono-n-hexyl phthalate | |
| Aflatoxin M1 | A member of the class of aflatoxins that is aflatoxin B1 in which the hydrogen at position 9a is replaced by a hydroxy group. |
| 15-keto-5,8,11,13-eicosatetraenoic acid | |
| mono-N-demethyladinazolam | |
| cirazoline | |
| Bupropion | A propanone that is propan-1-one substituted by a tert-butylamino group at position 2 and a 3-chlorophenyl group at position 1. |
| aspartyl-glutamyl-valyl-aspartal | |
| lucidenic acid N | A tetracyclic triterpenoid that is 25,26,27-trinorlanost-8-en-24-oic acid substituted by hydroxy groups at positions 3 and 7 and oxo groups at positions 11 and 15 respectively (the 3beta,5alpha,7beta stereoisomer). Isolated from the fruiting bodies of Ganoderma lucidum, it exhibits cytotoxicity against tumour cells. |
| Ethoxyquin | A quinoline that is 1,2-dihydroquinoline bearing three methyl substituents at position 2, 2 and 4 as well as an ethoxy substituent at position 6. |
| benzo(c)chrysene | |
| lucidenic acid Q | |
| Acenocoumarol | |
| 7-dehydrocholesterol | |
| 2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | |
| 2-methoxyidazoxan | A benzodioxine that is idazoxan substituted at position 2 by a methoxy group. |
| deslorelin | |
| Mercury | |
| indolo(3,2-b)carbazole | |
| Sotalol | A sulfonamide that is N-phenylmethanesulfonamide in which the phenyl group is sustituted at position 4 by a 1-hydroxy-2-(isopropylamino)ethyl group. It has both beta-adrenoreceptor blocking (Vaughan Williams Class II) and cardiac action potential duration prolongation (Vaughan Williams Class III) antiarrhythmic properties. It is used (usually as the hydrochloride salt) for the management of ventricular and supraventricular arrhythmias. |
| Nalorphine | A morphinane alkaloid that has formula C19H21NO3. |
| Dimethyl Sulfoxide | A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
| traxoprodil mesylate | |
| Oxidopamine | A benzenetriol that is phenethylamine in which the hydrogens at positions 2, 4, and 5 on the phenyl ring are replaced by hydroxy groups. It occurs naturally in human urine, but is also produced as a metabolite of the drug DOPA (used for the treatment of Parkinson's disease). |
| Glyoxal | |
| rostafuroxin | |
| Pesticides | |
| Dmt-NMe-Ala-Aba-Gly-NH2 | |
| aceanthrylene | An ortho- and peri-fused polycyclic arene that has formula C16H10. |
| propargyl alcohol | |
| 3-O-tert-butoxycarbonylspectaline | |
| Antigens | Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| Antipsychotic Agents | Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| 2'-hydroxychalcone | A member of the class of chalcones that is trans-chalcone substituted by a hydroxy group at position 2'. |
| ceftazidime monobactam | |
| Hypolipidemic Agents | A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| (4-amidinophenyl)methanesulfonyl fluoride | |
| chromium hexavalent ion | |
| Etazolate | |
| Sodium Dodecyl Sulfate | An alkyl sulfate that has formula C12H25NaO4S. |
| 3-methyl-N-phenyl-N-(3-(piperidin-1-yl)propyl)benzofuran-2-carboxamide | |
| Pyridoxal Phosphate | |
| 1-((3-benzyl-3-methyl-2,3-dihydro-1-benzofuran-6-yl)carbonyl)piperidine | |
| 1-pentyl-3-(1-naphthoyl)indole | |
| Aflatoxins | Any of a group of related and highly toxic secondary metabolites (mycotoxins) whose main structural feature is a fused coumarin-bis(dihydrofuran) ring system and which are produced by strains of the moulds Aspergillus flavus or A. parasiticus, together with further metabolites of these mycotoxins |
| Luteolin | A 3'-hydroxyflavonoid which is thought to play an important role in the human body as an antioxidant, a free radical scavenger, an agent in the prevention of inflammation, a promoter of carbohydrate metabolism, and an immune system modulator. |
| fexaramine | A biphenyl that has formula C32H36N2O3. |
| dextrallorphan | |
| 4-chloro-N-((4-(1,1-dimethylethyl)phenyl)methyl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide | |
| 4-(4-(bis(4-fluorophenyl)methyl)piperazin-1-ylbut-2-enyloxy)acetic acid | |
| methyl demeton | |
| Tobramycin | A amino cyclitol glycoside that is kanamycin B lacking the 3-hydroxy substituent from the 2,6-diaminoglucose ring. |
| 9-methoxycamptothecin | |
| trimethobenzamide | The amide obtained by formal condensation of 3,4,5-trihydroxybenzoic acid with 4-[2-(N,N-dimethylamino)ethoxy]benzylamine. It is used to prevent nausea and vomitting in humans. |
| heparin-sepharose | |
| Sodium | |
| eburnamonine | An alkaloid that has formula C19H22N2O. |
| Phosphorous Acids | |
| AAL 881 | |
| Clomiphene | A tertiary amine that has formula C26H28ClNO. |
| piclamilast | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 3-(cyclopentyloxy)-4-methoxybenzoic acid with the primary amino group of 3,5-dichloropyridin-4-amine. |
| thymoquinone | |
| 1,7-diphenyl-5-heptene-3-one | |
| xyloglucan | A glucan that consists of a backbone of alpha-(1->4)-linked glucose residues, most of which are substituted with (1->6)-linked xylose side-chains. |
| bisindolylmaleimide I | An indole that has formula C25H24N4O2. |
| ZD 2574 | |
| trimethyloxamine | |
| Corticosterone | A 21-hydroxy steroid that is consists of pregn-4-ene substituted by hydroxy groups at positions 11 and 21 and oxo groups at positions 3 and 20. Corticosterone is a 21-carbon steroid hormone of the corticosteroid type produced in the cortex of the adrenal glands. |
| kaempferol-7-methyl ether | |
| (Cr(salprn)(H2O)2)ClO4 | |
| cyclohexyl methylphosphonofluoridate | |
| heme arginate | |
| Sodium, Dietary | |
| Excitatory Amino Acid Antagonists | Any substance which inhibits the action of receptors for excitatory amino acids. |
| Epoprostenol | |
| CFM 1 | |
| 1-(5-isoquinolinylsulfonyl)-3-methylpiperazine | |
| BAG956 | |
| solifenacin | |
| polydatin | |
| Anions | |
| desethylamodiaquine | |
| 1-benzylimidazole | |
| zymosterol | A 3beta-sterol that has formula C27H44O. |
| Halogenated Diphenyl Ethers | |
| Pentoxifylline | |
| 5-amino-7-(2-phenylethyl)-2-(2-furyl)pyrazolo(4,3-e)-1,2,4-triazolo(1,5-c)pyrimidine | |
| L-826266 | |
| coenzyme Q10 | A ubiquinone having a side chain of 10 isoprenoid units. In the naturally-occurring isomer, all isoprenyl double bonds are in the E- configuration. |
| N-acetylsphingosine | A N-acylsphingosine that has formula C20H39NO3. |
| telithromycin | |
| 2-(2-(2-dimethylaminothiazol-5-yl)ethenyl)-6-(2-(fluoro)ethoxy)benzoxazole | |
| TAPI-2 | |
| digallic acid | A gallate ester that has formula C14H10O9. |
| Neomycin | A broad-spectrum highly toxic antibiotic or mixture of antibiotics produced by a streptomyces (Streptomyces fradiae) and used medically especially to treat local infections. |
| Acetylcarnitine | |
| 4-hydroxyequilenin-o-quinone | |
| 4-nitroaniline | A nitroaniline carrying a nitro group at position 4. |
| 4-benzyloxy-3,5-dimethoxy-N-(1-(dimethylaminocyclopently)methyl)benzamide | |
| gluconic acid | |
| microcrystalline cellulose | |
| 6-hydroxybenzbromarone | |
| gliquidone | |
| N-(2-thiolethyl)-2-(2-(N'-(2,6-dichlorophenyl)amino) phenyl)acetamide | |
| Pertussis Toxin | |
| exenatide | |
| Shuangling Fuzheng anticancer preparation | |
| piperidine | An azacycloalkane that is cyclohexane in which one of the carbons is replaced by a nitrogen. It is a metabolite of cadaverine, a polyamine found in the human intestine. |
| asperulosidic acid | |
| casiopeina II | |
| heptenophos | A trialkyl phosphate that has formula C9H12ClO4P. |
| SB 277011 | |
| isobavachin | |
| (2E,4E,6E,10E)-3,7,11,15-tetramethyl-2,4,6,10,14-hexadecapentaenoic acid | |
| Hydrochloric Acid | |
| olopatadine | |
| proanthocyanidin | A flavonoid oligomer obtained by the the condensation of two or more units of hydroxyflavans. |
| 4-methylhistamine | An aralkylamino compound that is histamine bearing a methyl substituent at the 5 position on the ring. |
| entacapone | |
| hecogenin | A triterpenoid that has formula C27H42O4. |
| BeKm-1 toxin | |
| MT19c compound | |
| Firemaster BP-6 | |
| IMMU-110 | |
| 2-methyl-5-isopropenylcyclohex-2-enone oxime | |
| 1,5-bis(2-bromophenyl)penta-1,4-dien-3-one | |
| KB R7785 | |
| rhodioloside | |
| 4-methylumbelliferyl beta-D-ribopyranoside | |
| di-n-octyl phthalate | A 2-hydroxyisophthalic acid that has formula C24H38O4. |
| Tetrahydropapaveroline | |
| valilactone | |
| sinensetin | A flavonoid that has formula C20H20O7. |
| 4,4'-(1,2-dimethyl-1,2-ethanediyl)bis-2,6-piperazinedione | |
| aniline | A primary arylamine in which an amino functional group is substituted for one of the benzene hydrogens. |
| LM11A-31 | |
| 10-propargyl-10-deazaaminopterin | |
| embelin | A hydroxybenzoquinone that is 1,4-benzoquinone substituted by hydroxy groups at positions 2 and 5 and an undecyl group at position 3. Isolated from, Lysimachia punctata and Embelia ribes, it exhibits antimicrobial, antineoplastic and inhibitory activity towards hepatitis C protease. |
| Technetium | A manganese group element atom that has formula Tc. |
| O,O-diisopropyl-S-benzylthiophosphate | |
| Rolipram | |
| lithocholic acid acetate | |
| dibenzo(a,l)pyrene diol epoxide | |
| 2,6-xylenol | |
| 4-vinylpyridine | |
| rimabotulinumtoxinB | |
| nickel sulfide | |
| abrine | |
| inositol-1,3,4,5,6-pentakisphosphate | |
| Tropicamide | |
| RES 701-1 | |
| botulinum toxin type E | |
| Strontium | An alkaline earth metal atom that has formula Sr. |
| HS 1030 | |
| 2,3-dimethylhydroquinone | |
| norgestimate, ethinyl estradiol drug combination | |
| xanomeline | A tetrahydropyridine that has formula C14H23N3OS. |
| 4-nitrophenyl 2-propylmethylphosphonate | |
| 1,2-didecanoylglycerol | A 1,2-diglyceride that has formula C23H44O5. |
| gamma-sitosterol | |
| Zearalenone | A macrolide comprising a fourteen-membered lactone fused to 1,3-dihydroxybenzene; a potent estrogenic metabolite produced by some Giberella species. |
| anthra(1,9-cd)pyrazol-6(2H)-one | |
| norverapamil | |
| tiaprofenic acid | An aromatic ketone that is thiophene substituted at C-2 by benzoyl and at C-4 by a 1-carboxyethyl group. |
| Pyrazines | |
| pranlukast | |
| Meperidine | |
| Clofazimine | |
| 4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-3H-cyclopenta(c)quinoline | |
| EMD 534085 | |
| Azepines | |
| 2-azido-3-iodo-7,8-dibromodibenzo-1,4-dioxin | |
| CB 3717 | A N-acyl-L-glutamic acid that has formula C24H23N5O6. |
| 3,3',5,5'-tetrahydroxystilbene | |
| muraglitazar | |
| 5-(4-(2-(2-ethyl-4-methyl-6-oxo-1,6-dihydro-1-pyrimidinyl)ethoxy)phenylmethyl)thiazolidine-2,4-dione | |
| befloxatone | |
| procyanidin | |
| (3,4-dihydroxyphenylamino)-2-imidazoline | |
| 4-Chloromercuribenzenesulfonate | |
| N-(3-(aminomethyl)benzyl)acetamidine | |
| alpha-viniferin | A nine-membered macrocycle that incorporates three 6-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuranyl moieties as part of the cyclic skeleton. It is isolated from Caragana chamlague Lamarck and exhibits significant inhibitory effect towards the enzyme acetylcholinesterase (EC 3.1.1.7). |
| AM 251 | |
| Diazinon | A member of the class of pyrimidines that is pyrimidine carrying an isopropyl group at position 2, a methyl group at position 6 and a (diethoxyphosphorothioyl)oxy group at position 4. |
| Silicon Compounds | |
| 5-hydroxymethylfurfural | A member of the class of furans that is furan which is substituted at positions 2 and 5 by formyl and hydroxymethyl substituents, respectively. Virtually absent from fresh foods, it is naturally generated in sugar-containing foods during storage, and especially by drying or cooking. It is the causative component in honey that affects the presystemic metabolism and pharmacokinetics of GZ in-vivo. |
| drospirenone | |
| resiniferatoxin | A diterpenoid that has formula C37H40O9. |
| Sulfaphenazole | A sulfonamide that is sulfanilamide in which the sulfonamide nitrogen is substituted by a 1-phenyl-1H-pyrazol-5-yl group. It is a selective inhibitor of cytochrome P450 (CYP) 2C9 isozyme, and antibacterial agent. |
| Buprenorphine | A morphinane alkaloid that is 7,8-dihydromorphine 6-O-methyl ether in which positions 6 and 14 are joined by a -CH2CH2- bridge, one of the hydrogens of the N-methyl group is substituted by cyclopropyl, and a hydrogen at position 7 is substituted by a 2-hydroxy-3,3-dimethylbutan-2-yl group. |
| sodium metasilicate | |
| Contraceptives, Oral | |
| 5-(4-methylpiperazin-1-yl)-2-(2'-(3,4-dimethoxyphenyl)-5'-benzimidazolyl)benzimidazole | |
| Epichlorohydrin | An epoxide that is 1,2-epoxypropene in which one of the methyl hydrogens is substituted by chlorine. |
| Methyl n-Butyl Ketone | |
| Ozone | An elemental molecule with formula O3. An explosive, pale blue gas (b.p. -112degreeC) that has a characteristic, pleasant odour, it is continuously produced in the upper atmosphere by the action of solar ultraviolet radiation on atmospheric oxygen. It is an antimicrobial agent used in the production of bottled water, as well as in the treatment of meat, poultry and other foodstuffs. |
| copper pyruvaldehyde bis(N(4)-methylthiosemicarbazone) complex | |
| aldosterone 18-glucuronide | |
| Cholesterol | |
| Cholecystokinin | |
| 1,2,7,8-tetrachlorodibenzofuran | |
| flosulide | |
| Noscapine | |
| 18-hydroxydeoxycorticosterone | |
| juzentaihoto | |
| bisacurone | |
| CHF 5022 | |
| alternariol monomethyl ether | An organic molecular entity that has formula C15H24O5. |
| Dibenz(b,f)(1,4)oxazepine-10(11H)-carboxylic acid, 8-chloro-, 2-acetylhydrazide | |
| lovastatin-niacin combination | |
| Platinum | A nickel group element atom that has formula Pt. |
| ruboxistaurin | |
| pentrinitrol | |
| Aminooxyacetic Acid | |
| Phosphatidylinositols | |
| Harmine | A harmala alkaloid in which the harman skeleton is methoxy-substituted at C-7. |
| Indoles | Any compound containing an indole skeleton. |
| homochlorocyclizine | |
| Porphobilinogen | A dicarboxylic acid that is pyrole bearing aminomethyl, carboxymethyl and 2-carboxyethyl substituents at positions 2, 3 and 4 respectively. |
| N-(3-fluorophenyl)-1-((4-(((3S)-3-methyl-1-piperazinyl)methyl)phenyl)acetyl)-4-piperidinamine | |
| 5,10,15,20-(etra(N-methyl-3-pyridyl))-26,28-diselenasapphyrin chloride | |
| 2-amino-3,8-dimethylimidazo(4,5-f)quinoxaline | |
| icajine | |
| Dicofol | A tertiary alcohol that is DDT in which the benzylic hydrogen has been replaced by a hydroxy group. |
| 4-hydroxypropranolol | |
| Ribonucleosides | |
| GW 501516 | An aromatic ether that is phenoxyacetic acid in which the phenyl group is substituted at position 2 by a methyl group and at position 4 by a (1,3-thiazol-5-ylmethyl)sulfanediyl group, and in which the 1,3-thiazolyl group is substituted at positions 2 and 4 by p-trifluoromethylphenyl and methyl groups, respectively. |
| 8-bromocyclic GMP | |
| D-161 compound | |
| Adrenergic beta-Antagonists | |
| AST 120 | |
| benzyloxyresorufin | |
| Androgens | |
| ethion | An organic thiophosphate that is S,S'-methanediyl bis[dihydrogen (phosphorodithioate)] in which all the hydroxy groups have been converted to their corresponding ethyl esters respectively. Ethion is an organophosphate insecticide with inhibitory activity towards the enzyme acetylcholinesterase ( EC 3.1.1.7). |
| 8-Bromo Cyclic Adenosine Monophosphate | |
| Cyclohexenes | |
| liarozole | |
| 4-(4-bromophenyl)-2,3-dihydro-N,3-bis(3,4,5-trimethoxyphenyl)-2-oxoidmi-dazole-1-carboxamide | |
| Thromboxane A2 | A thromboxane which is produced by activated platelets and has prothrombotic properties: it stimulates activation of new platelets as well as increases platelet aggregation. |
| SU 6656 | |
| F2-Isoprostanes | |
| G(M3) Ganglioside | |
| 8-isoprostaglandin E2 | |
| isobutyl alcohol | |
| withaferin A | A withanolide that is 5,6:22,26-diepoxyergosta-2,24-diene-1,26-dione substituted by hydroxy groups at positions 4 and 27 (the 4beta,5beta,6beta,22R stereoisomer). Isolated from Physalis longifolia, it exhibits cytotoxic activity. |
| Carbapenems | The class of beta-lactam antibiotics that whose members have a carbapenem skeleton which is variously substituted at positions 3, 4, and 6. |
| acetyl-aspartyl-glutamyl-valyl-aspartic acid p-nitroanilide | |
| 6-anilino-5,8-quinolinedione | A quinolone that is quinoline-5,8-dione in which the hydrogen at position 6 is replaced by an anilino group. |
| brassinin | A dithiocarbamic ester that has formula C11H12N2S2. |
| 3-hydroxypregn-4-en-20-one | |
| AL-10 compound | |
| amlodipine, atorvastatin drug combination | |
| Phosphoenolpyruvate | A monocarboxylic acid anion resuting from selective deprotonation of the carboxy group of phosphoenolpyruvic acid. |
| 4-propylphenol | An alkylbenzene that has formula C9H12O. |
| virodhamine | |
| benzidine | A biphenyl that has formula C12H12N2. |
| hydroxymethylbilane | |
| N-(2-(4-((3-chloro-4-(3-(trifluoromethyl)phenoxy)phenyl)amino)-5H-pyrrolo(3,2-d)pyrimidin-5-yl)ethyl)-3-hydroxy-3-methylbutanamide | |
| IMOL S-140 | |
| methyleugenol | |
| Carmustine | |
| Calcium | |
| corexit 9500 | |
| O-(chloroacetylcarbamoyl)fumagillol | |
| tetrakis(4-benzoic acid)porphyrin | |
| nociceptin (1-13)-NH2, Phe(1)-psi(CH2-NH)-Gly(2)- | |
| sarpogrelate | |
| ethylene glycol monohexyl ether | |
| Hydrocarbons, Brominated | |
| 1,4-bis(4-hydroxyiminomethylpyridinium)butane dibromide | |
| dihydrosanguinarine | A benzophenanthridine alkaloid obtained by selective hydrogenation of the 13,14-position of sanguinarine. |
| 2,3-dimethoxy-5-methyl-6-decyl-1,4-benzoquinone | |
| N(1), N(12)-diethylspermine | |
| 2-cyano-3-hydroxy-N-(4-(trifluoromethyl)phenyl)-2-hepten-6-ynamide | |
| Flufenamic Acid | |
| 7-hydroxy-4-trifluoromethylcoumarin | |
| spiroxamine | The spiroketal resulting from the formal condensation of 4-tert-butylcyclohexanone with 3-[ethyl(propyl)amino]propane-1,2-diol. An inhibitor of ergosterol synthesis, it is a broad spectrum agricultural fungicide used particularly against powdery mildew in the production of cereals, bananas and grapes. |
| 3-caffeoyl-4-dicaffeoylquinic acid | |
| bathophenanthroline | |
| HOE 140, desArg(10)- | |
| VX680 | |
| inecalcitol | |
| Humic Substances | |
| ammonium trichloro(dioxoethylene-O,O'-)tellurate | |
| 3-oxocholan-24-oic acid | |
| CP-470711 | |
| butamifos | A C-nitro compound that has formula C13H21N2O4PS. |
| Chlorophyllides | Chlorophylls lacking the terpenoid side chain such as phytyl or farnesyl. |
| glucoraphanin | A glucosinolic acid that consists of 1-thio-beta-D-glucopyranose attached to a 5-(methylsulfinyl)-N-(sulfooxy)pentanimidoyl group at the anomeric sulfur. |
| 3-nitroperylene | A phenanthrene that has formula C20H11NO2. |
| dexpanthenol | |
| 2-arachidonylglycerol | |
| diacetyldiphenylurea bisguanylhydrazone | |
| Diazooxonorleucine | |
| 3-hydroxydesloratadine | |
| SL 327 | |
| atazanavir | |
| estradiol sulfate | |
| Dimethylnitrosamine | |
| Iodocyanopindolol | An indole that is 1H-indole substituted at positions 2, 3 and 7 by cyano, iodo and 3-(tert-butylamino)-2-hydroxypropoxy groups respectively. |
| tanshinone II A sodium sulfonate | |
| limonene | |
| Carbon Dioxide | A one-carbon compound with formula CO2 in which the carbon is attached to each oxygen atom by a double bond. A colourless, odourless gas under normal conditions, it is produced during respiration by all animals, fungi and microorganisms that depend directly or indirectly on living or decaying plants for food. |
| L 655238 | |
| Sterigmatocystin | An organic heteropentacyclic compound whose skeleton comprises a xanthene ring system ortho-fused to a dihydrofuranofuran moiety. The parent of the class of sterigmatocystins. |
| lomeguatrib | |
| carveol | A limonene monoterpenoid that is cyclohex-2-en-1-ol substituted by a methyl group at position 2 and a prop-1-en-2-yl group at position 5. |
| Diminazene | A triazene derivative that is triazene in which each of the terminal nitrogens is substituted by a 4-carbamimidoylphenyl group. |
| mequitazine | |
| daidzin | |
| Naloxone | A morphinane alkaloid that has formula C19H21NO4. |
| phorbol-12-myristate | |
| N-(3-furylmethyl)eicosa-5,8,11,14-tetraenamide | |
| 17-benzyl-5-androstane-3,17-diol | |
| nitroaspirin | |
| 1-(beta-naphthylmethyl)-6,7-dihydroxy-1,2,3,4-tetra-hydroisoquinoline | |
| azetidine-2,4-dicarboxylic acid | |
| Ethyl Methanesulfonate | A methanesulfonate ester resulting from the formal condensation of methanesulfonic acid with ethanol. |
| N2 Dental Cement | |
| 2-(4-(2-(3,4-dichlorophenyl)ethyl)phenylamino)benzoic acid | |
| 2,4-nonadienal | |
| bullatacin | A polyketide that has formula C37H66O7. |
| 4-(2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)-1-propenyl)benzoic acid | |
| thorium nitrate | |
| Erythrosine | |
| dithiol | |
| spiro(imidazo-(1,2-a)pyridine-3,2-indan)-2(3H)-one | |
| Guaiacol | |
| Trinitrobenzenesulfonic Acid | |
| methoxyamine | |
| Polyglutamic Acid | |
| ABT-100 | |
| Digitoxigenin | A 5beta-cardenolide having hydroxy substituents at the 3beta- and 14beta-positions. |
| hexaarginine amide | |
| propylparaben | |
| roflumilast N-oxide | |
| CDP 840 | |
| cypermethrin | A carboxylic ester resulting from the formal condensation between 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and the alcoholic hydroxy group of hydroxy(3-phenoxyphenyl)acetonitrile. |
| gemcitabine | A 2'-deoxycytidine having geminal fluoro substituents in the 2'-position. An inhibitor of ribonucleotide reductase, gemcitabine is used in the treatment of various carcinomas, particularly non-small cell lung cancer, pancreatic cancer, bladder cancer and breast cancer. |
| N3-(4-(4-morpholinocyclohexyl)phenyl)-1-(pyridin-2-yl)-1H-1,2,4-triazole-3,5-diamine | |
| phenylpropylene oxide | |
| cholesterol alpha-oxide | |
| Trifluperidol | |
| styrofoam | |
| Cisapride | The amide resulting from formal condensation of 4-amino-5-chloro-2-methoxybenzoic acid with cis-1-[3-(4-fluorophenoxy)propyl]-3-methoxypiperidin-4-amine. It has been used (as its monohydrate or as its tartrate) for the treatment of gastro-oesophageal reflux disease and for non-ulcer dyspepsia, but its propensity to cause cardiac arrhythmias resulted in its complete withdrawal from many countries, including the U.K., and restrictions on its use elsewhere. |
| 4,4-difluoro-4-bora-3a,4a-diaza-s-indacene | A BODIPY compound that has formula C9H7BF2N2. |
| N-methylhistamine | |
| cholest-5-en-3 beta,7 alpha-diol | |
| O(2)-vinyl-1-(pyrrolidin-1-yl)diazen-1-ium-1,2-diolate | |
| di-n-butyltin | |
| D-JNKI-1 | |
| palladium chloride | |
| 18-methoxycoronaridine | |
| 9-fluorenone | |
| Cetylpyridinium | A pyridinium ion that has formula C21H38N. |
| Quaternary Ammonium Compounds | Derivatives of ammonium compounds, (NH4(+))Y(-), in which all four of the hydrogens bonded to nitrogen have been replaced with univalent (usually hydrocarbyl) groups. |
| nonanal | A fatty aldehyde formally arising from reduction of nonanoic acis. Metabolite observed in cancer metabolism. |
| 1,3-butadiene | |
| alpha-cobratoxin | |
| Thiotepa | |
| 7-methoxy-4-(aminomethyl)coumarin | |
| berbamine | An isoquinoline that has formula C37H40N2O6. |
| bis(12)-hupyridone | |
| Pyridoxine | A hydroxymethylpyridine with hydroxymethyl groups at positions 4 and 5, a hydroxy group at position 3 and a methyl group at position 2. |
| netoglitazone | |
| 3,7,11-trimethyldodeca-2,6,10-trienoic acid hexadecylamide | |
| n-propylbenzene | |
| Maleic Hydrazide | A pyridazinone that has formula C4H4N2O2. |
| Porfiromycin | |
| 4-aminobenzamide | |
| 4-(4-dimethylaminostyryl)-1-methylpyridinium | |
| lysophosphatidylglycerol | |
| Carticaine | |
| tauromuricholic acid | |
| 1,2-cyclohexanediamine | |
| raltegravir | |
| Cephaloridine | |
| calycopterin | |
| pretilachlor | An anilide that has formula C17H26ClNO2. |
| iodoresiniferatoxin | |
| Procyclidine | |
| chromium dinicocysteinate | |
| 4,4'-dinitro-2,2'-stilbenedisulfonic acid | |
| 4-((3-bromophenyl)amino)-6,7-dimethoxyquinazoline | |
| 3,3'-Dichlorobenzidine | A biphenyl that has formula C12H10Cl2N2. |
| benzo(a)pyrene-7,8-dihydrodiol-9,10-epoxide-DNA | |
| Delavirdine | |
| sodium selenide | An inorganic sodium salt having selenide as the counterion. |
| SD-208 | |
| 2-methylphenanthrene | |
| 1,2,3,4,6,7,8-heptachlorodibenzofuran | A chlorin that has formula C12HCl7O. |
| 4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-anthracenyl)benzoic acid | |
| toxin II (Anemonia sulcata) | |
| 5-methoxy-1-methyl-2-(n-propylamino)tetralin | |
| cyclopenta(c,d)pyrene | A pyrene that has formula C18H10. |
| Menhaden oil | |
| Hydrazines | Hydrazine (diazane) and its substituted derivatives. |
| N-acetyl-4-benzoquinoneimine | |
| PS1145 | |
| norathyriol | A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 6 and 7. Isolated from Garcinia mangostana and Maclura pomifera, it exhibits inhibitory activity against protein kinase C. |
| ponkoranol | |
| n-dodecane | |
| 4'-hydroxywarfarin | |
| naphthoresorcinol | |
| Thyronines | |
| 2-phenyl-4,4,5,5-tetramethylimidazoline-1-oxyl-3-oxide | |
| chromium (D-Phenylalanine)3 | |
| Fructose | A ketohexose that is an isomer of glucose. |
| Bromocriptine | An indole alkaloid that has formula C32H40BrN5O5. |
| butyl phosphorotrithioate | |
| 6-hydroxytaxol | |
| melamine | A trimer of cyanamide, with a 1,3,5-triazine skeleton. |
| Uracil | |
| gedunin | A pentacyclic triterpenoid natural product found particularly in Azadirachta indica and Cedrela odorata. |
| thymeleatoxin | |
| 1,8-diaminonaphthalene | |
| Aminoquinolines | |
| N-methyl-N-benzylnitrosamine | |
| 3-(3-chloro-4-hydroxyphenylamino)-4-(4-nitrophenyl)-1H-pyrrole-2,5-dione | |
| sphingosine 1-phosphate | A phosphosphingolipid that consists of sphingosine having a phospho group attached at position 1 |
| mono-(2-ethylhexyl)phthalate | The mono(2-ethylhexyl) ester of benzene-1,2-dicarboxylic acid. |
| N-(4-aminobutyl)-5-chloro-2-naphthalenesulfonamide | |
| Indocyanine Green | A benzoindole that has formula C43H47N2NaO6S2. |
| 1-methyl-4-phenyl-2,3-dihydropyridinium | |
| Hypoxanthine | A purine nucleobase that consists of purine bearing an oxo substituent at position 6. |
| Tretinoin | |
| nilutamide | |
| mesulergine | A member of the class of ergot alkaloids that is known to act on serotonin and dopamine receptors. |
| Ethylnitrosourea | |
| phenyl biguanide | A member of the class of biguanides that is biguanide in which one of the terminal nitrogen atoms is substituted by a phenyl group. |
| alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic Acid | |
| ponceau 4R | |
| 3',4',7-trihydroxyisoflavone | A 7-hydroxyisoflavone that is daidzein substituted by a hydroxy group at position 3'. |
| arachidin-1 | |
| ethanolamine O-sulfate | |
| 2-Propanol | |
| estradiol, norethindrone drug combination | |
| hydroxyoctadecadienoic acid | |
| mulberroside A | |
| Folic Acid Antagonists | An antimetabolite that impairs the action of folic acids |
| Ranitidine | A member of the class of furans used to treat peptic ulcer disease (PUD) and gastroesophageal reflux disease. |
| Thalidomide | |
| 1-(2-methoxyphenyl)-4-(4-(2-phthalimido)butyl)piperazine | |
| 4',5'-bis(1,3,2-dithioarsolan-2-yl)fluorescein | |
| macrophage stimulatory lipopeptide 2 | |
| PBOX-6 | |
| pheomelanin | |
| isomalathion | |
| perfluorodecanoic acid | A fluoroalkanoic acid that is perfluorinated decanoic acid. |
| Graphite | An allotropic form of the element carbon consisting of layers of hexagonally arranged carbon atoms in a planar condensed ring system (graphene layers). The layers are stacked parallel to each other in a three-dimensional crystalline long-range order. There are two allotropic forms with different stacking arrangements, hexagonal and rhombohedral. The chemical bonds within the layers are covalent with sp(2) hybridization and with a C--C distance of 141.7 pm. The weak bonds between the layers are metallic with a strength comparable to van der Waals bonding only. |
| 4-ethynylbiphenyl | |
| tandospirone | |
| mafosfamide | |
| Sulpiride | |
| Tetraisopropylpyrophosphamide | |
| DDMS | |
| flunisolide | A cyclic ketal that has formula C24H31FO6. |
| naphthol AS-E phosphate | |
| indenoindole | |
| 3,5-bis(2-fluorobenzylidene)piperidin-4-one | |
| methyllycaconitine | A diterpenoid that has formula C37H50N2O10. |
| 2-acetylphenothiazine | |
| olomoucine | |
| 11,14,15-trihydroxyeicosa-5,8,12-trienoic acid | |
| Metanephrine | |
| HMR 1098 | |
| Melphalan | A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring. |
| U 40481 | |
| 4-mercuribenzoate | |
| methyl 2,5-dihydroxycinnamate | |
| 1,4,5,8-naphthalenetetracarboxylic diimide | |
| Heroin | |
| idobenzamide | |
| N-(2-aminoethyl)-5-chloroisoquinoline-8-sulfonamide | A member of the class of isoquinolines that is isoquinoline-8-sulfonamide which is substituted by chlorine at position 5 and in which the sulfonamide nitrogen is substituted by a 2-aminoethyl group. It is an inhibitor of casein kinase I. |
| 2,3,4,2',3',4'-hexachlorobiphenyl | |
| brilliant blue | An organic molecular entity that has formula C37H34N2Na2O9S3. |
| 4-oxo-2-nonenal | |
| (N-(1-(((cyanoimino)(5-quinolinylamino) methyl) amino)-2,2-dimethylpropyl)-2-(3,4-dimethoxyphenyl)acetamide) | |
| glycoursodeoxycholic acid | |
| vinyl bromide | |
| neoechinulin | |
| Hesperidin | A disaccharide derivative that consists of hesperetin substituted by a 6-O-(alpha-L-rhamnopyranosyl)-beta-D-glucopyranosyl moiety at position 7 via a glycosidic linkage. |
| Riboflavin | D-Ribitol in which the hydroxy group at position 5 is substituted by a 7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl moiety. It is a nutritional factor found in milk, eggs, malted barley, liver, kidney, heart, and leafy vegetables, but the richest natural source is yeast. The free form occurs only in the retina of the eye, in whey, and in urine; its principal forms in tissues and cells are as flavin mononucleotide and flavin-adenine dinucleotide. |
| tPA stop | |
| pinosylvin | A stilbenol that has formula C14H12O2. |
| OXT-328 | |
| N-ethyl-3-toluamide | |
| 2',7'-bis(carboxyethyl)-5(6)-carboxyfluorescein | |
| pregnanediol-3 alpha-glucuronide | |
| Dicamba | A methoxybenzoic acid that is O-methylsalicylic acid substituted by chloro groups at positions 3 and 6. |
| rhodostomin | |
| Polychlorinated Biphenyls | |
| 4,4'-diphenylmethane diisocyanate | |
| benzo(a)pyrene-7,8,9,10-tetrol | |
| laquinimod | |
| 2-amino-1-methyl-6-(4-hydroxyphenyl)imidazo(4,5-b)pyridine | |
| Polylysine | A poly(amide) polymer, composed of poly(lysine) macromolecules. |
| 11-dehydro-thromboxane B2 | A thromboxane obtained by formal oxidation of the hemiacetal hydroxy function of thromboxane B2. |
| 6alpha-ethyl-23(S)-methylcholic acid | |
| cabergoline | An N-acylurea that is (8R)-ergoline-8-carboxamide in which the hydrogen attached to the piperidine nitrogen (position 6) is substituted by an allyl group and the hydrogens attached to the carboxamide nitrogen are substituted by a 3-(dimethylamino)propyl group and an N-ethylcarbamoyl group. A dopamine D2 receptor agonist, cabergoline is used in the management of Parkinson's disease and of disorders associated with hyperprolactinaemia. |
| imatinib | |
| 3-azibutanol | |
| piplartine | A cinnamamide that has formula C17H19NO5. |
| Trioxsalen | |
| broussochalcone A | |
| salubrinal | |
| Gossypol | A polyphenol that has formula C30H30O8. |
| Procaine | A benzoate ester, formally the result of esterification of 4-aminobenzoic acid with 2-diethylaminoethanol but formed experimentally by reaction of ethyl 4-aminobenzoate with 2-diethylaminoethanol. |
| BAY 11-7085 | |
| Dactinomycin | |
| antrocin | |
| Bromine | A monoatomic bromine that has formula Br. |
| azoxystrobin | An aryloxypyrimidine having a 4,6-diphenoxypyrimidine skeleton in which one of the phenyl rings is cyano-substituted at C-2 and the other carries a 2-methoxy-1-(methoxycarbonyl)vinyl substituent, also at C-2. An inhibitor of mitochondrial respiration by blocking electron transfer between cytochromes b and c1, it is used widely as a fungicide in agriculture. |
| Sulfur Compounds | |
| 2-(4-morpholinyl)-8-phenyl-4H-1-benzopyran-4-one | |
| pirfenidone | |
| gimeracil | |
| N(6)-cyclopentyladenosine | |
| Normetanephrine | |
| diethofencarb | A carbamate ester that is the isopropyl ester of (3,4-diethoxyphenyl)carbamic acid. A fungicide with strong activity against Botrytis cinerea and benzimidazole-resistant strains of Botryis spp. |
| cobra venom factor | |
| FOE 5043 | |
| proxyfan | |
| methylene bromide | |
| morphiceptin | |
| EUK-134 | |
| 4-nitroacetophenone | A member of the class of acetophenones that is acetophenone substituted at the para-position by a nitro group. |
| ZK 119010 | |
| mepenzolic acid | |
| 17-ethynyl-5-androstene-3, 7, 17-triol | |
| Ruthenium | An iron group element atom that has formula Ru. |
| Deoxyadenosines | |
| Methotrexate | A pteridine that has formula C20H22N8O5. |
| Guanosine Triphosphate | |
| NSC 724998 | |
| caprylic aldehyde | |
| benzophenone | |
| 1,2,3,7,8-pentachlorodibenzofuran | A chlorin that has formula C12H3Cl5O. |
| cefepime | A cephalosporin bearing (1-methylpyrrolidinium-1-yl)methyl and (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
| verbenone | |
| 2-(4-((dimethylamino)carbonyl)-3-fluorophenyl)-alpha,alpha-dimethyl-N-1,3,4-thiadiazol-2-yl-5H-(1)benzopyrano(2,3-b)pyridin-5-acetamide | |
| hypotaurine | An aminosulfinic acid comprising ethylamine having the sulfo group at the 2-position. |
| SR 48692 | |
| perchlorate | A monovalent inorganic anion obtained by deprotonation of perchloric acid. |
| naphtho(1,2-b)fluoranthene | A carbopolycyclic compound that has formula C24H14. |
| Bendroflumethiazide | A sulfonamide consisting of 7-sulfamoyl-3,4-dihydro-2H-1,2,4-benzothiadiazine 1,1-dioxide in which the hydrogen at position 6 is substituted by a trifluoromethyl group and that at position 3 is substituted by a benzyl group. |
| zotarolimus | |
| 1H-(1,2,3)oxadiazolo(4,4-a)quinoxalin-1-one | |
| sulindac sulfide | An aryl sulfide that is a metabolite of sulindac. A non-steroidal anti-inflammatory drug, which also has anticancer activity. |
| Flurbiprofen | A fluorobiphenyl that has formula C15H13FO2. |
| 10-nitro-oleic acid | |
| Methyl Methanesulfonate | A methanesulfonate ester resulting from the formal condensation of methanesulfonic acid with methanol. |
| Imidazoles | A five-membered organic heterocycle containing two nitrogen atoms at positions 1 and 3, or any of its derivatives; compounds containing an imidazole skeleton. |
| bopindolol | |
| Sodium Iodide | A metal iodide salt with a Na(+) counterion. |
| bis(maleimido)ethane | |
| Lu 28-179 | |
| heminordihydroguaiaretic acid | |
| drotaverin | |
| palmidrol | |
| inostamycin | |
| estradiol 3,17-disulfate | |
| amibegron | |
| pentaacetyl geniposide | |
| testosterone glucuronate | |
| dioctanoylphosphatidic acid | |
| vasopressin, Phe(2)-Ile(3)-Hgn(4)-Orn(iPr)(8)- | |
| Alcohols | A compound in which a hydroxy group, -OH, is attached to a saturated carbon atom. |
| S(alpha)-methyl-6-(2-quinolinylmethoxy)-2-naphthaleneacetic acid | |
| Allantoin | An imidazolidine-2,4-dione that is 5-aminohydantoin in which a carbamoyl group is attached to the exocyclic nitrogen. |
| dihydrofluorescein | |
| Meclofenamic Acid | An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,6-dichloro-3-methylphenyl group. A non-steroidal anti-inflammatory drug, it is used as the sodium salt for the treatment of dysmenorrhoea (painful periods), osteoarthritis and rheumatoid arthritis. |
| 6-aminoindazole | |
| picrotoxinin | A furopyran that has formula C15H16O6. |
| 2-(4,5-dihydro-1,3-thiazol-2-ylthio)-1-(3,4-dihydroxyphenyl)ethanone | |
| 6,6'-bis(2,3-dimethoxybenzoyl)-alpha,alpha-trehalose | |
| adenosine 3'-phosphate-5'-phosphate | |
| 2,6-di-tert-butyl-4-(3-hydroxy-2,2-dimethylpropyl)phenol | |
| Oxazines | |
| Nitrosourea Compounds | |
| JTP 4819 | |
| SB 225002 | |
| terbufos | An organothiophosphate insecticide that has formula C9H21O2PS3. |
| A-582941 | |
| roscovitine | |
| terpinenol-4 | |
| SR 144190 | |
| 2,2',4,5'-tetrabromodiphenyl ether | An organobromine compound that has formula C12H6Br4O. |
| Melarsoprol | A triazine that has formula C12H15AsN6OS2. |
| indium trichloride | |
| N-(2-fluoro-4-((2-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)carbonylaminopyridin-4-yl)oxy)phenyl)-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide | |
| Lithium Chloride | A metal chloride salt with a Li(+) counterion. |
| ziprasidone | A piperazine compound having 1,2-benzothiazol-3-yl- and 2-(6-chloro-1,3-dihydro-2-oxindol-5-yl)ethyl substituents attached to the nitrogen atoms. |
| Protoporphyrins | |
| 2',4'-dihydroxychalcone | |
| cordycepin | A 3'-deoxyribonucleoside that has formula C10H13N5O3. |
| Lithium Carbonate | A carbonate salt that has formula CO3.2Li. |
| pyrvinium | |
| Progesterone | A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
| naphthyl sulfate | |
| tetrapropylammonium | A quarternary ammonium cation with four propyl substituents around the central nitrogen. |
| Xenon | |
| Quinones | Compounds having a fully conjugated cyclic dione structure, such as that of benzoquinones, derived from aromatic compounds by conversion of an even number of -CH= groups into -C(=O)- groups with any necessary rearrangement of double bonds (polycyclic and heterocyclic analogues are included). |
| alternariol | A benzochromenone that is 6H-benzo[c]chromen-6-one which is substituted by a methyl group at position 1 and by hydroxy groups at positions 3, 7, and 9. It is the most important mycotoxin produced by the black mould Alternaria species, which are the most common mycoflora infecting small grain cereals worldwide. |
| bromacil | A racemate consisting of equimolar concentrations of (R)- and (S)-bromacil. |
| 2,2',4,6'-tetramethoxystilbene | |
| 4-O-methyl-12-O-tetradecanoylphorbol 13-acetate | |
| Shiga Toxin | |
| antroquinonol | An enone that is cyclohex-2-en-1-one substituted by a hydroxy group at position 4, methoxy groups at positions 2 and 3, a methyl group at position 6 and a (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl group at position 5 (the 4R,5R,6R stereoisomer). It is isolated from the solid-state fermented mycelium of the fungus Antrodia camphorata and has been found to exhibit potent cytotoxicity against a number of human cancer cell lines. |
| iron(III)-ascorbic acid complex | |
| destruxin B | |
| L-826,141 | |
| Phenethylamines | |
| scutellarin | The glycosyloxyflavone which is the 7-O-glucuronide of scutellarein. |
| Rifabutin | |
| quercitrin | A quercetin O-glycoside that is quercetin substituted by a alpha-L-rhamnosyl moiety at position 3 via a glycosidic linkage. |
| Trichlorfon | |
| estrone sulfate | |
| Methylhistamines | |
| tetraiodothyroacetic acid | |
| polychlorodibenzo-4-dioxin | |
| 1-Propanol | |
| Methoxydimethyltryptamines | |
| Benzoquinones | A quinone that is a cyclohexadiene which is substituted by two oxo groups. |
| Floxuridine | |
| sodium cyanoborohydride | |
| SQ 29548 | |
| Gemfibrozil | An aromatic ether that has formula C15H22O3. |
| Phenylglyoxal | |
| prostaglandin A2 | A prostaglandins A that has formula C20H30O4. |
| Fenoprofen | Propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding. |
| 2-(2-aminoethyl)pyridine | |
| calycosin-7-O-beta-D-glucoside | |
| 1-(4-ethynylphenyl)-4-propyl-2,6,7-trioxabicyclo(2.2.2)octane | |
| tributyl citrate | |
| phenylmethylpyrazolone | |
| indeno(1,2,3-cd)pyrene | A pyrene that has formula C22H12. |
| Heptachlor | A cyclodiene organochlorine insecticide that is 3a,4,7,7a-tetrahydro-1H-4,7-methanoindene substituted by chlorine atoms at positions 1, 4, 5, 6, 7, 8 and 8. |
| olivetol | A member of the class of resorcinols that is resorcinol in which the hydrogen at position 5 is replaced by a pentyl group. |
| Acyclovir | An oxopurine that is guanine substituted by a (2-hydroxyethoxy)methyl substituent at position 9. |
| BEP protocol | |
| 2,4,6-trichlorophenyl 4-nitrophenyl ether | |
| Trityl Compounds | |
| Ro 16-6491 | |
| glimepiride | A N-acylurea that has formula C24H34N4O5S. |
| 4-((3,4-(methylenedioxy)benzyl)amino)-6-methoxyquinazoline | |
| Neurokinin A | A polypeptide that has formula C50H80N14O14S. |
| indole-5-carboxamide | |
| Cholic Acid | A bile acid that is 5beta-cholan-24-oic acid bearing three alpha-hydroxy substituents at position 3, 7 and 12. |
| 3,4,5,4'-tetramethoxystilbene | |
| tiadenol | |
| nickel nitrate | |
| molybdate | A divalent inorganic anion obtained by removal of both protons from molybdic acid |
| sanshool | |
| protoporphyrinogen | A porphyrinogen that has formula C34H40N4O4. |
| naphthyl glucuronide | |
| N-acetyl-S--(1,2,3,4,4-pentachlorobutadienyl)cysteine sulfoxide | |
| Nitrofurantoin | An imidazolidine-2,4-dione that is hydantoin substituted at position 1 by a (5-nitro-2-furyl)methylene]amino group. An antibiotic that damages bacterial DNA. |
| 1,2-epoxy-3-(p-nitrophenoxy)propane | |
| danusertib | |
| Sulfisoxazole | A sulfonamide antibacterial with an oxazole substituent. It has antibiotic activity against a wide range of gram-negative and gram-positive organisms. |
| 4-chlorobiphenyl | A monochlorobiphenyl carrying a chloro substituent at position 4. |
| lauric acid | A straight-chain, twelve-carbon medium-chain saturated fatty acid with strong bactericidal properties; the main fatty acid in coconut oil and palm kernel oil. |
| cyazofamid | A member of the class of imidazoles carrying dimethylsulfamyl, cyano, chloro and 4-tolyl substituents at positions 1, 2, 4 and 5 respectively. A fungicide used mainly for controlling Oomycete and Plasmodiophora diseases on potatoes and tomatoes. It is a skin and eye irritant and is moderately toxic to birds, most aquatic organisms, honeybees and earthworms. |
| methylmercury hydroxide | |
| 1,2,3,4,6,7-hexachlorinated naphthalene | |
| myricetin | A hexahydroxyflavone that is flavone substituted by hydroxy groups at positions 3, 3', 4', 5, 5' and 7. It has been isolated from the leaves of Myrica rubra and other plants. |
| propionamide | A monocarboxylic acid amide obtained by the formal condensation of propionic acid with ammonia. |
| trigonelline | |
| illudin S | A sesquiterpenoid that has formula C15H20O4. |
| 2,3,2-tetramine | A tetraamine that has formula C7H20N4. |
| L 750667 | |
| etafenone | |
| Excitatory Amino Acid Agents | |
| krestin | |
| dipropylenetriamine-NONOate | |
| 7-chloro-3-imino-5-methyl-2-azabicyclo(4.1.0)heptane | |
| diadenosine tetraphosphate | |
| Amoxicillin | A penicillin in which the substituent at position 6 of the penam ring is a 2-amino-2-(4-hydroxyphenyl)acetamido group. |
| gefitinib | |
| 2-cyclopentyl-5-(5-isoquinolylsulfonyl)-6-nitro-1H-benzo(D)imidazole | |
| 3-benzylidene camphor | |
| p-271 peptide | |
| adenosine 5'-methylenediphosphate | A nucleoside diphosphate analogue that has formula C11H17N5O9P2. |
| ONO-AE1-329 | |
| CVT-10216 | |
| Enoxacin | |
| 2',4'-dichlorobenzamil amiloride | |
| tanshinone | |
| afromosin | |
| diphenylthiourea | |
| Ajmaline | |
| Thioridazine | A phenothiazine derivative having a methylsulfanyl subsitituent at the 2-position and a (1-methylpiperidin-2-yl)ethyl] group at the N-10 position. |
| zinc protoporphyrin | A metalloprotoporphyrin that has formula C34H32N4O4Zn. |
| leupeptin | A peptide that has formula C20H38N6O4. |
| epalrestat | A monocarboxylic acid that is 1,3-thiazolidine which is substituted on the nitrogen by a carboxymethyl group, at positions 2 and 4 by thioxo and oxo groups, respectively, and at position 5 by a 2-methyl-3-phenylprop-2-en-1-ylidene group. It is an inhibitor of aldose reductase (which catalyses the conversion of glucose to sorbitol) and is used for the treatment of some diabetic complications, including neuropathy. |
| protoberberine | |
| alpha-pyrrolidinovalerophenone | |
| 1,7-dimethyluric acid | An oxopurine that is 7,9-dihydro-1H-purine-2,6,8(3H)-trione substituted by methyl groups at N-1 and N-7. It is a metabolite of caffeine and is often found in human urine samples. |
| 9-anthraldehyde | |
| Gastrins | A family of gastrointestinal peptide hormones that stimulate the secretion of gastric acid. Gastrin is found primarily in three forms: gastrin-34 ('big gastrin'), gastrin-17 ('little gastrin') and gastrin-14 ('minigastrin'). |
| R 59949 | |
| Equilenin | A 3-hydroxy steroid that has formula C18H18O2. |
| phenyl-N-tert-butylnitrone | |
| 4'-O-methylalpinumisoflavone | |
| Androstenols | |
| ABVD protocol | |
| Phytanic Acid | A branched-chain saturated fatty acid consisting of hexadecanoic acid carrying methyl substituents at positions 3, 7, 11 and 15. |
| Thapsigargin | An organic heterotricyclic compound that is a hexa-oxygenated 6,7-guaianolide isolated fron the roots of Thapsia garganica L., Apiaceae. A potent skin irritant, it is used in traditional medicine as a counter-irritant. Thapsigargin inhibits Ca(2+)-transporting ATPase mediated uptake of calcium ions into sarcoplasmic reticulum and is used in experimentation examining the impacts of increasing cytosolic calcium concentrations. |
| (2-boronoethyl)-cysteine | |
| ciklavit | |
| Pharmaceutical Vehicles | |
| 2,4-diaminohypoxanthine | |
| 2-hydroxymenthofuran | |
| dimethyl sulfate | The dimethyl ester of sulfuric acid. |
| 4-iodo-N-(4-(4-(2-methoxyphenyl)piperazin-1-yl)butyl)cinnamoylamide | |
| lapatinib | |
| clasto-lactacystin beta-lactone | |
| lometrexol | |
| morphinone | A morphinane alkaloid that has formula C17H17NO3. |
| Sulfites | Any sulfurous acid derivative that is a salt or an ester of sulfurous acid. |
| K-12 lipopolysaccharide | |
| ortho-Aminobenzoates | |
| 1-(4-((2-(2-aminopyrimidin-5-yl)-7-methyl-4-morpholinothieno(3,2-d)pyrimidin-6-yl)methyl)piperazin-1-yl)-2-hydroxypropan-1-one | |
| N-chlorotaurine | |
| SU 5402 | An oxindole that is 3-methyleneoxindole in which one of the hydrogens of the methylene group is substituted by a 3-(2-carboxyethyl)-4-methyl-1H-pyrrol-2-yl group. It is an ATP-competitive inhibitor of the tyrosine kinase activity of fibroblast growth factor receptor 1. |
| (endo-N-8-methyl-8-azabicyclo(3.2.1)oct-3-yl)-2,3-dihydro-3-ethyl-2-oxo-1H-benzimidazol-1-carboxamide | |
| PM 00104 | |
| sodium chlorate | An inorganic sodium salt that has chlorate as the counter-ion. An oxidising agent, it is used for bleaching paper and as a herbicide. It is also used in the manufacture of dyes, explosives and matches. |
| 2,2'-(hydroxynitrosohydrazono)bis-ethanamine | |
| lysocellin | |
| 3-(4-t-butylphenyl)-N-(2,3-dihydrobenzo(b)(1,4)dioxin-6-yl)acrylamide | |
| bucindolol | |
| 2-ethylhexanoic acid | |
| hirulog-like peptide | |
| ammonium hexachloroplatinate | A salt comprising separate ammonium cations and octahedral [PtCl6](2-) anions. |
| 9,11-linoleic acid | |
| Pyrones | |
| 2-(6-((3,4-dihydro-2H-chromen-2-ylmethyl)amino)hexyl)tetrahydro-1H-pyrrolo(1,2-c)imidazole-1,3(2H)-dione | |
| nodosin | A delta-lactone that has formula C20H26O6. |
| latanoprost | A prostaglandin Falpha that is the isopropyl ester prodrug of latanoprost free acid. Used in the treatment of open-angle glaucoma and ocular hypertension. |
| 2-methyl-3-(4-(2-(5-methyl-2-thiophen-2-yloxazol-4-yl)ethoxy)phenyl)-2-phenoxypropionic acid | |
| irofulven | |
| corticosterone acetate | |
| Zeranol | |
| rhyncophylline | |
| dihydrofolate | |
| tobacco tar | |
| 2-phenylindole | |
| Polymyxin B | |
| GS-Succ-BP | |
| methyldithiocarbamate | |
| N-(2-cyclohexyloxy-4-nitrophenyl)methanesulfonamide | A C-nitro compound that is N-methylsulfonyl-4-nitroaniline bearing an additional cyclohexyloxy substituent at position 2. |
| 2-(2-(3,5-difluorophenyl)-2-hydroxyacetamido)-N-(3-methyl-4-oxo-4,5-dihydro-3H-benzo(d)(1,2)diazepin-5-yl)propanamide | |
| abanoquil | |
| Alkaloids | Any of the naturally occurring, basic nitrogen compounds (mostly heterocyclic) occurring mostly in the plant kingdom, but also found in bacteria, fungi, and animals. By extension, certain neutral compounds biogenetically related to basic alkaloids are also classed as alkaloids. Amino acids, peptides, proteins, nucleotides, nucleic acids, amino sugars and antibiotics are not normally regarded as alkaloids. Compounds in which the nitrogen is exocyclic (dopamine, mescaline, serotonin, etc.) are usually classed as amines rather than alkaloids. |
| diisononyl phthalate | The diisononyl ester of benzene-1,2-dicarboxylic acid. |
| letrozole | A triazole that has formula C17H11N5. |
| ICI 199441 | |
| rosemary oil | |
| TAK 147 | |
| 2-dimethylamino-4,5,6,7-tetrabromo-1H-benzimidazole | |
| Alprazolam | A member of the class of triazolobenzodiazepines that is 4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine carrying methyl, phenyl and chloro substituents at positions 1, 6 and 8 respectively. Alprazolam is only found in individuals that have taken this drug. |
| 4-nitrobenzyl chloride | |
| Propylthiouracil | |
| glucuronoxylomannan | A linear (1->3)-linked mannan polysaccharide derivative substituted at the 2-O-positions by single residues of either xylose or glucuronic acid. |
| dideoxypetrosynol A | |
| dyclonine | N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. |
| N-((2,2-dimethyl-2,3-dihydrobenzofuran-7-yloxy)ethyl)-3-(cyclopent-1-enyl)benzylamine | |
| nebivolol | |
| cudraflavone B | An extended flavonoid that consists of a pyranochromane skeleton that is 2H,6H-pyrano[3,2-g]chromen-6-one substituted by geminal methyl groups at position 2, a 2,4-dihydroxyphenyl group at position 8, a hydroxy group at position 5 and a prenyl group at position 7. Isolated from Morus alba and Morus species it exhibits anti-inflammatory activity. |
| chloramphenicol palmitate | A palmitate ester that has formula C27H42Cl2N2O6. |
| Antihypertensive Agents | Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| p-Chloroamphetamine | |
| 3-(2-(3-(1-adamantyl)-4-hydroxyphenyl)-5-pyrimidinyl)-2-propenoic acid | |
| diphenylcresyl phosphate | |
| vanillin | A member of the class of benzaldehydes carrying methoxy and hydroxy substituents at positions 3 and 4 respectively. |
| Phenylpropanolamine | |
| profenofos | An organophosphate insecticide that has formula C11H15BrClO3PS. |
| 1,2-dibromo-3-chloropropane | An organochlorine compound that has formula C3H5Br2Cl. |
| benzyloxycarbonyl-valyl-alanyl-aspartic acid | |
| 6-(4-(3-(2-methylpyrrolidin-1-yl)propoxy)phenyl)-2H-pyridazin-3-one | |
| 1,3-dimethylthiourea | |
| 3,4,5-trihydroxy-2--methoxy-8,8-dimethyl-N-(hexahydro-2-oxo-6-(cyclohexylcarbonyl)oxy-2H-azepin-3-yl)non-6-enamide | |
| phenylmercuric chloride | |
| cycloartenol | A phytosterol that has formula C30H50O. |
| quinalphos | An organothiophosphate insecticide that has formula C12H15N2O3PS. |
| thiosulfinic acids | |
| 1-amino-4-(3-(4,6-dichloro(1,3,5)triazine-2-ylamino)phenylamino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate | |
| E platinum | |
| cirsiliol | A flavonoid that has formula C17H14O7. |
| 15-hydroxy-11,12-epoxyeicosatrienoic acid | |
| Photosensitizing Agents | |
| beta-Cyclodextrins | |
| arsenic triiodide | |
| bortezomib | |
| ractopamine | A diastereoisomeric mixture of approximately equal amounts of all four possible diastereoisomers of 4-(1-hydroxy-2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)phenol. A beta-adrenergic agonist, it is used (generally as the hydrochloride salt) as a feed additive for use in pigs and other livestock to promote protein deposition, resulting in leaner meat. The R,R diastereoisomer, butopamine, is responsible for most of the leanness-enhancing effects. While use of ractopamine has been banned in over 120 countries including throughout the EU, in the US it used in an estimated 80% of all beef, pork and turkey production. |
| XK 469 | |
| S,S'-1,4-phenylenebis(1,2-ethanediyl)bisisoselenourea | |
| dienochlor | An organochlorine compound that has formula C10Cl10. |
| fidarestat | |
| CGP 20712A | |
| Organogold Compounds | A compound containing at least one carbon-gold bond. |
| Xylose | An aldopentose, found in the embryos of most edible plants and used in medicine to test for malabsorption by administration in water to the patient. |
| 1 alpha,24-dihydroxyvitamin D3 | |
| diphenyl | |
| Glucocorticoids | Glucocorticoids are a class of steroid hormones that regulate a variety of physiological processes, in particular control of the concentration of glucose in blood. |
| LU 224332 | |
| cisatracurium | |
| gingerol | A beta-hydroxy ketone that is 5-hydroxydecan-3-one substituted by a 4-hydroxy-3-methoxyphenyl moiety at position 1; believed to inhibit adipogenesis. It is a constituent of fresh ginger. |
| Clostridium difficile lethal toxin B | |
| Superoxides | |
| esmolol | A carboxylic ester that is methyl 3-(4-hydroxyphenyl)propanoate in which the hydrogen attached to the phenoic hydroxy group is substituted by a 2-hydroxy-3-(isopropylamino)propyl group. A cardioselective and short-acting beta1 receptor blocker with rapid onset but lacking intrinsic sympathomimetic and membrane-stabilising properties, it is used as the hydrochloride salt in the management of supraventricular arrhythmias, and for the control of hypertension and tachycardia during surgery. |
| 9,10-dimethylanthracene | |
| triphenylphosphine gold chloride | |
| dehydroevodiamine | |
| Dequalinium | |
| p-tert-amylphenol | An alkylbenzene that has formula C11H16O. |
| methanethiosulfonate | |
| lorcaserin | |
| Polyethylene Glycols | |
| rifamycin SV | |
| alpha-methyl-4-carboxyphenylglycine | |
| 1-(5-Isoquinolinesulfonyl)-2-Methylpiperazine | A member of the class of N-sulfonylpiperazines that is 2-methylpiperazine substituted at position 1 by a 5-isoquinolinesulfonyl group. |
| Titanium | A titanium group element atom that has formula Ti. |
| NRA 0160 | |
| NEPP11 compound | |
| monoferrous acid citrate | |
| 1,3-dichloro-1-propene | |
| Trichlormethiazide | |
| BIX 02189 | |
| potassium diazoacetate | |
| 15-acetyldeoxynivalenol | |
| Metronidazole | A member of the class of imidazoles substituted at C-1, -2 and -5 with 2-hydroxyethyl, nitro and methyl groups respectively. It has activity against anaerobic bacteria and protozoa, and has a radiosensitising effect on hypoxic tumour cells. It may be given by mouth in tablets, or as the benzoate in an oral suspension. The hydrochloride salt can be used in intravenous infusions. Metronidazole is a prodrug and is selective for anaerobic bacteria due to their ability to intracellularly reduce the nitro group of metronidazole to give nitroso-containing intermediates. These can covalently bind to DNA, disrupting its helical structure, inducing DNA strand breaks and inhibiting bacterial nucleic acid synthesis, ultimately resulting in bacterial cell death. |
| Quinoxalines | Any naphthyridine derivative that is a derivative of quinoxaline (1,4-naphthyridine). |
| naphthenic acid | |
| ammodytoxin A | |
| cobaltiprotoporphyrin | |
| Avosentan | |
| Castor Oil | |
| Ceftazidime | A cephalosporin bearing pyridinium-1-ylmethyl and {[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
| 2,4-dichloroaniline | A dichloroaniline carrying chloro substituents at positions 2 and 4. |
| epoxomicin | A tripeptide consisting of an Ile-Ile-Thr-NH2 sequence N-substituted on the threonamide amidic nitrogen with a (2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl group and with acetyl and methyl groups on the nitrogen of the isoleucine residue distal to the threonamide; a naturally occurring selective proteasome inhibitor with anti-inflammatory activity. |
| Carbolines | |
| 5-methylchrysene | A carbopolycyclic compound that has formula C19H14. |
| rosmarinic acid | The 1-carboxy-2-(2,4-dihydroxyphenyl)ethyl ester of trans-caffeic acid. |
| dihydroxyphenylethylene glycol | |
| Asbestos, Serpentine | |
| Beclomethasone | A 17alpha-hydroxy steroid that is prednisolone in which the hydrogens at the 9alpha and 16beta positions are substituted by a chlorine and a methyl group, respectively. |
| Sulfenic Acids | |
| 2-amino-6-boronohexanoic acid | |
| N-(3-propylcarbamoyloxirane-2-carbonyl)-isoleucyl-proline | |
| crenatoside | |
| yishen huoxue decoction | |
| 1-hydroxybenzo(a)pyrene | |
| L 657743 | |
| 1,4-phenylenebis(methylene)selenocyanate | |
| 7-hydroxycoumarin glucuronide | |
| 2-aminoethoxydiphenyl borate | |
| Silicates | |
| zoledronic acid | |
| 9-phenanthrol | A phenanthrol that has formula C14H10O. |
| Pipemidic Acid | A pyridopyrimidine that is 5-oxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylic acid substituted at position 2 by a piperazin-1-yl group and at position 8 by an ethyl group. Used for treatment of gastrointestinal, biliary, and urinary infections. |
| N-2-diazo-3,3,3-trifluoropropionyl-3,5,3'-triiodothyronine | |
| alvocidib | |
| 4-phenylphenol | |
| 1-cyclohexylethylamine | |
| 3-methylbenzaldehyde | A tolualdehyde compound with the methyl substituent at the 3-position. |
| diaziquone | |
| tert-Butyl Alcohol | |
| VUF 5455 | |
| thymidine glycol | |
| echinocystic acid | A triterpenoid that has formula C30H48O4. |
| tert-butylcatechol | |
| CD 2425 | |
| Hydroxamic Acids | A compound, RkE(=O)lNHOH, derived from an oxoacid RkE(=O)l(OH) (l =/= 0) by replacing -OH with -NHOH, and derivatives thereof. Specific examples of hydroxamic acids are preferably named as N-hydroxy amides. |
| phenylalanyl-glycyl-NHO-Bz | |
| N-ethyl-3-fluoro-3-(3-fluoro-4-(pyrrolidinylmethyl)phenyl)cyclobutanecarboxamide | |
| phenylacetic acid | A monocarboxylic acid that is benzene substituted with a carboxymethyl functional group. |
| sinapinic acid | |
| cladosporin | |
| Bucladesine | A 3',5'-cyclic purine nucleotide that is the 2'-butanoate ester and 6-N-butanoyl derivative of 3',5'-cyclic AMP. |
| propamocarb | A carbamate ester that is the propyl ester of 3-(dimethylamino)propylcarbamic acid. It is a systemic fungicied, used (normally as the hydrochloride salt) for the control of soil, root and leaf diseases caused by oomycetes, particularly Phytophthora and Pythium species. |
| triethanolamine | |
| Carbachol | An ammonium salt that has formula C6H15N2O2.Cl. |
| clivorine | |
| 1,2-dibromo-4-(1,2-dibromoethyl)cyclohexane | |
| N-(4-bromo-2-fluorophenyl)-6-methoxy-7-((1-methylpiperidin-4-yl)methoxy)quinazolin-4-amine | A quinazoline that is 7-[(1-methylpiperidin-4-yl)methoxy]quinazoline bearing additional methoxy and 4-bromo-2-fluorophenylamino substituents at positions 6 and 4 respectively. Used for the treatment of symptomatic or progressive medullary thyroid cancer in patients with unresectable locally advanced or metastatic disease. |
| panaxydol | An acetylenic compound that has formula C17H24O2. |
| barbituric acid | A barbiturate, the structure of which is that of perhydropyrimidine substituted at C-2, -4 and -6 by oxo groups. Barbituric acid is the parent compound of barbiturate drugs, although it is not itself pharmacologically active. |
| hydroxyethyl methacrylate | |
| rilmenidine | |
| 22-hydroxycholesterol | |
| Flavanones | Members of the class of flavans with a 3,4-dihydro-2-aryl-2H-1-benzopyran-4-one skeleton and its substituted derivatives. |
| Nitrogen Dioxide | A nitrogen oxide that has formula NO2. |
| vorinostat | |
| Guanosine Monophosphate | |
| alizarin | A dihydroxyanthraquinone in which the hydroxy groups are at C-1 and C-2 and whch has oxo groups at C-9 and C-10. |
| Ruthenium Compounds | |
| 17-(dimethylaminoethylamino)-17-demethoxygeldanamycin | |
| 2,2',3,3',4,6'-hexachlorobiphenyl | |
| Sparteine | A quinolizidine alkaloid fundamental parent that has formula C15H26N2. |
| Guanidine | An aminocarboxamidine, the parent compound of the guanidines. |
| isoeugenol | A phenylpropanoid that is an isomer of eugenol in which the allyl substituent is replaced by a prop-1-enyl group. |
| curcumin III | |
| 2'-epi-2'-O-acetylthevetin B | |
| candoxatrilat | A dicarboxylic acid monoamide obtained by formal condensation between the amino group of cis-4-aminocyclohexanecarboxylic acid and the cyclopentanecarboxylic acid group of 1-[(2S)-2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentanecarboxylic acid. A potent inhibitor of neutral endopeptidase (NEP, neprilysin, EC 3.4.24.11), it is used as its 2,3-dihydro-1H-inden-5-yl ester prodrug in the treatment of chronic heart failure. |
| BIM 23120 | |
| enterotoxin B, staphylococcal | |
| BIM 23127 | |
| histaprodifen | |
| propylene dichloride | |
| N-methyl-4-aminophenol | |
| Edetic Acid | |
| neohesperidin dihydrochalcone | A member of the dihydrochalcones that is 3,2',4',6'-tetrahydroxy-4-methoxydihydrochalcone attached to a neohesperidosyl residue at position 4' via glycosidic linkage. It is found in sweet orange. |
| 3,4,5,3',4',5'-hexachlorobiphenyl | A trichlorobenzene that has formula C12H4Cl6. |
| darglitazone | |
| SU 5614 | |
| efonidipine | |
| 4-methylene-2-octyl-5-oxofuran-3-carboxylic acid | |
| naringenin | A trihydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 6 and 4'. |
| 1,2,3,5,6,7-hexachloronaphthalene | |
| EMD 392949 | |
| 1-((4,5-bis(4-methoxyphenyl)-2-thiazoyl)carbonyl)-4-methylpiperazine | |
| glutathione-BPDE conjugate | |
| N-acetyl-S-(alpha-methyl-4-(2-methylpropyl)benzeneacetyl)cysteine 4-(nitrooxy)butyl ester | |
| CI 972 | |
| 8-ethoxy-2-(4-fluorophenyl)-3-nitro-2H-chromene | |
| Ethinyl Estradiol | |
| Fendiline | |
| rossicaside B | |
| Quinuclidinyl Benzilate | |
| Allura Red AC Dye | |
| quercetin 3-O-(2''-galloyl)glucopyranoside | |
| 8-hydroxyoctanoic acid | An omega-hydroxy fatty acid that is caprylic acid in which one of the hydrogens of the terminal methyl group is replaced by a hydroxy group. |
| Alkylating Agents | Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Cystine | |
| Atrazine | A diamino-1,3,5-triazine that is 1,3,5-triazine-2,4-diamine substituted by a chloro group at position 6 while one of hydrogens of each amino group is replaced respectively by an ethyl and a propan-2-yl group. |
| Picibanil | |
| Zineb | A polymeric complex of zinc with the ethylene bis(dithiocarbamate) anionic ligand. Formerly used as an agricultural fungicide for the control of downy mildews and rusts, its use is no longer permitted in the US or the EU. |
| ethylphenylepoxygeranyl ether | |
| trametinib | A pyridopyrimidine that is used (as its dimethyl sulfoxide addition compound) for the treatment of patients with unresectable or metastatic melanoma with BRAF V600E or V600K mutations, and who have not received prior BRAF inhibitor treatment. |
| Water | An inorganic hydroxy compound that has formula H2O. |
| 4-nitrotoluene | A mononitrotoluene that consists of toluene bearing a nitro substituent at the 4-position. |
| Spermidine | A triamine that is the 1,5,10-triaza derivative of decane. |
| 2,2'-Dipyridyl | |
| 5-hydroxydopamine | |
| chloroacetonitrile | A nitrile that has formula C2H2ClN. |
| GW 7845 | |
| tetrahydrogestrinone | |
| 10-hydroxynortriptyline | |
| Toxaphene | A highly complex mixture of several hundred polychlorinated compounds obtained by chlorination of camphene to an overall chlorine content of 67-69% by weight and having an overall empirical formula of C10H10Cl8 (including optical isomers, it could theoretically contain over 32,000 congeners). Toxaphene was used from the mid-1940s as an agricultural insecticide (mostly in the USA, particularly on corn and soybeans). Usage increased with the phasing out of DDT in the 1970s and it became the most heavily manufactured pesticide in the US, but it is now banned as a result of concerns over its toxicity and carcinogenicity. It is estimated that total production since its first use was around half a million tons. In the environment, most of the components of toxaphene get metabolised, but from 10 to >100 resist biodegradation, depending on the medium and the specialisation of the enzyme system. Breathing, drinking or eating high levels of toxaphene can damage the lungs, kidneys, and nervous system. |
| 4-hydroxyretinoic acid | A retinoid that consists of all-trans-retinoic acid bearing a hydroxy substituent at position 4 on the cyclohexenyl ring. |
| deflazacort | |
| 2,4,6-triphenyl-1,3-dioxane | |
| 4-nitro-3-cresol | |
| 4-methylesculetin | |
| Furosemide | A chlorobenzoic acid that is 4-chlorobenzoic acid substituted by a (furan-2-ylmethyl)amino and a sulfamoyl group at position 2 and 5 respectively. It is a diuretic used in the treatment of congestive heart failure. |
| sulconazole | |
| clidinium | The ester resulting from formal condensation of benzilic acid and 3-hydroxy-1-methyl-1-azoniabicyclo[2.2.2]octane. It is used, generally as the bromide, for the symptomatic treatment of peptic ulcer disease and also to help relieve abdominal or stomach spasms or cramps due to colicky abdominal pain, diverticulitis, and irritable bowel syndrome. |
| capsiate | |
| MF101 extract | |
| Tetrachlorodibenzodioxin | |
| Mercaptoethanol | An alkanethiol that has formula C2H6OS. |
| olive oil | |
| balsalazide | A monohydroxybenzoic acid consisting of 5-aminosalicylic acid (mesalazine) linked to 4-aminobenzoyl-beta-alanine via an azo bond. |
| bakuchiol | |
| Glucosinolates | |
| trans-phytol | |
| Dinitrofluorobenzene | |
| 17-alpha-Hydroxyprogesterone | A 17alpha-hydroxy steroid that is the 17alpha-hydroxy derivative of progesterone. |
| anthranilic acid | An aminobenzoic acid that is benzoic acid having a single amino substituent located at position 2. It is a metabolite produced in L-tryptophan-kynurenine pathway in the central nervous system. |
| Iodoacetates | |
| Carbonates | Organooxygen compounds that are salts or esters of carbonic acid, H2CO3. |
| XELOX | |
| Anthracyclines | An organic compound that has a tetrahydronaphthacenedione ring structure attached by a glycosidic linkage to the amino sugar daunosamine and which exhibits antibiotic activity. |
| plant extract, Houttuynia cordata | |
| Acetohexamide | An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is replaced by a p-acetylphenylsulfonyl group, while a hydrogen attached to the other nitrogen is replaced by a cyclohexyl group. |
| CMF protocol | |
| vestitol | |
| tyrphostin AG 1024 | |
| Oleic Acid | An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. |
| potassium oxonate | An organic molecular entity that has formula C4H2KN3O4. |
| N-oleoylethanolamine | |
| Cysteine Proteinase Inhibitors | Any protease inhibitor that restricts the action of a cysteine protease. |
| chalcone epoxide | |
| ethylenimine quinone | |
| 2-nitrofluoranthene | |
| ranitidine bismuth citrate | Complex of ranitidine, trivalent bismuth, and citrate. CAS#128345-62-0. |
| Butyrylthiocholine | |
| ponatinib | A benzamide obtained by the formal condensation of the carboxy group of 3-(imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylbenzoic acid with the anilino group of 4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)aniline. |
| Santowhite powder | |
| Leukotriene B4 | A leukotriene composed of (6Z,8E,10E,14Z)-icosatetraenoic acid having (5S)- and (12R)-hydroxy substituents. |
| Air Pollutants | |
| aspirin, dipyridamole drug combination | |
| KCC 009 | |
| cyamemazine sulfoxide | |
| 7-hydroxycoumarin | |
| SEW2871 | |
| very low density lipoprotein triglyceride | Triglycerides which are contained in very low density lipoproteins (VLDL). |
| chrysophanic acid | |
| sebacic acid | An alpha,omega-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane. |
| 1-palmitoyl-2-(5-oxovaleroyl)-sn-glycero-3-phosphorylcholine | |
| trichloronitritodiammineplatinum(IV) | |
| 7-(deoxyguanosin-N(2)-yl)aristolactam I | |
| enkephalin-Leu, Ala(2)-melphalan methyl ester- | |
| acenaphthylene | A ortho- and peri-fused tricyclic hydrocarbon that occurs in coal tar. |
| Carbenoxolone | |
| pramiconazole | |
| flupirtine | |
| Picolines | |
| amfonelic acid | |
| arctigenin | A lignan that has formula C21H24O6. |
| tazarotene | |
| palbociclib | |
| N(6)-(3-iodobenzyl)-5'-N-methylcarboxamidoadenosine | |
| kaempferol 3-O-sophoroside | |
| 8-methyl-1,3,8-trichlorodibenzofuran | |
| zaleplon | A pyrazolo[1,5-a]pyrimidine having a nitrile group at position 3 and a 3-(N-ethylacetamido)phenyl substituent at the 7-position. |
| triethyl phosphine gold | |
| azimilide | An imidazolidine-2,4-dione that has formula C23H28ClN5O3. |
| dexamethasone 21-phosphate | |
| tolyfluanid | |
| Estrogens, Conjugated (USP) | |
| oracine | |
| cloricromen | |
| 1,2-dichloro-4-nitrobenzene | |
| 2-(2-((1H-indole-2-carbonyl)amino)benzoylamino)-4-phenylbutyric acid | |
| arsenite | An arsenite ion resulting from the removal of all three protons from the hydroxy groups of arsenous acid. |
| Urocanic Acid | An alpha,beta-unsaturated monocarboxylic acid that is prop-2-enoic acid substituted by a 1H-imidazol-4-yl group at position 3. It is a metabolite of hidtidine. |
| 3,4,5-trihydroxybenzamidoxime | |
| Analgesics | |
| 20-hydroxycholesterol | An oxysterol that is cholesterol substituted by a hydroxy group at position 20. |
| 1,8-dinitropyrene | A pyrene that has formula C16H8N2O4. |
| propaphos | A dialkyl aryl phosphate that has formula C13H21O4PS. |
| 3-(5-methyl-2-(2-oxo-1,2-dihydroindol-3-ylidenemethyl)-1H-pyrrol-3-yl)propionic acid | |
| 8,9-dihydro-8-(S-glutathionyl)-9-hydroxyaflatoxin B1 | A member of the class of aflatoxins that is 8,9-dihydro-9-hydroxyaflatoxin B1 having an S-glutathionyl moiety attached at position 8. |
| 11-methylbenzanthracene | |
| substance P-saporin | |
| Perfadex | |
| AC3056 | |
| 2-nitrobenzaldehyde | Benzaldehyde substituted at the ortho-position with a nitro group. |
| tetradecylselenoacetic acid | |
| Calcifediol | |
| cismethrin | |
| gamma-Aminobutyric Acid | A gamma-amino acid that is butanoic acid with the amino substituent located at C-4. |
| methyl arachidonylfluorophosphonate | |
| Mevinphos | A dialkyl phosphate that has formula C7H13O6P. |
| 3,4-dihydroxybenzoate | A dihydroxybenzoate having the two hydroxy groups located at the 3- and 4-positions. |
| zAsp(Ome)-Arg-His-Asp(Ome)-fluoromethyl ketone | |
| Suramin | |
| Theobromine | |
| Cytidine Monophosphate | |
| saracatinib | |
| C186 65 | |
| Shiga Toxin 2 | |
| Shiga Toxin 1 | |
| 4-hydroxyretinal | |
| Dermatophagoides pteronyssinus antigen p 1 | |
| 2-mercaptoacetate | |
| beta-Endorphin | A polypeptide consisting of 31 amino acid residues in the sequence Tyr-Gly-Gly-Phe-Met-Thr-Ser-Glu-Lys-Ser-Gln-Thr-Pro-Leu-Val-Thr-Leu-Phe-Lys-Asn-Ala-Ile-Ile-Lys-Asn-Ala-Tyr-Lys-Lys-Gly-Glu. It is an endogenous opioid peptide neurotransmitter found in the neurons of both the central and peripheral nervous system and results from processing of the precursor protein proopiomelanocortin (POMC). |
| dinapsoline | |
| 2-amino-8-(4-(2-hydroxyethoxy)cyclohexyl)-6-(6-methoxypyridin-3-yl)-4-methylpyrido(2,3-d)pyrimidin-7(8H)-one | |
| manganese sulfate | |
| tagatose | A ketohexose used as a functional sweetener. |
| ferulic acid | A ferulic acid consisting of trans-cinnamic acid bearing methoxy and hydroxy substituents at positions 3 and 4 respectively on the phenyl ring. |
| 2-hydroxyphytanic acid | An alpha-hydroxy fatty acid formed from phytanic acid by bacterial cytochrome P450; and also formed in human peroxisomal disorders. |
| Bethanechol | The carbamic acid ester of 2-methylcholine. A slowly hydrolysed muscarinic agonist with no nicotinic effects, it is used as its chloride salt to increase smooth muscle tone, as in the gastrointestinal tract following abdominal surgery, treatment of gastro-oesophageal reflux disease, and as an alternative to catheterisation in the treatment of non-obstructive urinary retention. |
| mastoparan | A member of the class of mastopyrans that is a 14-amino acid polypeptide comprising isoleucyl, asparaginyl, leucyl, lysyl, alanyl, leucyl, alanyl, alanyl, leucyl, alanyl, lysyl, lysyl, isoleucyl, and leucinamide residues coupled in sequence. It is the major active component of the venom of the vespid wasp, Vespula lewisii and causes degranulation of mast cells. |
| Sodium Azide | The sodium salt of hydrogen azide (hydrazoic acid). |
| NNC 711 | |
| ubiquinone 9 | An ubiquinone that has formula C54H82O4. |
| CLIK 148 | |
| 7-hydroxywarfarin | |
| Niacinamide | |
| 12-deoxyphorbolphenylacetate-20-acetate | |
| nymphayol | |
| 1-O-hexyl-2,3,5-trimethylhydroquinone | |
| 7-Ala-angiotensin (1-7) | |
| peonidin | An anthocyanidin cation that is flavylium bearing four hydroxy substituents at positions 3, 4', 5 and 7 as well as a methoxy substituent at position 3'. |
| 3-(3-cyclohexyl-1-(2-(dimethylamino)-2-oxoethyl)-6-(4-methyl-5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)-1H-indol-2-yl)-N,N-dimethylbenzamide | |
| Josamycin | |
| beraprost | |
| 2-(4-isobutylphenyl)propionylmethanesulfonamide | |
| cajanol | A flavonoid that has formula C17H16O6. |
| CBV protocol | |
| potassium ferricyanide | |
| Dextromethorphan | An organic heterotetracyclic compound that is morphinan substituted by a methoxy group at position 3 and a methyl group at position 7. It is used as an antitussive drug for suppressing cough. |
| delta(9)-tetrahydrocannabinolic acid | A diterpenoid that is 6a,7,8,10a-tetrahydro-6H-benzo[c]chromene substituted at position 1 by a hydroxy group, positions 6, 6 and 9 by methyl groups and at position 3 by a pentyl group. A biosynthetic precursor to Delta(9)-tetrahydrocannabinol, the principal psychoactive constituent of the cannabis plant. |
| Phenylphosphonothioic Acid, 2-Ethyl 2-(4-Nitrophenyl) Ester | |
| N-(3-((2-ethyl-4-methyl-1H-imidazol-5-yl)methylene)-2-oxoindolin-5-yl)propiolamide | |
| agathic acid | |
| chrysene | An ortho-fused polycyclic arene found commonly in the coal tar. |
| MP470 | |
| Dapsone | A sulfone that is diphenylsulfone in which the hydrogen atom at the 4 position of each of the phenyl groups is substituted by an amino group. It is active against a wide range of bacteria, but is mainly employed for its actions against Mycobacterium leprae, being used as part of multidrug regimens in the treatment of all forms of leprosy. |
| Cyclodextrins | |
| benzo(g)chrysene-11,12-dihydrodiol-13,14-epoxide | |
| biphenyl-indanone A | |
| EUK-172 | |
| 2-methoxyestradiol-3,17-O,O-bis(sulfamate) | |
| 5-carboxamidotryptamine | A tryptamine that has formula C11H13N3O. |
| allyl chloride | An organochlorine compound that has formula C3H5Cl. |
| Cotinine | An N-alkylpyrrolidine that consists of N-methylpyrrolidinone bearing a pyridin-3-yl substituent at position C-5 (the 5S-enantiomer). It is an alkaloid commonly found in Nicotiana tabacum. |
| phorone | A dialkenyl ketone that has formula C9H14O. |
| fluorexon | |
| Fenitrothion | An organic thiophosphate that is O,O-dimethyl O-phenyl phosphorothioate substituted by a methyl group at position 3 and a nitro group at position 4. |
| DEET | |
| 10-formyltetrahydropteroylglutamic acid | |
| tocotrienol, alpha | |
| 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid | |
| Griseofulvin | Antibiotic produced by Penicillium griseofulvum. |
| N-(3-aminopropyl)-N-(1-(5-benzyl-3-methyl-4-oxo-(1,2)thiazolo(5,4-d)pyrimidin-6-yl)-2-methylpropyl)-4-methylbenzamide | |
| trimegestone | |
| phenylamil | A pyrazine that has formula C12H12ClN7O. |
| 1-vinylpyrene | |
| S 20098 | |
| Toremifene | |
| Phe-Leu boronic acid | |
| 4-methylbenz(a)anthracene | |
| Methylthiouracil | A 9,11,15-octadecatrienoic acid that has formula C5H6N2OS. |
| matrine | An alkaloid that has formula C15H24N2O. |
| bathophenanthroline disulfonic acid | |
| Canertinib | A quinazoline compound having a 3-chloro-4-fluoroanilino group at the 4-position, a propenamido group at the 6-position, and a 3-morpholinopropoxy group at the 7-position. |
| Metolazone | |
| tris(dicarboxymethylene)fullerene-C3 | |
| 3-(1,2,5,6-tetrahydropyrid-4-yl)pyrrolo(3,2-b)pyrid-5-one | |
| tetrabromobisphenol A | |
| IC 87114 | |
| INO 1001 | |
| Antigens, Plant | |
| glycylsarcosine | |
| allysine | An alpha-amino acid consisting of lysine having an oxo group in place of the side-chain amino group. |
| 2,5,7,8-tetramethyl-2R-(4R,8R,12-trimethyltridecyl)chroman-6-yloxy acetic acid | |
| wulingsan | |
| Naphthalimides | |
| Bile Acids and Salts | |
| 1-nitrobenzo(a)pyrene | |
| Linoleic Acids, Conjugated | |
| beclomethasone 17-monopropionate | |
| 2-tolidine | |
| 2-(acetoxyamino)-1-methyl-6-phenylimidazo(4,5-b)pyridine | |
| bambuterol | |
| mizolastine | |
| alpha-fluoromethylhistamine | |
| cortisol succinate | |
| Ancitabine | An organic heterotricyclic compound resulting from the formal condensation of the oxo group of cytidine to the 2' position with loss of water to give the corresponding cyclic ether. A prodrug, it is metabolised to the antineoplastic agent cytarabine, so is used to maintain a more constant antineoplastic action. |
| 7-methoxyresorufin | |
| OSU03013 | |
| 3,9-bis((ethylthio)methyl)-K-252a | |
| Egtazic Acid | |
| bromovanin | |
| carboxyamido-triazole | |
| istradefylline | |
| Myristic Acid | A straight-chain, fourteen-carbon, long-chain saturated fatty acid mostly found in milk fat. |
| Scarlet Red | |
| 3-(2-(2,2-dimethylpropylsulfanyl)pyridin-3-yl)-N-(3-hydroxycyclohexyl)acrylamide | |
| phenolphthalein monophosphate | |
| ibudilast | |
| eletriptan | |
| 6-chrysenamine | |
| N'-nitrosonornicotine | A pyrrolidine that has formula C9H11N3O. |
| DP 155 | |
| Diosmin | |
| N,N-dipropyl-2-(4-methoxy-3-(2-phenylethoxy)phenyl)ethylamine monohydrochloride | |
| JB-788 | |
| cyanidin | |
| methyl antcinate A | An ergostanoid that has formula C30H44O4. |
| ethyl 2-(4-chlorophenyl)-5-(2-furyl)-4-oxzoleacetate | |
| Plasticizers | Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. |
| RPR 121056 | |
| Lithocholic Acid | A monohydroxy-5beta-cholanic acid with a alpha-hydroxy substituent at position 3. It is a bile acid obtained from chenodeoxycholic acid by bacterial action. |
| ferric oxide | |
| methyl bromide | |
| sodium molybdate(VI) | |
| 3-((2,4-dimethylpyrrol-5-yl)methylidenyl)-2-indolinone | |
| sophocarpine | |
| Scopoletin | A hydroxycoumarin that is umbelliferone bearing a methoxy substituent at position 6. |
| varenicline | |
| procyanidin B2 | A proanthocyanidin consisting of two molecules of (-)-epicatechin joined by a bond between positions 4 and 8' in a beta-configuration. Procyanidin B2 can be found in Cinchona pubescens (Chinchona, in the rind, bark and cortex), in Cinnamomum verum (Ceylon cinnamon, in the rind, bark and cortex), in Crataegus monogyna (Common hawthorn, in the flower and blossom), in Uncaria guianensis (Cat's claw, in the root), in Vitis vinifera (Common grape vine, in the leaf), in Litchi chinensis (litchi, in the pericarp), in the apple, in Ecdysanthera utilis and in red wine. |
| procyanidin B3 | A proanthocyanidin consisting of two molecules of (+)-catechin joined by a bond between positions 4 and 8' in alpha-configuration. It can be found in red wine, in barley, in beer, in peach or in Jatropha macrantha, the Huanarpo Macho. |
| ferric sulfate | |
| cyanophenphos | |
| 3',3'',5',5''-tetrabromophenolphthalein | |
| cyanine 863 | |
| diadenosine 5',5''''-P1,P6-hexaphosphate | |
| N-(3,5-dichlorophenyl)succinimide | A pyrrolidine that has formula C10H7Cl2NO2. |
| Secobarbital | |
| GW 3965 | A diarylmethane that has formula C33H31ClF3NO3. |
| SAD-128 | |
| ProstaCaid | |
| monomethylarsonic acid | |
| 5,11-diethyl-5,6,11,12-tetrahydrochrysene-2,8-diol | |
| di-n-butyl adipate | |
| 5,7-dimethoxyflavone | |
| Kanamycin | Kanamycin is a naturally occurring antibiotic complex from Streptomyces kanamyceticus that consists of several components: kanamycin A, the major component (also usually designated as kanamycin), and kanamycins B, C, D and X the minor components. |
| allyl formate | |
| 2-methylanthracene | |
| acrylic acid | A alpha,beta-unsaturated monocarboxylic acid that is ethene substituted by a carboxy group. |
| calyculin A | A monoterpenoid that has formula C50H81N4O15P. |
| ibandronic acid | |
| 2,3',4,4'-tetrachlorobiphenyl | A tetrachlorobiphenyl in which the chlorines are positions at positions 2, 3, 4, and 4'. |
| KF58333 | |
| 3-acetyl-7-(4-hydroxyphenyl)-2H-chromen-2-one | |
| Thymol | A phenol that is a natural monoterpene derivative of cymene. |
| Eicosanoids | |
| dioctyl adipate | |
| Phenoxybenzamine | |
| Ticlopidine | A thienopyridine that has formula C14H14ClNS. |
| ethyl ferulate | |
| Phenolphthalein | A phenol that has formula C20H14O4. |
| pirprofen | |
| fenvalerate | A carboxylic ester obtained by formal condensation between 2-(4-chlorophenyl)-3-methylbutyric acid and cyano(3-phenoxyphenyl)methanol. |
| psymberin | |
| Phenylbutyrates | |
| Isosorbide Dinitrate | A glucitol derivative that has formula C6H8N2O8. |
| Phorate | An organothiophosphate insecticide that has formula C7H17O2PS3. |
| scriptaid | |
| norcantharidin | |
| BMS 649 | |
| N2-((2S)-2-(3,5-difluorophenyl)-2-hydroxyethanoyl)-N1-((7S)-5-methyl-6-oxo-6,7-dihydro-5H-dibenzo(b,d)azepin-7-yl)-L-alaninamide | |
| mannuronic acid | |
| gallocatechol | |
| 3,3'-dichlorobiphenyl | |
| aurapten | |
| Rutin | A rutinoside that is quercetin with the hydroxy group at position C-3 substituted with glucose and rhamnose sugar groups. |
| cephaelin | |
| 3-((4-(4-chlorophenyl)piperazin-1-yl)methyl)-1H-pyrrolo(2,3-b)pyridine | |
| 1-amino-2,4-dibromoanthraquinone | An anthraquinone that has formula C14H7Br2NO2. |
| violacein | |
| diphenylguanidine | |
| Proadifen | |
| perfluorobutyric acid | A monocarboxylic acid that is perfluorinated butyric acid. |
| N-(4-hydroxyphenyl)arachidonylamide | |
| leflunomide | A monocarboxylic acid amide obtained by formal condensation of the carboxy group of 5-methyl-1,2-oxazole-4-carboxylic acid with the anilino group of 4-(trifluoromethyl)aniline. The prodrug of teriflunomide. |
| Terpenes | A hydrocarbon of biological origin having carbon skeleton formally derived from isoprene [CH2=C(CH3)CH=CH2]. |
| undecane | A straight-chain alkane with 11 carbon atoms. |
| N(1),N(11)-diethylnorspermine | |
| norclozapine | |
| oxymatrine | |
| phthalazine | An azaarene that is the 2,3-diaza analogue of naphthalene. The parent of the class of phthalazines. |
| R18 peptide | |
| Methysergide | |
| 2-(3-cyano-5-(3,4-dichlorophenyl)-4,5-dimethylfuran-2(5H)-ylidene)malononitrile | |
| Oligodeoxyribonucleotides | |
| dynorphin (1-13) | |
| Brompheniramine | Pheniramine in which the hydrogen at position 4 of the phenyl substituent is substituted by bromine. A histamine H1 receptor antagonist, brompheniramine is used (commonly as its maleate salt) for the symptomatic relief of allergic conditions, including rhinitis and conjunctivitis. |
| phantolid | |
| Ketanserin | |
| 2-ethynylnaphthalene | |
| quercetin pentaacetate | |
| pluronic block copolymer p85 | |
| allopregnane-3,20-diol | |
| vindeburnol | |
| aspartyl-alanyl-histidyl-lysine | |
| AH 23848 | |
| ICI 118551 | An indane substituted at position 7 by a methyl group and at position 4 by a 3-(isopropylamino)-2-hydroxybutoxy group (the 2R,3S-diastereomer). |
| 8-fluoro-12-(4-methylpiperazin-1-yl)-6H-(1)benzothieno(2,3-b)(1,5)benzodiazepine | |
| benzoylhypaconine | |
| diallyl trisulfide | An organic trisulfide that is trisulfane in which both of the hydrogens are replaced by allyl groups. A component of the essential oil of garlic and a major component of the traditional Chinese medicine allitridium, it exhibits antifungal, antitumour and antioxidant activity |
| levonorgestrel oxime | |
| lercanidipine | |
| 5-p-methylphenyl-5-phenylhydantoin | |
| NOC 18 | |
| Cerulenin | An epoxydodecadienamide isolated from several species, including Acremonium, Acrocylindrum and Helicoceras. It inhibits the biosynthesis of several lipids by interfering with enzyme function. |
| benzyl benzoate | A benzoate ester obtained by the formal condensation of benzoic acid with benzyl alcohol. It has been isolated from the plant species of the genus Polyalthia. |
| ircinin-1 | |
| seletinoid G | |
| anastrozole | A 1,2,4-triazole compound having a 3,5-bis(2-cyano-2-propyl)benzyl group at the 1-position. |
| cannabidiol hydroxyquinone | |
| Nadolol | Nadolol is a diastereoisomeric mixture consisting of equimolar amounts of the four possible 2,3-cis-isomers of 5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol. |
| malealdehyde | A but-2-enedial that has formula C4H4O2. |
| chuanxiong rhizome preparation | |
| phenylglycidyl ether | An aromatic ether that has formula C9H10O2. |
| 2,4,6-trichlorophenyl-4'-aminophenyl ether | |
| genipin | An iridoid monoterpenoid that has formula C11H14O5. |
| Heptanol | |
| 4-iodo-2,5-dimethoxyphenylisopropylamine | |
| pyrrole-2,3,5-tricarboxylic acid | |
| crotonyl alcohol | |
| tabun | |
| salicylaldoxime | |
| tyrphostin AG 1478 | A member of the class of quinazolines that is quinazoline substituted by methoxy groups at positions 6 and 7 and a (3-chlorophenyl)nitrilo group at position 4. It acts as an epidermal growth factor receptor antagonist. |
| 3-acetyl-7-methoxycoumarin | |
| 4-chloro-N-(2-((5-trifluoromethyl-2-pyridyl)sulfonyl)ethyl)benzamide | |
| Free Radicals | |
| alpidem | |
| 5-O-methyl-(E)-resveratrol-3-O-beta-D-apiofuranosyl-(1-6)-beta-D-glucopyranoside | |
| arsenous acid | An arsenic oxoacid consisting of three hydroxy groups attached to a central arsenic atom. |
| L 158809 | |
| diazepinylbenzoic acid | |
| tyrosyl-valyl-alanyl-aspartal | |
| 2,2',3,5,5',6-hexachlorobiphenyl | |
| fluticasone | |
| Clenbuterol | |
| retinol palmitate | |
| muconomycin A | |
| Benzenesulfonates | Any arenesulfonate oxoanion in which the arene moiety is benzene. |
| norflurane | |
| Salicylic Acid | A monohydroxybenzoic acid that is benzoic acid with a hydroxy group at the ortho position. It is obtained from the bark of the white willow and wintergreen leaves. |
| 1-(2-trifluoromethoxyphenyl)-2-nitroethanone | |
| 2-hydroxyestriol | |
| oxaliplatin | A platinum coordination entity that has formula C6H14N2.C2O4.Pt. |
| Heparin | A highly sulfated linear glycosaminoglycan comprising complex patterns of uronic acid-(1->4)-D-glucosamine repeating subunits. Used as an injectable anticoagulant, it has the highest negative charge density of any known biological molecule. |
| Galactose | |
| glargine | |
| Pyrimethamine | |
| E 4031 | A sulfonamide that has formula C21H27N3O3S. |
| N-nitrosoguvacoline | A citraconoyl group that has formula C7H10N2O3. |
| N-Acetylcysteinamide | |
| defibrotide | |
| Dehydroascorbic Acid | A tetrahydrofuranone that has formula C6H6O6. |
| iodixanol | |
| rasagiline | |
| Tetrahydrouridine | |
| NSC 74859 | |
| Silver Nitrate | |
| tryptanthrine | An organic heterotetracyclic compound that has formula C15H8N2O2. |
| Sodium Chloride Symporter Inhibitors | |
| bromodichloromethane | A one-carbon compound that is methane substituted by a bromo and two chloro groups. It occurs as a contaminant in drinking water. |
| 3-aminothioacridone | |
| SR 121566 | |
| Dinitrochlorobenzene | |
| 4-hydroxyphenylethanol | |
| nisoxetine | A secondary amino compound that is N-methyl-3-phenylpropan-1-amine substitued at position 3 by a 2-methoxyphenoxy group. |
| olivacine | A carbazole that has formula C17H14N2. |
| lomerizine | |
| 5,6-dihydrocyclopenta-1,2-dithiole-3-thione | |
| KT 5926 | |
| onabotulinumtoxinA | |
| benzo(c)phenanthrene 3,4-dihydrodiol | |
| 3,3',5-trichlorobenzidine | |
| taurine-ursodeoxycholate conjugate | |
| Amitriptyline | An organic tricyclic compound that is 10,11-dihydro-5H-dibenzo[a,d][7]annulene substituted by a 3-(dimethylamino)propylidene group at position 5. |
| Enkephalin, Leucine | |
| mesaconitine | A diterpenoid that has formula C33H45NO11. |
| alpha-galactosylceramide | |
| ingenol dibenzoate | |
| BIA 3-335 | |
| parthenocissin A | |
| F14512 | |
| bisperoxo(1,10-phenanthroline)oxovanadate(1-) | |
| Bromhexine | |
| olprinone | |
| alpha-benzoylamino-1,4-naphthoquinone | |
| Cytidine Diphosphate Choline | |
| 2-nitrotoluene | A mononitrotoluene that is toluene carrying a nitro substituent at position 2. |
| lipoamide | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of lipoic acid with ammonia. |
| Picryl Chloride | |
| Sulfasalazine | An azobenzene consisting of diphenyldiazene having a carboxy substituent at the 4-position, a hydroxy substituent at the 3-position and a 2-pyridylaminosulphonyl substituent at the 4'-position. |
| Norgestrel | A 17-hydroxy steroid that has formula C21H28O2. |
| MRE 3008-F20 | |
| alvimopan | |
| CGP 56999A | |
| nitisinone | |
| montelukast | An aliphatic sulfide that has formula C35H36ClNO3S. |
| 2-S-glutathionylcaffeic acid | |
| Oxaloacetates | |
| ((E)-N-4-(1,2,3,4-tetrahydroisoquinolin-2-yl)butyl)-3-phenylacrylamide | |
| thioperamide | A primary aliphatic amine that has formula C15H24N4S. |
| N-benzyl-N-hydroxy-5-phenylpentamide | |
| butoconazole | |
| benzo(a)pyrene-6,12-quinone | |
| alpha-hederin | |
| Tetrahydronaphthalenes | |
| Busulfan | |
| Colchicine | An alkaloid that is a carbotricyclic compound comprising 5,6,7,9-tetrahydrobenzo[a]heptalene having four methoxy substituents at the 1-, 2-, 3- and 10-positions as well as an oxo group at the 9-position and an acetamido group at the 7-position. It has been isolated from the plants belonging to genus Colchicum. |
| E 6080 | |
| 2-(4-methoxyphenyl)ethyl-2-acetamido-2-deoxyglucopyranoside | |
| CP 96345 | |
| 6-((3-chloro)anilino)-2-(isopropyl-2-hydroxyethylamino)-9-isopropylpurine | |
| 3,N(4)-ethenocytosine | An organic heterobicyclic compound that has formula C6H5N3O. |
| 24,25-Dihydroxyvitamin D 3 | |
| Monensin | |
| aceclidine | |
| lactacystin | L-Cysteine substituted at nitrogen by an acetyl group and at sulfur by a substituted-lactam carbonyl group. |
| 7-ketocholesterol | A cholestanoid that consists of cholesterol bearing an oxo substituent at position 7. |
| Taurocholic Acid | A bile acid taurine conjugate of cholic acid that usually occurs as the sodium salt of bile in mammals. |
| Cholinesterase Reactivators | A drug used to reverse the inactivation of cholinesterase caused by organophosphates or sulfonates. |
| terbinafine | |
| 3-chloroperbenzoic acid | A peroxy acid that has formula C7H5ClO3. |
| 2,3-dichloro-1-propanol | |
| Dimenhydrinate | The diphenhydramine salt of 8-chlorotheophylline. Its effects are similar to those of diphenhydramine, but it is less potent. It was thought that by combining the antiemetic effects of diphenhydramine with the mild stimulant effects of 8-chlorotheophyline, the extreme drowsiness induced by the former would be mitigated. However, the sedation caused by diphenhydramine is considerably stronger than the stimulation caused by 8-chlorotheophylline. Dimenhydrinate is used mainly as an antiemetic in the prevention and treatment of motion sickness. |
| 3-buten-2-one | |
| Dichlorphenamide | |
| methyl salicylate | A benzoate ester that is the methyl ester of salicylic acid. |
| bromindione | |
| Cisplatin | A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. |
| 5-S-glutathionyldopamine | |
| 14,15-eicosa-5-enoic acid | |
| Nafenopin | A racemate comprising equimolar amounts of (R)- and (S)-nafenopin. It is a peroxisome proliferator that is used experimentally to promote liver tumors. It has been used as an hypolipidemic agent. |
| 3-phosphoglycerate | |
| BW A868C | |
| rhapontigenin | |
| 1-(1-(4-fluorophenyl)ethyl)-3-((3-methoxy-4-(4-methyl-1H-imidazol-1-yl)phenyl)methylene)-2-piperidinone | |
| lanthionine | An alanine derivative in which two alanine residues are linked on their beta-carbons by a thioether linkage. |
| Food Coloring Agents | |
| mevastatin | A carboxylic ester that is pravastatin that is lacking the allylic hydroxy group and in which the lactone moiety has been hydrolysed to the corresponding delta-hydroxy-carboxylic acid. A hydroxymethylglutaryl-CoA reductase inhibitor (statin) isolated from Penicillium citrinum and from Penicillium brevicompactum, its clinical use as a lipid-regulating drug ceased following reports of toxicity in animals. |
| 4-((2-(1-methyl-2-pyrrolidinyl)ethyl)thio)phenol hydrochloride | |
| phosphorus chloride | |
| Eicosapentaenoic Acid | |
| aloe emodin | A dihydroxyanthraquinone that is chrysazin carrying a hydroxymethyl group at position 3. It has been isolated from plant species of the genus Aloe. |
| forsythoside B | |
| 1-cyclohexyl-4-(3-(5-methoxy-1,2,3,4-tetrahydro-naphthalen-1-yl)-propyl)-piperazine | |
| sodium sulfide | |
| 2-(pro-1-ynyl)-5-(5,6-dihydroxypenta-1,3-diynyl)thiophene | |
| mepirodipine | |
| Ro 03-7410 | |
| 1,7-dimethylxanthine | A dimethylxanthine having the two methyl groups located at positions 1 and 7. It is a metabolite of caffeine and theobromine in animals. |
| cyproconazole | A diastereoisomeric mixture composed of enantiomeric pair (2R,3S)- and (2S,3R)-cyproconazole in ratio 1:1 with the enantiomeric pair (2R,3R)- and (2S,3S)-cyproconazole. |
| Chenodeoxycholic Acid | A dihydroxy-5beta-cholanic acid that is (5beta)-cholan-24-oic acid substituted by hydroxy groups at positions 3 and 7 respectively. |
| brazilein | A 1-benzopyran that has formula C16H12O5. |
| GYKI 52466 | A benzodiazepine that has formula C17H15N3O2. |
| Mesalamine | A monohydroxybenzoic acid that is salicylic acid which is substituted by an amino group at the 5-position. |
| Auranofin | |
| N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine | |
| Desipramine | A dibenzoazepine consisting of 10,11-dihydro-5H-dibenzo[b,f]azepine substituted on nitrogen with a 3-(methylamino)propyl group. |
| biotinylated linoleoylglycerylphosphatidylcholine | |
| 2,7-dichlorodibenzo-4-dioxin | |
| 2,2',3,3',4,4',5-heptachlorobiphenyl | |
| Bicyclo Compounds, Heterocyclic | |
| axitinib | |
| 2,4-Dichlorophenoxyacetic Acid | A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2 and 4 are substituted by chlorines. |
| 2'-deoxy-N4-(2-(4-nitrophenyl)ethoxycarbonyl)-5-azacytidine | |
| Molsidomine | |
| EPN oxon | |
| 2-iodomelatonin | |
| NSC 652287 | |
| Dahuang Zhechong pill | |
| 2-amino-3-methyl-3H-imidazo(4,5-f)quinoline | |
| 2-((8-chlorodibenzo(b,f)thiepin-10-yl)oxy)-N-methylethan-1-amine | |
| darexaban glucuronide | |
| 2-amino-3-methyl-9H-pyrido(2,3-b)indole | A pyridoindole that has formula C12H11N3. |
| 2-quinoxaline-carboxamide-N-adamantan-1-yl | |
| Anethole Trithione | |
| SU 1498 | |
| bromotetrandrine | |
| Felodipine | The mixed (methyl, ethyl) diester of 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid. A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. |
| 3-hydroxyflavanone | A monohydroxyflavanone in which the hydroxy group is located at position 3'. |
| caseargrewiin F | |
| Fungal Polysaccharides | |
| FR 190997 | |
| Asbestos, Crocidolite | |
| ReAsH-EDT2 compound | |
| N-vinyl-2-pyrrolidinone | |
| Dimethindene | |
| bistratene A | |
| rutecarpine | A beta-carboline that has formula C18H13N3O. |
| 3-(3,4,5-trimethoxybenzylidene)-5-carboethoxyindolin-2-one | |
| Simazine | A diamino-1,3,5-triazine that is N,N'-diethyl-1,3,5-triazine-2,4-diamine substituted by a chloro group at position 6. |
| homatropine | |
| nitrophenylphosphate | |
| Scopolamine Derivatives | |
| Aminacrine | |
| Erythromycin | Any of several wide-spectrum macrolide antibiotics obtained from actinomycete Saccharopolyspora erythraea (formerly known as Streptomyces erythraeus). |
| 4-(4-((glucopyranosyl)thiomethyl)-5-iodo-1-H-1,2,3-triazol-1-yl)benzenesulfonamide | |
| Ellagic Acid | An organic heterotetracyclic compound resulting from the formal dimerisation of gallic acid by oxidative aromatic coupling with intramolecular lactonisation of both carboxylic acid groups of the resulting biaryl. It is found in many fruits and vegetables, including raspberries, strawberries, cranberries, and pomegranates. |
| LY 353381 | |
| Antimony Potassium Tartrate | |
| 1,1-bis(3'-indolyl)-1-(4-chlorophenyl)methane | |
| CP-673,451 | |
| GSK 3987 | |
| phenyltin | |
| 2,3-bis(2-hydroxyethylsulfanyl)-(1,4)naphthoquinone | |
| Aminoacetonitrile | |
| CP 94253 | |
| martentoxin, Buthus martensi | |
| 4'-hydroxy-3'-methoxyacetophenone | |
| triphenyl phosphate | An aryl phosphate resulting from the formal condensation of phosphoric acid with 3 mol eq. of phenol. |
| cyhexatin | An organotin acaricide that has formula C18H34OSn. |
| phenylalanyl-cyclo(cysteinyltyrosyl-tryptophyl-ornithyl-threonyl-penicillamine)threoninamide | |
| Hexadimethrine Bromide | |
| St. Thomas' Hospital cardioplegic solution | |
| 3-(1,1-dimethyl-heptyl)-1-9-dihydroxy-benzo(c)chromen-6-one | |
| staphylococcal delta toxin | |
| 4-((4-bromophenyl)-(ethoxyimino)methyl)-1'-((2,4-dimethyl-3-pyridinyl)carbonyl)-4'-methyl-1,4'-bipiperidine N-oxide | |
| Testosterone Propionate | A steroid ester that has formula C22H32O3. |
| isoquercitrin | |
| acemetacin | |
| arsenic tetraoxide | |
| Benzolamide | |
| malvidin | An anthocyanidin cation that is delphinidin carrying methyl substituents at positions 3' and 5'. |
| Metoclopramide | A member of the class of benzamides resulting from the formal condensation of 4-amino-5-chloro-2-methoxybenzoic acid with the primary amino group of N,N-diethylethane-1,2-diamine. |
| TEMPO | An aminoxyl that has formula C9H18NO. |
| zhi-mu saponin | |
| 3-(4-dimethylaminobenzylidene)-1,3-dihydroindol-2-one | |
| HS 142-1 | |
| Central Nervous System Agents | A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| juglone | A naphthoquinone that has formula C10H6O3. |
| gastrodin | A glycoside that has formula C13H18O7. |
| Vidarabine Phosphate | |
| CJ 13610 | |
| 2-methyl-3-(4-(3-pyridinylmethyl)phenyl)-2-propenoic acid | |
| Acridine Orange | Fluorescent dye useful for cell cycle determination. It is cell-permeable, and interacts with DNA and RNA by intercalation or electrostatic attractions respectively. |
| 3',4'-dihydroxy-4-monochlorobiphenyl | |
| quintozene | |
| SC 45647 | |
| Terbutaline | A member of the class of phenylethanolamines that is catechol substuted at position 5 by a 2-(tert-butylamino)-1-hydroxyethyl group. |
| arachidonoylserotonin | |
| olvanil | |
| Dopamine | Catechol in which the hydrogen at position 4 is substituted by a 2-aminoethyl group. |
| diphenylcarboxylate | |
| 3-methylsydnone-5-nitrosimine | |
| 17-N,N-diethylcarbamoyl-4-methyl-4-azaandrostane-3-one | |
| U 78517F | |
| trypanothione | A glutathione derivative that has formula C27H49N9O10S2. |
| 9-hydroxymethylanthracene | |
| cesium chloride | |
| pyranoprofen | |
| IC 261 | |
| Arbutin | |
| dimethyl-4,4'-dimethoxy-5,6,5',6'-dimethylene dioxybiphenyl-2,2'-dicarboxylate | |
| N(6)-benzyl-cyclic adenosine 5'-monophosphate | |
| Bee Venoms | |
| Triazoles | An azole in which the five-membered heterocyclic aromatic skeleton contains three N atoms and two C atoms. |
| 6-aminochrysene-1,2-dihydrodiol | |
| 1,2-Dipalmitoylphosphatidylcholine | |
| nickel monoxide | |
| Thyroxine | An iodothyronine compound having iodo substituents at the 3-, 3'-, 5- and 5'-positions. |
| tricyclodecane-9-yl-xanthogenate | |
| 4-octylphenol | A member of the class of phenols that is phenol which is substituted at the para- position by an octyl group. |
| chlorendic acid | A bridged organochlorine compound resulting from the Diels-Alder reaction of hexachlorocyclopentadiene with maleic anhydride followed by hydrolysis of the resulting anhydride. A chemical intermediate used in the preparation of fire-retardant polyester resins and plasticisers. |
| Pyrazinamide | |
| (4-formyl-9-methoxy-5-methyl-naphtho(2,3-b)furan-3-yl)methyl acetate | |
| Biotin | An organic heterobicyclic compound that consists of 2-oxohexahydro-1H-thieno[3,4-d]imidazole having a valeric acid substituent attached to the tetrahydrothiophene ring. The parent of the class of biotins. |
| NSC-87877 | |
| aristolactam I | |
| 2-(2-furanyl)-7-(2-(4-(4-(2-methoxyethoxy)phenyl)-1-piperazinyl)ethyl)-7H-pyrazolo(4,3-e)(1,2,4)triazolo(1,5-c)pyrimidine-5-amine | |
| sodium bichromate | |
| lactisole | |
| propionic acid | |
| Butaclamol | An organic heteropentacyclic compound that is 2,3,4,4a,8,9,13b,14-octahydro-1H-benzo[6,7]cyclohepta[1,2,3-de]pyrido[2,1-a]isoquinoline substituted at position 3 by both hydroxy and tert-butyl groups. |
| 2,3-dichlorobiphenyl | |
| Cryptoxanthins | |
| benoxinate | |
| triphenylethylene | A stilbenoid that has formula C20H16. |
| Silicon | |
| Phytol | A diterpenoid that is hexadec-2-en-1-ol substituted by methyl groups at positions 3, 7, 11 and 15. |
| diethyl sulfate | An alkyl sulfate that has formula C4H10O4S. |
| Elements, Radioactive | |
| bisphenol A | A bisphenol that is 4,4'-methanediyldiphenol in which the methylene hydrogens are replaced by two methyl groups. |
| tecastemizole | |
| Metals | An atom of an element that exhibits typical metallic properties, being typically shiny, with high electrical and thermal conductivity. |
| bisphenol B | A bisphenol that has formula C16H18O2. |
| pleconaril | |
| Arsenic | A pnictogen that has formula As. |
| flucythrinate | An organofluorine acaricide that has formula C26H23F2NO4. |
| Smoke | |
| aminochrome 1 | |
| GW 7647 | A monocarboxylic acid that is 2-(phenylsulfanyl)isobutyric acid in which the phenyl group is substituted at the para- position by a 3-aza-7-cyclohexylhept-1-yl group in which the nitrogen is acylated by a (cyclohexylamino)carbonyl group. |
| ML 7 | An N-sulfonyldiazepane resullting from the formal condensation of 5-iodo-1-naphthylsulfonic acid with one of the nitrogens of 1,4-diazepane. It is a selective inhibitor of myosin light chain kinase (EC 2.7.11.18). |
| Phosphoadenosine Phosphosulfate | |
| ethyl bromophos | |
| 4-carboxybenzaladehyde | |
| ML 9 | |
| Dizocilpine Maleate | |
| N,N-Dimethyltryptamine | A tryptamine derivative having two N-methyl substituents on the side-chain. |
| Clonazepam | 1,3-Dihydro-2H-1,4-benzodiazepin-2-one in which the hydrogens at positions 5 and 7 are substituted by 2-chlorophenyl and nitro groups, respectively. It is used in the treatment of all types of epilepsy and seizures, as well as myoclonus and associated abnormal movements, and panic disorders. However, its use can be limited by the development of tolerance and by sedation. |
| Trihexyphenidyl | |
| eticlopride | |
| Nelfinavir | |
| 2-(2-((13-amino-2-(4-hydroxybenzyl)-3,14-dioxo-1,4-diazacyclotetradec-7-ene-5-carboxamido)methyl)phenyl)acetic acid | |
| nitroaniline | A substituted aniline that carries one or more nitro groups. |
| Cephalosporins | |
| 4-hydroxybutyric acid | A 4-hydroxy monocarboxylic acid that is butyric acid in which one of the hydrogens at position 4 is replaced by a hydroxy group. |
| 2,4-decadienal | |
| isocupressic acid | |
| methysticin | A 2-pyranone that has formula C15H14O5. |
| 5-(alpha-methyl-4-bromobenzylamino)phosphonomethyl-1,4-dihydroquinoxaline-2,3-dione | |
| Thiazoles | An azole in which the five-membered heterocyclic aromatic skeleton contains a N atom and one S atom. |
| valspodar | |
| Dexmedetomidine | |
| fluorocitrate | |
| 7-ethoxycoumarin | A member of the class of coumarins that is umbelliferone in which the hydroxy group at position 7 is replaced by an ethoxy group. |
| anthracene | An ortho-fused tricyclic hydrocarbon comprising three fused benzene rings. |
| beta-pinene | |
| Acetylcholine | |
| dracorhodin | |
| arachidonyltrifluoromethane | |
| Alendronate | |
| 2,3-bis(3'-hydroxybenzyl)butyrolactone | |
| YM-254890 | |
| Perhexiline | |
| 5-(3-((3-(5-methoxybenzisoxazol-3-yl)benzimidazol-1-yl)methyl)phenyl)-5-methyloxazolidinedione | |
| Lentinan | |
| allergovit | |
| Sesquiterpenes | A C15 terpene. |
| 1-(2-cyano-3,12-dioxooleana-1,9-dien-28-oyl) imidazole | |
| 4,4'-dihydroxybiphenyl | |
| estradiol-3,4-quinone | |
| LHRH, Ala(6)-Gly(10)-ethylamide- | |
| cadmium selenide | A cadmium molecular entity that has formula CdSe. |
| S-methyl N,N-diethylthiocarbamate sulfone | |
| Tosyllysine Chloromethyl Ketone | |
| pirinixil | |
| mitonafide | |
| semapimod | |
| 2-octanol | |
| Guanosine Diphosphate | |
| aspidin BB | |
| 2,3-bis(4-hydroxyphenyl)-propionitrile | A nitrile that is acetonitrile in which one of the hydrogens is replaced by a 4-hydroxyphenyl group while a second hydrogen is replaced by a 4-hydroxybenzyl group. It is a specific agonist for estrogen receptor beta (ERbeta). |
| N-acetylleucyl-leucyl-norleucine | |
| 4-amino-5-hexynoic acid | |
| Quisqualic Acid | An alpha-amino acid that has formula C5H7N3O5. |
| Omacor | |
| 4-isopropylphenol | |
| chlorotrifluoroethylene | |
| afloqualone | |
| daunorubicinol | |
| apo-12'-carotenoic acid | |
| L 759656 | |
| (3,3-dibenzylimidazo(1,2-a)pyridin-2-(3H)-one) | |
| sangre de grado | |
| hydroxypyruvic acid | |
| delta-hexachlorocyclohexane | A hexachlorocyclohexane that has formula C6H6Cl6. |
| 10-(2-pyrazolylethoxy)camptothecin | |
| CC 3052 | |
| BD 1008 | |
| Proliferating Cell Nuclear Antigen | |
| omega-Agatoxin IVA | |
| 16-O-demethylaconitine | |
| 3-(4-methylphenylsulfonyl)-2-propenenitrile | |
| tetrachloroguaiacol | |
| Rabeprazole | A sulfoxide that has formula C18H21N3O3S. |
| bredinin | |
| Magnesium Hydroxide | |
| Ethosuximide | A dicarboximide that is pyrrolidine-2,5-dione in which the hydrogens at position 3 are substituted by one methyl and one ethyl group. An antiepileptic, it is used in the treatment of absence seizures and may be used for myoclonic seizures, but is ineffective against tonic-clonic seizures. |
| cynandione A | |
| Ketones | A compound in which a carbonyl group is bonded to two carbon atoms: R2C=O (neither R may be H). |
| 4,7-diphenylphenanthroline sulfonate | |
| persulfated 3,6-(O-glucopyranosyl)xanthone | |
| Ro4368554 | |
| Protease Inhibitors | |
| dexamethasone 21-tributylacetate | |
| nicotinic acid adenine dinucleotide | |
| Carboxylic Acids | A carbon oxoacid acid carrying at least one -C(=O)OH group and having the structure RC(=O)OH, where R is any any monovalent functional group. Carboxylic acids are the most common type of organic acid. |
| 4-(heptyloxy)phenol | An aromatic ether that has formula C13H20O2. |
| Ursodeoxycholic Acid | A bile acid found in the bile of bears (Ursidae) as a conjugate with taurine. Used therapeutically, it prevents the synthesis and absorption of cholesterol and can lead to the dissolution of gallstones. |
| 7 alpha-hydroxy-4-cholesten-3-one | |
| noroxycodone | |
| r-1,t-2,3,c-4-tetrahydroxy-1,2,3,4-tetrahydrophenanthrene | |
| BQ 485 | A peptide that has formula C35H44N6O5. |
| oltipraz | A 1,2-dithiole that is 3H-1,2-dithiole-3-thione substituted at positions 4 and 5 by methyl and pyrazin-2-yl groups respectively. |
| bismuth tripotassium dicitrate | |
| SB 3CT compound | |
| N-(4-tert-butylphenyl)-4-(3-chloropyridin-2-yl)tetrahydropyrazine-1(2H)-carboxamide | |
| 1,24-dihydroxyvitamin D2 | |
| theaflavin | |
| trimethylarsine | An arsine that is arsane in which each of the hydrogens is substituted by a methyl group. |
| 2-(((3,5-dichlorophenyl)carbamoyl)oxy)-2-methyl-3-butenoic acid | |
| potassium periodate | |
| JTE 907 | |
| ascaridole | A p-menthane monoterpenoid that is p-menth-2-ene with a peroxy group across position 1 to 4. |
| benefin | |
| oxcarbazepine | A dibenzoazepine derivative, having a carbamoyl group at the ring nitrogen, substituted with an oxo group at C-4 of the azepeine ring which is also hydrogenated at C-4 and C-5. It is a anticholinergic anticonvulsant and mood stabilizing drug, used primarily in the treatment of epilepsy. |
| 1,2-dioctanoylglycerol | |
| aminoflavone | |
| SR 12813 | An organic phosphonate that is the tetraethyl ester of [2-(3,5-di-tert-butyl-4-hydroxyphenyl)ethene-1,1-diyl]bis(phosphonic acid). |
| Methoprene | An isopropyl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate that has formula C19H34O3. |
| Carbaryl | |
| Mycotoxins | Poisonous substance produced by fungi. |
| benzene 1,2,4-trisphosphate | |
| ethylisopropylamiloride | |
| N-((2-(hydroxyaminocarbonyl)methyl)-4-methylpentanoyl)-3-(2'-naphthyl)alanylalanine, 2-aminoethylamide | |
| pervanadate | |
| norharman | |
| remogliflozin etabonate | |
| panduratin A | A diarylheptanoid that has formula C26H30O4. |
| AS602868 | |
| pentabrominated diphenyl ether 100 | |
| H 35-25 | |
| NP00111 | |
| Bradykinin | A linear nonapeptide messenger belonging to the kinin group of proteins, with amino acid sequence RPPGFSPFR. Enzymatically produced from kallidin in the blood, it is a powerful vasodilator that causes smooth muscle contraction, and may mediate inflammation. |
| V 10367 | |
| Asbestos | Fibrous incombustible mineral composed of magnesium and calcium silicates with or without other elements. |
| benzylideneacetone | An enone in which a phenyl ring is attached to the beta-carbon atom of but-3-en-2-one. |
| Gestodene | |
| Hydroxyzine | A N-alkylpiperazine that is piperzine in which the nitrogens atoms are substituted by 2-(2-hydroxyethoxy)ethyl and (4-chlorophenyl)(phenyl)methyl groups respectively. |
| betanin | A betalain that has formula C24H26N2O13. |
| Dothiepin | |
| anthracenylmethyl homospermidine | |
| 2,2-bis(hydroxymethyl)-1-azabicyclo(2,2,2,)octan-3-one | |
| Cycloheximide | A piperidine antibiotic that has formula C15H23NO4. |
| beta-nitrostyrene | |
| fasudil | |
| 6-isopropoxy-9-oxoxanthene-2-carboxylic acid | |
| echinacoside | An oligosaccharide that has formula C35H46O20. |
| azidoprazosin | |
| musk ketone | |
| goniothalamin | |
| phoxim | An organothiophosphate insecticide that has formula C12H15N2O3PS. |
| Zinc Sulfate | A metal sulfate compound having zinc(2+) as the counterion. |
| triphenyltin hydroxide | |
| Ro 4-6790 | |
| Permethrin | A cyclopropanecarboxylate ester in which the esterifying alcohol is 3-phenoxybenzyl alcohol and the cyclopropane ring is substituted with a 2,2-dichlorovinyl group and with gem-dimethyl groups. |
| sodium phosphate | |
| MG 262 | |
| PKI 166 | |
| ETP-45299 | |
| boldine methine | |
| 2-nitrofluorene | A nitroarene that is fluorene substituted by a nitro group at position 2. |
| Sulfates | Salts and esters of sulfuric acid |
| alpha-benzyl-N-methylphenethylamine | |
| Active Hexose Correlated Compound | |
| prophalan | |
| botulinum toxin type D | |
| botulinum toxin type C | |
| Benzophenones | Any aromatic ketone in which the carbonyl group is bonded to 2 phenyl groups. |
| thiocyanate | A pseudohalide anion obtained by deprotonation of the thiol group of thiocyanic acid. |
| droloxifene | A stilbenoid that has formula C26H29NO2. |
| methylone | |
| T16AInh-A01 | |
| poly-N-4-vinylbenzyllactonamide | |
| morin | A pentahydroxyflavone that is 7-hydroxyflavonol bearing three additional hydroxy substituents at positions 2' 4' and 5. |
| dihydrosphingosine 1-phosphate | |
| Prodigiosin | A member of the class of tripyrroles that is a red-coloured pigment with antibiotic properties produced by Serratia marcescens. |
| VULM 1457 | |
| PNU-282987 | |
| 2-nitroanisole | A member of the class of 2-nitroanisoles that is anisole in which one of the hydrogens ortho to the methoxy group is replaced by a nitro group. |
| Deferoxamine | |
| heparin, O-desulfated | |
| guaiazulene | |
| Biperiden | |
| fluvalinate | An organofluorine acaricide that has formula C26H22ClF3N2O3. |
| benzyloxycarbonyl-leucyl-glutamyl-histidyl-aspartic acid fluoromethyl ketone | |
| Adenylyl Imidodiphosphate | |
| cobamamide | |
| Acarbose | A tetrasaccharide derivative consisting of a dideoxy-4-{[4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl C7 cyclitol moiety [called valienol (or valienamine)] linked via nitrogen to isomaltotriose. |
| 2-hydroxy-3-methoxyestradiol | |
| carnosol | A diterpenoid that has formula C20H26O4. |
| Adiponectin | |
| aspartyl-glutamyl-valyl-aspartyl-p-nitroanilide | |
| pyridate | A pyridazine that has formula C19H23ClN2O2S. |
| 4-(5-(4-chlorophenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl)benzenesulfonamide | |
| 4-chloro-2-cresol | |
| ethylenediamine | |
| fructose-1,6-diphosphate | |
| KB 130015 | |
| S 1 (combination) | |
| perfosfamide | |
| O-Acetyl-ADP-Ribose | |
| 2-iodophenyl-(1-(1-methylpiperidin-2-ylmethyl)-1H-indol-3-yl)methanone | |
| buprofezin | A thiadiazinane that has formula C16H23N3OS. |
| ZM 230487 | |
| Chlorambucil | |
| 3-(3-dimethylaminopropylamino)-8-oxo-8H-acenaphtho(1,2-b)pyrrole-9-carbonitrile | |
| 6-Ketoprostaglandin F1 alpha | |
| Aluminum Compounds | |
| Organophosphates | |
| heptylparaben | |
| pregna-4,17-diene-3,16-dione | |
| Diquat | The organic cation formed formally by addition of an ethylene bridge between the nitrogen atoms of 2,2'-bipyridine. Most often available as the dibromide. |
| Labrasol | |
| adriamycinol | |
| Vehicle Emissions | |
| Trimedoxime | |
| dibenzylfluorescein | |
| 1-(6-((3-methoxyestra-1,3,5(10)-trien-17-yl)amino)hexyl)-1H-pyrrole-2,5-dione | |
| Chloral Hydrate | An organochlorine compound that is the hydrate of trichloroacetaldehyde. |
| 6-Cyano-7-nitroquinoxaline-2,3-dione | A quinoxaline derivative that has formula C9H4N4O4. |
| 4-methylumbelliferyl-galactopyranoside | |
| Temazepam | |
| azosemide | A sulfonamide that is benzenesulfonamide which is substituted at positions 2, 4, and 5 by chlorine, (2-thienylmethyl)amino and 1H-tetrazol-5-yl groups, respectively. It is a diuretic that has been used in the management of oedema and hypertension. |
| Pirenzepine | |
| cyclopentanol | The simplest member of the class of cyclopentanols bearing a single hydroxy substituent. The parent of the class of cyclopentanols. |
| manganese(III)-tetrakis(4-benzoic acid)porphyrin | |
| Ro 32-0432 | |
| 5-((4-methylphenyl)methylene)-2-(phenylamino)-4(5H)-thiazolone | |
| tetrahydrocurcumin | A beta-diketone that is curcumin in which both of the double bonds have been reduced to single bonds. |
| 17-alpha-Hydroxypregnenolone | A hydroxypregnenolone carrying an alpha-hydroxy group at position 17. |
| S-Adenosylhomocysteine | |
| O(2)-(2,4-dinitrophenyl) 1-((4-ethoxycarbonyl)piperazin-1-yl)diazen-1-ium-1,2-diolate | |
| 4-nonylphenol | A member of the class of phenols that is phenol which is para-substituted with a nonyl group. |
| fluazinam | A member of the class of aminopyridines that is 2-amino-5-(trifluoromethyl)pyridine in which one of the amino hydrogens is replaced by a 3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl group. A fungicide used to control grey mould, downy mildew and other fungal pathogens. |
| 4-amino-2-phenoxymethanesulfonanilide | |
| glutaric acid | An alpha,omega-dicarboxylic acid that is a linear five-carbon dicarboxylic acid. |
| Hormones | Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| S-(2,4-dinitrophenyl)glutathione | A Glu-Cys-Gly tripeptide glutathione conjugate containing a 2,4-dinitrophenyl substituent on the S of Cys. |
| bemitradine | |
| phenothiazine | |
| 3-dinitrobenzene | |
| 4-hydroxymercuribenzoate | |
| BVT116429 | |
| Fire Trol 934 | |
| terconazole | |
| 4-dimethylamino-3',4'-dimethoxychalcone | |
| phosphatidylinositol 3,4-diphosphate | |
| SDZ HDL 376 | |
| palmitoyl trifluoromethyl ketone | |
| amentoflavone | A biflavonoid that is obtained by oxidative coupling of two molecules of apigenin resulting in a bond between positions C-3 of the hydroxyphenyl ring and C-8 of the chromene ring. A natural product found particularly in Ginkgo biloba and Hypericum perforatum. |
| 2,4,4'-trichlorobiphenyl | |
| 2-chlorobenzaldehyde | |
| zaprinast | |
| dimethyl-4-toluidine | |
| Minoxidil | A pyrimidine N-oxide that is pyrimidine-2,4-diamine 3-oxide substituted by a piperidin-1-yl group at position 6. |
| chelerythrine | A benzophenanthridine alkaloid isolated from the root of Zanthoxylum simulans, Chelidonium majus L., and other Papaveraceae. |
| benzo(c)phenanthrene | A phenanthrene that has formula C18H12. |
| diethyl fumarate | |
| BN 50730 | |
| 3-((2-fluorothiazol-4-yl)ethynyl)-5-fluorobenzonitrile | |
| 2-(3-hydroxypropoxy)-1,25-dihydroxyvitamin D3 | |
| 4-(2'-methoxyphenyl)-1-(2'-(N-(2''-pyridinyl)-4-iodobenzamido)ethyl)piperazine | |
| 4-nitrophenyl laurate | |
| BN 50739 | |
| piericidin A | |
| cholanic acid | A steroid acid that consists of cholane having a carboxy group in place of the methyl group at position 24. |
| diflorasone | The 16beta-analogue of flumethasone. It is used as the 17,21-diacetate as a topical anti-inflammatory and antipruritic in the treatment of various skin disorders. |
| ecopipam | |
| 5-7-oxo-zeaenol | |
| 2-piperidinoethyl 4-amino-5-chloro-2-methoxybenzoate | |
| 8-hydroxyquinoline glucuronide | |
| methoxytryptophol | |
| undecanal | A fatty aldehyde formally arising from reduction of the carboxylic acid group of undecanoic acid. It is a component of essential oils from citrus plants like Citrus reticulata. |
| di-n-butylphosphoric acid | |
| vildagliptin | |
| panobinostat | |
| Sch 59228 | |
| 9-(8-azabicyclo(3.2.1)oct-3-ylidene)-9H-xanthene-3-carboxylic acid diethylamide | |
| AM 281 | |
| 5-aziridinyl-3-hydroxyl-1-methylindole-4,7-dione | |
| SB 243213 | An indolyl carboxylic acid that has formula C22H19F3N4O2. |
| 5,10,15,20-tetrakis(4-sulfonatophenyl)porphyrinato iron(III) chloride | |
| oxamyl | A carbamate ester that has formula C7H13N3O3S. |
| amyrin | |
| garcinol | A monoterpenoid that has formula C38H50O6. |
| 2-nitrophenylacetic acid | |
| A-836339 | |
| tetrahydrodeoxycorticosterone | |
| arsenic acid | An arsenic oxoacid comprising one oxo group and three hydroxy groups attached to a central arsenic atom. |
| 3-methylquercetin | |
| motexafin gadolinium | A metallotexaphyrin that has formula C52H72GdN5O14. |
| pamoic acid | A dicarboxylic acid that has formula C23H16O6. |
| 1,1,2-trichloroethane | A member of the class of chloroethanes that is ethane substituted by chloro groups at positions 1, 1 and 2. |
| Hematoporphyrins | |
| ethyl protocatechuate | |
| PH 163 | |
| Phenylbutazone | A member of the class of pyrazolidines that is 1,2-diphenylpyrazolidine-3,5-dione carrying a butyl group at the 4-position. |
| ADP-ribosylarginine | |
| alpha-glycerophosphoric acid | |
| 3-nitropropionic acid | |
| 18-hydroxycortisol | |
| Naphthols | Any hydroxynaphthalene derivative that has a single hydroxy substituent. |
| microcystin RR | |
| retrorsine | A macrolide that has formula C18H25NO6. |
| dofequidar | |
| Ionomycin | A very long-chain fatty acid that is docosa-10,16-dienoic acid which is substituted by methyl groups at positions 4, 6, 8, 12, 14, 18 and 20, by hydroxy groups at positions 11, 19 and 21, and by a (2',5-dimethyloctahydro-2,2'-bifuran-5-yl)ethanol group at position 21. An ionophore produced by Streptomyces conglobatus, it is used in research to raise the intracellular level of Ca(2+) and as a research tool to understand Ca(2+) transport across biological membranes. |
| dimethylamine | A secondary aliphatic amine where both N-substituents are methyl. |
| Methionine | A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
| MZ-J-7-118 | |
| ebselen | A benzoselenazole that is 1,2-benzoselenazol-3-one carrying an additional phenyl substituent at position 2. Acts as a mimic of glutathione peroxidase. |
| n-butoxyacetaldehyde | |
| Creatine | |
| 1-oxo-1-(5-(2-pyridyl)-2-yl)-7-phenylheptane | |
| androst-16-en-3-ol | |
| XCT790 | A cinnamamide that has formula C23H13F9N4O3S. |
| fondaparinux | A synthetic pentasaccharide which, apart from the O-methyl group at the reducing end of the molecule, consists of monomeric sugar units which are identical to a sequence of five monomeric sugar units that can be isolated after either chemical or enzymatic cleavage of the polymeric glycosaminoglycans heparin and heparan sulfate. |
| N,N'-bis(salicylideneamino)ethane-manganese(II) | |
| 7-(3,4 dihydroxyphenyl)-5-hydroxy-1-phenyl-1-heptene | |
| Dicarboxylic Acids | |
| diethylstilbestrol monophosphate | |
| mito-carboxy proxyl | |
| Hexanones | A ketone that is a hexane carrying an oxo substituent at unspecified position. |
| phthalocyanine Pc 4 | |
| AFDX 384 | A pyridobenzodiazepine that acts as a selective antagonist of the muscarinic acetylcholine receptors. |
| N-methylnaloxone | |
| catechol | A benzenediol comprising of a benzene core carrying two hydroxy substituents ortho to each other. |
| 2-trans-4-trans-decadienal | |
| calfactant | |
| 2-chloroaniline | |
| 2,4'-dichlorobiphenyl | A dichlorobiphenyl that is chlorobenzene in which the hydrogen at position 2 has been replaced by a 4-chlorophenyl group. |
| 3-methoxymorphinan | |
| boldine | An isoquinoline alkaloid that has formula C19H21NO4. |
| diheptyl phthalate | The diheptyl ester of benzene-1,2-dicarboxylic acid. |
| 4-methylumbelliferyl glucoside | |
| 9-(6-aminopyridin-3-yl)-1-(3-(trifluoromethyl)phenyl)benzo(h)(1,6)naphthyridin-2(1H)-one | |
| Flavones | A member of the class of flavonoid with a 2-aryl-1-benzopyran-4-one (2-arylchromen-4-one) skeleton and its substituted derivatives. |
| riddelliine | A macrolide that is 13,19-didehydrosenecionan bearing two additional hydroxy substituents at positions 12 and 18 as well as two additional oxo groups at positions 11 and 16. |
| farnesylthiosalicylic acid | |
| alphaxalone | |
| mirtazapine | A tetracyclic antidepressant that has formula C17H19N3. |
| STO 609 | |
| GW 707 | |
| 3-(carbamoylamino)-5-(3-fluorophenyl)-N-(3-piperidyl)thiophene-2-carboxamide | |
| Mevalonic Acid | A dihydroxy monocarboxylic acid comprising valeric acid having two hydroxy groups at the 3- and 5-positions together with a methyl group at the 3-position. |
| thonningianin A | A tannin that has formula C42H34O21. |
| Selenious Acid | |
| Ifosfamide | The simplest member of the class of ifosfamides that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by 2-chloroethyl groups on both the nitrogen atoms respectively. It is a nitrogen mustard alkylating agent used in the treatment of advanced breast cancer. |
| NSC 23766 | |
| CGP 48369 | |
| anagrelide | A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
| Ro 47-8634 | |
| denbufylline | |
| Sodium Pertechnetate Tc 99m | |
| 4-chloro-3-(4-cyclopropylbenzyl)-1-(xylopyranosyl)-1H-indole | |
| antileukinate | |
| Diatrizoate Meglumine | |
| formamide | The simplest monocarboxylic acid amide, obtained by formal condensation of formic acid with ammonia. The parent of the class of formaldehydes. |
| enilconazole | A racemate comprising equimolar amounts of (R)- and (S)-enilconazole. A fungicide used to control a wide range of fungi including Tilletia and Helminthosporium spp. on fruit, vegetables and ornamentals. It is also used in veterinary medicine as a topical antimycotic. |
| isofenphos | A salicylate that has formula C15H24NO4PS. |
| N-chloromethylbrucine | |
| isoxaben | A benzamide obtained by formal condensation of the carboxy group of 2,6-dimethoxybenzoic acid and the amino group of 3-(3-methylpentan-3-yl)-1,2-oxazol-5-amine. |
| 1,2,4,5-tetrabromobenzene | |
| Phlorhizin | |
| 5-(5-amino-3-(4-fluorophenyl)pyrazin-2-yl)-1-isopropylprydine-2(1H)-one | |
| certolizumab pegol | |
| monobutyryl cyclic AMP | |
| N,N'-bis(dichloroacetyl)-1,8-octamethylenediamine | |
| Megestrol Acetate | A steroid ester that has formula C24H32O4. |
| vaticanol C | |
| Dronabinol | |
| UAB 30 | |
| 2-methoxycinnamaldehyde | |
| seryl-leucyl-isoleucyl-glycyl--arginyl-leucinamide | |
| raubasine | |
| PD 407824 | |
| fingolimod | |
| 2-aminopyrimidine | |
| 2-chloroethyl ethyl sulfide | |
| anandamide | A fatty amide obtained by the formal condensation of arachidonic acid with ethanolamine. |
| Aconitine | A diterpenoid that is 20-ethyl-3alpha,13,15alpha-trihydroxy-1alpha,6alpha,16beta-trimethoxy-4-(methoxymethyl)aconitane-8,14alpha-diol having acetate and benzoate groups at the 8- and 14-positions respectively. |
| 2-dodecyl-6-methoxycyclohexa-2,5-diene-1,4-dione | |
| Indans | |
| Ipratropium | A propanoate ester that has formula C20H30NO3. |
| 4,5-dianilinophthalimide | Phthalimide substituted at the 4- and 5-positions by anilino groups. |
| Fluorocarbons | Compounds consisting wholly of fluorine and carbon. |
| oncrasin-1 | |
| tetrafluoroethylene | |
| histidyl-proline diketopiperazine | |
| Hydroxychloroquine | |
| perfluorooctane sulfonic acid | |
| Hymecromone | |
| nutlin 3 | A Nutlin that has formula C30H30Cl2N4O4. |
| 1-(1-propynyl)pyrene | |
| Ro 41-0960 | |
| selenocystine | A diselenide that has formula C6H12N2O4Se2. |
| Nitrobenzenes | A C-nitro compound with formula C6H(6-n)(NO2)n (n can be from 1 up to 6, but is usually 1, 2 or 3). A closed class. |
| asoxime chloride | |
| 1,2-dihydroxy-1,2-dihydronaphthalene | |
| benzyloxycarbonyl-valyl-alanyl-aspartyl-fluoromethane | |
| 1-(4-nitro-2-(trifluoromethyl)phenyl)-4-(3-(trifluoromethyl)phenyl)piperazine | |
| N'-((1E)-(4-(diethylamino)phenyl)methylene)-4-hydroxybenzohydrazide | |
| argatroban | An alpha-N-substituted L-arginine that has formula C23H36N6O5S. |
| carebastine | |
| AGN 193109 | |
| Gallopamil | |
| crocetin | A 20-carbon dicarboxylic acid which is a diterpenoid and natural carotenoid. Found in the crocus flower, it has been administered as an anti-fatigue dietary supplement. |
| 4-chlorocatechol | A chlorocatechol that is catechol substituted by a chloro group at position 4. |
| 2-amino-4-phenylbutyric acid | |
| o,p'-DDT | |
| valerylsalicylate | |
| tolclofos-methyl | An organic thiophosphate that is 2,6-dichloro-4-methylphenol in which the hydrogen of the hydroxy group group has been replaced by a dimethoxyphosphorothioyl group. Tolclofos-methyl is a phospholipid biosynthesis inhibitor and fungicide that is used for controlling soil-borne diseases caused by Typhula incarnata, Corticium rolfsii, Typhula ishikariensis, and Rhizoctonia solani. |
| Phosphodiesterase Inhibitors | An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| N-(1-Acetyl-2,3-dihydro-1H-indol-6-yl)-3-(3-cyano-phenyl)-N-(1-(2-cyclopentyl-ethyl)-piperidin-4yl)acrylamide | |
| Hypochlorous Acid | A chlorine oxoacid with formula HOCl; a weak, unstable acid, it is the active form of chlorine in water. |
| desmethylastemizole | |
| Ferrichrome | A member of the class of ferrichromes that is an iron(III) chelate of a homodetic cyclic peptide made up of a tripeptide of glycine and a tripeptide of N(4)-acetyl-N(4)-hydroxy-L-ornithine. |
| 6-methoxycomaparvin | |
| erucic acid | A docosenoic acid having a cis- double bond at C-13. It is found particularly in brassicas - it is a major component of mustard and rapeseed oils and is produced by broccoli, Brussels sprouts, kale, and wallflowers. |
| 1,1-bis(3'-indolyl)-1-(4-trifluoromethylphenyl)methane | |
| methoxyacetic acid | |
| Contact Lens Solutions | |
| beta-Naphthoflavone | An extended flavonoid resulting from the formal fusion of a benzene ring with the f side of flavone. |
| Dacarbazine | A monocarboxylic acid amide that is 1H-imidazole-4-carboxamide which is substituted at position 5 by a 3,3-dimethyltriaz-1-en-1-yl group. It is used for the treatment of metastatic malignant melanoma, and in combination with other drugs for the treatment of Hodgkin's disease and soft-tissue sarcoma. |
| N-methyl-7H-dibenzo(c,g)carbazole | |
| Coumaric Acids | |
| octabromobiphenyl | |
| thioflavin T | An organic chloride salt having 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium as the counterion. It is widely used to visualise and quantify the presence of amyloids, both in vitro and in vivo. |
| triadimefon | A racemate comprising equal amounts of (R)- and (S)-triadimefon. A fungicide used to control powdery mildew, rusts and other infections in many crops. |
| Peptidoglycan | A glycosaminoglycan formed by alternating residues of D-glucosamine and either muramic acid {2-amino-3-O-[(S)-1-carboxyethyl]-2-deoxy-D-glucose} or L-talosaminuronic acid (2-amino-2-deoxy-L-taluronic acid), which are usually N-acetylated or N-glycoloylated. The carboxyl group of the muramic acid is commonly substituted by a peptide containing residues of both L- and D-amino acids, whereas that of L-talosaminuronic acid is substituted by a peptide consisting of L-amino acids only. |
| 2-chloro-5-nitrobenzanilide | A benzamide that has formula C13H9ClN2O3. |
| 5,7,3',4'-tetramethylluteolin | |
| sodium arsenite | An inoganic sodium salt with formula with formula NaAsO2. |
| 4-(3-(4-(4-fluoro-phenyl)-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-propoxy)-benzamide | |
| 3,5,6-trichloro-2-pyridinol | |
| Fluorescein-5-isothiocyanate | The 5-isomer of fluorescein isothiocyanate. Acts as a fluorescent probe capable of being conjugated to tissue and proteins; used as a label in fluorescent antibody staining procedures as well as protein- and amino acid-binding techniques. |
| Mianserin | |
| Probenecid | |
| phlorofucofuroeckol A | |
| 5,5-dimethyl-3-(3-fluorophenyl)-4-(4-methylsulfonyl)phenyl-2(5H)-furanone | |
| Edrophonium | |
| 2-methyl-4-chlorophenol | |
| sodium perchlorate | |
| Promensil | |
| hexyl 2,5-dichlorophenylphosphoroamidate | |
| 13-hydroxy-9,11-octadecadienoic acid | |
| TEMPOL-H | |
| Econazole | A racemate composed of equimolar amounts of (R)- and (S)-econazole. Used (as its nitrate salt) to treat skin infections such as athlete's foot, jock itch, ringworm and other fungal skin infections. |
| bis(cysteinato)zincate(lI) | |
| olaparib | A member of the class of N-acylpiperazines obtained by formal condensation of the carboxy group of 2-fluoro-5-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]benzoic acid with the free amino group of N-(cyclpropylcarbonyl)piperazine. |
| Methyldopa | |
| thiazolyl blue | |
| benzyl selenocyanate | |
| 7alpha,11beta-dimethyl-19-nortestosterone | |
| 4-oxofenretinide | |
| 5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-((2-(trifluoromethyl)benzyl)oxy)thiophene-2-carboxamide | |
| enfuvirtide | |
| tapentadol | |
| 4-ethylphenol | A member of the class of phenols carrying an ethyl substituent at position 4. |
| Polycyclic Hydrocarbons, Aromatic | |
| nonivamide | |
| 1-(3-(4-(3-chlorophenyl)-1-piperazinyl)propyl)-3,4-dihydro-5-methoxy-2(1H)-quinolinone | |
| labdanolic acid methyl ester | |
| (N)-methanocarba-2MeSADP | |
| 1-(2-((1-ethoxycarbonyloxyethoxycarbonylmethyl)carbamoyl)-3-phenylpropyldisulfanylmethyl)-3-methylsulfanylpropylamine | |
| diphenidol | |
| Mustard Gas | |
| Taurolithocholic Acid | The bile acid taurine conjugate of lithocholic acid. |
| benzil | An alpha-diketone that is ethane-1,2-dione substituted by phenyl groups at positions 1 and 2 respectively. |
| 6 beta-hydroxytestosterone | A 17beta-hydroxy steroid that is testosterone bearing an additional hydroxy substituent at the 6beta-position. |
| secretoneurin | |
| Stearates | |
| xanthurenic acid | A quinolinemonocarboxylic acid that is quinoline-2-carboxylic acid substituted by hydroxy groups at C-4 and C-8. |
| NCX 4040 | |
| Depsipeptides | A natural or synthetic compound having a sequence of amino and hydroxy carboxylic acid residues (usually alpha-amino and alpha-hydroxy acids), commonly but not necessarily regularly alternating. |
| Cefotiam | |
| Carbon Monoxide | A one-carbon compound in which the carbon is joined only to a single oxygen. It is a colourless, odourless, tasteless, toxic gas. |
| RO 3306 | |
| estrone-3-glucuronide | |
| Sirolimus | |
| 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole | |
| Bolton Hunter-cholecystokinin nonapeptide | |
| CHIR-124 | |
| chromic chloride | |
| propioin | |
| potassium chromate(VI) | |
| 6-hydroxyquinoline | |
| tebufenozide | A carbohydrazide that is hydrazine in which the amino hydrogens have been replaced by tert-butyl, 3,5-dimethylbenzoyl and 4-ethylbenzoyl groups respectively. It is an insecticide used widely against caterpillars. |
| Vidarabine | |
| 1,6-dinitropyrene | A pyrene that has formula C16H8N2O4. |
| bufogenin | A steroid lactone that has formula C24H32O4. |
| 7-benzyloxy-4-trifluoromethylcoumarin | |
| Pregnenolone Carbonitrile | |
| phenyl acetate | |
| Ethanolamine | |
| hydroxypentenal | |
| N1-(2-aminophenyl)-N8-phenyloctanediamide | |
| glycylproline 4-nitroanilide | |
| ramatroban | |
| Cytarabine | A pyrimidine nucleoside in which cytosine is attached to D-arabinofuranose via a beta-N(1)-glycosidic bond. |
| decanoic acid | |
| adefovir dipivoxil | |
| Disulfoton | An organic thiophosphate that is the diethyl ester of S-[2-(ethylsulfanyl)ethyl] dihydrogen phosphorodithioate. |
| squalestatin 1 | A polyketide isolated from fungi that is a potent inhibitor of fungal and mammalian squalene synthase. |
| LY 341495 | |
| Oleylethanolamide | |
| N-(1-(4-cyclopropylmethyl-3,4-dihydro-2H-benzo(1,4)oxazin-6-yl)ethyl)-3-(2-fluorophenyl)acrylamide | |
| ginsenoside Rg3 | |
| Pravastatin | A carboxylic ester resulting from the formal condensation of (S)-2-methylbutyric acid with the hydroxy group adjacent to the ring junction of (3R,5R)-7-[(1S,2S,6S,8S,8aR)-6,8-dihydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid. Derived from microbial transformation of mevastatin, pravastatin is a reversible inhibitor of 3-hydroxy-3-methylglutaryl-coenzyme A (HMG-CoA). The sodium salt is used for lowering cholesterol and preventing cardiovascular disease. It is one of the lower potency statins, but has the advantage of fewer side effects compared with lovastatin and simvastatin. |
| ginsenoside Rg1 | A ginsenoside found in Panax ginseng and Panax japonicus var. major that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions, in which the hydroxy groups at positions 6 and 20 have been converted to the corresponding beta-D-glucopyranosides, and in which a double bond has been introduced at the 24-25 position. |
| Organophosphonates | |
| kolaviron | |
| S-Nitroso-N-Acetylpenicillamine | |
| adipic acid | |
| 5-hydroxyeicosatetraenoic acid lactone | |
| Prednisone | A synthetic glucocorticoid drug that is particularly effective as an immunosuppressant, and affects virtually all of the immune system. Prednisone is a prodrug that is converted by the liver into prednisolone (a beta-hydroxy group instead of the oxo group at position 11), which is the active drug and also a steroid. |
| Carotenoids | |
| Buspirone | An azaspiro compound that is 8-azaspiro[4.5]decane-7,9-dione substituted at the nitrogen atom by a 4-(piperazin-1-yl)butyl group which in turn is substituted by a pyrimidin-2-yl group at the nitrogen atom. |
| oren gedoku to | |
| Quinolinium Compounds | |
| azamethiphos | An organochlorine acaricide that has formula C9H10ClN2O5PS. |
| benzo(a)pyrene 7,8-oxide | A pyrene that has formula C20H12O. |
| Cefuroxime | A 3-(carbamoyloxymethyl)cephalosporin compound having a 7-(2Z)-2-(furan-2-yl)-2-(methoxyimino)acetamido side chain. |
| methyl 2-cyano-3,12-dioxooleana-1,9(11)-dien-28-oate | |
| 3,4,5,3',4'-pentachlorobiphenyl | |
| beryllium sulfate | A metal sulfate in which the metal is beryllium (in the +2 oxidation state) and the ratio of beryllium to sulfate is 1:1. |
| Benzaldehydes | Any arenecarbaldehyde that consists of a formyl substituted benzene ring and its substituted derivatives thereof. |
| sym-trinitrobenzene | |
| glutathione glycylethyl ester | |
| periodate-oxidized adenosine | |
| (2S,4R)-methyl-1-acetyl-4-(N-(4-bromophenyl)sulfamoyloxy)pyrrolidine-2-carboxylate | |
| zolantidine | |
| Thiourea | The simplest member of the thiourea class, consisting of urea with the oxygen atom substituted by sulfur. |
| sultopride | |
| 4,5-dihydroorotic acid | |
| 2-ethyl-4-(4-hydroxyphenyl)-5-(4-(2-piperidin-1-ylethoxy)phenyl)-2-imidazoline | |
| Triiodothyronine | |
| Hydroxyl Radical | |
| Chlorobutanol | |
| G(M1) Ganglioside | |
| 5-nitroso-8-quinolinol | |
| KC 500 | |
| dehydroglyasperin C | |
| Chlortetracycline | A tetracycline that has formula C22H23ClN2O8. |
| 2-desamino-2-methylaminopterin | |
| 4-hydroxyphenylacetic acid | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 4-hydroxyphenyl group. |
| patchouli alcohol | A carbotricyclic compound and sesquiterpenoid tertiary alcohol that is tricyclo[5.3.1.0(3,8)]undecan-3-ol which is substituted at positions 2, 2, 6 and 8 by methyl groups (the 1R,3R,6S,7S,8S-diastereoisomer). |
| pyrrolo(2,1-c)(1,4)benzodiazepine | |
| 12-O-tetradecanoylphorbol-1,3-acetate | |
| PI103 | |
| adrogolide hydrochloride | |
| cefoselis | A cephalosporin that has formula C19H22N8O6S2. |
| Coal Tar | |
| PF 03715455 | |
| Dimethylphenylpiperazinium Iodide | |
| si-wu-tang | |
| Uridine Diphosphate N-Acetylgalactosamine | |
| 2-toluidine | |
| 1-carboxysalsolinol | |
| eicosa-5,11,14-trienoic acid | |
| Glycosylphosphatidylinositols | |
| Echinomycin | A cyclodepsipeptide that has formula C51H64N12O12S2. |
| Thymidine | A pyrimidine 2'-deoxyribonucleoside having thymine as the nucleobase. |
| gabazine | |
| heptane-1,7-bis-(dimethyl-3'-phthalimidopropyl)ammonium bromide | |
| 2-(2-(4-phenoxy-2-propylphenoxy)ethyl)indole-5-acetic acid | |
| silybin | |
| NW 1029 | |
| 3,4,5,6-tetrachlorocatechol | |
| 1-(4-(octahydropyrido(1,2-a)pyrazin-2-yl)phenyl)-2-phenyl-1,2,3,4-tetrahydroisoquinolin-6-ol | |
| thymiplatin | |
| Dietary Sucrose | |
| gamma-butyrobetaine | |
| microorganism fermentation extract | |
| 3-hydroxy-5-cholestenoic acid | |
| SB 222200 | |
| Tocopherols | |
| arachidoyl-coenzyme A | |
| troxacitabine | |
| IC486241 | |
| Anabasine | A pyridine alkaloid that is pyridine substituted by a piperidin-2-yl group at position 3. |
| Procaterol | |
| Cerium | A lanthanoid atom that has formula Ce. |
| 1-nitropyrene | A nitroarene that is pyrene substituted at the 1-position by a nitro group. A by-product of combustion, it is the predominant nitrated polycyclic aromatic hydrocarbon emitted in a diesel engine. |
| methyl pyruvate | An alpha-ketoester that has formula C4H6O3. |
| Aluminum Oxide | |
| Fenoterol | |
| acetoacetic acid | A 3-oxo monocarboxylic acid that is butyric acid bearing a 3-oxo substituent. |
| fosbretabulin | |
| cetaben | |
| acetic anhydride | An acyclic carboxylic anhydride that has formula C4H6O3. |
| Sulfobromophthalein | |
| diacetylcurcumin | |
| alverine | |
| Polyethylene | A polymer composed of ethane units. |
| AQ4N | |
| N-(4-(2-hydroxy-3-(2-methoxy-1-oxyethylaminobenzene)propoxy))benzaldehyde | |
| Glucosylceramides | Any of the cerebrosides in which the monosaccharide head group is glucose. |
| Deuteroporphyrins | |
| 3-chloroaniline | |
| Cesium | |
| iopromide | A dicarboxylic acid diamide that consists of N-methylisophthalamide bearing three iodo substituents at positions 2, 4 and 6, a methoxyacetyl substituent at position 5 and two 2,3-dihydroxypropyl groups attached to the amide nitrogens. A water soluble x-ray contrast agent for intravascular administration. |
| quinidinium | |
| Capsaicin | A capsaicinoid that has formula C18H27NO3. |
| Kathon 886 | |
| 6-O-monoacetylmorphine | |
| acetaminophen cysteine | |
| 3,4-dichlorinated biphenyl | |
| 3-methoxymethyl-7-(4,4,4-trifluorobutoxy)-3,3a,4,5-tetrahydro-1,3-oxazolo(3,4-a)quinolin-1-one | |
| dulcin | An urea that has formula C9H12N2O2. |
| cinnamic aldehyde | |
| dioxybenzone | |
| 1,25-dihydroxy-16-ene-vitamin D3 | |
| Triazolam | A triazolobenzodiazepine that has formula C17H12Cl2N4. |
| fenoprop | A monocarboxylic acid that has formula C9H7Cl3O3. |
| BCG Vaccine | |
| 5-n-butyl-pyrazolo(1,5-a)pyrimidine | |
| 9-oxononanoic acid | A medium-chain oxo-fatty acid that is the 9-oxo derivative of nonanoic acid. |
| rubimaillin | |
| phthalic anhydride | The cyclic dicarboxylic anhydride that is the anhydride of phthalic acid. |
| protocatechualdehyde | |
| trilostane | |
| geldanamycin | A 19-membered macrocyle incorporating a benzoquinone ring and a lactam functionality. it is an ansamycin antibiotic and thus shows antimicrobial activity against many gram-positive and some gram-negative bacteria. |
| N-hydroxy-4-aminobiphenyl | A N-substituted amine that is 4-aminobiphenyl substituted by a hydroxy group at the nitrogen atom. |
| methyl 4-tolylsulfide | |
| SCH-202676 | |
| N-(1,2,3,4-tetrahydro-1-naphthyl)-4-nitroaniline | |
| Halofenate | |
| N,N-diethyl-3-hydroxymethylbenzamide | |
| Isoniazid | |
| 2-chlorodibenzo-4-dioxin | |
| IDN 5109 | |
| ethyl cinnamate | A cinnamate ester that has formula C11H12O2. |
| Changkil | |
| biphosphinic palladacycle complex | |
| n-propyl disulfide | |
| metanil yellow | |
| Sizofiran | |
| m-(N,N,N-trimethylammonio)trifluoroacetophenone | |
| Androsterone | An androstanoid that is 5alpha-androstane having a hydroxy substituent at the 3alpha-position and an oxo group at the 17-position. It is a metabolite of dehydroepiandrosterone . |
| chromium tripicolinate | |
| N-acetyl-S-geranylgeranyl-cysteine | |
| 2,3,5-(triglutathion-S-yl)hydroquinone | |
| 3,5-dimethoxy-4'-hydroxystilbene | |
| Trazodone | An N-arylpiperazine in which one nitrogen is substituted by a 3-chlorophenyl group, while the other is substituted by a 3-(3-oxo[1,2,4]triazolo[4,3-a]pyridin-2(3H)-yl)propyl group. |
| perfluorooctanesulfonamide | |
| dimethyl succinate | |
| 1-ethyl-2-benzimidazolinone | An imidazole that has formula C9H10N2O. |
| SB939 compound | |
| 3-(5'-hydroxymethyl-2'-furyl)-1-benzylindazole | |
| myristicin | An organic molecular entity that has formula C11H12O3. |
| dimethylarsine | |
| 3'-amino-2',3'-dideoxycytidine | |
| 2-oxohexyl isothiocyanate | |
| Muscarinic Agonists | |
| oleuropein | A terpene glycoside that has formula C25H32O13. |
| 1-(N-(3-ammoniopropyl)-N-(n-propyl)amino)diazen-1-ium-1,2-diolate | |
| Acrylamide | A member of the class of acrylamides that results from the formal condensation of acrylic acid with ammonia. |
| R116301 | |
| 3-ketolithocholic acid | |
| Sodium Acetate | An organic sodium salt that has formula C2H3NaO2. |
| 4-hydroxy-N-desmethyltamoxifen | A stilbenoid that has formula C25H27NO2. |
| 5,6-dichloro-1-ethyl-1,3-dihydro-2H-benzimidazol-2-one | |
| 1-naphthaldehyde | A naphthaldehyde with a formyl group at position 1. |
| voglibose | |
| AS 19 compound | |
| capecitabine | |
| arjunolic acid | A pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by hydroxy groups at positions 2, 3 and 23 (the 2alpha,3beta stereoisomer). Isolated from Symplocos lancifolia and Juglans sinensis, it exhibits antioxidant and antimicrobial activities. |
| PD 142893 | |
| GW0072 | |
| phenyltoloxamine | |
| alpha-methylhistamine | An aralkylamino compound that is histamine bearing a methyl substituent at the alpha-position. |
| Thenoyltrifluoroacetone | |
| Hexylresorcinol | |
| antimony trichloride | An inorganic chloride salt with formula SbCl3. It is used as a reagent for detecting vitamin A and related carotenoids, reacting with the carotenoid to form a blue complex that can be measured by colorimetry (the Carr-Price test). Solutions of antimony trichloride were formerly used for dissolving and removing horn stubs from calves and goats. |
| Octanols | |
| 4-phenylbutylamine | |
| flavone acetic acid | |
| Neostigmine | A quaternary ammonium ion comprising an anilinium ion core having three methyl substituents on the aniline nitrogen, and a 3-[(dimethylcarbamoyl)oxy] substituent at position 3. It is a parasympathomimetic which acts as a reversible acetylcholinesterase inhibitor. |
| 5,6-dichloro-1-beta-D-ribofuranosylbenzimidazole-3',5'-monophosphorothioate | |
| APETx1, Anthopleura elegantissima | |
| Thiazolidinediones | An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| tetrahydropalmatine | A berberine alkaloid obtained by formal addition of two molecules of hydrogen to the pyridine ring of palmatine. |
| sodium bromide | An inorganic sodium salt having bromide as the counterion. |
| Hydromorphone | A morphinane alkaloid that has formula C17H19NO3. |
| 17-(4'-ethynyldimethylbenzylamine)-17-testosterone | |
| 5-hydroxyindomethacin | |
| 4-hydroxyestradiol | |
| Acetamides | Compounds with the general formula RNHC(=O)CH3. |
| muconic acid | A hexadienedioic acid with unsaturation at positions 2 and 4. |
| Uroporphyrinogens | |
| benzyl salicylate | |
| TBC 3214 | |
| N-acetylglucosaminono-1,5-lactone O-(phenylcarbamoyl)oxime | |
| isocoumarin NM-3 | |
| methyl 3-hydroxyimino-11-oxoolean-12-en-28-oate | |
| Isoetharine | |
| paliperidone | |
| clavulone II | A clavulone that has formula C25H34O7. |
| alpha-ketobutyric acid | |
| o-Phthalaldehyde | |
| 20-hydroxyeicosa-5(Z),14(Z)-dienoic acid | |
| methylmercury cysteine | |
| chetomin | An organic heteropentacyclic compound of the class of epipolythiodioxopiperazine. Isolated from Chaetomium globosum and Farrowia seminuda, it exhibits immunosuppressive activity. |
| Turpentine | |
| paeonol | A methoxybenzene that has formula C9H10O3. |
| 2-vanillin | |
| imidazole | |
| nicotinamide N-oxide | |
| clofarabine | |
| 3,4',5-trimethoxystilbene | |
| 2-chlorobiphenyl | A monochlorobiphenyl carrying a single chloro substituent at position 2. |
| hyperoside | |
| Mannose | An aldohexose that is the C-2 epimer of glucose. |
| Stilbenes | Any olefinic compound characterised by a 1,2-diphenylethylene backbone. |
| divinyl sulfone | A sulfone compound having two S-vinyl substituents. |
| Fatty Acids, Nonesterified | |
| everolimus | |
| SAR 020106 | |
| cornin iridoid | |
| BD 1047 | |
| Deoxyguanosine | |
| 2-oxindole | |
| maleylacetone | |
| Nitric Acid | |
| 3-cyano-7-ethoxycoumarin | |
| energostim | |
| Gadolinium DTPA | |
| panaxadiol | |
| potassium octatitanate | |
| 2-amino-4-phosphonobutyric acid | |
| 8-(4-methoxyphenyl)-4-oxo-4,6,7,8-tetrahydroimidazo(2,1-c)(1,2,4)triazine-3-carbohydrazide | |
| titanium alloy (TiAl6V4) | |
| Vasotocin | A heterodetic cyclic peptide that is homologous to oxytocin and vasopressin. It is a pituitary hormone that acts as an endocrine regulator for water balance, osmotic homoeostasis and is involved in social and sexual behavior in non-mammalian vertebrates. |
| Amantadine | A member of the class of adamantanes that is used as an antiviral and antiparkinson drug. |
| Prometryne | |
| Cortisone | A C21-steroid that is pregn-4-ene substituted by hydroxy groups at positions 17 and 21 and oxo group at positions 3, 11 and 20. |
| 5,8,11,14-Eicosatetraynoic Acid | |
| aluminum maltolate | |
| Triterpenes | A C30 terpene. |
| methylurea | |
| 17 alpha-iodoethynylestradiol | |
| benfuracarb | A 1-benzofuran that has formula C20H30N2O5S. |
| Durapatite | |
| 9-chloro-2-(2-furyl)-5-phenylacetylamino(1,2,4)triazolo(1,5-c)quinazoline | |
| CP-654577 | |
| 4,7-phenanthroline | A phenanthroline that has formula C12H8N2. |
| Zyflamend | |
| phenylhydrazine | A phenylhydrazine that is the monophenyl derivative of hydrazine. |
| phenyl salicylate | A benzoate ester that is the phenyl ester of salicylic acid. |
| 1-palmitoyl-2-lysophosphatidylcholine | |
| Phencyclidine | A member of the class of piperidines that is piperidine in which the nitrogen is substituted with a 1-phenylcyclohexyl group. Formerly used as an anaesthetic agent, it exhibits both hallucinogenic and neurotoxic effects. |
| Pulmonary Surfactants | |
| SC 514 | |
| tolfenamic acid | |
| 3,4-xylidine | |
| Dextrans | |
| brusatol | A triterpenoid that has formula C26H32O11. |
| DRF 2519 | |
| Orotic Acid | |
| alpha-hexachlorocyclohexane | A hexachlorocyclohexane that has formula C6H6Cl6. |
| Bentonite | |
| 5,12,20-trihydroxy-6,8,10,14-eicosatetraenoic acid | |
| 4-fluoroaniline | A primary arylamine that is the derivative of aniline in which the hydrogen at position 4 has been substituted by fluorine. It is used as an intermediate in the manufacture of pharmaceuticals, herbicides and plant growth regulators. |
| GDC-0152 | |
| imidapril | |
| Mesna | |
| MSH, 4-Nle-7-Phe-alpha- | |
| N-(N-(3,5-difluorophenacetyl)alanyl)phenylglycine tert-butyl ester | |
| Nitrosomethylurethane | |
| Oligopeptides | |
| 12-hydroxydodecanoic acid | A medium-chain fatty acid that is the 12-hydroxylated derivative of lauric acid. |
| 6-(2-fluoroethoxy)-2-(2-(4-methylaminophenil)ethenyl)benzoxazole | |
| 2,3',4,4',5-pentachlorobiphenyl | |
| dichloridobis(3-imino-2-methoxyflavanone)ruthenium(II) | |
| Coffee | |
| wuzi yanzong | |
| 7-propyl spirolactone | |
| fraxetin | A hydroxycoumarin that has formula C10H8O5. |
| Dicloxacillin | A penicillin that has formula C19H17Cl2N3O5S. |
| arodyn | |
| nodularin | An ether that has formula C41H60N8O10. |
| 1,1-bis(3'-indolyl)-1-(p-anisyl)methane | |
| azacyclonol | |
| Timolol | 1,2,5-Thiadiazole substituted at the 3 position by a 3-(tert-butylamino)-2-hydroxypropoxy group and at the 4 position by a morpholin-4-yl group. The (S)-(-) enantiomer, also known as timolol, is a beta-adrenergic antagonist and is used in the mangement of glaucoma, hypertension, angina pectoris and myocardial infarction, and for the prevention of migraine. |
| 2-butylamino-2-demethoxy-hypocrellin B | |
| 3-(phenylsulfonyl)-4-(2-(4-(2-(3,7,11-trimethyldodeca-2,6,10-trienylthio)benzoyl)piperazin-1-yl)ethoxy)-1,2,5-oxadiazole-2-oxide | |
| ethephon | |
| Arginine Vasopressin | |
| pancratistatin | A citraconoyl group that has formula C14H15NO8. |
| 3-hydroxyquinidine | |
| Carbonyl Cyanide p-Trifluoromethoxyphenylhydrazone | A hydrazone that is hydrazonomalononitrile in which one of the hydrazine hydrogens is substituted by a p-trifluoromethoxyphenyl group. |
| 2-aminodiphenyl | |
| Galantamine | |
| (4-chloro-2-((2-methyl-5-(propylsulfonyl)phenyl)ethynyl)phenoxy)acetic acid | |
| Carisoprodol | A carbamate ester that is the mono-N-isopropyl derivative of meprobamate (which is a significant metabolite). Carisoprodol interrupts neuronal communication within the reticular formation and spinal cord, resulting in sedation and alteration in pain perception. It is used as a muscle relaxant in the symptomatic treatment of musculoskeletal conditions associated with painful muscle spasm. |
| Pentanones | |
| Aminolevulinic Acid | |
| Acetazolamide | A thiadiazole that has formula C4H6N4O3S2. |
| triciribine | A nucleoside analogue in which the nucleobase portion is a 1,4,5,6,8-pentaazaacenaphthylene ring system substituted with an amino group at position 3, and a methyl group at position 5 and is bound to the beta-D-ribofuranosyl moiety by an N(1)-glycosidic linkage. |
| cerivastatin | (3R,5S)-3,5-dihydroxyhept-6-enoic acid in which the (7E)-hydrogen is substituted by a 4-(4-fluorophenyl)-2,6-diisopropyl-5-(methoxymethyl)pyridin-3-yl group. Formerly used (as its sodium salt) to lower cholesterol and prevent cardiovascular disease, it was withdrawn from the market worldwide in 2001 following reports of a severe form of muscle toxicity. |
| chloro(2,2'-6',2''-terpyridine)(2,2'-bipyridine)ruthenium | |
| 3-(pentadec-10-enyl)catechol | |
| vortioxetine | An N-arylpiperazine in which the aryl group is specified as 2-[(2,4-dimethylphenyl)sulfanyl]phenyl. Used (as its hydrobromide salt) for treatment of major depressive disorder. |
| Ritonavir | A L-valine derivative in which the alpha-nitrogen of L-valinamide is substituted with a methyl{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}carbamoyl group and the amide nitrogen by a (2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl group. An antiretroviral drug from the protease inhibitor class used to treat HIV infection and AIDS, it is often used as a fixed-dose combination with another protease inhibitor, lopinavir. |
| Glucuronides | |
| histamine trifluoromethyl-toluidide | |
| quercetin 3-O-glucuronide | |
| olomoucine II | |
| 3-aminopropylphosphinic acid | |
| Cosyntropin | A synthetic peptide that is identical to the 24-amino acid segment at the N-terminal of adrenocorticotropic hormone (corticotropin). A segment similar in all species, it contains the biological activity that stimulates production of corticosteroids in the adrenal cortex. It is used diagnostically to investigate adrenocortical insufficiency. |
| Phosphorus | |
| 2-amino-6-borono-2-(difluoromethyl)hexanoic acid | |
| Levodopa | |
| Thiophenes | Compounds containing at least one thiophene ring. |
| Isocyanates | Organonitrogen compounds that are derivatives of isocyanic acid; compounds containing the isocyanate functional group -N=C=O (as opposed to the cyanate group, -O-C#N). |
| 2-(5-benzo(1,3)dioxol-5-yl-2-tert-butyl-3H-imidazol-4-yl)-6-methylpyridine hydrochloride | |
| 4-ethylnaphthalen-1-yl-(1-pentylindol-3-yl)methanone | |
| Ro 41-5253 | |
| eritoran | A lipid A derivative used for the treatment of severe sepsis. |
| beta-Tocopherol | A tocopherol in which the chroman-6-ol core is substituted by methyl groups at positions 5 and 8. While it is found in low concentrations in many vegetable oils, only cottonseed oil contains significant amounts. |
| 2-methyl-1-((4-methyl-5-isoquinolinyl)sulfonyl)homopiperazine | |
| elzasonan | |
| praeruptorin E | |
| praeruptorin C | |
| 3,4,5,4'-tetrahydroxystilbene | |
| praeruptorin A | |
| 2-sec-butylphenol | A member of the class of phenols that is phenol carrying a butan-2-yl group at position 2. |
| octanoic acid | |
| Rotenone | A member of the class of rotenones that consists of 1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one substituted at position 2 by a prop-1-en-2-yl group and at positions 8 and 9 by methoxy groups (the 2R,6aS,12aS-isomer). A non-systemic insecticide, it is the principal insecticidal constituent of derris (the dried rhizome and root of Derris elliptica). |
| stevioside | |
| 17-desoxyestradiol | A 3-hydroxy steroid resulting from deoxygenation at position 17 of estradiol or estrone. |
| sabcomeline | |
| rosemarinic acid | |
| 4-androstene-3,17-diol | |
| 2-mercaptomethylbenzimidazole | |
| Desoximetasone | Dexamethasone in which the hydroxy group at the 17alpha position is substituted by hydrogen. A synthetic corticosteroid with glucocorticoid activity, it is used as an anti-inflammatory and anti-pruritic in the treatment of various skin disorders, including skin allergies and psoriasis. |
| geranylgeranyl pyrophosphate | |
| Prednisolone | A glucocorticoid that is prednisone in which the oxo group at position 11 has been reduced to the corresponding beta-hydroxy group. It is a drug metabolite of prednisone. |
| Mustard Compounds | |
| MF59 oil emulsion | |
| pateamine A | |
| pyrrolidine | A cyclic amine whose five-membered ring contains four carbon atoms and one nitrogen atom; the parent compound of the pyrrolidine family. |
| Acetylthiocholine | |
| PK 11195 | A monocarboxylic acid amide obtained by formal condensation of the carboxy group of 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid with the amino group of sec-butylmethylamine |
| 24-hydroxycholesterol | A 24-hydroxy steroid that has formula C27H46O2. |
| acetyl-11-ketoboswellic acid | |
| Hydroxyindoleacetic Acid | |
| Elacridar | |
| Hemagglutinins | |
| ergosta-7,22-dien-5-hydroxy-3,6-dione | |
| 2,2,2,-trichloro-1-(3,4-dichlorophenyl)-ethylacetate | |
| Propafenone | An aromatic ketone that is 3-(propylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is replaced by a 2-(3-phenylpropanoyl)phenyl group. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used as the hydrochloride salt in the management of supraventricular and ventricular arrhythmias. |
| Aniline Mustard | |
| 3-morpholinopropyl isothiocyanate | |
| 2,4,5,2',4',5'-hexachlorobiphenyl | |
| Opiate Alkaloids | |
| Anacardic Acids | |
| cadmium acetate | |
| zopiclone | |
| 20-alpha-dihydrodydrogesterone | |
| soyasaponin Ab | |
| bendiocarb | A benzodioxole that has formula C11H13NO4. |
| 4-ethylaniline | |
| glycyl-histidyl-lysine | |
| 7-methoxy-N-((6-(3-methylisothiazol-5-yl)-(1,2,4)triazolo(4,3-b)pyridazin-3-yl)methyl)-1,5-naphthyridin-4-amine | |
| BAY u9773 | |
| trimazosin | |
| hesperetin | A trihydroxyflavanone having the three hydroxy gropus located at the 3'-, 5- and 7-positions and an additional methoxy substituent at the 4'-position. |
| Fumarates | |
| 1-(5-chloro-2,4-dimethoxyphenyl)-3-(5-methylisoxazol-3-yl)urea | |
| isomethyleugenol | A phenylpropanoid that has formula C11H14O2. |
| Lucanthone | A thioxanthen-9-one compound having a methyl substituent at the 1-position and a 2-[(diethylamino)ethyl]amino substituent at the 4-position. Formerly used for the treatment of schistosomiasis. It is a prodrug, being metabolised to hycanthone. |
| 1,4-diaminoanthraquinone | |
| apo-14'-carotenoic acid | |
| CP 265298 | |
| cepharanthine | An isoquinoline that has formula C37H38N2O6. |
| alpha-cyano-4-hydroxycinnamate | |
| Apamin | |
| Serotonin | A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
| GDC-0973 | |
| 3,5-dicaffeoylquinic acid methyl ester | |
| molinate | An azepane that has formula C9H17NOS. |
| 2,4-dibromophenol | A bromophenol that has formula C6H4Br2O. |
| 6-bromo-8-ethoxy-3-nitro-2H-chromene | |
| chrysoeriol | |
| 4-hydroxy-2-nonenoic acid | |
| 15-hydroxy-5,8,11,13-eicosatetraenoic acid | |
| methyl 5-chloro-4,5-didehydrojasmonate | |
| 1,2-linoleoylphosphatidylcholine | |
| Fusidic Acid | A steroid antibiotic that is isolated from the fermentation broth of Fusidium coccineum. |
| Cyclic AMP | |
| 2-ethyl-5-carboxypentyl phthalate | |
| Methomyl | A carbamate ester obtained by the formal condensation of methylcarbamic acid with the hydroxy group of 1-(methylsulfanyl)acetaldoxime. |
| KN 93 | |
| disparlure | |
| BEACOPP protocol | |
| MK-8776 | |
| glycine-extended gastrin 17 | |
| paricalcitol | |
| BPDE-II | |
| ZM 241385 | |
| 7-hydroxytheonellasterol | |
| 3,4-methylenedioxyethamphetamine | |
| cyclo-L-glycyl-L-2-allylproline | |
| 11,12,15-trihydroxyeicosatrienoic acid | |
| SR 59104A | |
| 14-benzyloxy-4,5-epoxy-3-hydroxy-17-methylmorphinan-6-one | |
| bazedoxifene | |
| Antivenins | |
| butylcyclohexane | |
| thioacridone | |
| Flupenthixol | |
| 2-ethoxyethanol | |
| 4'-hydroxyflavanone | A monohydroxyflavanone that has formula C15H12O3. |
| N,N-diallyl-tyrosyl-alpha-aminoisobutyric acid-phenylalanyl-leucine | |
| quinapril | An isoquinoline that has formula C25H30N2O5. |
| 5-hydroxydiclofenac | A member of the class of phenols that is the 5-hydroxylated metabolite of diclofenac. |
| myxothiazol | A 2,4'-bi-1,3-thiazole substituted at the 4-position with a (1E,3S,4R,5E)-7-amino-3,5-dimethoxy-4-methyl-7-oxohepta-1,5-dien-1-yl] group and at the 2'-position with a (2S,3E,5E)-7-methylocta-3,5-dien-2-yl group. It is an inhibitor of coenzyme Q - cytochrome c reductase. |
| Cortodoxone | |
| ICI D2138 | |
| arbutamine | |
| benzyloxycarbonyl-isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone | |
| Androstanols | |
| bis(acetato)(1-adamantylamine)amminedichloroplatinum(IV) | |
| Pentanoic Acids | |
| sesamex | A benzodioxole that has formula C15H22O6. |
| 5-S-glutathionyl-alpha-methyldopa | |
| mancozeb | A mixture composed from maneb and zineb, which is used as a broad-spectrum contact fungicide. |
| nordihydrocapsaicin | |
| 2-(4-isobutylphenyl)propionic acid 4-(diethoxyphosphoryloxy)butyl ester | |
| Zymosan | |
| imazethapyr | An aromatic carboxylic acid that has formula C15H19N3O3. |
| benzanthracene-3,4-dihydrodiol | |
| 2-((2-(dimethylamino)ethyl)thio)-3-phenylquinoline | |
| 4-(2-(3,5-dimethoxyphenyl)vinyl)pyridine | |
| Spermine | A polyazaalkane that is tetradecane in which the carbons at positions 1, 5, 10 and 14 are replaced by nitrogens. Spermine has broad actions on cellular metabolism. |
| tiagabine | |
| 1-methylfluorene | |
| 1,2-bis-N-cytisinylethane | |
| BW 245C | |
| NSC 401077 | |
| procymidone | An azabicycloalkane that is 1,5-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione in which the amino hydrogen is replaced by a 3,5-dichlorophenyl group. A fungicide widely used in horticulture as a seed dressing, pre-harvest spray or post-harvest dip for the control of various diseases. |
| etofibrate | |
| Trypsin Inhibitors | An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of trypsin (EC 3.4.21.4). |
| calcipotriene | |
| PQ 401 | |
| 2,3,5,6-tetrafluoro-4-methylbenzyl (Z)-(1RS)-cis-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropanecarboxylate | |
| cytisine | An organic heterotricyclic compound that is the toxic principle in Laburnum seeds and is found in many members of the Fabaceae (legume, pea or bean) family. An acetylcholine agonist, it is widely used throughout Eastern Europe as an aid to giving up smoking. |
| potassium mercuric thiocyanate | |
| Bretylium Tosylate | The tosylate salt of bretylium. It blocks noradrenaline release from the peripheral sympathetic nervous system, and is used in emergency medicine, cardiology, and other specialties for the acute management of ventricular tachycardia and ventricular fibrillation. |
| oxcarbamazepine | |
| Cholinesterase Inhibitors | An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| riccardin D | |
| Adenosine-5'-(N-ethylcarboxamide) | A derivative of adenosine in which the 5'-hydroxymethyl group is replaced by an N-ethylcarboxamido group. |
| metoprine | |
| splitomicin | A benzochromenone that is 2,3-dihydro-1H-benzo[f]chromene substituted by an oxo group at position 3. It has been found to exhibit potential inhibitory activity against Sir2 proteins. |
| cyamemazine | |
| Ethionine | |
| rocuronium | A 5alpha-androstane compound having 3alpha-hydroxy-, 17beta-acetoxy-, 2beta-morpholino- and 16beta-N-allyllyrrolidinium substituents. |
| lucidone | |
| Enzyme Inhibitors | |
| chrysarobin | |
| YC137 | |
| aciculatin | |
| Perindopril | An alpha-amino acid ester that is the ethyl ester of N-{(2S)-1-[(2S,3aS,7aS)-2-carboxyoctahydro-1H-indol-1-yl]-1-oxopropan-2-yl}-L-norvaline |
| 4-hydroxytoremifene | |
| 2-hydroxyestradiol | |
| Indinavir | |
| 3-caffeoyl-4-dihydrocaffeoylquinic acid | A quinic acid that has formula C25H26O12. |
| 9,12-dioxo-10-dodecenoic acid | |
| SCH 14988 | |
| 4-(methylnitrosamino)-1-(3-pyridyl)-1-butan-1-ol | |
| cyclobenzaprine | 5-Methylidene-5H-dibenzo[a,d]cycloheptene in which one of the hydrogens of the methylidene group is substituted by a 2-(dimethylamino)ethyl group. A centrally acting skeletal muscle relaxant, it is used as its hydrochloride salt in the symptomatic treatment of painful muscle spasm. |
| carbamic acid | A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
| Scutellaria baicalensis extract | |
| bropirimine | A pyrimidine that has formula C10H8BrN3O. |
| diethanolamine | |
| N,N-di-n-hexyl-2-(4-fluorophenyl)indole-3-acetamide | |
| kahweol acetate | |
| S 3483 | |
| Thiamine | |
| niuhuang | |
| GW280264X | |
| Thyroid Hormones | Any hormone produced by the thyroid gland |
| stilbene oxide | An epoxide that has formula C14H12O. |
| 11,12-dihydroxyeicosatrienoic acid | |
| N-(2(R)-2-(hydroxamidocarbonylmethyl)-4-methylpentanoyl)-L-tryptophan methylamide | |
| Sufentanil | An anilide resulting from the formal condensation of the aryl amino group of 4-(methoxymethyl)-N-phenyl-1-[2-(2-thienyl)ethyl]piperidin-4-amine with propanoic acid. |
| 7-methoxy-4-trifluoromethylcoumarin | |
| 2-phenyl-2-(1-piperidinyl)propane | |
| muconaldehyde | |
| 8-Hydroxy-2-(di-n-propylamino)tetralin | |
| Soybean Oil | |
| SCH 51866 | |
| perfluorohexanoic acid | A monocarboxylic acid that is perfluorinated hexanoic acid. |
| emtricitabine | |
| azaribine | |
| dichlobanil | |
| conotoxin GV | |
| benzeneseleninic acid | |
| Glucaric Acid | A hexaric acid derived by oxidation of sugar such as glucose with nitric acid. |
| dehydroglyasperin D | |
| 4-xylene | |
| 1-palmitoyl-2-arachidonyl-3-phosphorylcholine | |
| dexamethasone oxetanone | |
| ozagrel | |
| Mannitol | A hexitol produced by a variety of organisms including bacteria, fungi, lichens and plants. |
| Paroxetine | A benzodioxole that consists of piperidine bearing 1,3-benzodioxol-5-yloxy)methyl and 4-fluorophenyl substituents at positions 3 and 4 respectively; the (3S,4R)-diastereomer. Highly potent and selective 5-HT uptake inhibitor that binds with high affinity to the serotonin transporter (Ki = 0.05 nM). Ki values are 1.1, 350 and 1100 nM for inhibition of [3H]-5-HT, [3H]-l-NA and [3H]-DA uptake respectively. Displays minimal affinity for alpha1-, alpha2- or beta-adrenoceptors, 5-HT2A, 5-HT1A, D2 or H1 receptors at concentrations below 1000 nM, however displays weak affinity for muscarinic ACh receptors (Ki = 42 nM). Antidepressant and anxiolytic in vivo. |
| phenethyl salicylate | |
| zinc mesoporphyrin | |
| sappanchalcone | A member of the class of chalcones that consists of trans-chalcone substituted by hydroxy groups at positions 3, 4 and 4' and a methoxy group at position 2'. Isolated from Caesalpinia sappan, it exhibits neuroprotective and cytoprotective activity. |
| milbemycin | |
| doramectin | |
| lipstatin | |
| 5-benzylacyclouridine | |
| Quinolines | A class of aromatic heterocyclic compounds each of which contains a benzene ring ortho fused to carbons 2 and 3 of a pyridine ring. |
| Propolis | |
| N4-(2,2-dimethyl-3-oxo-4H-pyrid(1,4)oxazin-6-yl)-5-fluoro-N2-(3,4,5-trimethoxyphenyl)-2,4-pyrimidinediamine | |
| A 77636 | |
| tretazicar | |
| R 121919 | |
| cyfluthrin | A carboxylic ester obtained by formal condensation between 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid and (4-fluoro-3-phenoxyphenyl)(hydroxy)acetonitrile. |
| stearoyl-coenzyme A | |
| 4-methyl-7-diethylaminocoumarin | |
| Ammonium Chloride | An inorganic chloride that has formula ClH4N. |
| 4,4'-(hexafluoroisopropylidene)diphenol | |
| strontium chloride | |
| hydroxymethyltolbutamide | |
| chlorpyrifos-methyl | An organic thiophosphate that is O,O-dimethyl hydrogen phosphorothioate in which the hydrogen of the hydroxy group has been replaced by a 3,5,6-trichloropyridin-2-yl group. |
| harmol | |
| tribromodiphenyl ether 28 | |
| MK 212 | |
| Heterocyclic Compounds | |
| L 709049 | |
| thiacloprid | A nitrile that is cyanamide in which the hydrogens are replaced by a 1,3-thiazolidin-2-ylidene group which in turn is substituted by a (6-chloropyridin-3-yl)methyl group at the ring nitrogen. |
| omega-Chloroacetophenone | |
| angelica lactone | |
| 4'-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol | |
| pronamide | An organohalogen compound that has formula C12H11Cl2NO. |
| ((3Z)-N-(3-chlorophenyl)-3-((3,5-dimethyl-4-((4-methylpiperazin-1-yl)carbonyl)-1H-pyrrol-2-yl)methylene)-N-methyl-2-oxo-2,3-dihydro-1H-indole-5-sulfonamide) | |
| Hydrochlorothiazide | |
| kutkin | |
| Alum Compounds | |
| diphenylarsinic acid | |
| glutamyl-(2-(((3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl)oxy)carbonyl)-3-((2-(1H-indol-3-yl)ethyl)amino)-3-oxopropyl)-cysteinyl-glycine sodium salt | |
| 9-(2-hydroxy-3-nonyl)adenine | |
| 4,4'-dihydroxystilbene | |
| 4-(1-adamantyl)phenol | |
| alpha-amino-3-hydroxy-5-tert-butyl-4-isoxazolepropionate | |
| Zinc | |
| EMD 527040 | |
| cyanobacterial toxin | |
| 3-(2-(N,N-diethyl-N-methylammonium)ethyl)-7-methoxy-4-methylcoumarin | |
| microcystin-LF | |
| MLN 8237 | |
| polaprezinc | |
| Alpha-Amanitin | A heterodetic cyclic peptide consisting of eight amino acid residues and containing a thioether bridge between a cysteine and a tryptophan residue. It is found in a number of poisonous mushrooms, including Amanita phalloides (the death cap), Galerina marginata, and and Conocybe filaris. |
| n-(n-nonyl)-deoxygalactonojirimycin | |
| tenofovir disoproxil | |
| chlorodibromomethane | An organochlorine compound that has formula CHBr2Cl. |
| Cefixime | |
| S-(1,2-dichlorovinyl)cysteine | |
| (glycyl-glycyl)GLP-2 | |
| methional | |
| 4'-methoxy licoflavanone | |
| adefovir | |
| 2,2',4,4',5,6'-hexabromodiphenyl ether | An organobromine compound that has formula C12H4Br6O. |
| 2-hydroxyamino-3-methylimidazolo(4,5-f)quinoline | |
| TAK 779 | |
| Goserelin | |
| erigeroflavanone | |
| 1-(4-(1-(2,6-difluorobenzyl)-5-((dimethylamino)methyl)-3-(6-methoxypyridazin-3-yl)-2,4-dioxo-1,2,3,4-tetrahydrothieno(2,3-d)pyrimidin-6-yl)phenyl)-3-methoxyurea | |
| 13-hydroperoxy-9,11-octadecadienoic acid | |
| 3,5,5-trimethylhexanoylferrocene | |
| Flavonols | Any hydroxyflavone in which is the ring hydrogen at position 3 of the heterocyclic ring is replaced by a hydroxy group. |
| Phenylacetates | |
| Nifedipine | A dihydropyridine that has formula C17H18N2O6. |
| Etilefrine | |
| cyclosporin G | |
| cyclosporin H | |
| Phenylmethylsulfonyl Fluoride | |
| ligustilide | |
| diethyl maleate | A maleate ester resulting from the formal condensation of both carboxy groups of maleic acid with ethanol. A colourless liquid at room temperature (m.p. -10degreeC) with boiling point 220degreeC at 1 atm., it is commonly used as a dienophile for Diels-Alder-type cycloaddition reactions in organic synthesis. |
| xanthohumol | A member of the class of chalcones that is trans-chalcone substituted by hydroxy groups at positions 4, 2' and 4', a methoxy group at position 6' and a prenyl group at position 3'. Isolated from Humulus lupulus, it induces apoptosis in human malignant glioblastoma cells. |
| 1-Methyl-3-isobutylxanthine | |
| Valerates | |
| fenamic acid | An aminobenzoic acid that is the N-phenyl derivative of anthranilic acid. It acts as a parent skeleton for the synthesis of several non-steroidal anti-inflammatory drugs. |
| Galactosamine | |
| 5-(N-methyl-N-isobutyl)amiloride | |
| Gangliosides | |
| trantinterol | |
| Uridine | |
| epolactaene | |
| 3-O-Methylglucose | |
| estradiol-17 beta-glucuronide | |
| methionylmethylsulfonium chloride | |
| Triazenes | A nitrogen molecular entity resulting from the formal substitution of one or more of the hydrogens of triazene. |
| dichlone | |
| hyperforin dicyclohexylammonium | |
| GSK 1363089 | |
| 9-anilinoacridine | |
| Palmitic Acid | A straight-chain, sixteen-carbon, saturated long-chain fatty acid. |
| trovafloxacin | |
| clopidogrel | A thienopyridine that has formula C16H16ClNO2S. |
| Antimycin A | A nine-membered bis-lactone having methyl substituents at the 2- and 6-positions, an n-hexyl substituent at the 8-position, an acyloxy substituent at the 7-position and an aroylamido substituent at the 3-position. It is produced by Streptomyces bacteria and has found commercial use as a fish poison. |
| aflatoxin B1-bovine serum albumin | |
| 3-hydroxy-17-(imidazol-1-yl)androsta-5,16-diene | |
| BQ 22-708 | |
| Magnetite Nanoparticles | |
| amthamine | |
| CGS 35601 | |
| Mitogens | A chemical substance that encourages a cell to commence cell division, triggering mitosis. |
| 6-(methylamino)pyrido(3,4-d)pyrimidine | |
| hard metal | |
| LLL12 compound | |
| leukotriene A methyl ester | |
| 16-(4-fluorophenoxy)lipoxin A4 | |
| 2-methylbenz(a)anthracene | |
| Xanthine | A purine nucleobase found in humans and other organisms. |
| Eudragit RSPO | |
| Desoxycorticosterone | |
| 2-phenylcyclopropanecarboxylic acid | |
| 6-formylindolo(3,2-b)carbazole | |
| Mineralocorticoid Receptor Antagonists | |
| 4-(4-(4-chloro-phenyl)thiazol-2-ylamino)phenol | |
| CR 3294 | |
| indoleacetic acid | |
| diosmetin | A monomethoxyflavone that is the 4'-methyl ether derivative of luteolin. |
| PENTA | |
| CTAP octapeptide | |
| Vinyl Compounds | |
| canagliflozin | A C-glycosyl compound that is used (in its hemihydrate form) for treatment of type II diabetes via inhibition of sodium-glucose transport protein subtype 2. |
| zopolrestat | |
| 1-(3-chlorophenyl)piperazine | A N-arylpiperazine that is piperazine carrying a 3-chlorophenyl substituent at position 1. It is a metabolite of the antidepressant drug trazodone. |
| 2,4-dihydroxybenzophenone | A benzophenone that has formula C13H10O3. |
| bicuculline methiodide | |
| triforine | A member of the class of N-alkylpiperazines in which the two amino groups of piperazine are replaced by 1-formamido-2,2,2-trichloroethyl groups. A fungicide active against a range of diseases including powdery mildew, scab and rust. |
| 4,4-dimethylcholesta-8,14,24-trienol | |
| glabridin | An isoflavonoid that has formula C20H20O4. |
| liquiritigenin | A dihydroxyflavanone compound having the two hydroxy substituents at the 4'- and 7-positions. Isolated from the root of Glycyrrhizae uralensis, it is a selective agonist for oestrogen receptor beta. |
| Nitrosamines | N-Nitroso amines, compounds of the structure R2NNO. Compounds RNHNO are not ordinarily isolable, but they, too, are nitrosamines. The name is a contraction of N-nitrosoamine and, as such, does not require the N locant. |
| idrapril | |
| Manganese | A manganese group element atom that has formula Mn. |
| carbinoxamine | An organochlorine compound that is 2-(4-chlorobenzyl)pyridine in which one of the benzylic hydrogens is substituted by 2-(dimethylamino)ethoxy group. It is an ethanolamine-type antihistamine, used as its maleate salt for treating hay fever, as well as mild cases of Parkinson's disease. |
| chromium protoporphyrin IX | |
| metolachlor | A racemate that consists of equimolar amounts of (R)- and (S)-metolachlor. |
| shogaol | |
| Catechols | Any compound containing an o-diphenol component. |
| donepezil | Donepezil is a centrally acting reversible acetyl cholinesterase inhibitor. Its main therapeutic use is in the treatment of Alzheimer's disease where it is used to increase cortical acetylcholine. |
| vitisin A | |
| GBR 12935 | |
| Valproic Acid | A branched-chain saturated fatty acid that comprises of a propyl substituent on a pentanoic acid stem. |
| deoxymiroestrol | An organooxygen compound that has formula C20H22O5. |
| formononetin | A member of the class of 7-hydroxyisoflavones that is 7-hydroxyisoflavone substituted by a methoxy group at position 4'. |
| Estramustine | |
| isopentyl alcohol | |
| 11,11'-dideoxyverticilin | |
| RTI 121 | |
| Trimipramine | A dibenzoazepine that is 10,11-dihydro-5H-dibenzo[b,f]azepine substituted by a 3-(dimethylamino)-2-methylpropyl group at the nitrogen atom. It is used as an antidepressant. |
| 2-amino-4-(4-methoxyphenyl)-7-(naphthalen-1-yl)-5-oxo-5,6,7,8-tetrahydro-4H-chromene-3-carbonitrile | |
| Grape Seed Proanthocyanidins | |
| 5-diisopropoxyphosphoryl-5-methyl-1-pyrroline-N-oxide | |
| 1-methyl-2-phenylindole | |
| lipopolysaccharide, E coli O55-B5 | |
| oxaprozin | |
| NCQ 344 | |
| 2-amino-6-methyldipyrido(1,2-a-3',2'-d)imidazole | |
| pimobendan | |
| pyrimidin-2-one beta-ribofuranoside | |
| eicosapentaenoic acid ethyl ester | |
| 1-methoxy-3-indolylmethylglucosinolate | |
| clobutinol | |
| aceclofenac | |
| N-methylprotoporphyrin IX | |
| Mirex | A chlorocarbon that has formula C10Cl12. |
| NF023 | |
| pararosaniline | An iminie that is 4-methylidenecyclohexa-2,5-dien-1-imine in which both the hydrogens of the methylidene group are replaced by 4-aminophenyl groups. |
| valrubicin | |
| Organothiophosphates | |
| JBP 485 | |
| phenolphthalein diphosphate | |
| anthrarobin | An anthracenetriol having the three hydroxy substituents at the 1-, 2- and 10-positions. |
| N-(6-(6-chloro-5-(4-fluorophenylsulfonamido)pyridin-3-yl)benzo(d)thiazol-2-yl)acetamide | |
| Glucosamine | |
| aluminum citrate | |
| N-nitrosopiperidine | A nitrosamine that is piperidine in which the hydrogen attached to the nitrogen is replaced by a nitroso group. One of the many carcinogens detected in cigarette smoke, it is found in meat, cheese and spices that have been treated with the preservative sodium nitrite. |
| dichloridobis(3-imino-2-ethoxyflavanone)ruthenium(II) | |
| 3',5'-dichloro-2-hydroxy-2-methylbut-3-enanilide | |
| 7,8-diacetoxy-4-methylcoumarin | |
| 1,6-Bis(4-(4-amino-3-hydroxyphenoxy)phenyl)diamantane | |
| pregnenolone sulfate | A steroid sulfate that has formula C21H32O5S. |
| octyl gallate | A gallate ester obtained by condensation of the carboxy group of gallic acid with the hydroxy group of octanol. |
| Amikacin | An amino cyclitol glycoside that is kanamycin A acylated at the N-1 position by a 4-amino-2-hydroxybutyryl group. |
| almotriptan | |
| arecaidine esters | |
| chlorophyllin | |
| Phenylhydrazines | Any member of the class of hydrazines carrying a phenyl substituent. |
| BM 910228 | |
| Hydroxytryptophol | |
| Ribavirin | A 1-ribosyltriazole that is the 1-ribofuranosyl derivative of 1,2,4-triazole-3-carboxamide. An inhibitor of HCV polymerase. |
| Phalloidine | |
| 1,7-phenanthroline | A phenanthroline that has formula C12H8N2. |
| 2,4-dichlorophenoxyacetyl-S-acyl-CoA thioester | |
| 3-Mercaptopropionic Acid | |
| Lipofundin | |
| imazapyr | An aromatic carboxylic acid that has formula C13H15N3O3. |
| iproplatin | |
| 2,2',4,6-tetrachlorobiphenyl | |
| 9,10-dimethoxy-3,3-dimethyl-7,7a,13,13atetrahydro-3H-chromeno(3,4-b)pyrano(2,3-h)chromen-7-ol | |
| trisialoganglioside GT1 | |
| calcium phosphate | |
| clobenpropit | An imidothiocarbamic ester that consists of isothiourea bearing S-3-(imidazol-4-yl)propyl and N-4-chlorobenzyl substituents. An extremely potent histamine H3 antagonist/inverse agonist (pA2 = 9.93). Also displays partial agonist activity at H4 receptors; induces eosinophil shape change with an EC50 of 3 nM. |
| 2-amino-(1,6-dimethylfuro(3,2-e)imidazo(4,5-b))pyridine | |
| N1-benzyl-4-methylbenzene-1,2-diamine | |
| 2,5-dihydroxybenzoic acid | A dihydroxybenzoic acid having the two hydroxy groups at the 2- and 5-positions. |
| CP 154526 | |
| oligomycin B | An oligomycin that has formula C45H72O12. |
| bis(3-hydroxyphenyl) diselenide | |
| 3-cresol | |
| Lactones | Any cyclic carboxylic ester containing a 1-oxacycloalkan-2-one structure, or an analogue having unsaturation or heteroatoms replacing one or more carbon atoms of the ring. |
| benthiocarb | |
| dihydrocytochalasin B | |
| mycophenolate mofetil | |
| AGN 190299 | |
| simendan | |
| cifenline | |
| Aluminum | |
| rhodocytin protein, Calloselasma rhodostoma | |
| Codeine | A morphinane alkaloid found in the opium poppy, Papaver somniferum var. album; has analgesic, anti-tussive and anti-diarrhoeal properties. |
| Vincristine | A vinca alkaloid that has formula C46H56N4O10. |
| nemadectin | |
| arvelexin | |
| pimecrolimus | |
| VIVIT peptide | |
| Plant Preparations | |
| 2,3,5-trichlorophenyl methyl sulfone | |
| oxfendazole | A member of the class of benzimidazoles that is fenbendazole in which the sulfur has been oxidised to the corresponding sulfoxide. |
| Quinidine | A cinchona alkaloid consisting of cinchonine with the hydrogen at the 6-position of the quinoline ring substituted by methoxy. |
| oxazepam glucuronide | |
| crizotinib | |
| Ethyl Biscoumacetate | |
| Magnesium Chloride | |
| hydroquinone | A benzenediol comprising benzene core carrying two hydroxy substituents para to each other. |
| ME 3277 | |
| ethafluralin | |
| Grape Seed Extract | |
| monoacetin | |
| desmethylazelastine | |
| GGTI 298 | |
| 1,1-dimethylbutyl-1-deoxy-Delta(9)-THC | |
| retinal dimer | |
| octocrylene | |
| Antipyrine | A member of the class of pyrazoles that is 1,2-dihydropyrazol-3-one substituted with methyl groups at C-1 and C-5 and with a phenyl group at N-2. |
| Lamivudine | |
| 17-hydroxyjolkinolide B | A diterpene lactone that has formula C20H26O5. |
| CAP18 lipopolysaccharide-binding protein | |
| BDMC-A | |
| ganoderiol F | |
| Nystatin | A polyene macrolide antibiotic; part of the nystatin complex produced by several Streptococcus species. The keto-form of nystatin A1. |
| methylethylnitrosamine | |
| 5(S),6(R)-7-trihydroxyheptanoic acid, methyl ester | |
| CGP 55845A | |
| N-bromotaurine | |
| Methoxyflurane | |
| Phosphatidylinositol Phosphates | Any member of the phosphoinositide family of compounds, of which seven occur naturally. |
| 4-methoxyestradiol | |
| 6-hydroxyflavone | A hydroxyflavonoid that has formula C15H10O3. |
| cyanazine | A chloro-1,3,5-triazine that is 2-chloro-1,3,5-triazine substituted by an ethyl amino and a (2-cyanopropan-2-yl)amino group at positions 6 and 4 respectively. |
| 2,2',3',4,4',5-hexachlorobiphenyl | |
| tris(4-chlorophenyl)methanol | |
| alsterpaullone | |
| hydratropic aldehyde | |
| N-(3-(aminosulfonyl)-4-chloro-2-hydroxyphenyl)-N'-(2,3-dichlorophenyl)urea | |
| 2-nitropropane | A C-nitro compound that has formula C3H7NO2. |
| cobalt sulfate | |
| Benzhydryl Compounds | |
| 4-toluidine | |
| vanadyl sulfate | |
| lilial | |
| thiaton | |
| decursin | A coumarin that has formula C19H20O5. |
| N-acetylleucyl-leucyl-methioninal | A peptide that has formula C19H35N3O4S. |
| 3,N-dimethyl-N-(1-methyl-3-(4-methylpiperidin-1-yl)propyl)benzenesulfonamide | |
| tertatolol | |
| ditekiren | |
| thiosalicylic acid | |
| stattic | |
| VX-745 | |
| Estrenes | |
| 4-hydroxyazobenzene | An azobenzene that has formula C12H10N2O. |
| Inositol | Any cyclohexane-1,2,3,4,5,6-hexol. |
| TS 108 | |
| prostaglandin B1 | A prostaglandins B that has formula C20H32O4. |
| allopregnan-20 alpha-ol-3-one | A corticosteroid hormone that has formula C21H34O2. |
| 1, 3-di-(N-carboxybenzoyl-leucyl-leucyl)amino acetone | |
| Diarylheptanoids | A family of plant metabolites with a common 1,7-diphenylheptane structural skeleton, carrying various substituents. They are mainly distributed in the roots, rhizomes and bark of Alpinia, Zingiber, Curcuma and Alnus species. |
| Dextran Sulfate | A polymer composed of repeating (1->6)-alpha-linked anhydroglucose sulfate units. |
| 2-heptanone | |
| Piperazines | |
| FPL 55712 | |
| allosamidin | A N-acyl-hexosamine that has formula C25H42N4O14. |
| 4-hydroxycyclophosphamide | A phosphorodiamide that consists of 2-amino-1,3,2-oxazaphosphinan-4-ol 2-oxide having two 2-chloroethyl groups attached to the exocyclic nitrogen. |
| 1'-hydroxysafrole | |
| O(6)-(4-bromothenyl)guanine | |
| N-(adamantan-1-yl)-8-methoxy-4-oxo-1-pentyl-1,4-dihydroquinoline-3-carboxamide | |
| 3-deazaadenosine | |
| Lipid Peroxides | |
| lysergol | An alkaloid of the ergoline family that occurs as a minor constituent in some species of fungi and in the morning glory family of plants. Its structure is that of ergoline with a methyl group at N-6 and a beta-hydroxymethyl substituent at C-8. |
| dibenzoanthracene-3,4-dihydrodiol | |
| bicuculline methobromide | |
| 4-hexyloxyaniline | |
| oblimersen | |
| 1-pentene-3-one | |
| 4-(2-phenyl-5,7-bis(trifluoromethyl)pyrazolo(1,5-a)pyrimidin-3-yl)phenol | |
| furtrethonium | |
| 1,3-dichloro-2-propanol | |
| PD 123319 | An imidazopyridine consisting of 4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine having 4-(dimethylamino)-3-methylbenzyl, diphenylacetyl and carboxy and groups at positions 1, 5 and 6 respectively |
| Apomorphine | |
| acetamide | A member of the acetamides that has formula C2H5NO. |
| Thiorphan | A N-acyl-amino acid that has formula C12H15NO3S. |
| Ro 16-9100 | |
| tris(2-ethylhexyl)phosphate | |
| TMC 120A | |
| Protein Kinase Inhibitors | An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| olmesartan | A biphenylyltetrazole that has formula C24H26N6O3. |
| 1H,1H,2H,2H-perfluorooctan-1-ol | |
| prasugrel | |
| S-nitrosopenicillamine | |
| aflatoxin B1-DNA adduct | |
| Diuron | A member of the class of ureas that is urea in which both of the hydrogens attached to one nitrogen are substituted by methyl groups, and one of the hydrogens attached to the other nitrogen is substituted by a 3,4-dichlorophenyl group. |
| LY 171883 | |
| Ipodate | |
| Neodymium | A lanthanoid atom that has formula Nd. |
| duloxetine | |
| endothelium-dependent hyperpolarization factor | |
| aclacinomycins | An anthracycline antibiotic that is produced by Streptomyces galilaeus and also exhibits antineoplastic activity. |
| 1-(1H-indol-3-yl)-3-(3H-indol-3-ylidene)propan-2-one | |
| quinoxyfen | A member of the class of quinolines carrying two chloro substituents at positions 5 and 7 together with a 4-fluorophenoxy substituent at position 4. A fungicide used mainly to control powdery mildew in cereals. |
| diallyl phthalate | |
| isopropyl 4-hydroxybenzoate | |
| formylmethionyl-leucyl-phenylalanine methyl ester | A peptide that has formula C22H33N3O5S. |
| Meprobamate | |
| Tocotrienols | |
| 4-benzoylbenzoic acid | |
| 6-O-palmitoylascorbic acid | |
| hwanggunchungyitang | |
| SK&F 83959 | |
| alanyl-tyrosyl-prolyl-glycyl-lysyl-phenylalanine | |
| 1-oleoyl-2-acetylglycerol | |
| 4,6-diamino-5-N-formamidopyrimidine | |
| lipopolysaccharide, Helicobacter pylori | |
| 3-Iodobenzylguanidine | |
| lupeol linoleate | |
| Butorphanol | Levorphanol in which a hydrogen at position 14 of the morphinan skeleton is substituted by hydroxy and one of the hydrogens of the N-methyl group is substituted by cyclopropyl. A semi-synthetic opioid agonist-antagonist analgesic, it is used as its (S,S)-tartaric acid salt for relief or moderate to severe pain. |
| Benzophenanthridines | |
| BL 11282 | |
| torbafylline | |
| Etanidazole | A monocarboxylic acid amide obtained by formal condensation of the carboxy group of (2-nitro-1H-imidazol-1-yl)acetic acid with the amino group of ethanolamine. Used as a radiosensitising agent for hypoxic tumour cells. |
| I-152 compound | |
| Prime and Bond NT | |
| Clozapine | A benzodiazepine that is 5H-dibenzo[b,e][1,4]diazepine substituted by a chloro group at position 8 and a 4-methylpiperazin-1-yl group at position 11. It is a second generation antipsychotic used in the treatment of psychiatric disorders like schizophrenia. |
| artemisin | A sesquiterpenoid that has formula C15H18O4. |
| peoniflorin | |
| Brefeldin A | A metabolite from Penicillium brefeldianum that exhibits a wide range of antibiotic activity. |
| erucin | |
| 2,4-dibromo-17-ethynyl(6,7)estradiol | |
| 4-nitrocatechol | A member of the class of catechols that is benzene-1,2-diol substituted by a nitro group at position 4.It is the by-product of the hydroxylation of p-nitrophenol. |
| HOE 33342 | |
| carboxycinnamic acid bishydroxamide | |
| gamma-glutamyl-glutathione | |
| 12-(3-adamantan-1-ylureido)dodecanoic acid | |
| Sodium Chloride, Dietary | |
| 2-amino-4-methylthio-3-butenoic acid | |
| cyclopentaphenanthrene | |
| parthenolide | |
| L-161982 | |
| Dimethylformamide | |
| Ketocholesterols | |
| 4-biphenylamine | |
| 4-hydroxy-2-octenal | |
| 4-nitrophenyl sulfate | |
| 1-(2-(3-(4-methoxyphenyl)propoxy)-4-methoxyphenylethyl)-1H-imidazole | |
| 15-Hydroxy-11 alpha,9 alpha-(epoxymethano)prosta-5,13-dienoic Acid | |
| 3,7-dihydroxyflavone | |
| lauryl gallate | |
| tadalafil | |
| eutigoside C | |
| seryl-arginyl-leucyl-leucyl-argininamide | |
| Aminosalicylic Acid | |
| 7-(deoxyadenosin-N(6)--yl)aristolactam II | |
| fipronil | A racemate comprising equimolar amounts of (R)- and (S)-fipronil. |
| 9-hydroxy-12-oxo-10(E)-dodecenoic acid | |
| nociceptin (1-13) amide | |
| ammonium perchlorate | |
| chlortoluron | A member of the class of ureas that is N-methyl urea substituted by a 3-chloro-4-methylphenyl group at position 3 and a methyl group at position 1. A herbicide that is non-toxic to honeybees but is moderately toxic to mammals, birds, earthworms and most aquatic organisms. |
| darbufelone | |
| 2-methoxyacetaldehyde | |
| homocysteine thiolactone | |
| Ethacrynic Acid | |
| T 0070907 | |
| 4-aminocrotonic acid | |
| BMS 310705 | |
| PI 620 | |
| 1-(4-(6-bromobenzo(1,3)dioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta(c)quinolin-8-yl)ethanone | |
| telcagepant | |
| lurasidone | |
| 1-pyrenebutanol | |
| pyrazolo(3,4-d)pyrimidine | |
| 3-methyl-1-phenyl-2-(phenylseleno)oct-2-en-1-one | |
| 4-phenylenediamine | |
| chlorphenesin carbamate | The carbamate ester of the primary hydroxy group of chlorphenesin. A centrally acting skeletal muscle relaxant, it is used in the symptomatic treatment of painful muscle spasm. |
| araldite | |
| 4-nitrophenyl butyrate | |
| mesoxalonitrile | |
| oxophenylarsine | An arsine oxide derived from phenylarsine. |
| cyclohexene oxide | |
| methyl caffeate | An ester formed by the formal condensation of caffeic acid with methyl alcohol. |
| dibutylnitrosamine | |
| 4-diphenylacetoxy-1,1-dimethylpiperidinium | |
| AP20187 | |
| Caffeine | A trimethylxanthine in which the three methyl groups are located at positions 1, 3, and 7. A purine alkaloid that occurs naturally in tea and coffee. |
| gossypetin | A hexahydroxyflavone having the hydroxy groups placed at the 3-, 3'-, 4'-, 5- 7- and 8-positions. |
| monorden | |
| Deoxycytidine | |
| astressin | A 30-membered homodetic cyclic peptide comprising the sequence D-Phe-His-Leu-Leu-Arg-Glu-Val-Leu-Glu-Nle-Ala-Arg-Ala-Glu-Gln-Leu-Ala-Gln-Glu-Ala-His-Lys-Asn-Arg-Lys-Leu-Nle-Glu-Ile-Ile-NH2 cyclised by an amide bridge, formed by condensation of the side-chain carboxy group of the Glu residue at position 19 and the side-chain amino group of the Lys residue at posoition 22. |
| Boc-D-FMK | |
| Meclofenoxate | |
| N-3-benzylnirvanol | |
| SK&F 104856 | |
| N-hydroxy-2-aminofluorene | |
| alpha-conotoxin MII | |
| Thallium | A metallic element first identified and named from the brilliant green line in its flame spectrum (from Greek thetaalphalambdalambdaomicronsigma, a green shoot). |
| 4-((4-(4-ethylphenyl)-2,2-dimethyl-(2H)-thiochromen-6-yl)ethynyl)benzoic acid | |
| Methazolamide | |
| glucan phosphate | |
| Oxymetholone | |
| stannous mesoporphyrin | |
| CD 437 | |
| Methylene Chloride | |
| Carbofuran | A 1-benzofuran that has formula C12H15NO3. |
| 5-hydroxyvalproate | |
| 2'-deoxycytidine 5'-triphosphate | |
| nitroxyl | Look at wikipedia page http://en.wikipedia.org/wiki/Nitroxyl |
| nivalenol | A trichothecene that has formula C15H20O7. |
| baicalin | The glycosyloxyflavone which is the 7-O-glucuronide of baicalein. |
| chloramine | A halide that has formula ClH2N. |
| NCGC 00229600 | |
| Sulindac | A monocarboxylic acid that is 1-benzylidene-1H-indene which is substituted at positions 2, 3, and 5 by methyl, carboxymethyl, and fluorine respectively, and in which the phenyl group of the benzylidene moiety is substituted at the para position by a methylsulfinyl group. It is a prodrug for the corresponding sulfide, a non-steroidal anti-inflammatory drug, used particularly in the treatment of acute and chronic inflammatory conditions. |
| linoleic acid hydroperoxide | A HPODE that is a mono-hydroperoxy derivative of linoleic acid |
| 1,9-dideoxyforskolin | A labdane diterpenoid that is the 1,9-dideoxy derivative of forskolin. |
| lipoteichoic acid | A teichoic acid which is covalently bound to a lipid. |
| ispronicline | |
| tribulin | |
| 1'-hydroxyestragole | |
| rubratoxins | |
| chlorin e6 | |
| shexiang baoxin | |
| Glucuronic Acid | |
| cyclazosin | A monocarboxylic acid amide obtained by formal condensation of the carboxy group of furoic acid with the secondary amino group of 6,7-dimethoxy-2-[(4aR,8aS)-octahydroquinoxalin-1-yl]quinazolin-4-amine. |
| Lisinopril | A dipeptide that has formula C21H31N3O5. |
| Sterols | A 3-hydroxy steroid closely related to cholestan-3-ol. |
| perilla seed oil | |
| Huang Qi | |
| Mimosine | |
| 1,6-dichlorosucrose | |
| Lipids | 'Lipids' is a loosely defined term for substances of biological origin that are soluble in nonpolar solvents. They consist of saponifiable lipids, such as glycerides (fats and oils) and phospholipids, as well as nonsaponifiable lipids, principally steroids. |
| 9-(tetrahydro-2-furyl)-adenine | |
| mecarbam | An organic thiophosphate that is O,O-diethyl hydrogen phosphorodithioate in which the hydrogen attached to a sulfur is replaced by a 2-[(ethoxycarbonyl)(methyl)amino]-2-oxoethyl group. |
| MK-0524 | |
| 1,2,3,4,7,8-hexachlorodibenzodioxin | A dibenzodioxine that has formula C12H2Cl6O2. |
| Aldosterone | A pregnane-based steroidal hormone produced by the outer-section (zona glomerulosa) of the adrenal cortex in the adrenal gland, and acts on the distal tubules and collecting ducts of the kidney to cause the conservation of sodium, secretion of potassium, increased water retention, and increased blood pressure. The overall effect of aldosterone is to increase reabsorption of ions and water in the kidney. |
| desethylchloroquine | |
| fumonisin B1 | A diester that results from the condensation of the 1-carboxy groups of two molecules of propane-1,2,3-tricarboxylic acid with hydroxy groups at positions 14 and 15 of (2S,3S,5R,10R,12S,14S,15R,16R)-2-amino-12,16-dimethylicosane-3,5,10,14,15-pentol. |
| trestolone | |
| ponasterone A | A 2beta-hydroxy steroid that has formula C27H44O6. |
| D-65476 | |
| halofuginone | |
| Wen-pi-tang-Hab-Wu-ling-san | |
| N-(2-(4-(2-methoxyphenyl)-1-piperazinyl)ethyl)-N-(2-pyridinyl)cyclohexanecarboxamide | |
| Strophanthins | |
| carvacryl acetate | |
| ciprofibrate-coenzyme A | |
| Cyclosporine | |
| epoxy resin AH-26 | |
| S-methylthiocitrulline | |
| 4-ethynylpyrene | |
| benzo(b)fluoranthene | An ortho- and peri-fused polycyclic arene that consists of a benzene ring fused with a acephenanthrylene ring. |
| amperozide | |
| 3-O-caffeoyl-1-methylquinic acid | |
| deethylatrazine | A chloro-1,3,5-triazine that is 6-chloro-1,3,5-triazine-2,4-diamine in which one of the hydrogens of the amino group is replaced by a propan-2-yl group. |
| Potassium Iodide | A metal iodide salt with a K(+) counterion. It is a scavenger of hydroxyl radicals. |
| ochratoxin A | A phenylalanine derivative resulting from the formal condensation of the amino group of L-phenylalanine with the carboxy group of (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. It is among the most widely occurring food-contaminating mycotoxins, produced by Aspergillus ochraceus, Aspergillus carbonarius and Penicillium verrucosum. |
| PD 156252 | |
| Diazepam | A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a methyl group at position 1 and a phenyl group at position 5. |
| vestipitant | |
| 1-(3-(2-(1-benzothiophen-5-yl) ethoxy) propyl)-3-azetidinol maleate | |
| ZSTK474 | |
| 2,2',4,5'-tetrachlorobiphenyl | A tetrachlorobiphenyl that is biphenyl in which the hydrogens at positions 2, 4, 5, and 2' are replaced by chlorines. |
| Methanol | |
| MCI 826 | |
| diisodecyl phthalate | A 2-hydroxyisophthalic acid that has formula C28H46O4. |
| Foropafant | |
| nitrocatechol | |
| Potassium | An alkali metal atom that has formula K. |
| YM 529 | |
| bis(2-hydroxy-2-ethylbutanoato)oxochromate(V) | |
| CJX1, amlodipine derivative | |
| Oxymorphone | |
| desglucoanagalloside B | |
| HDL cholesteryl ester | |
| Carbon | |
| triethyl-(beta-4-stilbenoxyethyl)ammonium | |
| 4,4'-bisphenol F | |
| neuropeptide Y, Leu(31)-Pro(34)- | |
| Foscarnet | |
| polyhexamethyleneguanidine | |
| ciprofibrate | |
| taraxerone | A scalarane sesterterpenoid that has formula C30H48O. |
| N-(2-(1-azabicyclo(3.3.0)octan-5-yl)ethyl)-2-nitroaniline | |
| Phenelzine | |
| Indican | An exopolysaccharide that has formula C14H17NO6. |
| L 742694 | |
| Maneb | A polymeric complex of manganese with the ethylene bis(dithiocarbamate) anionic ligand. |
| Moclobemide | |
| Monoglycerides | |
| 6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide | |
| ethylene bromohydrin | |
| adenosine 5'-pentaphosphate | An organophosphate oxoanion resulting from the removal of all six protons from the phosphate groups of adenosine 5'-pentaphosphate; the major species at pH 7.3. |
| 3,4,4a,10b-tetrahydro-4-propyl-2H,5H-(1)benzopyrano(4,3-b)-1,4-oxazin-9-ol | |
| Alamethicin | |
| Methoxamine | |
| R 115866 | |
| pyrazinoic acid | |
| (+)-JQ1 compound | |
| 3-pentadecylphenol | |
| wedelolactone | A member of the class of coumestans that is coumestan with hydroxy substituents as positions 1, 8 and 9 and a methoxy substituent at position 3. |
| diallyl tetrasulfide | |
| 4-chlorobenzo(f)isoquinoline | |
| quetiapine | A dibenzothiazepine that has formula C21H25N3O2S. |
| Uranyl Nitrate | |
| cholan-2,3,24-tryl-2,3,24-trisulfate | |
| CEF regimen | |
| clebopride | |
| Tubocurarine | |
| codonoposide | |
| Proscillaridin | |
| naphtho(1,2-b)furan-4,5-dione | |
| tellimagrandin I | A tannin that has formula C34H26O22. |
| carbamazepine epoxide | |
| benzofuran | |
| 2,4,5-Trichlorophenoxyacetic Acid | A chlorophenoxyacetic acid that is phenoxyacetic acid in which the ring hydrogens at postions 2, 4 and 5 are substituted by chlorines. |
| pyridine-4-aldoxime | |
| diindolylmethane | |
| lipopolysaccharide A | |
| Pargyline | |
| nitrobenzene | A nitroarene consisting of benzene carrying a single nitro substituent. An industrial chemical used widely in the production of aniline. |
| diphenylmethyl selenocyanate | |
| SR 90107A-ORG 31540 | |
| Tiapamil Hydrochloride | |
| Catecholamines | 4-(2-Aminoethyl)pyrocatechol [4-(2-aminoethyl)benzene-1,2-diol] and derivatives formed by substitution. |
| Xylazine | |
| RD162 compound | |
| Scorpion Venoms | |
| dibenzo(1,4)dioxin | |
| camostat | |
| eurycomanone | A quassinoid isolated from Eurycoma longifolia and has been shown to exhibit antineoplastic and antimalarial activties. |
| HT-2 toxin | |
| Hydroxylamine | The simplest hydroxylamine, consisting of ammonia bearing a hydroxy substituent. It is an intermediate in the biological nitrification by microbes like bacteria. |
| hippuryl-histidyl-leucine | |
| metsulfuron methyl | A N-sulfonylurea in which the sulfonyl group is attached to a 2-(methoxycarbonyl)phenyl group while a (4-methoxy-6-methyl-1,3,5-triazin-2-yl group replaces one of the amino hydrogens of the remaining urea group. |
| Phosphatidylserines | |
| 2',7'-bis-(carboxypropyl)-5(6)-carboxyfluorescein | |
| Chlorates | Any salt that has chlorate, [ClO3](-), as the anionic component. |
| 4(2'-aminoethyl)amino-1,8-dimethylimidazo(1,2-a)quinoxaline | |
| 18alpha-glycyrrhetinic acid | |
| 2,5-dichlorobiphenyl | A dichlorobiphenyl that is p-dichlorobenzene in which one of the hydrogens has been replaced by a phenyl group. |
| AG-879 | |
| Genistein | 7-Hydroxyisoflavone with additional hydroxy groups at positions 5 and 4'. It is a phytoestrogenic isoflavone with antioxidant properties. |
| 2,3-dichlorodibenzo-4-dioxin | |
| dimethylarsinous acid | A methylarsinous acid that has formula C2H7AsO. |
| sibutramine | |
| gamisopoonghwanghyul-tang | |
| Phortress | |
| tridiphane | A dichlorobenzene that has formula C10H7Cl5O. |
| Organoselenium Compounds | |
| antimony trioxide | |
| bisindolylmaleimide IX | |
| N-(3-((2-hydroxynaphthalen-1-ylmethylene)amino)phenyl)-2-phenylpropionamide | |
| Rose Bengal | |
| monodansylcadaverine | An aminonaphthalene that has formula C17H25N3O2S. |
| bisindolylmaleimide II | |
| Tegafur | |
| beta-1,3-glucan | |
| Podophyllotoxin | An organic heterotetracyclic compound that has a furonaphthodioxole skeleton bearing a 3,4,5-trimethoxyphenyl substituent. It is found in the roots and rhizomes of Podophyllum species and is used for the topical treatment of genital warts. |
| galactose-1-phosphate | |
| celecoxib | |
| 3',4'-dihydroxyflavone | |
| Trimetrexate | |
| 3-methylcatechol | A methylcatechol carrying a methyl substituent at position 3. It is a xenobiotic metabolite produced by some bacteria capable of degrading nitroaromatic compounds present in pesticide-contaminated soil samples. |
| N-chlorophenylalanine | |
| lanthanum chloride | |
| Mn(III) meso-tetrakis(N-n-butoxyethylpyridinium-2-yl)porphyrin | |
| Masoprocol | |
| 2,5-diaziridinyl-3-(hydroxymethyl)-6-methyl-1,4-benzoquinone | |
| TDP 521252 | |
| Berberine | |
| Zalcitabine | |
| pycnidione | |
| 2-deoxyribose 1-phosphate | |
| Diethyl Pyrocarbonate | The diethyl ester of dicarbonic acid. |
| 12-Hydroxy-5,8,10,14-eicosatetraenoic Acid | A HETE that is icosa-5,8,10,14-tetraenoic acid substituted by a hydroxy group at position 12. It is a metabolite of arachidonic acid. |
| ethyl 1-benzyl-3-hydroxy-2(5H)-oxopyrrole-4-carboxylate | |
| allyl isothiocyanate | An isothiocyanate with the formula CH2=CHCH2N=C=S. A colorless oil with boiling point 152degreeC, it is responsible for the pungent taste of mustard, horseradish, and wasabi. |
| cloxazolam | |
| (1,2-bis(1,2-benzisoselenazolone-3(2H)-ketone))ethane | |
| 6-hydroxychlorzoxazone | |
| 6-deisopropylatrazine | |
| 2-(2-amino-3-methoxyphenyl)-4H-1-benzopyran-4-one | |
| acenaphthene | A polycyclic aromatic hydrocarbon derived from naphthalene by the addition of an ethylene bridge connecting C-1 and C-8. |
| cyclopamine | A piperidine that has formula C27H41NO2. |
| 4-amino-1-(6-chloro-2-pyridyl)piperidine hydrochloride | |
| Sphingomyelins | |
| thallium(III) hydroxide | |
| 2,4-thiazolidinedione | |
| 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(6-(4-(4-ethylpiperazin-1-yl)-phenylamino)pyrimidin-4-yl)-1-methylurea | A member of the class of ureas that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 2,6-dichloro-3,5-dimethoxyphenyl group, while the hydrogens attached to the other nitrogen are replaced by a methyl group and a 6-{[4-(4-ethylpiperazin-1-yl)phenyl]amino}pyrimidin-4-yl group. It is a potent and selective fibroblast growth factor receptor inhibitor. |
| sanguinarine | A benzophenanthridine alkaloid that has formula C20H14NO4. |
| 7,3'-dihydroxy-4'-methoxyisoflavone | |
| walrycin A | |
| 3,4,3',4'-tetrachlorobiphenyl | |
| endotoxin, Escherichia coli | |
| sho-saiko-to-kyo-shokyo-ka-oren-bukuryo | |
| alpha-Linolenic Acid | A linolenic acid with cis-double bonds at positions 9, 12 and 15. Shown to have an antithrombotic effect. |
| MOPP protocol | |
| etiron | |
| (4,4-dimethyl-2,2-bipyridine)(acetylacetonate)copper(II) | |
| Cyclohexanols | An alcohol in which one or more hydroxy groups are attached to a cyclohexane skeleton. |
| Ribitol | |
| robinetin | A flavone that has formula C15H10O7. |
| Trichloroepoxypropane | |
| alpha-carotene | A cyclic carotene with a beta- and an epsilon-ring at opposite ends respectively. |
| Piracetam | |
| WIN 62577 | |
| Fluorescein | |
| CHF 4056 | |
| Amrinone | |
| 2-(1-(3-dimethylaminopropyl)-5-methoxyindol-3-yl)-3-(1H-indol-3-yl)maleimide | |
| substance P (6-11), Tyr(6)-D-Phe(7)-D-His(9)- | |
| eliprodil | |
| 5-octylphenol | |
| octanedioic acid (1-(3-azido-5-azidomethylbenzyl)-1H-pyrazol-4-yl)amide hydroxyamide | |
| 3-amino-1,4-dimethyl-5H-pyrido(4,3-b)indole | A pyridoindole that has formula C13H13N3. |
| triethylene glycol dimethacrylate | |
| 3-methyladenine | A methyladenine that is adenine substituted with a methyl group at position N-3. |
| emodin-6-O-glucoside | |
| 2-piperidone | |
| brassinolide | A 2alpha-hydroxy steroid that has formula C28H48O6. |
| SR 48968 | |
| methylformamide | |
| Benzodiazepines | A group of two-ring heterocyclic compounds consisting of a benzene ring fused to a diazepine ring. |
| vinorelbine | A vinca alkaloid with a norvinblastine skeleton. |
| 2-methyl-4-(N-propyl-N-cycloproanemethylamino)-5-chloro-6-(2,4,6-trichloranilino)pyrimidine | |
| Aniline Compounds | |
| glutathione sulfinamide | |
| cumene hydroperoxide | A peroxol that is cumene in which the alpha-hydrogen is replaced by a hydroperoxy group. |
| 8-oxo-7,8-dihydrodeoxyguanine | |
| isolevin | |
| pozanicline | |
| alpha,alpha-dimethoxytoluene | |
| HR 325 | |
| Quercetin | A pentahydroxyflavone having the five hydroxy groups placed at the 3-, 3'-, 4'-, 5- and 7-positions. |
| Sodium Bicarbonate | |
| 2-cyclohexylselenazolidine-4-carboxylic acid | |
| potassium perchlorate | |
| 8-bromo-7-methoxychrysin | |
| cinnamic acid | A monocarboxylic acid that consists of acrylic acid bearing a phenyl substituent at the 3-position. It is found in Cinnamomum cassia. |
| dihydrolipoic acid | A thio-fatty acid that is reduced form of lipoic acid. A potent antioxidant shown to directly destroy superoxide, hydroperoxy and hydroxyl radicals; also has neuroprotective and anti-tumour effects. |
| mercury nitrate | |
| CPS 11 | |
| Ovalbumin | |
| tryptoquivaline | |
| Amoxapine | A dibenzooxazepine compound having a chloro substituent at the 2-position and a piperazin-1-yl group at the 11-position. |
| 7,7'-dimethoxy-(4,4'-bi-1,3-benzodioxole)-5,5'-dicarboxylic acid dimethyl ester | |
| arachidonyl-coenzyme A | |
| 4'-demethyldesoxypodophyllotoxin | |
| N-methylaminoethanol | |
| thymol blue | |
| 1,4-dimethylnaphthalene | A dimethylnaphthalene carrying methyl groups at positions 1 and 4. |
| GW 1929 | A benzophenone that has formula C30H29N3O4. |
| androstane-3,17-diol glucuronide | |
| 1-chloro-2,4-dinitrobenzene-glutathione conjugate | |
| menthone | |
| perfluoro-n-nonanoic acid | |
| Manure | |
| 4-bromophenacyl bromide | |
| norgestimate | |
| Nafronyl | |
| oxiconazole | |
| systhane | |
| 4-vinyl-1-cyclohexene dioxide | |
| carbidopa, levodopa drug combination | |
| 2,3,6,2',3',6'-hexachlorobiphenyl | |
| Biguanides | A class of oral hypoglycemic drugs used for diabetes mellitus or prediabetes treatment. They have a structure based on the 2-carbamimidoylguanidine skeleton. |
| polymarcine | |
| ginkgolide C | A diterpene lactone that has formula C20H24O11. |
| ginkgolide B | A diterpene lactone that has formula C20H24O10. |
| ginkgolide A | A diterpene lactone that has formula C20H24O9. |
| 16,16-Dimethylprostaglandin E2 | |
| ginkgolide K | |
| ginkgolide J | A diterpene lactone that has formula C20H24O10. |
| crocin | |
| cyprodime | |
| digalloylresveratrol | |
| RMI 12330A | |
| furan | A monocyclic heteroarene with a structure consisting of a 5-membered ring containing four carbons and one oxygen, with formula C4H4O. It is a toxic, flammable, low-boiling (31degreeC) colourless liquid. |
| Azithromycin | A macrolide antibiotic useful for the treatment of bacterial infections. |
| di-tert-butyl peroxide | |
| 1-phenyl-2-hexadecanoylamino-3-pyrrolidino-1-propanol | |
| glutathionyl 4-hydroxy-2-nonenal conjugate | |
| mithramycin A | |
| Sodium Salicylate | An organic molecular entity that has formula C7H5O3.Na. |
| CpG ODN 1826 | |
| perphenazine GABA ester | |
| 5-nitroindazole | |
| testosterone enanthate | An enanthate ester that has formula C26H40O3. |
| Propranolol | A propanolamine that is propan-2-ol substituted by a propan-2-ylamino group at position 1 and a naphthalen-1-yloxy group at position 3. |
| usnic acid | |
| crotoxyphos | A carboxylic ester that has formula C14H19O6P. |
| Fluorides | |
| 8-((4-chlorophenyl)thio)cyclic-3',5'-GMP | |
| dihydroxyethyldithiocarbamate | |
| butamben | |
| Botulinum Toxins | |
| relcovaptan | |
| cicloprolol | |
| Triolein | A triglyceride formed by esterification of the three hydroxy groups of glycerol with oleic acid. Triolein is one of the two components of Lorenzo's oil. |
| Benzyl Alcohol | An aromatic alcohol that consists of benzene bearing a single hydroxymethyl substituent. |
| 6-prenylchrysin | |
| 2-(4-amylcinnamoyl)amino-4-chlorobenzoic acid | |
| Fibrinolytic Agents | |
| RU24858 | |
| diarctigenin | |
| fotemustine | |
| 4-cyano-4-(2,3-dihydro-8-methoxy-1,4-benzodioxin-5-yl)cyclohexanecarboxylic acid | |
| triazophos | An organothiophosphate insecticide that has formula C12H16N3O3PS. |
| alpha-ketoglutaric acid | |
| tipranavir | A pyridine-2-sulfonamide substituted at C-5 by a trifluoromethyl group and at the sulfonamide nitrogen by a dihydropyrone-containing m-tolyl substituent. It is an HIV-1 protease inhibitor. |
| sepiapterin | A pterin that has formula C9H11N5O3. |
| imidazolium-bis(imidazole)dimethylsulfoxideimidazotetrachlororuthenate(III) | |
| Chlorhexidine | A bisbiguanide compound with a structure consisting of two (p-chlorophenyl)guanide units linked by a hexamethylene bridge. |
| Nitrites | |
| 5-chloro-6-(1-(2-iminopyrrolidinyl) methyl)uracil hydrochloride | |
| (1,2,5,6-tetrahydropyridin-4-yl)methylphosphinic acid | |
| N,N-dimethylphytosphingosine | |
| Amifostine | An organic thiophosphate that is the S-phospho derivative of 2-[(3-aminopropyl)amino]ethanethiol. A prodrug for the free thiol, WR-1065, which is used as a cytoprotectant in cancer chemotherapy and radiotherapy. |
| 4,4'-hexafluorisopropylidene diphenol | |
| amurensin G | |
| levodopa methyl ester | |
| avasimibe | |
| 3-(2,2,2-trimethylhydrazine)propionate | |
| bisdequalinium | |
| Benzocaine | A benzoate ester having 4-aminobenzoic acid as the acid component and ethanol as the alcohol component. A surface anaesthetic, it is used to suppress the gag reflex, and as a lubricant and topical anaesthetic on the larynx, mouth, nasal cavity, respiratory tract, oesophagus, rectum, urinary tract, and vagina. |
| Arachidonic Acid | A long-chain fatty acid that is a C20, polyunsaturated fatty acid having four (Z)-double bonds at positions 5, 8, 11 and 14. |
| resveratrol | |
| OR 1958 | |
| 4-(1H-imidazol-4-ylmethyl)piperidine | |
| 1-hydroxy-2-oxo-3-(3-aminopropyl)-3-isopropyl-1-triazene | |
| 8-hydroxyeicosatetraenoic acid | |
| 1-hydroxypyrene | A pyrene that has formula C16H10O. |
| Estradiol | A 3-hydroxy steroid that is estra-1,3,5(10)-triene substituted by hydroxy groups at positions 3 and 17. |
| ergosine | An ergot alkaloid isolated from the fungus Epichloe typhina. |
| SRT2183 | |
| naringin | |
| DNA-(2-amino-3-methylimidazo(4,5-f)quinoline) adduct | |
| Arachidonic Acids | |
| Piperoxan | |
| 1-(4-chlorophenyl)-3-(3-(4-chlorophenyl)-5,5-dimethyl-1-(3-(5-nitrofuran-2-yl)allyldienehydrazinocarbonylmethyl)-2-oxoimidazolidin-4-yl)-1-hydroxyurea | |
| N-(3-oxo-3-(4-(pyridin-4-yl)piperazin-1-yl)propyl)benzo(c)(1,2,5)thiadiazole-4-sulfonamide | |
| Fatty Acids, Monounsaturated | |
| pycnogenols | |
| N,N'-dicyclopentyl-2-methylsulfanyl-5-nitro-pyrimidine-4,6-diamine | |
| deferiprone | |
| 6-hydroxy-10-chlorobenzo(c)quinolizinium | |
| squamosamide | |
| dihydrocapsaicin | A capsaicinoid that has formula C18H29NO3. |
| Interferons | |
| Cholestanol | |
| OR486 | |
| dalcetrapib | |
| 5-amino-2,4-dihydroxy-alpha-methylphenylethylamine | |
| Bicarbonates | |
| dinophysistoxin 2 | |
| terbutryne | |
| Flumazenil | A 1,4-benzodiazepine that has formula C15H14FN3O3. |
| arotinolol | |
| aleppo tannin | |
| 3-bromopropylamine | |
| methylamine | The simplest of the methylamines, consisting of ammonia bearing a single methyl substituent. |
| benzcoprine | |
| Benzofurans | |
| 1',2'-dihydrorotenone | |
| OMDM-2 cpd | |
| 2,3-dioxo-6-nitro-7-sulfamoylbenzo(f)quinoxaline | A sulfonic acid derivative that has formula C12H8N4O6S. |
| Cardiotoxins | |
| ebastine | |
| maraviroc | |
| lopinavir-ritonavir drug combination | |
| 5-(4-(3-(4-cyclohexyl-2-propylphenoxy)propoxy)phenyl)-1,3-oxazolidine-2,4-dione | |
| GR 127935 | A member of the class of benzamides obtained by formal condensation of the carboxy group of 2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-carboxylic acid and the anilino group of 4-methoxy-3-(4-methylpiperazin-1-yl)aniline. Potent and selective 5-HT1B/1D receptor antagonist (pKi values are 8.5 for both guinea pig 5-HT1D and rat 5-HT1B receptors). Displays > 100-fold selectivity over 5HT1A, 5-HT2A, 5-HT2C receptors and other receptor types. Centrally active following oral administration. |
| nervonic acid | A tetracosenoic acid having a cis-double bond at position 15. |
| mesoporphyrin IX | |
| Chlormethiazole | |
| UCF 101 | |
| acetyl-aspartyl-glutamyl-valyl-aspartal | |
| bis(4-hydroxycinnamoyl)methane | |
| Carbazoles | |
| Adrenal Cortex Hormones | Any of a class of steroid hormones that are produced in the adrenal cortex. |
| 4'-iodoflavone | |
| BRL 37344 | |
| 5-methoxy 3-(1,2,3,6-tetrahydro-4-pyridinyl)1H indole | |
| brevianamide A | |
| neem oil | |
| Indomethacin | |
| tropisetron | |
| 1-methylphenanthrene | A member of the class of phenanthrenes that is phenanthrene substituted by a methyl group at position 1. |
| 2,4,6-triiodophenol | |
| Antibiotics, Antineoplastic | |
| 3,4,3',4'-tetrachloroazoxybenzene | |
| Phenanthrolines | |
| desloratadine | Loratadine in which the ethoxycarbonyl group attached to the piperidine ring is replaced by hydrogen. The major metabolite of loratidine, desloratadine is an antihistamine which is used for the symptomatic relief of allergic conditions including rhinitis and chronic urticaria. It does not readily enter the central nervous system, so does not cause drowsiness. |
| 5'-amino-5'-deoxyadenosine | |
| 3-hexen-1-ol | |
| 1-(3-chlorophenyl)biguanide | |
| 3-methylquinoline | A methylquinoline that has formula C10H9N. |
| Epinephrine | |
| tert-butylphenyl diphenyl phosphate | |
| 4-methoxy-2-naphthylamine | |
| lac dye | |
| 3,8-dihydroxy-6H-dibenzo(b,d)pyran-6-one | |
| benzoperylene | |
| geranylgeraniol | A diterpenoid that is hexadeca-2,6,10,14-tetraene substituted by methyl groups at positions 3, 7, 11 and 15 and a hydroxy group at position 1. |
| Dichlorodiphenyl Dichloroethylene | |
| 7-chloro-3-(1-hydroxy-2-propyl)amino-4H-1,2,4-benzothiadiazine 1,1-dioxide | |
| Tetraethylammonium | A quaternary ammonium ion that has formula C8H20N. |
| Ro 15-4513 | |
| Leukotriene D4 | A leukotriene that is (7E,9E,11Z,14Z)-icosa-7,9,11,14-tetraenoic acid substituted by a hydroxy group at position 5 (5S) and a L-cysteinylglycinyl group at position 6 (6R). |
| ginsenoside F2 | A ginsenoside found in Panax species that is dammarane which is substituted by hydroxy groups at the 3beta, 12beta and 20 pro-S positions, in which the hydroxy groups at positions 3 and 20 have been converted to the corresponding beta-D-glucopyranosides, and in which a double bond has been introduced at the 24-25 position. |
| Ubiquinone | |
| acetaminophen glucuronide | |
| di-n-butyl-2,2-dichlorovinyl phosphate | |
| beryllium fluoride | |
| diphenylpyraline | |
| hydroxyfasudil | |
| palmitoleic acid | A hexadecenoic acid with a cis-double bond at position C-9. |
| VX | |
| 5-(4-benzyloxyphenyl)-4S-(7-phenylheptanoylamino)pentanoic acid | |
| Diphosphates | |
| 26-aminocholesterol | |
| Polymethyl Methacrylate | An acrylic polymer, composed of poly(methyl methacrylate) macromolecules. |
| adrenocorticotropin zinc | |
| 2,4-dinitrobenzene | |
| xylosides | |
| Pyridoxamine | A monohydroxypyridine that is pyridine substituted by a hydroxy group at position 3, an aminomethyl group at position 4, a hydroxymethyl group at position 5 and a methyl group at position 2. |
| 1-bromopropane | A bromoalkane that is propane carrying a bromo substituent at position 1. |
| Tetranitromethane | An organonitrogen compound that has formula CN4O8. |
| Re 80 | |
| 3-bromo-7-nitroindazole | |
| rimexolone | |
| Ro 363 | |
| Taurodeoxycholic Acid | A bile acid taurine conjugate of deoxycholic acid. |
| methoctramine | A tetramine that is N,N'-bis(6-aminohexyl)octane-1,8-diamine where the primary amino groups both carry 2-methoxybenzyl substituents. |
| Arsenates | |
| pilsicainide | |
| falcarinol | A long-chain fatty alcohol that has formula C17H24O. |
| 6-codeinone | |
| grifolin | |
| 2-tert-butyl-4-quinone | |
| gold chloride | |
| Fadrozole | |
| N-(2-methyl-4,5-bis(methylsulfonyl)benzoyl)guanidine | |
| 1-(1-dimethylaminomethyl-5-methoxybenzocyclobutan-1-yl)cyclohexanol | |
| Ticrynafen | |
| Thiouracil | A nucleobase analogue that is uracil in which the oxo group at C-2 is replaced by a thioxo group. |
| F 12509A | |
| LF 16-0687 | |
| Aminopropionitrile | |
| Adenosine | A ribonucleoside composed of a molecule of adenine attached to a ribofuranose moiety via a beta-N(9)-glycosidic bond. |
| dorzolamide | 5,6-Dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide in which hydrogens at the 4 and 6 positions are substituted by ethylamino and methyl groups, respectively (4S, trans-configuration). A carbonic anhydrase inhibitor, it is used as the hydrochloride in ophthalmic solutions to lower increased intraocular pressure in the treatment of open-angle glaucoma and ocular hypertension. |
| sarafotoxins s6 | |
| carbobenzoxy-leucyl-leucyl-norvalinal | |
| S-decylglutathione | |
| 3,7,11,15-tetramethyl-2,4,6,10,14-hexadecapentaenoic acid | |
| 2-methoxyestradiol-3,17-bis-O,O-sulfamate | |
| 1,N(6)-ethenoadenine | |
| bosentan | |
| ((1S)-1-((((1S)-1-benzyl-3-cyclopropylamino-2,3-di-oxopropyl)amino)carbonyl)-3-methylbutyl)carbamic acid 5-methoxy-3-oxapentyl ester | |
| 2-nonenal | |
| 9,10-dihydro-9,10-dihydroxybenzo(a)pyrene | |
| PD 166866 | |
| aflatoxin G1 | A coumarin that has formula C17H12O7. |
| N-(oxo-5,6-dihydrophenanthridin-2-yl)-N,N-dimethylacetamide hydrochloride | |
| Antipain | |
| 3,4-dihydroxyacetophenone | |
| AICA ribonucleotide | A 1-(phosphoribosyl)imidazolecarboxamide that is acadesine in which the hydroxy group at the 5' position has been converted to its monophosphate derivative. |
| ursolic acid | A pentacyclic triterpenoid that has formula C30H48O3. |
| tetracycline CMT-3 | |
| Oligosaccharides | A compound in which monosaccharide units are joined by glycosidic linkages. The term is commonly used to refer to a defined structure as opposed to a polymer of unspecified length or a homologous mixture. When the linkages are of other types the compounds are regarded as oligosaccharide analogues. |
| tetracycline CMT-8 | |
| Acrolein | An enal that is prop-2-ene with an oxo group at position 1. |
| N-(1-((4-(3-carbamoylphenyl)-3,4-dimethylpiperidin-1-yl)methyl)-2-methylpropyl)-7-hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide | |
| PB28 compound | |
| mono-N-desethylamiodarone | |
| SK-7041 | |
| Hyoscyamine | |
| 4,5,6,7-tetrachlorophthalide | |
| oxytocin, Thr(4)-Gly(7)- | |
| kuguacin J | |
| Trichloroethylene | |
| bisindolylmaleimide VIII | |
| GR 73632 | |
| Dicarbethoxydihydrocollidine | |
| pyrithione | |
| F-180 vasoconstrictor peptide | |
| polyaspartate | |
| 6-deoxypenciclovir | |
| Nocodazole | A member of the class of benzimidazoles that is benzimidalole which is substituted at position 2 by a (methoxycarbonyl)amino group and at position 5 by a 2-thienoyl group. It is an antineoplastic agent that exerts its effect by depolymerising microtubules. |
| reviparin | |
| CP 31398 | |
| 7-(3-(2-(cyclopropylmethyl)-3-methoxy-4-((methylamino)carbonyl)phenoxy)propoxy)-3,4-dihydro-8-propyl-2H-1-benzopyran-2-propanoic acid | |
| methyl 3, 5-O-dicaffeoylquinate | |
| lonafarnib | |
| alpha-pentyl-3-(2-quinolinylmethoxy)benzenemethanol | |
| Platelet Activating Factor | A 2-acyl-1-alkyl-sn-glycero-3-phosphocholine where the 2-O-acyl group is specified as acetyl; a potent phospholipid activator and mediator of many leukocyte functions, including platelet aggregation, inflammation, and anaphylaxis. |
| pseudoisocyanine | |
| senktide | |
| Bisphenol A-Glycidyl Methacrylate | A diarylmethane that has formula C29H36O8. |
| atipamezole | |
| 1,10-phenanthroline | A phenanthroline that has formula C12H8N2. |
| Zeaxanthins | |
| Carbimazole | |
| Cosmetics | The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. |
| Tobacco Smoke Pollution | |
| itopride | |
| sauchinone | |
| Pentanes | |
| Azetidinecarboxylic Acid | A member of the class of azetidines that is azetidine substituted by at least one carboxy group at unspecified position. |
| pifithrin | |
| astressin-2B | |
| ABT-737 | |
| 3-oxo-1,1-diphenyltetrahydrooxazolo(3,4-a)pyrazine-7-carboxylic acid 4-fluorobenzylamide | |
| tetrachloroplatinate | |
| N-(1-(2,3-dimethoxyphenyl)-4-methyl-3-penten-1-yl)-1-(5-bromofurfuryl)-1-piperidyl-4-amine | |
| 4-amino-5-(4-methylphenyl)-7-(tert-butyl)pyrazolo(3,4-d)pyrimidine | |
| N-2-(4-bromophenyl) ethyl caffeamide | |
| hexafluoroisopropanol | |
| quinaprilat | |
| lipoarabinomannan | A glycolipid comprising a glycosylphosphatidyl-myo-inositol-anchored lipoglycan; a virulence factor associated with Mycobacterium tuberculosis. |
| 2,4,3',5'-tetramethoxystilbene | |
| 2,6-dinitrotoluene | A dinitrotoluene carrying nitro substituents at positions 2 and 6. |
| cinchonine | Cinchonan in which a hydrogen at position 9 is substituted by hydroxy (S configuration). It occurs in the bark of most varieties of Cinchona shrubs, and is frequently used for directing chirality in asymmetric synthesis. |
| Glycolates | |
| homocamptothecin | |
| (19Z)-halichondramide | |
| Plutonium | An actinoid atom that has formula Pu. |
| dioctanoyl-phosphatidylinositol 4,5-bisphosphate | |
| Stigmasterol | |
| Chloramphenicol | An organochlorine compound that is dichloro-substituted acetamide containing a nitrobenzene ring, an amide bond and two alcohol functions. |
| Hydrocodone | An organic heteropentacyclic compound that has formula C18H21NO3. |
| 16 alpha-ethyl-21-hydroxy-19-nor-4-pregnene-3,20-dione | |
| 2-tert-butylphenol | An alkylbenzene that has formula C10H14O. |
| Sulfur | A chalcogen that has formula S. |
| succinic semialdehyde | A succinate semialdehyde that has formula C4H6O3. |
| phenobarbital quinidine | |
| 3-hydroxyflavone | |
| capoamycin | |
| 2-(1'-methyl-2'-pyrrolidinyl)-7-hydroxy-1,4-benzodioxane | |
| ((1-ethylpyrrolidin-2-yl) methyl)-4-hydroxy-7-methoxy-quinoline-3-carboxamide | |
| 3-hydroxypicolinic acid | A monohydroxypyridine that is picolinic acid in which the hydrogen at position 3 is replaced by a hydroxy group. It is used as a matrix in matrix-assisted laser desorption/ionization (MALDI) mass spectrometry for the analysis of oligonucleotides. |
| potassium tellurate(IV) | |
| Thiabendazole | A member of the class of benzimidazoles carrying a 1,3-thiazol-4-yl substituent at position 2. A mainly post-harvest fungicide used to control a wide range of diseases including Aspergillus, Botrytis, Cladosporium and Fusarium. |
| Bisoprolol | A secondary amine that has formula C18H31NO4. |
| Starch | The most important reserve polysaccharide found in plants. It is a glucan consisting of amylose and amylopectin. |
| Dehydroepiandrosterone | An androstanoid that is androst-5-ene substituted by an beta-hydroxy group at position 3 and an oxo group at position 17. It is a naturally occurring steroid hormone produced by the adrenal glands. |
| CEP-11004 | |
| Rafoxanide | |
| Dibutyryl Cyclic GMP | |
| Amiloride | A monocarboxylic acid amide that is N-carbamimidoylpyrazine-2-carboxamide substituted by amino groups at positions 3 and 5 and a chloro group at position 6. |
| 5,7,3'-trihydroxy-3,4'-dimethoxyflavone | |
| honokiol | A biphenyl that has formula C18H18O2. |
| Losartan | A biphenylyltetrazole where a 1,1'-biphenyl group is attached at the 5-position and has an additional trisubstituted imidazol-1-ylmethyl group at the 4'-position |
| Propionates | |
| Carrageenan | A family of sulfated polysaccharides extracted from red seaweeds. The name is derived from a common name of red algae Chondrus crispus, carrageen moss (Irish moss). |
| 2-oleoylglycerol | A 2-monoglyceride where the acyl group is (9Z)-octadecenoyl. |
| isonitrosoacetone | |
| Phorbol 12,13-Dibutyrate | |
| tomatidine | A 3beta-hydroxy steroid resulting from the substitution of the 3beta-hydrogen of tomatidane by a hydroxy group. |
| 1-sulfooxymethylpyrene | |
| triphenyltin chloride | An organotin compound that is triphenylstannane in which the hydrogen attached to tin is replaced by a chloro group. A fungicide used to control blights on potatoes, leaf spot diseases on sugar beet and anthracnose on beans. |
| Inulin | |
| pyrimethanil | A member of the class of aminopyrimidines that is N-phenylpyrimidin-2-amine carrying two additional methyl substituents at positions 4 and 6. A fungicide used to control grey mould on fruit, vegetables and ornamentals as well as leaf scab on pome fruit. Also commonly employed to control Botrytis cinerea throughout the winemaking process in grapes, must, fermenting must and wine. |
| Chlordan | |
| 2,4,5,2',5'-pentachlorobiphenyl | |
| vanoxerine | An N-alkylpiperazine that consists of piperazine bearing 2-bis(4-fluorophenyl)methoxy]ethyl and 3-phenylpropyl groups at positions 1 and 4 respectively. Potent, competitive inhibitor of dopamine uptake (Ki = 1 nM for inhibition of striatal dopamine uptake). Has > 100-fold lower affinity for the noradrenalin and 5-HT uptake carriers. Also a potent sigma ligand (IC50 = 48 nM). Centrally active following systemic administration. |
| Cytochalasin D | An organic heterotricyclic compound that is a mycotoxin produced by Helminthosporium and other moulds which is cell permeable and a potent inhibitor of actin polymerisation and DNA synthesis. |
| Cytochalasin B | An organic heterotricyclic compound, that is a mycotoxin which is cell permeable an an inhibitor of cytoplasmic division by blocking the formation of contractile microfilaments. |
| BPC96 peptide | |
| psorospermin | An organic heterotetracyclic compound that is 1,2-dihydro-6H-furo[2,3-c]xanthene substituted by a hydroxy group at position 10, a methoxy group at position 5 nad a 2-methyloxiran-2-yl group at position 2. |
| NS3728 | |
| 2-(N-ethylperfluorooctanesulfonamido)ethyl alcohol | |
| Peruvian balsam | |
| 14,15-dihydroxyeicosatrienoic acid | |
| pegvisomant | |
| BIBW 2992 | |
| azalanstat | |
| Acetylcysteine | |
| aluminum lactate | |
| BIRB 796 | |
| mofegiline | |
| 2,3-bis(palmitoyloxy)-2-propyl-N-palmitoyl-cysteinyl-seryl-seryl-asparaginyl-alanine | |
| N'-(2-chloroethyl)-N-(2-(methylsulfonyl)ethyl)-N'-nitrosourea | |
| ioxynil | A nitrile that is benzonitrile substituted by a hydroxy group at position 4 and iodo groups at positions 3 and 5. |
| hexestrol diazirine | |
| 4-dichlorobenzene | |
| WJ1376-1 | |
| Thiram | |
| trimethylenediamine | An alkane-alpha,omega-diamine comprising a propane skeleton with amino substituents at positions 1 and 3. |
| n-hexane | |
| Methylurea Compounds | |
| diisopropanolnitrosamine | |
| Primaquine | A N-substituted diamine that is pentane-1,4-diamine substituted by a 6-methoxyquinolin-8-yl group at N(4) position. It is a drug used in the treatment of malaria and Pneumocystis pneumonia. |
| royal jelly | |
| Aprindine | |
| benzylparaben | |
| erucylphosphocholine | |
| tubastatin A | |
| 6-(bromomethylene)tetrahydro-3-(1-naphthaleneyl)-2H-pyran-2-one | |
| phenalen-1-one | |
| goralatide | |
| glyceollin | An organic heteropentacyclic compound that has formula C20H18O5. |
| Cloxacillin | A semisynthetic penicillin antibiotic carrying a 3-(2-chlorophenyl)-5-methylisoxazole-4-carboxamido group at position 6. |
| YM 758 | |
| LY 117018 | |
| methyl(acetoxymethyl)nitrosamine | |
| diphosphoric acid | An acyclic phosphorus acid anhydride obtained by condensation of two molecules of phosphoric acid. |
| SH-6 compound | |
| Cyclic GMP | |
| 2-ethynylpyrene | |
| 5-((2,4-dioxo-5-thiazolidinyl)methyl)-2-methoxy-N-((4-(trifluoromethyl)phenyl)methyl)benzamide | |
| 5-hydroxyindole | |
| 4,5,6,7-tetrabromobenzotriazole | |
| 2-pyridylcarboxaldehyde isonicotinoylhydrazone | |
| 2-methyl-4-isothiazolin-3-one | |
| 1,3-dihydroxy-2-hydroxymethylpropyl-2-ammonium 2-((R)-3-cyclo-hexyl-1-phenylpropyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate monohydrate | |
| Anthraquinones | |
| Benzbromarone | |
| Metalloids | |
| chlorodifluoroacetaldehyde | |
| fenbufen | |
| lipopeptidophosphoglycan | A glycoconjugate expressed by Leishmania promastigotes, the stage of the parasite characteristic for the sandfly vector. Lipophosphoglycan consists of lysoalkyl-sn-glycerophosphoinositol linked to a phosphosaccharide core conserved in all species, which is connected to PO4-6Galbeta1,4Manalpha1 repeats with species-specific substitutions at the Gal residue; the repeats are capped by conserved and species-specific oligosaccharides. |
| Ethylene Glycols | |
| carmoxirole | An indolecarboxylic acid that is indole-5-carboxylic acid bearing an additional 4-(4-phenyl-1,2,3,6-tetrahydropyridin-1-yl)butyl substituent at position 3. Selective, peripherally acting dopamine D2 receptor agonist. Modulates noradrenalin release and sympathetic activation. Displays antihypertensive properties in vivo. |
| Phosphines | Phosphane (PH3) and compounds derived from it by substituting one, two or three hydrogen atoms by hydrocarbyl groups: RPH2, R2PH, R3P (R =/= H) are called primary, secondary and tertiary phosphines, respectively. A specific phosphine is preferably named as a substituted phosphane. |
| resveratrol-4'-O-glucuronide | |
| tert-butylbicyclophosphorothionate | |
| N'-nitrosoanabasine | A citraconoyl group that has formula C10H13N3O. |
| Trinitrotoluene | |
| Okadaic Acid | A polycyclic ether that has formula C44H68O13. |
| 4-(3-(1-adamantyl)-4-hydroxyphenyl)-3-chlorocinnamic acid | |
| DIBA-1 | |
| Glycine Agents | |
| N-((5-(3-(1-benzylpiperidin-4-yl)propoxy)-1-methyl-1H-indol-2-yl)methyl)-N-methylprop-2-yn-1-amine | |
| germacrone | A germacrane sesquiterpenoid that has formula C15H22O. |
| Cyanamide | A nitrile that is hydrogen cyanide in which the hydrogen has been replaced by an amino group. |
| 11-oxoeicosatetraenoic acid | |
| Nitrogen Compounds | |
| tripeptide tyroservatide | |
| methyl bensulfuron | |
| sarsasapogenin | |
| tibolone | |
| aza-(6)-gingerol | |
| azastene | |
| gum mastic | |
| tetrahydrothiophene | A member of the tetrahydrothiophenes that has formula C4H8S. |
| carbobenzoxy-leucyl-leucyl-leucine | |
| Beryllium | |
| aroclor 1221 | |
| benzyloxycarbonyl-alanyl-glutamyl-valyl-aspartic acid fluoromethyl ketone | |
| ICI 164384 | |
| columbamine | A berberine alkaloid that has formula C20H20NO4. |
| dibromoacetic acid | |
| Hydrocarbons, Aromatic | |
| monomethyl succinate | A dicarboxylic acid monoester that is succinic acid in which one of the carboxy groups has been converted to its methyl ester. |
| lycorine | An indolizidine alkaloid that is 3,12-didehydrogalanthan substituted by hydroxy groups at positions and 2 and a methylenedioxy group across positions 9 and 10. Isolated from Crinum asiaticum, it has been shown to exhibit antimalarial activity. |
| (3b,5b,7a,12a)-7,12-dihydroxy-3-(2-((4-((11b,17b)-17-hydroxy-3-oxo-17-prop-1-ynylestra-4,9-dien-11-yl) phenyl)(methyl)amino)ethoxy)cholan-24-oic acid | |
| poractant alfa | |
| 2-(4-(quinolin-2-yl-methoxy)phenyl)-2-cyclopentylacetic acid | |
| (5-formylfuran-2-yl)methyl 4-hydroxy-2-methylenebutanoate | |
| Didanosine | A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. |
| acifluorfen | A member of the class of benzoic acids that is 2-nitrobenzoic acid in which the hydrogen at position 5 is replaced by a 2-chloro-4-(trifluoromethyl)phenoxy group. It is a herbicide used for the post-emergence control of a variety of annual broadleaf weeds. |
| 3,4-dihydroxyphenylacetaldehyde | A phenylacetaldehyde in which the 3 and 4 positions of the phenyl group are substituted by hydroxy groups. |
| 2-tert-butyl-9-fluoro-3,6-dihydro-7H-benz(h)imidazo(4,5-f)isoquinoline-7-one | |
| quinone methide | |
| 2,3,5-trichlorophenol | |
| LG 100268 | |
| Bromates | Any salt that has chlorate, [BrO3](-), as the anionic component. |
| fluorene | An ortho-fused tricyclic hydrocarbon that is a major component of fossil fuels and their derivatives |
| dinoseb | A racemate composed of equimolar amounts of (R)- and (S)-dinoseb. |
| CycloProvera | |
| bucolome | |
| Insecticides | Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| 3-Hydroxybutyric Acid | A straight-chain 3-hydroxy monocarboxylic acid comprising a butyric acid core with a single hydroxy substituent in the 3- position; a ketone body whose levels are raised during ketosis, used as an energy source by the brain during fasting in humans. Also used to synthesise biodegradable plastics. |
| Mefloquine | A racemate composed of (+)-(11R,2'S)- and (-)-(11S,2'R)-enantiomers of mefloquine. An antimalarial agent which acts as a blood schizonticide; its mechanism of action is unknown. |
| 10,11-dihydro-5H-dibenzo(a,d)cycloheptene | |
| Verapamil | A racemate comprising equimolar amounts of dexverapamil and (S)-verapamil. An L-type calcium channel blocker of the phenylalkylamine class, it is used (particularly as the hydrochloride salt) in the treatment of hypertension, angina pectoris and cardiac arrhythmia, and as a preventive medication for migraine. |
| Coke | |
| Bromides | |
| 1,4-naphthoquinone | A naphthoquinone that has formula C10H6O2. |
| PD168393 | |
| Tungsten | A chromium group element atom that has formula W. |
| bleomycetin | A member of the class of bleomycins that is used in sclerotherapy for cervicofacial lymphatic malformations. |
| monotropein | An iridoid monoterpenoid that is 1,4a,7,7a-tetrahydrocyclopenta[c]pyran substituted by a beta-D-glucopyranosyloxy group at position 1, a carboxylic acid group at position 4, and at position 7 by a hydroxy and hydroxymethyl groups respectively (the 1S,4aS,7R,7aS diastereomer). |
| PD 173074 | A member of the class of ureas that is 1-tert-butylurea in which one of the hydrogens attached to N(3) is substituted by a pyrido[2,3-d]pyrimidin-7-yl group, which is itself substituted at positions 2 and 6 by a 4-(diethylamino)butyl]amino group and a 3,5-dimethoxyphenyl group, respectively. It is a FGF/VEGF receptor tyrosine kinase inhibitor. |
| 3,4-dihydroxyphenylpropionic acid | |
| 2-methyl-2H-pyrazole-3-carboxylic acid (2-methyl-4-o-tolylazophenyl)amide | |
| toxB protein, Clostridium difficile | |
| SK&F 91488 | |
| Filipin | |
| 3-hydroxy-4-pentenoic acid | |
| sulfanitran | |
| estropipate | |
| clazosentan | |
| isosorbide-5-mononitrate | |
| Ageladine A | An imidazopyridine that is 1H-imidazo[4,5-c]pyridin-2-amine substituted by a 4,5-dibromo-1H-pyrrol-2-yl group at position 4. It is an alkaloid isolated from a marine sponge Agelas nakamurai and acts as an inhibitor of the matrix metalloproteinases, the key enzymes involved in tumour growth, migration, angiogenesis, invasion and metastasis. |
| 4-benzhydryloxy-1-(3-(1H-tetrazol-5-yl-)-propyl)piperidine | |
| O(6)-benzylguanine | |
| N-benzyloxycarbonyl-valyl-leucyl-leucinal | |
| 2-methoxy-4-amino-5-chlorobenzoic acid 2-(diethylamino)ethyl ester | |
| Erbium | A lanthanoid atom that has formula Er. |
| Flavonoids | Any organic molecular entity whose stucture is based on derivatives of a phenyl-substituted 1-phenylpropane possessing a C15 or C16 skeleton, or such a structure which is condensed with a C6-C3 lignan precursors. The term is a 'superclass' comprising all members of the classes of flavonoid, isoflavonoid, neoflavonoid, chalcones, dihydrochalcones, aurones, pterocarpan, coumestans, rotenoid, flavonolignan, homoflavonoid and flavonoid oligomers. Originally restricted to natural products, the term is also applied to synthetic compounds related to them. |
| brevetoxin | |
| ferric nitrilotriacetate | |
| neferine | |
| Lansoprazole | A sulfoxide that has formula C16H14F3N3O2S. |
| nandrolone decanoate | A steroid ester that has formula C28H44O3. |
| azo rubin S | |
| puerarin | An isoflavonoid that has formula C21H20O9. |
| 8-(4-chlorophenylthio)guanosine 3',5'-cyclic monophosphorothioate | |
| bromoethane | |
| Disopyramide | A monocarboxylic acid amide that is butanamide substituted by a diisopropylamino group at position 4, a phenyl group at position 2 and a pyridin-2-yl group at position 2. It is used as a anti-arrhythmia drug. |
| Risperidone | A member of the class of pyridopyrimidines that is 2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one carrying an additional 2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl group at position 2. |
| 2'-(glutathion-S-yl)-deschlorodiclofenac | |
| 6-bromoindirubin-3'-oxime | |
| 7,8-dihydrobiopterin | A dihydropterin that is biopterin dihydrogenated at positions 7 and 8. |
| homocysteic acid | |
| ilomastat | |
| lupane | A triterpene that has formula C30H52. |
| Polysaccharides | A biomacromolecule consisting of large numbers of monosaccharide residues linked glycosidically. This term is commonly used only for those containing more than ten monosaccharide residues. |
| coniferaldehyde | |
| trans-10,cis-12-conjugated linoleic acid | |
| GSK690693 | |
| nomilin | A limonoid that has formula C28H34O9. |
| Bupleuran 2IIc | |
| Akt-I-1 compound | |
| Atovaquone | |
| 2-hydroxyamino-1-methyl-6-phenylimidazo(4,5-b)pyridine | |
| BP 897 | |
| Octopamine | Octopamine is a biogenic phenylethanolamine, which has been found to act as a neurotransmitter, neurohormone or neuromodulator in invertebrates. |
| Ro 25-6603 | |
| perfluoroundecanoic acid | A fluoroalkanoic acid that is perfluorinated undecanoic acid. |
| diarylpropionitrile | |
| 6-((2-(4-imidazolyl)ethyl)amino)heptanoic acid 4-toluidide | |
| pinostilbene | |
| Coformycin | An N-glycosyl in which (8R)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol is attached to ribofuranose via a beta-N(3)-glycosidic bond. compound The parent of the class of coformycins. |
| U 69593 | A monocarboxylic acid amide obtained by formal condensation between the carboxy group of phenylacetic acid and the secodary amino group of (5R,7S,8S)-N-methyl-7-(pyrrolidin-1-yl)-1-oxaspiro[4.5]decan-8-amine. |
| Staurosporine | An indolocarbazole alkaloid that has formula C28H26N4O3. |
| N-benzyl-N-methyl-2-(7-methyl-8-oxo-2-phenyl-7,8-dihydro-9H-purin-9-yl)acetamide | |
| VBA protocol | |
| soyasaponin II | A triterpenoid saponin that has formula C47H76O17. |
| diazepinone riboside | |
| N-nitroso(di-n-propyl)amine | A nitroso compound that has formula C6H14N2O. |
| Coal Ash | |
| LHRH, N-acetyl-(4-chlorophenylalanyl)(1)-(4-chlorophenylalanyl)(2)-tryptophyl(3)-arginyl(6)-alanine(10)- | |
| phosphoric acid mono-(2-(4-(3,3-dimethylbutyrylamino)-3,5-difluorobenzoylimino)thiazol-3-ylmethyl) ester | |
| A 192621 | |
| 7-acetoxy-6,7-dihydro-6-(4-methoxyphenyl)pyrrolo(2,1-d)(1,5)benzothiazepine | |
| cryptotanshinone | |
| epimuqubilin A | |
| bromoxynil octanoate | |
| Desmosterol | A cholestanoid that is cholesta-5,24-diene substituted by a beta-hydroxy group at position 3. It is an intermediate metabolite obtained during the synthesis of cholesterol. |
| Dydrogesterone | |
| SSR180711 | |
| 4-methylumbelliferyl heptanoate | |
| 1,2,4-triazolo(1,5-c)pyrimidine | |
| 4-chlorophenol | A monochlorophenol substituted at the pare position by a chlorine atom. |
| denopamine | |
| Minocycline | A tetracycline analogue having a dimethylamino group at position 7 and lacking the methyl and hydroxy groups at position 5. |
| 2'-benzoyloxycinnamaldehyde | |
| 64Cu-DOTA-cetuximab | |
| ormosil | |
| N-(2-amino-3-methyl-n-butyl)-3-((bis-4-fluorophenyl)methoxy)tropane | |
| Progestins | A synthetic progestogen. |
| argemone oil | |
| pseudocumene | |
| tallow | |
| Veratridine | A steroid that has formula C36H51NO11. |
| glycidamide | |
| 2-tetradecylglycidic acid | |
| homocastasterone | |
| gadolinium chloride | |
| diethylamine | |
| 4-hydroxy-equilenin | |
| Tranexamic Acid | |
| ONO 3708 | |
| Gentamicins | |
| Fenbendazole | |
| hellebrigenin | A 19-oxo steroid that has formula C24H32O6. |
| 3-hydroxy-17-(1H-benzimidazole-1-yl)androsta-5,16-diene | |
| Flavoring Agents | |
| 1-aminocyclopropanol | |
| Pyrimidines | Any compound having a pyrimidine as part of its structure. |
| gaboxadol | |
| Selective Estrogen Receptor Modulators | |
| Methyltestosterone | A 17beta-hydroxy steroid that is testosterone bearing a methyl group at the 17alpha position. |
| Dicumarol | |
| 4-((methylnitrosoamino)-1-(3-pyridyl)but-1-yl)beta-omega-glucosiduronic acid | |
| eliglustat | A carboxamide obtained by formal condensation of the carboxy group of octanoic acid with the primary amino group of (1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(pyrrolidin-1-yl)propan-1-ol. A ceramide glucosyltransferase inhibitor used (as its tartrate salt) for treatment of Gaucher's disease. |
| Glucose | An aldohexose used as a source of energy and metabolic intermediate. |
| cis-diammine(pyridine)chloroplatinum(II) | |
| bilirubin ditaurine | |
| LY2066948 | |
| benzothiophene | |
| cladribine monophosphate | |
| Sewage | |
| Scandium | A rare earth metal atom that has formula Sc. |
| 4-(4-fluorophenyl)-2-(4-hydroxyphenyl)-5-(4-pyridyl)imidazole | |
| 6,10-diaza-3(1,3),8(1,4)dibenzena-1,5(1,4)diquinolinacyclodecaphane | |
| Centella asiatica extract | |
| acephate | A phosphoramide that is methamidophos in which one of the hydrogens is replaced by an acetyl group. |
| cinnamyl alcohol | A primary alcohol comprising an allyl core with a hydroxy substituent at the 1-position and a phenyl substituent at the 3-position (geometry of the C=C bond unspecified). |
| Trientine | |
| Anesthetics, Combined | |
| Urethane | A carbamate ester obtained by the formal condensation of ethanol with carbamic acid. It has been found in alcoholic beverages. |
| (dichloro)tetraammineruthenium(III) | |
| CGS 12066B | |
| phytosphingosine | |
| Coproporphyrinogens | |
| silodosin | |
| domiphen | |
| Nanodiamonds | |
| Flumethasone | |
| kahweol | |
| ambrisentan | |
| 4-nitrocatechol sulfate | |
| 3,4-dihydro-5-methyl-1(2H)-isoquinolinone | |
| rivaroxaban | |
| diethylthiourea | |
| Tetracyclines | A subclass of polyketides having an octahydrotetracene-2-carboxamide skeleton, substituted with many hydroxy and other groups. |
| Carbocysteine | |
| valproylcarnitine | |
| 2-aminoethoxydiphenylborane | |
| irbesartan | |
| carfilzomib | |
| Carbamates | Any ester of carbamic acid or its N-substituted derivatives. |
| Anthelmintics | |
| Dithiothreitol | |
| 3-deazaneplanocin | |
| 24-norcholan-2,3,24-tryl-2,3,23-sulfuric acid | |
| 1-chloronaphthalene | |
| Triiodothyronine, Reverse | |
| methyl tert-butyl ether | An ether having methyl and tert-butyl as the two alkyl components. |
| 8-cyclopentyl-1,3-dimethylxanthine | |
| beta-hydroxy simvastatin acid | |
| 2,4-dinitrofluorobenzene sulfonic acid | |
| Fenretinide | |
| 4-hydroxymephenytoin | |
| glaucine | An isoquinoline alkaloid that has formula C21H25NO4. |
| HS-1199 | |
| bisabolol | |
| sitafloxacin | |
| bis(quercetinato)oxovanadium(IV) | |
| desethylamiodarone | |
| kurarinol | A flavanone that has formula C26H32O7. |
| 2,3,3',4,4',5-hexachlorobiphenyl | |
| Muscarine | A monosaccharide that has formula C9H20NO2. |
| Prostaglandins | Naturally occurring compounds derived from the parent C20 acid, prostanoic acid. |
| Debrisoquin | |
| Aminobenzoates | |
| benzylhydrazine | |
| simvastatin acid | |
| N,N-dimethyl-2-(2-amino-4-cyanophenylthio)benzylamine | |
| benzyl acetate | An acetate ester that has formula C9H10O2. |
| NVP ADW742 | |
| 2,5-anhydromannitol 1-phosphate | |
| colestimide | |
| Arsenites | |
| 3-methylpyridine | A methylpyridine that is pyridine substituted by a methyl group at position 3. |
| farnesoic acid | A methyl-branched, trienoic fatty acid consisting of dodeca-2,6,10-trienoic acid having three methyl substituents at the 3-, 7- and 11-positions. |
| NL-71-101 | |
| migalastat | |
| tripterine | |
| n-hexanal | |
| miglustat | |
| pelargonidin | An anthocyanidin cation that is flavylium substituted by a hydroxy groups at positions 3, 5, 7 and 4'. |
| butein | A chalcone that is (E)-chalcone bearing four additional hydroxy substituents at positions 2', 3, 4 and 4'. |
| 2,4-xylidine | |
| K117 compound | |
| N-(4-cyano-benzo(b)thiophene-2-carbonyl)guanidine | |
| pirinixic acid | An aryl sulfide that has formula C14H14ClN3O2S. |
| Citrinin | |
| n-butoxyacetic acid | |
| homobrassinolide | |
| lipid-linked oligosaccharides | |
| 1-(carboxymethylthio)tetradecane | |
| Ceftriaxone | A cephalosporin compound having 2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetylamino and [(2-methyl-5,6-dioxo-1,2,5,6-tetrahydro-1,2,4-triazin-3-yl)sulfanyl]methyl side-groups. |
| TN 16 | |
| Chromium Compounds | |
| Maltose | |
| dimethyl mercury | A methylmercury compound that has formula C2H6Hg. |
| Ochratoxins | |
| Dietary Carbohydrates | |
| 2-hydroxyestrone | A 2-hydroxy steroid that is estrone substituted by a hydroxy group at position 2. |
| prostaglandin D3 | A prostaglandins D that has formula C20H30O5. |
| raltitrexed | |
| (9H-fluoren-9-yl)methyl(1-((6-(tert-butoxycarbonyl)amino-1-((4-methyl-2-oxo-1,2-dihydroquinolin-7-yl)amino)-1-oxohexan-2-yl)amino)-3-cyclohexyl-1-oxopropan-2-yl)carbamate | |
| benfuresate | A benzofuran that has formula C12H16O4S. |
| 3,4,3',4'-tetrachloroazobenzene | |
| cyclohexyl methylphosphonic acid | |
| Azaguanine | |
| 2-amino-1-methyl-6-phenolimidazo(4,5-b)pyridine-DNA adduct | |
| isoprothiolane | A malonate ester that is diisopropyl malonate in which the two methylene hydrogens at position 2 are replaced by a 1,3-dithiolan-2-ylidene group. An insecticide and fungicide used to control a range of diseases including Pyricularia oryzae, Helminthosporium sigmoideum and Fusarium nivale. |
| FR 173657 | |
| Palmitoyl Coenzyme A | |
| musk xylene | A C-nitro compound that is m-xylene bearing three nitro substituents at positions 2, 4 and 6 as well as a tert-butyl group at position 5. |
| mozavaptan | |
| silver acetate | |
| Selegiline | |
| Sulfadiazine | A sulfonamide consisting of pyrimidine with a 4-aminobenzenesulfonamido group at the 2-position. |
| punarnavine | |
| A-317491 | |
| Metergoline | |
| S-methylcysteine | |
| Cytidine Triphosphate | |
| 4-(nitroxy)butanoic acid 4-acetylaminophenyl ester | |
| mangiferin | A C-glycosyl compound consisting of 1,3,6,7-tetrahydroxyxanthen-9-one having a beta-D-glucosyl residue at the 6-position. |
| prostaglandin E2 glyceryl ester | |
| alpha-naphthoflavone | An extended flavonoid resulting from the formal fusion of a benzene ring with the h side of flavone. A synthetic compound, it is an inhibitor of aromatase (EC 1.14.14.14). |
| Sorbitol | |
| RAPTA-T | |
| alpha-latrotoxin | |
| 1,4,7-tris(carboxymethyl)-1,4,7,10-tetraazacyclododecane | |
| Hemicholinium 3 | |
| Succinic Acid | |
| Probucol | |
| Fenofibrate | A chlorobenzophenone that is (4-chlorophenyl)(phenyl)methanone substituted by a [2-methyl-1-oxo-1-(propan-2-yloxy)propan-2-yl]oxy group at position 1 on the phenyl ring. |
| Surface-Active Agents | |
| Levonorgestrel | A 17beta-hydroxy steroid that has formula C21H28O2. |
| Bromkal 70 | |
| acetohydroxamic acid | |
| momordin I (Oleanolic Acid) | |
| Allethrin | |
| Ferrous Compounds | |
| 1,2,4-trimethylcyclohexane | |
| diinosine pentaphosphate | |
| dibenzothiophene | A mancude organic heterotricyclic parent that consists of a thiophene ring flanked by two benzene rings ortho-fused across the 2,3- and 4,5-positions. |
| Carbonyl Cyanide m-Chlorophenyl Hydrazone | |
| pseudohypericin | An ortho- and peri-fused polycyclic arene that has formula C30H16O9. |
| pencycuron | A member of the class of ureas carrying 4-chlorobenzyl and cyclopentyl substituents at position 1 and a phenyl substituent at position 3. A fungicide used to control diseases caused by Rhizoctonia solani and Pellicularia spp. It is not highly toxic to mammals but is moderately toxic to birds, most aquatic organisms, honeybees and earthworms. |
| Hirudins | |
| alfuzosin | A tetrahydrofuranol that has formula C19H27N5O4. |
| Ospemifene | An organochlorine compound that is a selective estrogen receptor modulator; used for treatment of dyspareunia. |
| benzylphosphonic acid | |
| Retinoids | Oxygenated derivatives of 3,7-dimethyl-1-(2,6,6-trimethylcyclohex-1-enyl)nona-1,3,5,7-tetraene and derivatives thereof. |
| Ethinyl Estradiol-Norgestrel Combination | |
| Acetanilides | |
| malassezin | |
| Muscarinic Antagonists | A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| 1,1-dichloro-2,2-difluoroethylene | |
| Galactolipids | |
| entinostat | |
| tirapazamine | A member of the class of benzotriazines that is 1,2,4-benzotriazine carrying an amino substituent at position 3 and two oxido substituents at positions 1 and 4. |
| 4-fluoro-N-methylaniline | |
| N(6)-cyclopropyl-9-(2-phosphonylmethoxyethyl)-2,6-diaminopurine | |
| cadmium sulfate | A cadmium salt that has formula CdO4S. |
| Aluminum Hydroxide | |
| Chlorprothixene | |
| Rubidium | An alkali metal atom that has formula Rb. |
| N-methyl-3-(bis(4'-fluorophenyl)methoxy)tropane | |
| EGYT 3615 | |
| Sertraline | A member of the class of tetralins that is tetralin which is substituted at positions 1 and 4 by a methylamino and a 3,4-dichlorophenyl group, respectively (the S,S diastereoisomer). A selective serotonin-reuptake inhibitor (SSRI), it is administered orally as the hydrochloride salt as an antidepressant for the treatment of depression, obsessive-compulsive disorder, panic disorder and post-traumatic stress disorder. |
| citral | |
| Deamino Arginine Vasopressin | |
| Mefenamic Acid | An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis. |
| salicyl alcohol | |
| 4-(6-cyclohexylmethoxy-9H-purin-2-ylamino)-N,N-diethylbenzamide | |
| N-(2-(2-ethyl-8,9-dihydrofuro(3,2-c)pyrazolo(1,5-a)pyridin-1-yl)ethyl)acetamide | |
| SGA 360 | |
| Dextrorphan | A morphinane alkaloid that has formula C17H23NO. |
| BMS453 | |
| muscone | |
| 2-methoxynaphthalene | |
| formic acid | |
| mequinol | |
| miltefosine | A phospholipid that is the hexadecyl monoester of phosphocholine. |
| erlotinib | |
| 2,6-dihydroxyanthraquinone | |
| Methamphetamine | A member of the class of amphetamines in which the amino group of (S)-amphetamine carries a methyl substituent. |
| 5-acetyl-1,1,2,6-tetramethyl-3-isopropylindane | |
| U 75302 | |
| 5-androstene-3,17-dione | |
| erucylphospho-N,N,N-trimethylpropylammonium | |
| 4-methyl-N-(3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl)-3-((4-pyridin-3-ylpyrimidin-2-yl)amino)benzamide | |
| p-nitrophenol glucuronide | |
| phosphatidylcholine hydroperoxide | |
| JP5 jet fuel | |
| ethylbenzene | An alkylbenzene carrying an ethyl substituent. It is a constituent of coal tar and petroleum. |
| bifonazole | |
| Indigo Carmine | |
| 4-aminophenylmercuriacetate | |
| palm oil | |
| Camphor | A cyclic monoterpene ketone that is bornane bearing an oxo substituent at position 2. A naturally occurring monoterpenoid. |
| mezerein | A diterpenoid that has formula C38H38O10. |
| FD & C Yellow No. 6 | |
| N-acetyl-Cys-Gly-Pro-Cys-amide | |
| peroxycarbonic acid | |
| Butyric Acid | A four-carbon straight-chain saturated fatty acid. |
| ENNG | |
| sulfamidochrysoidine | |
| ergotoxin, Centruroides noxius | |
| BSF 302146 | |
| cyhalothrin | A carboxylic ester obtained by formal condensation between 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid and cyano(3-phenoxyphenyl)methanol. |
| 4-oxoretinoic acid | A retinoid that consists of all-trans-retinoic acid bearing an oxo substituent at position 4 on the cyclohexenyl ring. |
| 2'-deoxyadenosine | A purine 2'-deoxyribonucleoside having adenine as the nucleobase. |
| 3,4-dihydroxymandelic acid | A catechol that is the 3,4-dihydroxy derivative of mandelic acid; a metabolite of L-dopa. |
| imidazolidinyl urea | |
| Fatty Acids | Any aliphatic monocarboxylic acid derived from or contained in esterified form in an animal or vegetable fat, oil or wax. |
| Cyclopentanes | Cyclopentane and its derivatives formed by substitution. |
| Methandrostenolone | |
| tetramethylpyrazine | |
| 9-(4'-aminophenyl)-9H-pyrido(3,4-b)indole | |
| Nafoxidine | A benzene that has formula C29H31NO2. |
| dicyclanil | |
| 4-(2-adamantan-1-yl-2-oxoethoxymethyl)-N,N-dimethylbenzamide | |
| Methapyrilene | |
| NSC73306 | |
| 2,3,5,4'-tetrahydroxystilbene-2-O-glucoside | |
| isophthalate | |
| sodium borate | An inorganic sodium salt having metaborate as the counterion. |
| BRL 39924A | |
| Toxins, Biological | |
| fisetin | A 7-hydroxyflavonol with additional hydroxy groups at positions 3, 3' and 4'. |
| azatadine | |
| caracurine | |
| L 694247 | |
| arvanil | |
| 3,4-dideoxyglucosone-3-ene | |
| 1-(3',4',5'-trimethoxyphenyl)-3-(3'',4''-dimethoxy-2'-hydroxyphenyl)propane | |
| benzoxazolone | |
| 2-hexynyladenosine-5'-N-ethylcarboxamide | |
| neocuproine | |
| GW0742 | A monocarboxylic acid that has formula C21H17F4NO3S2. |
| benzamidine | A carboxamidine that is benzene carrying an amidino group. |
| Isopropyl Thiogalactoside | An S-glycosyl compound consisting of beta-D-1-thiogalactose having an isopropyl group attached to the anomeric sulfur. |
| Methylmethacrylate | |
| 3-cyano-N-(1,3-diphenyl-1H-pyrazol-5-yl)benzamide | |
| L 663581 | |
| 7-chlorobenz(a)anthracene | |
| ethyl-p-((E)-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthyl)-1-propenyl)benzoic acid | |
| Dihydroxyacetone | |
| ethyl octylphosphonofluoridate | |
| 5-methyltetrahydrofolate | A group of heterocyclic compounds based on the 5-methyl-5,6,7,8-tetrahydropteroic acid skeleton conjugated with one or more L-glutamic acid or L-glutamate units. |
| Polysorbates | |
| Carbanilides | |
| Mazindol | |
| darexaban | |
| alpha-Chlorohydrin | |
| perfluorohexanesulfonic acid | |
| Choline | A choline that is the parent compound of the cholines class, consisting of ethanolamine having three methyl substituents attached to the amino function. |
| sivelestat | |
| formylchromone | |
| Roxithromycin | |
| Succinylcholine | A quaternary ammonium ion that is the bis-choline ester of succinic acid. |
| aristolochic acid I | |
| chromotrope 2R | |
| 3-(4-chlorophenyl)-adamantane-1-carboxylic acid (pyridin-4-ylmethyl)amide | |
| sodium tungstate(VI) | An inorganic sodium salt having tungstate as the counterion. Combines with hydrogen peroxide for the oxidation of secondary amines to nitrones. |
| 6-methylchrysene | A carbopolycyclic compound that has formula C19H14. |
| 5,6-dihydroxy-1-(2-imidazolinyl)tetralin | |
| CGP 57698 | |
| Cannabinoids | A diverse group of pharmacologically active secondary metabolite characteristic to Cannabis plant as well as produced naturally in the body by humans and animals. Cannabinoids contain oxygen as a part of the heterocyclic ring or in the form of various functional groups. They are subdivided on the basis of their origin. |
| N6-(((4-(4-aminobenzyl)phenyl)amino)carbonyl)lysine | |
| LW 50020 | |
| CMF regimen | |
| posaconazole | |
| Halcinonide | |
| SANT-1 compound | |
| Hydrocortisone | |
| Quinacrine | |
| aphidicolin glycinate | |
| DLJ14 compound | |
| danaproid | |
| dibenzo(a,e)pyrene | An ortho- and peri-fused polycyclic arene that has formula C24H14. |
| radafaxine | |
| Nitrofurazone | |
| deferasirox | |
| Warfarin | A hydroxycoumarin that is 4-hydroxycoumarin which is substituted at position 3 by a 1-phenyl-3-oxo-1-butyl group. |
| 4-nitrophenyl acetate | |
| chlorophenyl isocyanate | |
| diacetylrhein | |
| JZL 184 | |
| Finasteride | An aza-steroid that is a synthetic drug for the treatment of benign prostatic hyperplasia. |
| N,N-dimethylsphingosine | A sphingoid that is sphingosine in which the two amino hydrogens are replaced by amino groups. |
| HX 600 | |
| Mephobarbital | A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at N-1 by a methyl group and at C-5 by ethyl and phenyl groups. |
| arzanol | |
| catalpol | An organic molecular entity that has formula C15H22O10. |
| Chromates | |
| bilirubin glucuronate | |
| MK 0591 | |
| Betamethasone Valerate | A steroid ester that is betamethasone in which the hydroxy group at the 17alpha position has been converted to the corresponding pentanoate ester. |
| Pancuronium | A steroid ester in which a 5alpha-androstane skeleton is C-3alpha- and C-17beta-disubstituted with acetoxy groups and 2beta- and 16beta-disubstituted with 1-methylpiperidinium-1-yl groups. It is a non-depolarizing curare-mimetic muscle relaxant. |
| AGN 194204 | |
| 6-bromo-3-methylthieno(3,2-b)thiophene-2-carboxylic acid | |
| osthol | |
| vasoactive intestinal peptide, 4-chloro-Phe(6)-Leu(17)- | |
| Tetrabenazine | |
| tetrachloroisophthalonitrile | |
| 2,2'-thiodiethanol | |
| Ascorbic Acid | |
| methylumbelliferyl-alpha-D-mannopyranoside | |
| Leu-Ser-Lys-Leu peptide | |
| cyanoginosin LR | |
| N,N'-monomethylenebis(pyridiniumaldoxime) | |
| glyoxylic acid | A 2-oxo monocarboxylic acid that is acetic acid bearing an oxo group at the alpha carbon atom. |
| 4'-chlorodiazepam | |
| Particulate Matter | |
| Ethylene Dibromide | |
| 1-chlorosucrose | |
| 4-anisaldehyde | |
| FuMi protocol | |
| goitrin | A solanapyrone A that has formula C5H7NOS. |
| Sulfhydryl Compounds | |
| dipin | |
| 2'-deoxythymidylyl-(3'-5')-2'-deoxyadenosine | |
| ONO AE 248 | |
| MDL 100907 | |
| Simvastatin | A fatty acid ester comprising a dihydroxyheptanoic acid unit condensed into a lactone; a partially reduced naphthalene structure; and a 2,2-dimethylbutyric acyl substituent at C17. It is used as a cholesterol-lowering and anti-cardiovascular disease drug. |
| ZM323881 | |
| LY2109761 | |
| 2-methyl-5-(1-methylethenyl)cyclohexanol | |
| N-methyl-N-2-(methylsulfinyl)ethylpropionic acid amide | |
| hydroxycotinine | |
| irsogladine | |
| Testolactone | |
| azadirachtin | A family of terpenoids isolated from the neem tree (Azadirachta indica). |
| Bromodeoxyuridine | |
| sarizotan | |
| 1,1-bis(4-hydroxyphenyl)cyclohexane | |
| sodium sulfite | |
| polyphenon E | |
| Oxandrolone | An oxa-steroid that has formula C19H30O3. |
| Methylene Blue | An organic chloride salt that has formula C16H18N3S.Cl. |
| SM 164 | |
| SK&F 550 | |
| AZ 002 | |
| eupatilin | A trimethoxyflavone with flavone substituted by hydroxy groups at C-5 and C-7 and methoxy groups at C-6, C-3' and C-4' respectively. Isolated from Citrus reticulata and Salvia tomentosa, it exhibits anti-inflammatory, anti-ulcer and antineoplastic activities. |
| Ro 31-8425 | |
| vinyltributylstannane | |
| phorbol-12,13-didecanoate | |
| Deoxyepinephrine | |
| Vanillic Acid | A monohydroxybenzoic acid that is 4-hydroxybenzoic acid substituted by a methoxy group at position 3. |
| bexarotene | |
| Heterocyclic Compounds, 3-Ring | |
| chloramine-T | |
| lumiracoxib | An amino acid that is phenylacetic acid which is substituted at position 2 by the nitrogen of 2-chloro-6-fluoroaniline and at position 5 by a methyl group. A highly selective cyclooxygenase 2 inhibitor, it was briefly used for the treatment of osteoarthritis, but was withdrawn due to concersns of hepatotoxicity. |
| Hydrocarbons, Halogenated | |
| gigantol | |
| N,N'-((5-(2-amino-5-(2-methylpropyl)-4-thiazolyl)-2-furanyl)phosphinylidene)bis(alanine) diethyl ester | |
| Promethazine | A tertiary amine that is a substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropan-2-amine moiety. |
| dihydroceramide | A ceramide consisting of sphinganine in which one of the amino hydrogens is substituted by a fatty acyl group. |
| Inositol Phosphates | |
| (2S)-2-(4-(((3S)-1-acetimidoyl-3-pyrrolidinyl)oxy)phenyl)-3-(7-amidino-2-naphtyl)propanoic acid | |
| 1,2,3,4-tetrahydro-1-(phenylmethyl)isoquinoline | |
| Levorphanol | |
| corticosterone-21-hemisuccinate | |
| methanandamide | |
| 1-(2-methoxy-phenyl)-4-(4-(4-(6-imidazol(2,1-b) thiazolyl)-phenoxy)-butyl-4-(14)C)-piperazine dimethane | |
| 1-(acetyloxy)-3,5,6,6a,7,8,9,10-octahydro-10-hydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dien-1-yl)naphtho(1,8a-c)furan-3,5-diyl dibutanoate | |
| terodiline | |
| 2-hydroxy-1-naphthylaldehyde isonicotinoyl hydrazone | |
| Dextroamphetamine | |
| 3-aminobenzanthrone | |
| stepholidine | |
| glyceryl-isoeugenol | |
| Norepinephrine | |
| rosiglitazone-metformin combination | |
| S-methyl N,N-diethylthiolcarbamate sulfoxide | |
| N-alpha-(2-carboxyl)benzoyl-N5-(2-chloro-1-iminoethyl)ornithine amide | |
| deguelin | An isoflavanone that has formula C23H22O6. |
| 7-methyljuglone | |
| hexaconazole | A racemate comprising equimolar amounts of (R)- and (S)-hexaconazole. An agricultural fungicide introduced in the 1980s, it is not approved for use within the European Union. |
| 3,3'-diiodothyronine | An iodothyronine that has formula C15H13I2NO4. |
| perfluoro-n-heptanoic acid | |
| estriol 3-glucuronide | |
| Prenylamine | |
| 2,2-(2-chlorophenyl-4'-chlorophenyl)-1,1-dichloroethene | A diarylmethane that has formula C14H8Cl4. |
| 27-hydroxycholesterol | |
| 3,5,3',4',5'-pentahydroxy-stilbene | |
| 4-hydroxyacetophenone | A monohydroxyacetophenone carrying a hydroxy substituent at position 4'. |
| SMe1EC2 | |
| 3,3-bis(trifluoromethyl)bicyclo(2.2.1)heptane-2,2-dicarbonitrile | |
| dechloroethylifosfamide | |
| L 706000 | |
| 6-(4-hydroxy-3-(trifluoromethyl)phenyl)-1-naphthol | |
| Fluocinolone Acetonide | A fluorinated steroid that is flunisolide in which the hydrogen at position 9 is replaced by fluorine. A corticosteroid with glucocorticoid activity, it is used (both as the anhydrous form and as the dihydrate) in creams, gels and ointments for the treatment of various skin disorders. |
| troglitazone sulfate | |
| Hexobarbital | |
| Kalpaamruthaa | |
| 2-(3-chloro-4-hydroxyphenyl)-2-(4-hydroxyphenyl)propane | |
| Fenoldopam | A benzazepine that has formula C16H16ClNO3. |
| tetralin | An ortho-fused bicyclic hydrocarbon that is 1,2,3,4-tetrahydro derivative of naphthalene. |
| tele-methylhistamine | |
| 1,1-diethyl-2-hydroxy-2-nitrosohydrazine | |
| 1,8-diazafluoren-one | |
| Neurotensin | A polypeptide that has formula C78H121N21O20. |
| turmeric extract | |
| 11,12-epoxy-5,8,14-eicosatrienoic acid | |
| WP 744 | |
| 5-fluoropyrimidine | |
| Microcystins | A family of cyclic heptapeptide hepatotoxins produced by a number of cyanobacteria, the most notable of which is Microcystis, from which the name of the family is derived. Microcystins consist of a heptapeptide macrocycle made up of five non-protein amino acids and two protein amino acids. |
| dieckol | A phlorotannin isolated from a brown alga Ecklonia cava which exhibits antioxidant, hepatoprotective and anticoagulant activities. |
| Acetylglucosamine | |
| Celsior | |
| silicon carbide | An organosilicon compound that has formula CSi. |
| Methadone | A ketone that is heptan-3-one substituted by a dimethylamino group at position 6 and two phenyl groups at position 4. |
| 4-(diethylamino)benzaldehyde | |
| UAMC00132 | |
| 7-(2-(4-(4-nitrobenzene)piperazinyl)ethyl)-1,3-dimethylxanthine | |
| Nitrates | |
| delta-1-piperidine-6-carboxylic acid | |
| allyl methyl disulfide | An organic disulfide having allyl and methyl as the two organic groups. |
| SP 5186 | |
| Estrogens | |
| pyrachlostrobin | |
| glycycoumarin | A member of the class of coumarins that is coumarin substituted by a hydroxy group at position 7, a methoxy group at position 5, a prenyl group at position 6 and a 2,4-dihydroxyphenyl group at position 3. Isolated from Glycyrrhiza uralensis, it exhibits antispasmodic activity. |
| Quinine | A cinchona alkaloid that is cinchonidine in which the hydrogen at the 6-position of the quinoline ring is substituted by methoxy. |
| Polyacetylenes | |
| hexabrominated diphenyl ether 153 | |
| Chlordecone | An organochlorine compound with insecticidal activity. |
| ferumoxtran-10 | |
| vicanicin | |
| chlorethylclonidine | |
| 3-((3-trifluoromethyl)phenyl)-5-((3-carboxyphenyl)methylene)-2-thioxo-4-thiazolidinone | |
| Benzethonium | |
| Levofloxacin | An optically active form of ofloxacin having (S)-configuration; an inhibitor of bacterial topoisomerase IV and DNA gyrase |
| APETx2 protein, Anthopleura elegantissima | |
| Epothilones | Any member of the class of 16-membered macrolide natural products, or their analogues, normally containing a double bond or its epoxide at positions 12-13 and bearing hydroxy groups at positions 4 and 8, methyl groups at positions 5, 5, 7, and 9, an oxo group at position 6, and a 1-(2-substituted-1,3-thiazol-4-yl)prop-1-en-2-yl substituent at position 15. |
| Thymic Factor, Circulating | |
| 4-chloronitrobenzene | A C-nitro compound that has formula C6H4ClNO2. |
| N-acetyl-S-pentachloro-1,3-butadienylcysteine | |
| N-(piperidin-1-yl)-1-(2,4-dichlorophenyl)-1,4-dihydro-6-methylindeno(1,2-c)pyrazole-3-carboxamide | |
| Cephalexin | A semisynthetic first-generation cephalosporin antibiotic having methyl and beta-(2R)-2-amino-2-phenylacetamido groups at the 3- and 7- of the cephem skeleton, respectively. It is effective against both Gram-negative and Gram-positive organisms, and is used for treatment of infections of the skin, respiratory tract and urinary tract. |
| cyclohexylisocyanate | An isocyanate comprising a cyclohexane core with a single isocyanato substituent. |
| sertindole | |
| Quinazolines | Any organic heterobicyclic compound based on a quinazoline skeleton and its substituted derivatives. |
| Mescaline | A phenethylamine alkaloid that is phenethylamine substituted at positions 3, 4 and 5 by methoxy groups. |
| Poly I-C | A mismatched double-stranded RNA with one strand being a polymer of inosinic acid, the other a polymer of cytidylic acid. |
| protamine heparin aggregate | |
| Azides | Any nitrogen molecular entity containing the group -N3. |
| nornicotine | |
| Diuretics | An agent that promotes the excretion of urine through its effects on kidney function. |
| alpha-naphthyl isocyanate | |
| Droperidol | An organofluorine compound that is haloperidol in which the hydroxy group has been eliminated with the introduction of a double bond in the piperidine ring, and the 4-chlorophenyl group has been replaced by a benzimidazol-2-on-1-yl group. It is used in the management of chemotherapy-induced nausea and vomiting, and in conjunction with an opioid analgesic such as fentanyl to maintain the patient in a calm state of neuroleptanalgesia with indifference to surroundings but still able to cooperate with the surgeon. |
| (4-chloro-2-((2-fluoro-5-(propylsulfonyl)phenyl)ethynyl)phenoxy)acetic acid | |
| Apigenin | A trihydroxyflavone that is flavone substituted by hydroxy groups at positions 4', 5 and 7. |
| Zidovudine | A pyrimidine 2',3'-dideoxyribonucleoside compound having a 3'-azido substituent and thymine as the nucleobase. |
| chlorhexidine gluconate | A D-gluconate adduct that has formula C34H54Cl2N10O14. |
| 11-hydroxy-delta(9)-tetrahydrocannabinol | A phytocannabinoid that is Delta(9)-tetrahydrocannabinol in which the methyl group at C-11 has been hydroxylated . Major metabolite of Delta(9)-tetrahydrocannabinol. |
| Uridine Diphosphate Galactose | |
| mitoquinone | |
| Kallidin | A peptide that has formula C56H85N17O12. |
| lumiflavin | A compound showing yellow-green fluorescence, formed by a photolysis of riboflavin in alkaline solution. |
| 3-N-methylspiperone | |
| 2,5-hexanedione | 2,5-hexanedione is an aliphatic diketone. It is a toxic metabolite of hexane and of 2-hexanone |
| glycitin | An isoflavonoid that has formula C22H22O10. |
| Sorbose | A ketohexose often involved in the commercial production of vitamin C. It has been found to occur naturally in grapes. |
| dehydrofelodipine | |
| CAY 10580 | |
| tianeptine | |
| 1-methylxanthine | A monomethylxanthine having the methyl group located at the 1-position. It is a metabolite of caffeine in humans. |
| Granisetron | |
| 6-iodouridine 5'-monophosphate | |
| Phenylthiourea | |
| chromium histidinate | |
| alanylglutamine | |
| mineral trioxide aggregate | |
| aluminum phosphate | |
| 8-bromoguanosino-3',5'-cyclic monophosphorothioate | |
| alantolactone | A sesquiterpene lactone that is 3a,5,6,7,8,8a,9,9a-octahydronaphtho[2,3-b]furan-2-one bearing two methyl substituents at positions 5 and 8a as well as a methylidene substituent at position 3. |
| Heme | A heme is any tetrapyrrolic chelate of iron. |
| Chloranil | |
| exemestane | A 17-oxo steroid that is androsta-1,4-diene-3,17-dione in which the hydrogens at position 6 are replaced by a double bond to a methylene group. A selective inhibitor of the aromatase (oestrogen synthase) system, it is used in the treatment of advanced breast cancer. |
| S-methylisothiopseudouronium | |
| Novobiocin | |
| N-(5-(3-dimethylaminobenzamido)-2-methylphenyl)-4-hydroxybenzamide | |
| Metoprolol | A propanolamine that is 1-(propan-2-ylamino)propan-2-ol substituted by a 4-(2-methoxyethyl)phenoxy group at position 1. |
| Propyl Gallate | |
| BRL 41992 | |
| bepafant | |
| Safflower Oil | |
| mepifiline | |
| alliin | An alpha-amino acid that has formula C6H11NO3S. |
| 3',5'-dimethoxyflavone | |
| Nalidixic Acid | A monocarboxylic acid comprising 1,8-naphthyridin-4-one substituted by carboxylic acid, ethyl and methyl groups at positions 3, 1, and 7, respectively. |
| 12-tungstophosphoric acid | |
| 4-(4-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-quinoxalinyl)-1,3-thiazol-2-yl)benzoic acid | |
| aluminum fluoride | |
| (1-(2-(bis(4-fluorophenyl)methoxy)ethyl)-4-(3-hydroxy-3-phenylpropyl) piperazinyl decanoate) | |
| Phosphorus, Dietary | |
| Idazoxan | An imidazoline that has formula C11H12N2O2. |
| cyprodinil | A member of the class of aminopyrimidine that is N-phenylpyrimidin-2-amine carrying additional cyclopropyl and methyl substituents at positions 4 and 6 respectively. A broad spectrum fungicide used to control a range of pathogens including Tapesia yallundae, Botrytis spp., Alternaria spp. and Rhynchospium secalis. Whilst it is a recognised irritant no serious human health concerns have been identified. It is moderately toxic to birds, most aquatic organisms and earthworms, but is not considered toxic to honeybees. |
| dephostatin | |
| artemisinine | |
| Aroclors | |
| 2-(1'H-indolo-3'-carbonyl)thiazole-4-carboxylic acid methyl ester | |
| thymoglobulin | |
| Palmitates | |
| Phosphorylcholine | |
| meclocycline | |
| 4-nitrophenylacetic acid | A monocarboxylic acid that is phenylacetic acid carrying a nitro substituent at position 4. |
| 6,7-dimethyl-2-(2E)-3-(1-methyl-2-phenyl-1H-pyrrolo(2,3-b)pyridin-3-yl-prop-2-enoyl)-1,2,3,4-tetrahydroisoquinoline hydrochloride | |
| Temefos | |
| loganin | An iridoid monoterpenoid isolated from the plant species of the genus Cornus. |
| 3,6-dihydroxychrysene | |
| Propoxur | A carbamate ester that is phenyl methylcarbamate substituted at position 2 by a propan-2-yloxy group. |
| 3-fluoro-5-(2-(2-(fluoromethyl)thiazol-4-yl)ethynyl)benzonitrile | |
| 111In-DOTA-TOC | |
| caspofungin | |
| pentachlorobenzene | A member of the class of pentachlorobenzenes that is benzene in which five of the hydrogens are replaced by chlorines. Now classed as a persistent organic pollutant under the Stockholm Convention. |
| RU 43044 | |
| Benzenaminium, 4,4'-(3-oxo-1,5-pentanediyl)bis(N,N-dimethyl-N-2-propenyl-), Dibromide | |
| 2-hydroxymethyl-4,8-dihydrobenzo(1,2-b-5,4-b')dithiophene-48-dione | |
| N-(2-(4-hydroxyphenyl)ethyl)-2-(2,5-dimethoxyphenyl)-3-(3-methoxy-4-hydroxyphenyl)acrylamide | |
| bupirimate | A member of the class of aminopyrimidines that is 2-ethylaminopyrimidine carrying methyl, butyl and dimethylaminosulfooxy substituents at posiitons 4, 5 and 6 respectively. |
| carbamylhydrazine | |
| 4'-bromoflavone | |
| 2,2',3,5',6-pentachlorobiphenyl | |
| phenylalanyl corticotropin-releasing factor (12-41) | |
| butylphen | |
| T 1095 | |
| (5-(3-(4-(2-bromo-5-fluorophenoxy)piperidin-1-yl)isoxazol-5-yl)-2H-tetrazol-2-yl)acetic acid | |
| nebicapone | |
| mannosamine | |
| 2,2,5,7,8-pentamethyl-1-hydroxychroman | |
| 5-carboxyfluorescein diacetate | |
| angiotensin III, Ile(7)- | |
| 2-aziridin-1-yl-3-((2-((2-(3-aziridin-1-yl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)thio)ethoxy)ethyl)thio)naphthoquinone | |
| N-((4-(((3-(6-((2-amino-1,3-benzothiazol-4-yl)oxy)pyrimidin-4-yl)) -6-(trifluoromethyl)pyridin-2-yl)amino)methyl)-2-fluorophenyl)methanesulfonamide | |
| ginsenoside Rh1 | |
| iralukast | |
| 3-aminofluoranthene | |
| 5-((2,6-dichlorobenzyl)sulfonyl)-3-((3,5-dimethyl-4-((2-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl)carbonyl)-1H-pyrrol-2-yl)methylene)-1,3-dihydro-2H-indol-2-one | |
| leptomycin B | A leptomycin having a (2E,10E,12E,16Z,18E)-double bond configuration as well as an ethyl substituent at position 17. |
| Glucose-6-Phosphate | |
| maleimide | A cyclic dicarboximide in which the two carboacyl groups on nitrogen together with the nitogen itself form a 1H-pyrrole-2,5-dione structure. |
| pregnenolone 16-acetonitrile | |
| 6-Mercaptopurine | |
| VRT 532 | |
| Y134 compound | |
| Molybdenum | A chromium group element atom that has formula Mo. |
| phenothrin | |
| Teniposide | |
| 3-(2-(dimethylamino)isopropoxy)-1-hydroxybenzo(b)naphtho(2,3-d)furan-6,11-dione | |
| pirimicarb | An aminopyrimidine that is N,N,4,5-tetramethylpyrimidin-2-amine substituted by a (dimethylcarbamoyl)oxy group at position 4. |
| anilofos | An anilide that has formula C13H19ClNO3PS2. |
| ado-trastuzumab emtansine | |
| 1-menaphthyl sulfate | |
| bicalutamide | A sulfone that is an oral non-steroidal antiandrogen used in the treatment of prostate cancer and hirsutism. |
| 2-(4-toluidino)-6-naphthalenesulfonic acid | |
| Anticonvulsants | A drug used to prevent seizures or reduce their severity. |
| arabitol | A pentitol that is the sugar alcohol produced by the reduction of arabinose or lyxose. It is found in serum or urine of human infected with Candida albicans. |
| candesartan | A benzimidazolecarboxylic acid that is 1H-benzimidazole-7-carboxylic acid substituted by an ethoxy group at position 2 and a ({2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl}methyl) group at position 1. It is a angiotensin receptor antagonist used for the treatment of hypertension. |
| bucillamine | |
| tetrachlorodian | |
| alitretinoin | |
| tanoproget | |
| 5-nitro-2-(3-phenylpropylamino)benzoic acid | A nitrobenzoic acid that has formula C16H16N2O4. |
| 17-hydroxy-4,7,10,13,15,19-docosahexaenoic acid | |
| cryptolepine | An organic heterotetracyclic compound that is 5H-indolo[3,2-b]quinoline in which the hydrogen at position N-5 is replaced by a methyl group. |
| ceftibuten | |
| rubiadin | A dihydroxyanthraquinone that is anthracene-9,10-dione substituted by hydroxy groups at positions 1 and 3 and a methyl group at position 2. It has been isolated from Rubia yunnanensis. |
| arecaidine | A citraconoyl group that has formula C7H11NO2. |
| trichostatin A | A trichostatin that has formula C17H22N2O3. |
| (4-amino-1,4-dihydro-3-(2-pyridyl)-5-thioxo-1,2,4-triazole)copper(II) | |
| 2-amino-3-methylimidazo(4,5-f)quinoline | |
| 1H,1H,2H,2H-perfluorodecanol | |
| ribose-5-phosphate | |
| Flurazepam | |
| 4,5-dimethoxy-2-nitrobenzyl-8-bromo-cAMP | |
| lingzhi | |
| dabrafenib | An organofluorine compound and antineoplastic agent, used as its mesylate salt in treatment of metastatic melanoma. |
| 2,2',4,4',5,5'-hexabrominated diphenyl ether | |
| AL 8810 | |
| 2-nitrophenol | A mononitrophenol having the nitro group at the 2-position. |
| astaxanthine | |
| protein kinase inhibitor peptide | |
| (gamma-CyD)2 C60 | |
| N-(4-(1-benzoylpiperidin-4-yl)butyl)-3-(pyridin-3-yl)acrylamide | |
| hexabromocyclododecane | |
| 3-(4-(4-((1-(2-chlorophenyl)ethoxy)carbonyl amino)-3-methyl-5-isoxazolyl) benzylsulfanyl) propanoic acid | |
| cicaprost | |
| GW 9578 | |
| alogliptin | A piperidine that is 3-methyl-2,4-dioxo-3,4-dihydropyrimidine carrying additional 2-cyanobenzyl and 3-aminopiperidin-1-yl groups at positions 1 and 2 respectively (the R-enantiomer). Used in the form of its benzoate salt for treatment of type 2 diabetes. |
| amosulalol | |
| RV09 compound | |
| 1-(4-hydroxyiminomethylpyridinium)-4-(4-carbamoylpyridinium)butane | |
| sargachromanol G | |
| 3-DOXYLANDROSTANOL | |
| N'-(2-phenylallyl)hydrazine | |
| Succimer | |
| Phenylisopropyladenosine | |
| Melanins | |
| etomoxir | |
| 1-(5-chloro-1-((2,4-dimethoxyphenyl)sulfonyl)-3-(2-methoxyphenyl)-2-oxo-2,3-dihydro-1H-indol-3-yl)-4-hydroxy-N,N-dimethyl-2-pyrrolidinecarboxamide | |
| chelidonine | An alkaloid fundamental parent that has formula C20H19NO5. |
| 2-butanol | |
| Amaranth Dye | |
| 3,3',4,4',5,5'-hexahydroxystilbene | |
| WR 33278 | |
| bromochloroacetic acid | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is replaced by bromine while a second is replaced by chlorine. A low-melting (27.5-31.5degreeC), hygroscopic crystalline solid, it can be formed during the disinfection (by chlorination) of water that contains bromide ions and organic matter, so can occur in drinking water as a byproduct of the disinfection process. |
| Ammonium Sulfate | |
| Melanocyte-Stimulating Hormones | |
| 2-(2-hydroxyethylsulfanyl)-3-methyl-1,4-naphthoquinone | |
| Org 41841 | |
| 1-Naphthylisothiocyanate | An isothiocyanate that has formula C11H7NS. |
| Oleanolic Acid | A pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3. |
| apomine | |
| Phthalic Acids | |
| S-tetradecanoyl-coenzyme A | |
| 4-(4-cyclohexyl-2-methyloxazol-5-yl)-2-fluorobenzenesulfonamide | |
| N-(1-phenylcyclohexyl)-3-ethoxypropanamine | |
| cholyl-lysylfluorescein | |
| Acetoin | A methyl ketone that has formula C4H8O2. |
| LL-202 | |
| Poloxamer | |
| Chlorfenvinphos | |
| oxatomide | |
| 4-coumaric acid | A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring. |
| Carbohydrates | Any member of the class of organooxygen compounds that is a polyhydroxy-aldehyde or -ketone or a lactol resulting from their intramolecular condensation (monosaccharides); substances derived from these by reduction of the carbonyl group (alditols), by oxidation of one or more hydroxy groups to afford the corresponding aldehydes, ketones, or carboxylic acids, or by replacement of one or more hydroxy group(s) by a hydrogen atom; and polymeric products arising by intermolecular acetal formation between two or more such molecules (disaccharides, polysaccharides and oligosaccharides). Carbohydrates contain only carbon, hydrogen and oxygen atoms; prior to any oxidation or reduction, most have the empirical formula Cm(H2O)n. Compounds obtained from carbohydrates by substitution, etc., are known as carbohydrate derivatives and may contain other elements. Cyclitols are generally not regarded as carbohydrates. |
| Fluorodeoxyglucose F18 | |
| ethotoin | |
| aliskiren | |
| isoprene | A hemiterpene with the formula CH2=C(CH3)CH=CH2; the monomer of natural rubber and a common structure motif to the isoprenoids, a large class of other naturally occurring compounds. |
| perfluoro-n-undecanoic acid | |
| palmatine | A berberine alkaloid that has formula C21H22NO4. |
| PD 150606 | |
| N(6)-cyclohexyladenosine | |
| Oxidants | A substance that removes electrons from another reactant in a redox reaction. |
| clophen A60 | |
| methyl isobutyl ketone | A ketone that has formula C6H12O. |
| Oligomycins | Any of the 26-membered ring macrolides produced by Streptomyces species that can be toxic to other organisms through their ability to inhibit mitochondrial membrane-bound ATP synthases. |
| enkephalin, Ser(2), Leu(5), Thr(6)- | |
| Cyclodecanes | |
| Dihydroergotamine | Ergotamine in which a single bond replaces the double bond between positions 9 and 10. A semisynthetic ergot alkaloid with weaker oxytocic and vasoconstrictor properties than ergotamine, it is used (as the methanesulfonic or tartaric acid salts) for the treatment of migraine and orthostatic hypotension. |
| Sorbic Acid | A hexadienoic acid with double bonds at C-2 and C-4; it has four geometrical isomers, of which the trans,trans-form is naturally occurring. |
| fructose 2,6-diphosphate | |
| Lindane | |
| PCI 32765 | |
| Ethylketocyclazocine | A tetralin that has formula C19H25NO2. |
| chloroxylenol | |
| alclometasone dipropionate | A prednisolone compound having an alpha-chloro substituent at the 7-position, an alpha-methyl substituent at the 16-position and O-propanoyl groups at the 17- and 21-positions. |
| acadesine | A 1-ribosylimidazolecarboxamide in which the carboxamide group is situated at position 4 of the imidazole ring, which is further substituted at position 5 by an amino group. A purine nucleoside analogue and activator of AMP-activated protein kinase, it is is used for the treatment of acute lymphoblastic leukemia and is reported to have cardioprotective effects. |
| SB 273005 | |
| lenalidomide | |
| 3-(2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl)phenol | |
| FLLL 31 | |
| FLLL 32 | |
| beta-carboline-3-carboxylic acid methyl ester | |
| Cimetidine | A member of the class of guanidines that consists of guanidine carrying a methyl substituent at position 1, a cyano group at position 2 and a 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl group at position 3. It is a H2-receptor antagonist that inhibits the production of acid in stomach. |
| dabigatran etexilate | |
| stanolone benzoate | A steroid ester that has formula C26H34O3. |
| 2-octenal | |
| (N-N'-bis-(2-(1H-indol-3-yl)-ethyl)-N,N'-bis-(3-thiomorpholin-4-yl-propyl)-phthalamide) | |
| Glycogen | A polydisperse, highly branched glucan composed of chains of D-glucopyranose residues in alpha(1->4) glycosidic linkage, joined together by alpha(1->6) glycosidic linkages. A small number of alpha(1->3) glycosidic linkages and some cumulative alpha(1->6) links also may occur. The branches in glycogen typically contain 8 to 12 glucose residues. |
| N-(2-(2-(4-(4-(2-hydroxypropyl)piperazin-1-yl)-2-methoxyphenylamino)pyrrolo(2,1-f)(1,2,4)triazin-7-yl)phenyl)-N-methylmethanesulfonamide | |
| Saponins | A glycoside that is a compound containing one or more hydrophilic glycoside moieties combined with a lipophilic triterpenoid or steroid derivative. Found in particular abundance in plant species. |
| racecadotril | |
| 1-(methanesulfonamido-1-naphthyloxy)-2-(N-(4-methane sulfonamidophenethyl)-N-acetamido)ethane | |
| NSC606985 | |
| Cladribine | 2'-Deoxyadenosine in which the hydrogen at position 2 on the purine ring has been substituted by chlorine. It inhibits the synthesis and repair of DNA, particularly in lymphocytes and monocytes, and is used as an antimetabolite antineoplastic drug for the treatment of lymphoid malignancies including hairy-cell leukaemia and chronic lymphocytic leukaemia. |
| 5-hydroxy-6,8,11,14-eicosatetraenoic acid | |
| Bleomycin | A glycopeptide antibiotic produced by the bacterium Streptomyces verticillus. The term, 'bleomycin' refers to a family of structurally related compounds. When used as an anti-cancer agent, the chemotherapeutical forms are primarily bleomycin A2 and B2. |
| 2,2,2-trichloroethanol | A chloroethanol that has formula C2H3Cl3O. |
| 1-(3-(5-(1,2,4-triazol-4-yl)-1H-indol-3-yl)propyl)-4-(2-(3-fluorophenyl)ethyl)piperazine | |
| Pipecuronium | |
| LM-1685 | An indolyl carboxylate ester that is methyl 1H-indole-2-carboxylate substituted by a 4-chlorobenzyl group at position 1 and a methylsulfonyl group at position 5. It acts as a selective inhibitor of cyclooxygenase 2. |
| nectandrin-B | |
| 1,5-anhydrofructose | |
| benzoylcarbonyl-valyl-aspartyl-valyl-alanyl-aspartyl-fluoromethyl ketone | |
| difructose anhydride III | |
| Sarin | A racemate composed of equal amounts of (R)- and (S)-sarin. A potent and irreversible inhibitor of acetylcholinesterase that is toxic to the nervous system and is employed as a chemical warfare agent. |
| Polystyrenes | |
| retigeric acid B | |
| Gallamine Triethiodide | |
| Malonyl Coenzyme A | |
| 5-(4-dimethylaminobenzoyl)-aminovaleric acid hydroxamate | |
| CAY10506 | |
| Cytidine Diphosphate Diglycerides | |
| dicholesteroyl diselenide | |
| Pregnanes | |
| Isradipine | |
| eperisone | A racemate that is an equimolar mixture of (R)- and (S)-eperisone. It is used (as the hydrochloride salt) as a muscle relaxant for the symptomatic treatment of muscle spasm and spasticity. |
| hexamethylene bisacetamide | |
| oxadiazon | An aromatic ether that has formula C15H18Cl2N2O3. |
| tetrahydrodaidzein | |
| dodecyl sulfate | |
| 5-chloromethylfluorescein | An acetate ester that has formula C25H17ClO7. |
| epsilon-viniferin | |
| benz(j)aceanthrylene | A phenanthrene that has formula C20H12. |
| cyclohexyl carbamic acid 3'-carbamoylbiphenyl-3-yl ester | |
| BIX 01294 | |
| 2-morpholin-4-yl-6-thianthren-1-yl-pyran-4-one | |
| K127 compound | |
| 18-oxocortisol | |
| 3,5-dichlorobenzidine | |
| DLBS 1425 | |
| Ku 0063794 | |
| formetanate | A carbamate ester that has formula C11H15N3O2. |
| Flavin Mononucleotide | |
| Cefoperazone | |
| Barium | |
| hispidin | Fungal metabolite first found in basidiomycete Inonotus hispidus (formerly Polyporus hispidus). |
| nomegestrol | |
| Angiotensin II Type 1 Receptor Blockers | |
| lemon oil | |
| cilostazol | A lactam that is 3,4-dihydroquinolin-2(1H)-one in which the hydrogen at position 6 is substiuted by a 4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy group. |
| Iodoacetamide | |
| phenylglycidol | |
| 2'-(4-chlorophenyl)-3-(4-chlorophenylidene)-5,10-dimethyl-12-methylene-decahydro-1,2-(1',3'-dioxocyclopenta(c))azuleno(4,5-b)furan-4,11-dione | |
| LR-90 | |
| Dietary Fats | |
| Pyridines | Any organonitrogen heterocyclic compound based on a pyridine skeleton and its substituted derivatives. |
| DDT | A chlorophenylethane that is 1,1,1-trichloro-2,2-diphenylethane substituted by additional chloro substituents at positions 4 of the phenyl substituents. It is a commonly used organochlorine insecticide. |
| Antirheumatic Agents | |
| DuP 697 | A thiophene that has formula C17H12BrFO2S2. |
| 2-chloroethyl isocyanate | |
| dibenzoylmethane | A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
| Benzylamines | |
| phenylsaligenin cyclic phosphate | |
| JYL 1421 | |
| 2-allylphenol | A member of the class of phenols that is phenol carrying an allyl group at position 2. |
| 1,3,5-tris(4-hydroxyphenyl)-4-propyl-1H-pyrazole | |
| tiotidine | |
| tempol | |
| T 614 | |
| alpha 1-Antitrypsin | |
| Anti-Inflammatory Agents, Non-Steroidal | |
| methanethiosulfonate ethylammonium | |
| Acetates | Any carboxylic ester where the carboxylic acid component is acetic acid. |
| butyl-methoxydibenzoylmethane | |
| leiurotoxin I | |
| arsenic trioxide | |
| bioresmethrin | A resmethrin that has formula C22H26O3. |
| picoxystrobin | An enoate ester that is the methyl ester of (2E)-3-methoxy-2-[2-({[6-(trifluoromethyl)pyridin-2-yl]oxy}methyl)phenyl]prop-2-enoic acid. A cereal fungicide used to control a wide range of diseases including brown rust, tan spot, powdery mildew and net blotch. |
| Midazolam | |
| 2-methyl-1-propenylbenzoate | |
| pimagedine | |
| Taurochenodeoxycholic Acid | A bile acid taurine conjugate of chenodeoxycholic acid. |
| S-methyl glutathione | |
| 1,2-dilauroylphosphatidylcholine | |
| Rodenticides | A substance used to destroy rodent pests. |
| Cyanides | Salts and C-organyl derivatives of hydrogen cyanide, HC#N. |
| bis(4-nitrophenyl)phosphate | An aryl phosphate that has formula C12H9N2O8P. |
| Methylcholanthrene | |
| L 748706 | |
| 5-(3-chlorophenylamino)benzo(c)(2,6)naphthyridine-8-carboxylic acid | |
| methyl cellosolve | |
| 1-hydroxymethylpyrene | |
| kojic acid | A pyranone that is 4H-pyran substituted by a hydroxy group at position 5, a hydroxymethyl group at position 2 and an oxo group at position 4. It has been isolated from the fungus Aspergillus oryzae. |
| 6-(4-chlorophenyl)imidazo(2,1-b)(1,3)thiazole-5-carbaldehyde O-(3,4-dichlorobenzyl)oxime | An imidazothiazole that has formula C19H12Cl3N3OS. |
| 6(hydroxymethyl)-1,4-anthracenedione | |
| epomediol | |
| Phenols | Organic aromatic compounds having one or more hydroxy groups attached to a benzene or other arene ring. |
| 1-(2-(diphenylmethoxy)ethyl)-4-(3-phenyl-2-propenyl)piperazine | |
| Nicotine | An N-alkylpyrrolidine that consists of N-methylpyrrolidine bearing a pyridin-3-yl substituent at position 2. It has been isolated from Nicotiana tabacum. |
| 3-dihydroxy-6-methyl-7-(phenylmethyl)-4-propylnaphthalene-1-carboxylic acid | |
| guggulu extract | |
| liraglutide | |
| Thioglycolates | |
| RS 39604 | An aromatic ether that is the 3,5-dimethoxybenzyl derivative of N-(2-{4-[3-(4-amino-5-chloro-2-hydroxyphenyl)-3-oxopropyl]piperidin-1-yl}ethyl)methanesulfonamide. A potent and selective 5-HT4 antagonist, with a pKi of 9.1 at 5-HT4 receptors in guinea pig striatal membranes and greater than 1000-fold selectivity over 5-HT1A, 2C, 3 and D1, D2, M1, M2, AT1, B1 and alpha1C receptors. The ketone group gives RS 39604 a relatively long half life; it is also orally active and so suitable for in vivo studies. |
| 14,15-epoxy-5,8,11-eicosatrienoic acid | |
| isopimpinellin | A psoralen that has formula C13H10O5. |
| ioversol | |
| enzacamene | |
| Cobalt | A cobalt group element atom that has formula Co. |
| SB 203580 | |
| Mineralocorticoids | Mineralocorticoids are a class of steroid hormones that regulate water and electrolyte metabolism. |
| Ibuprofen | A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group. |
| Naphazoline | |
| Trifluoperazine | A member of the class of phenothiazines that is phenothiazine having a trifluoromethyl subsitituent at the 2-position and a 3-(4-methylpiperazin-1-yl)propyl group at the N-10 position. |
| 3,4-dichloropropionanilide | |
| Celiprolol | |
| 3,3'-diindolylmethane | An indole that has formula C17H14N2. |
| Ioxaglic Acid | A benzenedicarboxamide compound having N-substituted carbamoyl groups at the 1- and 3-positions, iodo substituents at the 2-, 4- and 6-positions and an acetyl(methyl)amino group at the 5-position. |
| Mebendazole | A carbamate ester that is methyl 1H-benzimidazol-2-ylcarbamate substituted by a benzoyl group at position 5. |
| fumarylacetone | |
| Norethindrone | |
| allyl sulfide | |
| Thiethylperazine | |
| Furazolidone | |
| Acetoxyacetylaminofluorene | |
| Zinc Compounds | |
| N-(6-methylamino-3-nitrophenyl)-3-(3-indolyl)acrylamide | |
| pridinol | |
| ZK159222 | |
| Nimodipine | A dihydropyridine that is 1,4-dihydropyridine which is substituted by methyl groups at positions 2 and 6, a (2-methoxyethoxy)carbonyl group at position 3, a m-nitrophenyl group at position 4, and an isopropoxycarbonyl group at position 5. An L-type calcium channel blocker, it acts particularly on cerebral circulation, and is used both orally and intravenously for the prevention and treatment of subarachnoid hemorrhage from ruptured intracranial aneurysm. |
| dimethyl fumarate | An enoate ester resulting from the formal condensation of both carboxy groups of fumaric acid with methanol. Used for treatment of adults with relapsing forms of multiple sclerosis. |
| Lipopolysaccharides | |
| Fosfomycin | |
| Gonadotropins, Equine | |
| 1-(2-hydroxyethyl)-1-nitrosourea | |
| tert-butyl beta-carboline-3-carboxylate | |
| moxonidine | |
| amlexanox | |
| Receptors, IgG | |
| ponalrestat | |
| Receptors, IgE | |
| Potassium Dichromate | A potassium salt that is the dipotassium salt of dichromic acid. |
| 1,2,3,5-tetrachlorobenzene | A tetrachlorobenzene carrying chloro groups at positions 1, 2, 3 and 5. |
| dexchlorpheniramine | A chlorphenamine that has formula C16H19ClN2. |
| ammonium ferric sulfate | |
| Snake Venoms | |
| ajoene | |
| MR 2266 | |
| diphenyleneiodonium | |
| 2,5,2',5'-tetrachlorobiphenyl | |
| olanzapine | A benzodiazepine that has formula C17H20N4S. |
| 2-amino-4-hydroxymethyl-3,8-dimethylimidazo(4,5-f)quinoxaline | |
| Chondroitin Sulfates | |
| Mersalyl | |
| hydroxyflutamide | An anilide that has formula C11H11F3N2O4. |
| isoborneol glucuronide | |
| octylmethoxycinnamate | |
| Fluorometholone | A member of the class of glucocorticoids that is Delta(1)-progesterone substituted at positions 11beta and 17 by hydroxy groups, at position 6alpha by a methyl group and at position 9 by a fluoro group. Used for the treatment of corticosteroid-responsive inflammation of the palpebral and bulbar conjunctiva, cornea and anterior segment of the globe. |
| BQ 610 | |
| sapropterin | |
| Dicyclohexylcarbodiimide | |
| CGS 27023A | |
| tetrachloroethane | |
| Congo Red | An indicator dye that is blue-violet at pH 3.0 and red at pH 5.0. |
| Tetracycline | A broad-spectrum polyketide antibiotic produced by the Streptomyces genus of actinobacteria. |
| Ibogaine | A monoterpenoid indole alkaloid that has formula C20H26N2O. |
| cuprous chloride | |
| Netilmicin | |
| N-alpha-(2-carboxyl)benzoyl-N5-(2-fluoro-1-iminoethyl)ornithine amide | |
| propiverine | |
| 2,5-dichloro-3-(glutathionyl-S-yl)-1,4-benzoquinone | |
| taxane | A diterpene that has formula C20H36. |
| S-Nitrosoglutathione | A glutathione derivative that has formula C10H16N4O7S. |
| necrostatin-1 | |
| Neurotoxins | A poison that interferes with the functions of the nervous system. |
| Ceruletide | A decapeptide comprising 5-oxoprolyl, glutamyl, aspartyl, O-sulfotyrosyl, threonyl, glycyl, tryptopyl, methionyl, aspartyl and phenylalaninamide residues in sequence. Found in the skins of certain Australian amphibians, it is an analogue of the gastrointestinal peptide hormone cholecystokinin and stimulates gastric, biliary, and pancreatic secretion. It is used in cases of paralysis of the intestine (paralytic ileus) and as a diagnostic aid in pancreatic malfunction. |
| sulprostone | |
| GW8510 | |
| hexabromobenzene | |
| Benzo(a)pyrene | An ortho- and peri-fused polycyclic arene consisting of five fused benzene rings. |
| N-(1-ethyl-1-(4-methylphenyl)propyl)-7,7-dimethyl-5-phenyl-4,5,6,7-tetrahydropyrazolo(1,5-a)pyrimidine-3-carboxamide | |
| cisplatin-deoxy(guanosine monophosphate guanosine) adduct | |
| Metals, Heavy | |
| Magnesium | |
| cresidine | |
| neoechinulin A | An organic molecular entity that has formula C19H29N3O2. |
| 5-oxo-6,8,11,14-eicosatetraenoic acid | |
| benzotriphenylene | A carbopolycyclic compound that has formula C22H14. |
| 2-methoxyestradiol | |
| S-(1,1,2,2-tetrafluoroethyl)cysteine | |
| CGP 71872 | |
| enrasentan | |
| Penicillin G | |
| 3,4-dihydro-5-(4-(1-piperidinyl)butoxy)-1(2H)-isoquinolinone | |
| angelicin | A furanocoumarin that has formula C11H6O3. |
| ferrous sulfate | |
| Sulfadimethoxine | |
| bromfenvinphos | |
| Digoxin | Digitoxin beta-hydroxylated at C-12. A cardiac glycoside extracted from the foxglove plant, Digitalis lanata, it is used to control ventricular rate in atrial fibrillation and in the management of congestive heart failure with atrial fibrillation, but the margin between toxic and therapeutic doses is small. |
| Penicillin V | |
| Pyocyanine | A phenazine that has formula C13H12N2O. |
| Kerosene | |
| dichlorido-zinc(II)-4-(2-(5-methoxybenzylideneamino)ethyl)piperazin-1-iumphenolate | |
| 2,2',4,4'-tetrahydroxybenzophenone | |
| BBR3610 | |
| N-(1-methyl-2-oxo-1,2,3,4-tetrahydro-7-quinolyl)-2-((2-methylpyrrolidin-1-yl)methyl)biphenyl-4-carboxamide | |
| lard | |
| Cholesterol, Dietary | |
| Aminopyrine | |
| N-(4-hydroxy-3-methoxybenzyl)-7-hydroxy-8-methyl-5-nonenamide | |
| 7,8-Dihydro-7,8-dihydroxybenzo(a)pyrene 9,10-oxide | |
| bradykinin, Leu(8)-des-Arg(9)- | |
| imetit | An imidothiocarbamic ester that consists of isothiourea in which the thiol hydrogen is substituted by a 2-(imidazol-4-yl)ethyl group. An extremely potent, high affinity agonist at H3 and H4 receptors (Ki values are 0.3 and 2.7 nM respectively). Induces shape change in eosinophils with an EC50 of 25 nM. Centrally active following systemic administration. |
| Fluoroacetates | |
| gold cyanide | |
| 2,5-di-tert-butylhydroquinone | |
| 2,6-diisocyanatotoluene | |
| NRA 0045 | |
| glutapyrone | |
| SR140333B | |
| flutolanil | A member of the class of benzamides, obtained by formal condensation of the carboxy group of 2-(trifluoromethyl)benzoic acid with the amino group of 3-(ispropyloxy)aniline. A fungicide used to control a range of pathogens especially Rhizoctonia spp. on rice, turf and other crops. |
| imazamox | A racemate composed of equimolar amounts of (S)- and (R)-imazamox. |
| benzo-1,2,3-thiadiazole | |
| sodium arsenate | An inorganic sodium salt composed from sodium cations and arsenate anions in a 3:1 ratio. |
| Gold Sodium Thiosulfate | |
| imperatorin | A member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 8. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. |
| staphylococcal alpha-toxin | |
| alpha-(4-fluorophenyl)-4-(5-fluoro-2-pyrimidinyl)-1-piperazine butanol | |
| 3-methyl-9-(2-oxa-2lambda(5)-2H-1,3,2-oxazaphosphorine-2-cyclohexyl)-3,6,9-triazaspiro(5.5)undecane | |
| Tetramethylphenylenediamine | |
| oleylamide | |
| Biliverdine | |
| succinylmonocholine | |
| Reserpine | An alkaloid found in the roots of Rauwolfia serpentina and R. vomitoria. |
| Porphyrins | Natural pigments containing a fundamental skeleton of four pyrrole nuclei united through the alpha-positions by four methine groups to form a macrocyclic structure. |
| ragaglitazar | |
| beta-Glucans | |
| BIIE 0246 | |
| artemisic acid | |
| plaunotol | A primary alcohol that has formula C20H34O2. |
| hypaconitine | A diterpenoid that has formula C33H45NO10. |
| Aziridines | |
| dazoxiben | |
| methylglucoside | |
| Glycosides | A glycosyl compound resulting from the attachment of a glycosyl group to a non-acyl group RO-, RS-, RSe-, etc. The bond between the glycosyl group and the non-acyl group is called a glycosidic bond. By extension, the terms N-glycosides and C-glycosides are used as class names for glycosylamines and for compounds having a glycosyl group attached to a hydrocarbyl group respectively. These terms are misnomers and should not be used. The preferred terms are glycosylamines and C-glycosyl compounds, respectively. |
| FR 180204 | |
| Iodates | Any salt that has chlorate, [IO3](-), as the anionic component. |
| eriodictyol | A tetrahydroxyflavanone that is flavanone substituted by hydroxy groups at positions 5, 7, 3' and 4' respectively. |
| Betaxolol | A propanolamine that is 3-aminopropane-1,2-diol in which the hydrogen of the primary hydoxy is substituted by a 4-[2-(cyclopropylmethoxy)ethyl]phenyl group and one of the hydrogens attached to the amino group is substituted by isopropyl. It is a selective beta1-receptor blocker and is used in the treatment of glaucoma as well as hypertension, arrhythmias, and coronary heart disease. It is also used to reduce non-fatal cardiac events in patients with heart failure. |
| cannabidiol dimethyl ether | |
| bornyl caffeate | |
| 2-(2,6-diisopropylphenyl)-5-hydroxy-1H-isoindole-1,3-dione | |
| N,N'-diphenyl-4-phenylenediamine | |
| sodium chromate(VI) | |
| MK 6892 | |
| aranidipine | |
| capseal II | |
| Galanin | |
| Soot | |
| stallimycin | |
| carbosulfan | A 1-benzofuran that has formula C20H32N2O3S. |
| Endrin | An oxacycle that has formula C12H8Cl6O. |
| Salts | |
| 8-sulfocholecystokinin octapeptide | |
| 5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-1-hydroxymethyl-6,8-dioxabicyclo(3.2.1)octane-2,3,4-triol | |
| 1,25-dihydroxyvitamin D | |
| 3-(4-Amino-5-cyclopropylpyrimidine-2-yl)-1-(2-fluorobenzyl)-1H-pyrazolo(3,4-b)pyridine | |
| glycine propionyl carnitine | |
| SB 22489G | |
| Ethylene Glycol | |
| thiazovivin | |
| 7,12-dimethylbenz(a)anthracene-DNA adduct | |
| dynorphin A-(1-11)-NH2, Nalpha-benzylTyr(1)-cyclo(Asp(5)-Dap(8))- | |
| flunixin | |
| octamethylcyclotetrasiloxane | A cyclosiloxane that is the octamethyl derivative of cyclotetrasiloxane. |
| allyl methyl sulfide | |
| corticotropin releasing hormone (9-41) | |
| MEN 11420 | |
| 4-(4-((2',3',4',6'-tetra-O-acetylglucopyranosyl)thiomethyl)-5-iodo-1-H-1,2,3-triazol-1-yl)benzenesulfonamide | |
| 1-nitrosopyrene | |
| BU 224 | |
| 1-palmitoyl-2-(5-oxovaleroyl)phosphatidylcholine | |
| bovine serum albumin-corticosterone conjugate | |
| ((Py-3')TPP-Ru(phen)2Cl)Cl | |
| SP 303 | |
| phosphatidylbutanol | |
| barium chloride | The inorganic dichloride salt of barium. |
| 6-Aminonicotinamide | A monocarboxylic acid amide resulting from the formal condensation of the carboxy group of 6-aminonicotinic acid with ammonia. An inhibitor of the NADP(+)-dependent enzyme, 6-phosphogluconate dehydrogenase, it interferes with glycolysis, resulting in ATP depletion and synergizes with DNA-crosslinking chemotherapy drugs, such as cisplatin, in killing cancer cells. |
| MK2i peptide | |
| 8-isoprostaglandin A2 | |
| L 748,337 | |
| Dinoprostone | |
| scutellarein | Flavone substituted with hydroxy groups at C-4', -5, -6 and -7. |
| perillic acid | A cyclohexenecarboxylic acid that has formula C10H14O2. |
| Gur | |
| bis(maltolato)oxovanadium(IV) | |
| 8-dibenzothiophen-4-yl-2-morpholin-4-yl-chromen-4-one | |
| 4-(3-Butoxy-4-methoxybenzyl)-2-imidazolidinone | |
| Nevirapine | |
| 5,5-dimethyl-1-pyrroline-1-oxide | |
| 4-nitrososulfamethoxazole | |
| BW 175 | |
| 1-(2-chlorobenzyl)-5'-phenyl-3'H-spiro(indoline-3,2'-(1,3,4)thiadiazol)-2-one | |
| aroclor 1242 | |
| GR 218231 | |
| N-(3-phenoxycinnamyl)acetohydroxamic acid | |
| arginyl-glycyl-aspartic acid | |
| norfenefrine | |
| N-(2-acetyl-4,6-dimethylphenyl)-3-(3,4-dimethylisoxazol-5-ylsulfamoyl)thiophene-2-carboxamide | |
| Ritodrine | |
| 2-(3'-methoxyphenyl)-6-pyrrolidinyl-4-quinazolinone | |
| zotepine | |
| Cilomilast | |
| dibenzo(a,l)pyrene 11,12-dihydrodiol | |
| Orphenadrine | A tertiary amino compound which is the phenyl-o-tolylmethyl ether of 2-(dimethylamino)ethanol. |
| Selenocysteine | An alpha-amino acid that consists of alanine where one of the methyl hydrogens is substituted with a seleno group. |
| 2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane | |
| Alcuronium | |
| poly-N-acetyllactosamine | An aminoglycan composed of a backbone of N-acetyllactosamine repeating units that are joined to each other via beta-(1->3)-linkages. |
| N-caproylsphingosine | |
| 2-amino-3,4-dimethylimidazo(4,5-f)quinoline | An aminoquinoline that has formula C12H12N4. |
| benzothiazole | An organic heterobicyclic compound that is a fusion product between benzene and thiazole. The parent of the class of benzothiazoles. |
| Medroxyprogesterone Acetate | A steroid ester that has formula C24H34O4. |
| 2-((3-((2-(4-chlorophenyl)-5-methyloxazol-4-yl)methoxy)benzyl)(methoxycarbonyl)amino)acetic acid | |
| octanoylcarnitine | |
| AG 494 | |
| Tropolone | A cyclic ketone that has formula C7H6O2. |
| 5-((5-fluoro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide | |
| Iopanoic Acid | |
| Betaine | |
| leucine sarcolysine | |
| 4-(benzo(b)thiophen-2-yl)-3-bromo-5-hydroxydihydrofuran-2(3H)-one | |
| talipexole | |
| 4-carboxyphenylglycine | |
| quercetin 3-acetyl-7,3',4'-trisulfate | |
| Thymine | A pyrimidine nucleobase that is uracil in which the hydrogen at position 5 is replaced by a methyl group. |
| Tramadol | |
| KRN 7000 | |
| 4-Aminopyridine | An aromatic amine that is pyridine bearing a single amino substituent at position 4. An orphan drug in the US, it is used to improve walking in adults with multiple sclerosis. |
| grepafloxacin | |
| 2-methyl-5-HT | |
| bacoside A | |
| acifluorfen-methyl | |
| ethinyl estradiol-desogestrel combination | |
| Chlorophenols | A halophenol that is any phenol containing one or more covalently bonded chlorine atoms. |
| Procainamide | 4-Aminobenzamide substituted on the amide N by a 2-(diethylamino)ethyl group. It is a pharmaceutical antiarrhythmic agent used for the medical treatment of cardiac arrhythmias. |
| xanthoangelol | |
| Ubiquinone Q2 | |
| Ubiquinone Q1 | |
| 5,6-epoxy-8,11,14-eicosatrienoic acid | |
| 5-hydroxypropranolol | |
| candesartan cilexetil | A biphenyl that has formula C33H34N6O6. |
| 8-epi-prostaglandin F2alpha | A prostanoid that is prostaglandin F2alpha having inverted stereochemistry at the 8-position. |
| PIK 75 | |
| ezogabine | |
| Akt-I-1,2 compound | |
| Thienopyridines | |
| Nedocromil | |
| Calcium Chloride | A calcium salt that has formula CaCl2. |
| lead acetate | |
| halazone | |
| Aporphines | |
| cupric chloride | |
| E-2-(4'-methoxybenzylidene)-benzusuberone | |
| fulvestrant | |
| Pyruvic Acid | A 2-oxo monocarboxylic acid that is the 2-keto derivative of propionic acid. It is a metabolite obtained during glycolysis. |
| 4-nitrosobiphenyl | |
| 24,25-epoxycholesterol | |
| conduritol epoxide | An epoxide resulting from the epoxidation of the double bond of a conduritol. |
| KB R8301 | |
| 3,3'-iminodipropionitrile | |
| Vigabatrin | |
| sucrose octasulfate | An oligosaccharide sulfate that has formula C12H22O35S8. |
| 3-phenoxybenzaldehyde | |
| lipophosphonoglycan | |
| finrozole | |
| 2-aminoanthraquinone | An anthraquinone that has formula C14H9NO2. |
| N-Methylscopolamine | |
| Methoxychlor | An organochlorine insecticide that has formula C16H15Cl3O2. |
| SB 258585 | |
| olcegepant | |
| Guanidines | Any organonitrogen compound containing a carbamimidamido (guanidino) group. Guanidines have the general structure (R(1)R(2)N)(R(3)R(4)N)C=N-R(5) and are related structurally to amidines and ureas. |
| abacavir | |
| prolinedithiocarbamate | |
| promen | |
| nafadotride | A naphthalenecarboxamide resulting from the formal condensation of the carboxylic acid group of 4-cyano-1-methoxynaphthalene-2-carboxylic acid with the primary amino group of 1-(1-butylpyrrolidin-2-yl]methanamine. It is a highly potent, competitive, preferential dopamine D3 receptor antagonist, centrally active upon systemic administration. |
| Pyridostigmine Bromide | |
| oleanolic acid 3-acetate | |
| 1,5-benzothiazepine | |
| Win 55212-2 | A organic heterotricyclic compound that is 5-methyl-3-(morpholin-4-ylmethyl)-2,3-dihydro[1,4]oxazino[2,3,4-hi]indole substituted at position 6 by a 1-naphthylcarbonyl group. |
| cyclo(leucylglycine) | |
| estradiol-17 beta-3-methyl ether | |
| ONO-NT 012 | |
| 2,3-dialdehydocellulose | |
| Adenosine Diphosphate Ribose | |
| 10-hydroxycamptothecin | A pyranoindolizinoquinoline that has formula C20H16N2O5. |
| S-Adenosylmethionine | |
| Uranium Compounds | |
| 2-acetyltributylcitrate | |
| ammonium acetate | An ammonium salt obtained by reaction of ammonia with acetic acid. A deliquescent white crystalline solid, it has a relatively low melting point (114degreeC) for a salt. Used as a food acidity regulator, although no longer approved for this purpose in the EU. |
| dibenzothiazyl disulfide | |
| 2-(4-hydroxy-3,5-dimethylphenyl)-5-methoxy-3-methylindole | |
| Valinomycin | A twelve-membered cyclodepsipeptide composed of three repeating D-alpha-hydroxyisovaleryl-D-valyl-L-lactoyl-L-valyl units joined in sequence. An antibiotic found in several Streptomyces strains. |
| anthraceno(1,2-c)(1,2,5)selenadiazolo-6,11-dione | |
| Polybrominated Biphenyls | |
| Oxymetazoline | |
| Nizatidine | |
| Heparitin Sulfate | |
| Disulfiram | An organic disulfide that is 1,1'-[disulfanediylbis(carbonothioylimino)]diethane substituted by ethyl groups at the N atom. An EC 1.2.1.3 [aldehyde dehydrogenase (NAD+)] inhibitor, it is used as an alcohol deterrent. |
| Paromomycin | An amino cyclitol glycoside that is the 1-O-(2-amino-2-deoxy-alpha-D-glucopyranoside) and the 3-O-(2,6-diamino-2,6-dideoxy-beta-L-idopyranosyl)-beta-D-ribofuranoside of 4,6-diamino-2,3-dihydroxycyclohexane (the 1R,2R,3S,4R,6S diastereoisomer). It is obtained from various Streptomyces species. A broad-spectrum antibiotic, it is used (generally as the sulfate salt) for the treatment of acute and chronic intestinal protozoal infections, but is not effective for extraintestinal protozoal infections. It is also used as a therapeutic against visceral leishmaniasis. |
| 20-alpha-Dihydroprogesterone | |
| bivalirudin | |
| 3-(N-phenylamino)-1,2-propanediol 1,2-dioleoyl ester | |
| 3,3',4',5-tetrachlorosalicylanilide | A salicylanilide derivative with chloride substituents at C-3 and C-5 of the salicylate moiety and at C-3 and C-4 of the anilide moiety. |
| norbuprenorphine | |
| 4-fluorobenzoyl-TN-14003 | |
| Propanil | An anilide that has formula C9H9Cl2NO. |
| indatraline | |
| 2-(4-hydroxyphenyl)-3-methyl-1-(4-(2-piperidin-1-yl-ethoxy)-benzyl)-1H-indol-5-ol | |
| Shi-Bi-Lin herbal formula | |
| sodium bisulfide | |
| valproic acid glucuronide | |
| 3,4-dihydroxybenzaldoxime | |
| bourgeonal | |
| CGC 11093 | |
| Clobetasol | 16beta-Methylpregna-1,4-diene-3,20-dione bearing hydroxy groups at the 11beta and 17alpha positions, fluorine at position 9, and a chlorine substituent at position 21. It is used as its 17alpha-propionate ester to treat various skin disorders, including exzema and psoriasis. |
| tamibarotene | A tetralin that has formula C22H25NO3. |
| decanoyl-coenzyme A | |
| (E)-3-(2,3,4,5-tetrabromophenyl)acrylic acid | |
| endomorphin 1 | |
| Danshen extract | |
| Iron Chelating Agents | |
| dinonylphthalate | |
| 11,17-dihydroxy-6-methyl-17-(1-propynyl)androsta-1,4,6-triene-3-one | |
| geniposide | A terpene glycoside that has formula C17H24O10. |
| Phosphamidon | An organophosphate nematicide that has formula C10H19ClNO5P. |
| 7-(2-aminopyrimidin-5-yl)-1-((1-cyclopropyl-2,2,2-trifluoroethyl)amino)-5H-pyrido(4,3-b)indole-4-carboxamide | |
| trans-1,4-Bis(2-chlorobenzaminomethyl)cyclohexane Dihydrochloride | |
| cholesteryl oleyl ether | |
| bromoxynil | |
| 16-hydroxytestosterone | |
| 4-(N-methyl-N-nitrosamino)-1-(3-pyridyl)-1-butanone | |
| IBS008738 | |
| bretazenil | |
| Nomifensine | |
| cis-1-methyl-7-((4-(2,6-dichlorophenyl)piperidin-1-yl)methyl)-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-ol | |
| 17-amino-17-demethoxygeldanamycin -C2-galactose | |
| Cadmium | A zinc group element atom that has formula Cd. |
| raspberry ketone | A ketone that is 4-phenylbutan-2-one in which the phenyl ring is substituted at position 4 by a hydroxy group. It is found in a variety of fruits including raspberries, blackberries and cranberries, and is used in perfumery and cosmetics. |
| Famotidine | A guanidine that has formula C8H15N7O2S3. |
| Sphingosine | A sphing-4-enine in which the double bond is trans. |
| 4-aminobenzoyl-glycyl-prolyl-leucyl-alanine hydroxamic acid | |
| 3-hydroxybenzaldehyde | A hydroxybenzaldehyde carrying a hydroxy substituent at position 3. |
| menthol glucuronide | |
| 24-norursodeoxycholic acid | |
| isoline | |
| Potassium Chloride | A metal chloride salt with a K(+) counterion. |
| 2-(4-hydroxyphenyl)-3-phenylpent-2-enoic acid (4-(2-dimethylaminoethoxy)phenyl)amide | |
| maltolyl p-coumarate | |
| decamethrin | |
| perifosine | A phospholipid consisting of 1,1-dimethylpiperidinium-4-yl hydrogen phosphate in which the hydrogen is replaced by a stearyl (octadecyl) group. |
| Pentobarbital | A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
| idebenone | |
| N1-(4-bis(pivaloyloxymethyl)phosphinylbuten-2-yl)thymine | |
| Benzimidazoles | An organic heterocyclic compound containing a benzene ring fused to an imidazole ring. |
| Theophylline | A dimethylxanthine having the two methyl groups located at positions 1 and 3. It is structurally similar to caffeine and is found in green and black tea. |
| 3-benzyl-7-(2-benzoxazolyl)thio-1,2,3-triazolo(4,5-d)pyrimidine | |
| Ammonia | |
| sorafenib | |
| 8-hydroxyguanosine | |
| dexloxiglumide | |
| N-(1-(4-fluoro-3-morpholin-4-ylphenyl)ethyl)-3-(4-fluorophenyl)acrylamide | |
| Food Additives | Any substance which is added to food to preserve or enhance its flavour and/or appearance. |
| Ethambutol | An ethylenediamine derivative that is ethane-1,2-diamine in which one hydrogen attached to each of the nitrogens is sutstituted by a 1-hydroxybutan-2-yl group (S,S-configuration). It is a bacteriostatic antimycobacterial drug, effective against Mycobacterium tuberculosis and some other mycobacteria. It is used (as the dihydrochloride salt) in combination with other antituberculous drugs in the treatment of pulmonary and extrapulmonary tuberculosis; resistant strains of M. tuberculosis are readily produced if ethambutol is used alone. |
| Dibenzoxazepines | An organic heterotricyclic compound consisting of two benzene rings fused to a seven-membered ring containing one oxygen and one nitrogen atom. |
| Selenium Oxides | |
| N-(3-hydroxy-1-(naphthalen-1-yl)-1,8,11-trioxa-5-azatridecan-13-yl)-6-(2-(2-(4,4-difluoro-4,4a-dihydro-5-(thiophen-2-yl)-4-bora-3a,4a-diaza-s-indacene-3-yl)vinyl)phenoxyacetamido)hexanamide | |
| prochloraz | A member of the class of ureas that is 1H-imidazole-1-carboxamide substituted by a propyl and a 2-(2,4,6-trichlorophenoxy)ethyl group at the amino nitrogen atom. A fungicide active against a wide range of diseases affecting field crops, fruit, turf and vegetables. |
| corosolic acid | A triterpenoid that has formula C30H48O4. |
| M-VAC protocol | |
| Progesterone Congeners | |
| N(6)-phenyl-cAMP | |
| Phytochelatins | A family of peptides related to glutathione and composed of (gamma-Glu-Cys)n-Gly where n is in the range 2-11. |
| Palladium | Chemical element (nickel group element atom) with atomic number 46. |
| 1-((5-(1-aminoethyl)-2-(8-methoxy-2-(triflurormethyl)-5-quinolinyl)-4-oxazolyl) carbonyl)-4-((cyclopropylcarbonyl)amino)proline ethyl ester | |
| L 364373 | |
| Phytoestrogens | Any compound produced by a plant that happens to have estrogenic activity. |
| Corn Oil | |
| doxifluridine | A pyrimidine 5'-deoxyribonucleoside that is 5-fluorouridine in which the hydroxy group at the 5' position is replaced by a hydrogen. It is an oral prodrug of the antineoplastic agent 5-fluorouracil. Designed to circumvent the rapid degradation of 5-fluorouracil by dihydropyrimidine dehydrogenase in the gut wall, it is converted into 5-fluorouracil in the presence of pyrimidine nucleoside phosphorylase. |
| Guanine | A 2-aminopurine carrying a 6-oxo substituent. |
| Triptorelin Pamoate | |
| calcium bicarbonate | |
| 3-hydroxyacetanilide | |
| 2-isopropylphenol | A member of the class of phenols carrying an isopropyl group at position 2. |
| sitagliptin | A triazolopyrazine that exhibits hypoglycemic activity. |
| cadmium nitrate | An inorganic nitrate salt having Cd(2+) as the counterion. |
| pirarubicin | |
| decanaldehyde | |
| Hydroxocobalamin | A cobalamin that has formula C62H89CoN13O15P. |
| 2-ethylhexanol | |
| naphthacene | |
| ascorbate-2-phosphate | |
| Pergolide | A diamine that is ergoline in which the beta-hydrogen at position 8 is replaced by a (methylthio)methyl group and the hydrogen attached to the piperidine nitrogen (position 6) is replaced by a propyl group. A dopamine D2 receptor agonist which also has D1 and D2 agonist properties, it is used as the mesylate salt in the management of Parkinson's disease, although it was withdrawn from the U.S. and Canadian markets in 2007 due to an increased risk of cardiac valve dysfunction. |
| Metribolone | |
| Omeprazole | A racemate comprising equimolar amounts of (R)- and (S)-omeprazole. |
| Aphidicolin | A tetracyclic diterpenoid that has an tetradecahydro-8,11a-methanocyclohepta[a]naphthalene skeleton with two hydroxymethyl substituents at positions 4 and 9, two methyl substituents at positions 4 and 11b and two hydroxy substituents at positions 3 and 9. An antibiotic with antiviral and antimitotical properties. Aphidicolin is a reversible inhibitor of eukaryotic nuclear DNA replication. |
| 3,4-epoxybutane-1,2-diol | |
| eugenosedin-A | |
| terpinolene | A p-menthadiene with double bonds at positions 1 and 4(8). |
| 3',4'-dimethoxy-alpha-naphthoflavone | |
| 2,4,6-trichlorobiphenyl | |
| Piperidines | |
| artesunate | |
| allose | An aldohexose that is the C-3 epimer of glucose. |
| estradiol-3-glucuronide | |
| acetyldinaline | |
| 1,3-ditolylguanidine | |
| SAICAR | A 1-(phosphoribosyl)imidazolecarboxamide resulting from the formal condesation of the darboxy group of 5-amino-1-(5-O-phosphono-beta-D-ribofuranosyl)-1H-imidazole-4-carboxylic acid with the amino group of L-aspartic acid. |
| 2,4,5,2',4',5'-hexabromobiphenyl | |
| 1,3-dihydroxypropan-2-yl 11-(3-hydroxy-5-(2-methyloctan-2-yl)phenoxy)undecanoate | |
| fenofibric acid | A monocarboxylic acid that is 2-methylpropanoic acid substituted by a 4-(4-chlorobenzoyl)phenoxy group at position 2. It is a metabolite of the drug fenofibrate. |
| gentamicin C | |
| (2R, 3S)-2-(((4-(2-butynyloxy)phenyl)sulfonyl)amino)-N,3-dihydroxybutanamide | |
| 3-(2,4-dichloro-5-methoxyphenyl)-2-sulfanyl-4(3H)-quinazolinone | |
| 2-chloro-N(6)-(3-iodobenzyl)adenosine-5'-N-methyluronamide | |
| 1-((5-chloro-1H-indol-2-yl)carbonyl)-4-methylpiperazine | |
| Cysteine | A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
| Trimethaphan | |
| 4'-hydroxydiclofenac | An monocarboxylic acid that is the 4'-hydroxylated metabolite of diclofenac. |
| AG 538 | |
| stiripentol | |
| N-t-butyl-n'-tetradecyl-3-tetradecylaminopropionamidine | |
| 7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid | |
| 1-Naphthylamine | A naphthylamine that is naphthalene substituted by an amino group at position 1. |
| Anti-Inflammatory Agents | Any compound that has anti-inflammatory effects. |
| Dimercaprol | |
| indene | |
| beauvericin | A trimeric cyclodepsipeptide composed from alternating methylphenylalanyl and hydroxyvaleryl residues. |
| 4,4'-dipyridyl disulfide | An organic disulfide obtained by formal oxidative dimerisation of 4-thiopyridine. |
| chromic acid | A chromium oxoacid that has formula CrH2O4. |
| chaetoglobosins | |
| roquinimex | |
| huperzine A | A sesquiterpene alkaloid isolated from a club moss Huperzia serrata that has been shown to exhibit neuroprotective activity. |
| Tinidazole | 1H-imidazole substituted at C-1 by a (2-ethylsulfonyl)ethyl group, at C-2 by a methyl group and at C-5 by a nitro group. It is used as an antiprotozoal, antibacterial agent. |
| calcium silicate | |
| aminoacetone | A propanone consisting of acetone having an amino group at the 1-position. |
| atranorin | |
| 4,4'-Diisothiocyanostilbene-2,2'-Disulfonic Acid | An arenesulfonic acid that has formula C16H10N2O6S4. |
| temozolomide | |
| 1,3-di(1H-indol-3-yl)propan-2-one | |
| SK&F 81297 | |
| interferon alfa-n1 | |
| ximelagatran | A member of the class of azetidines that is melagatran in which the carboxylic acid group has been converted to the corresponding ethyl ester and in which the amidine group has been converted to the corresponding amidoxime. A prodrug for melagatran, ximelagatran was the first orally available direct thrombin inhibitor to be brought to market as an anticoagulant, but was withdrawn in 2006 following reports of it causing liver damage. |
| 1-(2-methylbenzoxazol-6-yl)-3-(1,5)naphthyridin-4-yl urea | |
| methylparaoxon | |
| HTI-286 | |
| kurarinone | |
| ellipticine | A organic heterotetracyclic compound that is pyrido[4,3-b]carbazole carrying two methyl substituents at positions 5 and 11. |
| eckol | A phlorotannin that is oxanthrene-1,3,6,8-tetrol substituted by a 3,5-dihydroxyphenoxy moiety at position 4. Isolated from the marine brown alga, Ecklonia cava, it exhibits antioxidant activity. |
| taurolithocholic acid 3-sulfate | |
| myrtenal | A monoterpenoid that has formula C10H14O. |
| 2-bromo-12,13-dihydro-5-indolo(2,3-a)pyrrolo(3,4-c)carbazole-5,7(6H)-dione | |
| 3,5-dimethyl-2-(3-pyridyl)thiazolidin-4-one | |
| 2-chloro-11-(4-methyl-1-piperazinyl)-5H-dibenzo(b,e)(1,4)diazepine | |
| cacospongionolide B | |
| zolpidem | An imidazo[1,2-a]pyridine compound having a 4-tolyl group at the 2-position, an N,N-dimethylcarbamoylmethyl group at the 3-position and a methyl substituent at the 6-position. |
| Iron-Dextran Complex | |
| atpenin A5 | |
| Eosine I Bluish | |
| lithospermic acid | A benzofuran that has formula C27H22O12. |
| Mepivacaine | A piperidinecarboxamide in which N-methylpipecolic acid and 2,6-dimethylaniline have combined to form the amide bond. It is used as a local amide-type anaesthetic. |
| WAY 100135 | |
| flavomannin-6,6'-dimethylether | |
| tetrahydrophthalamic acid | |
| MB327 | |
| LY 311727 | |
| bafilomycin A1 | The most used of the bafilomycins, a family of toxic macrolide antibiotics derived from Streptomyces griseus. |
| 2,3,5,6-tetrachlorobiphenyl | A tetrachlorobiphenyl that is biphenyl in which one of the phenyl groups is substituted by chlorines at positions 2, 3, 5, and 6. |
| methyl palmitate | A fatty acid methyl ester that has formula C17H34O2. |
| lanreotide | |
| Dichlorvos | An alkenyl phosphate that is the 2,2-dichloroethenyl ester of dimethyl phosphate. |
| bisphenol A glucuronide | |
| salvianolic acid | |
| desformylflustrabromine | |
| Demeclocycline | Tetracycline which lacks the methyl substituent at position 7 and in which the hydrogen para- to the phenolic hydroxy group is substituted by chlorine. Like tetracycline, it is an antibiotic, but being excreted more slowly, effective blood levels are maintained for longer. It is used (mainly as the hydrochloride) for the treatment of Lyme disease, acne and bronchitis, as well as for hyponatraemia (low blood sodium concentration) due to the syndrome of inappropriate antidiuretic hormone (SIADH) where fluid restriction alone has been ineffective. |
| 6-chloro-5-methyl-1-((2-(2-methylpyrid-3-yloxy)pyrid-5-yl)carbamoyl)indoline | |
| 11-fluoro-7-(14,14,15,15-pentafluoro-6-methyl-10-thia-6-azapentadecyl)estra-1,3-5(10)-triene-3,17-diol | |
| Urea | A carbonyl group with two C-bound amine groups. |
| Trimethoprim-Sulfamethoxazole Combination | |
| 7-(3-(cyclohexylmethyl)ureido)-3-(1-methyl-1H-pyrrolo(2,3-b)pyridin-3-yl)quinoxalin-2(1H)-one | |
| gamma-oryzanol | |
| lornoxicam | |
| 1,2,7,8-tetrachlorodibenzo-p-dioxin | |
| manganese chloride | |
| Vitamin K 2 | |
| 1,2,5,8-tetrahydroxy anthraquinone | |
| troglitazone | |
| 2-Aminopurine | The parent compound of the 2-aminopurines, comprising a purine core carrying an amino substituent at the 2-position. |
| Styrenes | |
| Superantigens | |
| Medazepam | |
| secoisolariciresinol diglucoside | |
| AWD 12-281 | |
| GCS-100 | |
| 9,10-epoxy-12-octadecenoic acid | |
| ribosome inactivating protein, Viscum | |
| 3,6-dinitrobenzopyrene | |
| acetosulfame | |
| 13,17,21-trimethyldocosa-12,16,20-trien-11-one | |
| Neurotransmitter Agents | A substance used for its pharmacological action on any aspect of neurotransmitter systems. Neurotransmitter agents include agonists, antagonists, degradation inhibitors, uptake inhibitors, depleters, precursors, and modulators of receptor function. |
| Thymolphthalein | |
| mangiferin heptasulfate | |
| 2'-hydroxyflavanone | |
| 1',3'-dihydro-1'-ethanol-3',3'-dimethyl-8-methoxy-6-nitro-spiro(2H-1-benzopyran-2,2'-(2H)-indole) | |
| cephalosporin C | A cephalosporin antibiotic carrying a 3-acetoxymethyl substituent and a 6-oxo-N(6)-L-lysino group at position 7. |
| Glyburide | An N-sulfonylurea that is acetohexamide in which the acetyl group is replaced by a 2-(5-chloro-2-methoxybenzamido)ethyl group. |
| tolterodine | A tertiary amine that has formula C22H31NO. |
| 7alpha-methyl-17alpha-ethynylestradiol | |
| KN 62 | |
| Detergents | |
| 5S,12R,18R-trihydroxy-6Z,8E,10E,14Z,16E-eicosapentaenoic acid | A leukotriene that has formula C20H30O5. |
| L 245976 | |
| Etoposide | A furonaphthodioxole that has formula C29H32O13. |
| pemirolast | |
| 1-(1-methanesulfonylpiperidin-4-yl)-3-(4-trifluoromethoxyphenyl)urea | |
| 3,5-dihydroxy-4'-methoxystilbene | |
| Benzamides | |
| 2-methylnaphthalene | A methylnaphthalene carrying a methyl substituent at position 2. |
| caffeic acid phenethyl ester | |
| platycodin D | A triterpenoid saponin that has formula C57H92O28. |
| 7,8-dihydro-8-oxoguanine | An oxopurine that is guanine in which the hydrogen at position 8 is replaced by an oxo group and in which the nitrogens at positions 7 and 9 each bear a hydrogen. |
| Dobutamine | A catecholamine that is 4-(3-aminobutyl)phenol in which one of the hydrogens attached to the nitrogen is substituted by a 2-(3,4-dihydroxyphenyl)ethyl group. A beta1-adrenergic receptor agonist that has cardiac stimulant action without evoking vasoconstriction or tachycardia, it is used as the hydrochloride to increase the contractility of the heart in the management of acute heart failure. |
| perospirone | |
| N-(4-fluorophenylsulfonyl)-L-valyl-L-leucinal | |
| gabapentin | |
| omeprazole sulfone | |
| nilestriol | |
| Antifungal Agents | An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Antifungal agents differ from industrial fungicides in that they defend against fungi present in human or animal tissues. |
| Fosinopril | A phosphinate ester-containing N-acyl derivative of (4S)-cyclohexyl-L-proline. It is used for the treatment of hypertension and heart failure. A pro-drug, it is hydrolysed in vivo to the corresponding phosphininc acid, fosinoprilat, which is the active metabolite. |
| Cysteamine | |
| latrunculin B | A macrolide consisting of a 14-membered bicyclic lactone attached to the rare 2-thiazolidinone moiety. It is obtained from the Red Sea sponge Latrunculia magnifica. |
| latrunculin A | A bicyclic macrolide natural product consisting of a 16-membered bicyclic lactone attached to the rare 2-thiazolidinone moiety. It is obtained from the Red Sea sponge Latrunculia magnifica and from the Fiji Islands sponge Cacospongia mycofijiensis. Latrunculin A inhibits actin polymerisation, microfilament organsation and microfilament-mediated processes. |
| N-ethoxymethyl-3-amino-1,2,4-benzotriazine-1,4-dioxide | |
| RS41A | |
| Clioquinol | |
| Tolu balsam | |
| N-(4-methoxy-3-(4-methylpiperazin-1-yl)phenyl)-3-methyl-4-(4-pyridyl)benzamide | |
| Uridine Diphosphate Glucose | |
| microcystin | A family of cyclic heptapeptide hepatotoxins produced by a number of cyanobacteria, the most notable of which is Microcystis, from which the name of the family is derived. Microcystins consist of a heptapeptide macrocycle made up of five non-protein amino acids and two protein amino acids. |
| Alfentanil | A member of the class of piperidines that is piperidine having a 2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl group at the 1-position as well as N-phenylpropanamido- and methoxymethyl groups at the 4-position. |
| 4-chloroaniline | A chloroaniline in which the chloro atom is para to the aniline amino group. |
| 4-hydroxybenzyl isothiocyanate | |
| 8-phenyltheophylline | |
| glucosamine 6-phosphate | |
| triptolide | An oxacycle that has formula C20H24O6. |
| evodiamine | A beta-carboline that has formula C19H17N3O. |
| 2,6-di-tert-butyl-4-methylene-2,5-cyclohexadienone | |
| Sulfamethazine | |
| Norethynodrel | |
| 2,3,5,6-tetrachlorophenate | |
| Ether | An organooxygen compound with formula ROR, where R is not hydrogen. |
| clocinnamox | |
| Androstenedione | |
| HG-7-85-01 compound | |
| enadoline | |
| Adenovirus E1A Proteins | |
| Aminoglutethimide | |
| 2-chloro-5-hydroxyphenylglycine | |
| chloroacetic acid | A chlorocarboxylic acid that is acetic acid carrying a 2-chloro substituent. |
| N-(1-(3-morpholin-4-ylphenyl)ethyl)-3-phenylacrylamide | |
| Fluorodeoxyuridylate | |
| isobutyl-4-hydroxybenzoate | |
| phenethyl isothiocyanate | An isothiocyanate having a phenethyl group attached to the nitrogen. It is a naturally occurring compound found in some cruciferous vegetables (e.g. watercress) and is known to possess anticancer properties. |
| N-desmethyldauricine | |
| glutaryl-coenzyme A | |
| Methylprednisolone Hemisuccinate | |
| ferric ammonium citrate | |
| Hyaluronic Acid | A mucopolysaccharide composed of N-acetylglucosamine and glucuronic acid subunits. It is found in the connective tissues of vertebrates. |
| nemonapride | A racemate composed of (2S,3S)- and (2R,3R)-enantiomers of nemonapride. Highly potent dopamine D2-like receptor antagonist; selective over D1-like receptors (Ki values are 0.1 and 740 nM for D2-like and D1-like receptors respectively). Also potent 5-HT1A receptor agonist (IC50 = 34 nM) and has affinity for sigma receptors. |
| Diazoxide | A benzothiadiazine that is the S,S-dioxide of 2H-1,2,4-benzothiadiazine which is substituted at position 3 by a methyl group and at position 7 by chlorine. A peripheral vasodilator, it increases the concentration of glucose in the plasma and inhibits the secretion of insulin by the beta- cells of the pancreas. It is used orally in the management of intractable hypoglycaemia and intravenously in the management of hypertensive emergencies. |
| methylselenic acid | |
| Pt(O,O'-acac)(gamma-acac)(DMS) | |
| Trenbolone Acetate | |
| hydroxymaprotilin | |
| 28-deoxonimbolide | A limonoid isolated from Azadirachta indica. |
| 8-hydroxyguanine | |
| 2-dichlorobenzene | |
| Equol | A hydroxyisoflavan that has formula C15H14O3. |
| quinelorane | |
| aflatoxin Q1 | A member of the class of aflatoxins that is aflatoxin B1 in which the hydrogen at the pro-3S position is replaced by a hydroxy group. |
| cochinchinenin | |
| Levamisole | |
| Heptanoic Acids | |
| 1-trichloromethyl-1,2,3,4-tetrahydro-beta-carboline | |
| benzoylaconine | |
| Triglycerides | |
| perillaldehyde | |
| 4-(4-(2,4-dioxothiazolidin-5-ylidenemethyl)-2-methoxyphenoxy)-3-trifluoromethylbenzonitrile | |
| asiaticoside | |
| A 86929 | |
| monoethyl phthalate | A dicarboxylic acid monoester that is the monoethyl ester of benzene-1,2-dicarboxylic acid. |
| dibutyldi(4-chlorobenzohydroxamato)tin(IV) | |
| dioleoyl ethylene glycol | |
| Amphetamines | A class of central nervous system stimulants based on the structure of the parent amphetamine 1-phenylpropan-2-amine. |
| isopentenyl pyrophosphate | |
| Enalaprilat | |
| 5-methylbenzanthracene | |
| nolatrexed | |
| 4-hydroxynonenoic acid | |
| 14-methoxymetopon | |
| benzamil | A pyrazine that has formula C13H14ClN7O. |
| omeprazole sulfide | |
| tectochrysin | A flavonoid that has formula C16H12O4. |
| 2,4-dinitrobenzenesulfonic acid | The arenesulfonic acid that is benzenesulfonic acid with two nitro substituents in the 2- and 4-positions. |
| alpha,beta-methyleneadenosine 5'-diphosphate | |
| Methylmercury Compounds | |
| N3-cyclopropyl-7-((4-(1-methylethyl)phenyl)methyl)-7H-pyrrolo(3, 2-f)quinazoline-1,3-diamine | |
| Diethylstilbestrol | |
| 2-(1-hexyloxyethyl)-2-devinyl pyropheophorbide-a | |
| cocoa butter | |
| 3-(4-(4-chlorophenyl-4-hydroxypiperidino)methyl)indole | |
| 6-(4-fluorophenyl)-2,3-dihydro-5-(4-pyridinyl)imidazo(2,1-b)thiazole | |
| Clofibric Acid | A monocarboxylic acid that is isobutyric acid substituted at position 2 by a p-chlorophenoxy group. It is a metabolite of the drug clofibrate. |
| Equilin | A 17-oxo steroid that has formula C18H20O2. |
| moexipril | |
| ethyl 3-phenylglycidate | |
| 2-methylpyrrolidine | |
| Peroxynitrous Acid | A nitrogen oxoacid that has formula HNO3. |
| U 74389F | |
| isoleucyl-glutamyl-threonyl-aspartic acid fluoromethyl ketone | |
| silybin-phytosome | |
| Chelating Agents | A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| N-(2-(dimethylamino)ethyl)-2-aminothiazonaphthalimide | |
| zafirlukast | A carbamate ester that has formula C31H33N3O6S. |
| N-(4-chlorobenzoyl)melatonin | |
| 4-methylbenzenethiol | |
| metazachlor | An organochlorine compound that is 2-chloroacetamide substituted by a 2,6-dimethylphenyl and a (1H-pyrazol-1-ylmethyl) group at the nitrogen atom. |
| eplerenone | A steroid acid ester that has formula C24H30O6. |
| Echothiophate Iodide | |
| EPTC | A tertiary amine that has formula C9H19NOS. |
| sinefungin | An adenosine that is the the delta-(5'-adenosyl) derivative of ornithine. |
| 4-nitrosodimethylaniline | |
| 2-(4-fluorophenylsulfonyl)-3-(1-(3-nitrophenylsulfonyl)-1H-pyrrol-2-yl)acrylonitrile | |
| transplatin | A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a trans planar configuration around the central platinum ion. Unlike its cis-isomer, cisplatin, it does not exhibit any useful pharmacological effect and is toxic. |
| Povidone | |
| deltorphin II, Ala(2)- | |
| Enkephalin, Leucine-2-Alanine | |
| chlorinated dibenzofurans | |
| Z 338 | |
| 3-amino-5-((2-((2-methoxyethyl)amino)-6-(4-(trifluoromethyl)phenyl)pyrimidin-4-yl)oxy)quinoxalin-2(1H)-one | |
| 1,4-dihydroxy-2-nonene | |
| DOPA melanin | |
| N-(1-(2,3-dihydro(1,4)dioxin-5-yl)piperidi-4-yl)indan-2-ylamine | |
| benzo(a)pyrene-1,6-quinone | |
| Ro 31-8220 | An imidothiocarbamic ester that has formula C25H23N5O2S. |
| norflurazone | |
| Teicoplanin | |
| oridonin | |
| 2,5-dimethyl-3,6-diaziridinyl-1,4-benzoquinone | |
| N-methylsulfonyl-6-(2-propargyloxyphenyl)hexanamide | |
| asperuloside | A iridoid monoterpenoid glycoside isolated from Galium verum. |
| cyanophos | An organothiophosphate insecticide that has formula C9H10NO3PS. |
| Hydroxyprogesterones | |
| Dimethyldithiocarbamate | A member of the class of dithiocarbamate anions resulting from the removal of the proton from the dithiocarbamic acid moiety of dimethyldithiocarbamic acid. The major species at pH 7.3. |
| 3,5-dibromo-2-(2,4-dibromophenoxy)phenol | |
| PCB 180 | |
| CA 074 methyl ester | |
| lafutidine | |
| fluoroaluminum | |
| Leucovorin | |
| carvone | |
| Parathion | An organothiophosphate insecticide that has formula C10H14NO5PS. |
| Fentanyl | The carboxamide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid. |
| estriol glucuronide | |
| SR 11237 | |
| 5-hydroxydecanoic acid | |
| 4,4'-diiodobiphenyl | |
| C 1305 | |
| Acetaminophen | |
| NCQ 436 | |
| losoxantrone | |
| cremophor EL | |
| N-palmitoylsphingosine | |
| dicloran | |
| Flurandrenolone | |
| (2-(2',6'-dimethoxy)phenoxyethylamino)methylbenzo-1,4-dioxane | |
| Leukotriene E4 | A leukotriene that has formula C23H37NO5S. |
| indolebutyric acid | |
| BLX 1002 | |
| Methadyl Acetate | |
| naringenin chalcone | |
| tetralol | |
| Ru 360 | |
| 1,1,1,2-tetrafluoro-2-chloroethane | |
| Monocrotophos | An alkenyl phosphate that is the 4-(methylamino)-4-oxobut-2-en-2-yl ester of dimethyl phosphate. |
| Doxycycline | Tetracycline in which the 5beta-hydrogen is replaced by a hydroxy group, while the 6alpha-hydroxy group is replaced by hydrogen. A semi-synthetic tetracycline antibiotic, it is used to inhibit bacterial protein synthesis and treat non-gonococcal urethritis and cervicitis, exacerbations of bronchitis in patients with chronic obstructive pulmonary disease (COPD), and adult periodontitis. |
| 2-chloro-N-(2,6-diethylphenyl)acetamide | |
| tocotrienol, beta | |
| butyraldehyde | |
| Antazoline | |
| Tripelennamine | |
| CGS 15855A | |
| 4,4'-diaminodiphenylmethane | An aromatic amine that is diphenylmethane substituted at the 4-position of each benzene ring by an amino group. |
| allyl alcohol | A propenol in which the C=C bond connects C-2 and C-3. It is has been found in garlic (Allium sativum). |
| BMS 191095 | |
| benzimidazole | A mancude organic heterobicyclic parent that is a heterocyclic organic compound comprising fused benzene and imidazole rings. |
| 4'-methoxyflavone | |
| Carteolol | A quinolone that has formula C16H24N2O3. |
| icilin | |
| Mn(III) 5,10,15,20-tetrakis(N-methylpyridinium-2-yl)porphyrin | |
| Piperacillin | A penicillin that has formula C23H27N5O7S. |
| Chlorotrianisene | |
| zinc sulfide | |
| Immunoferon | |
| beryllium trifluoride | |
| 1,1-dichloroethane | An organochlorine compound that has formula C2H4Cl2. |
| HTS 466284 | |
| vinylidene chloride | |
| 2,4-dinitrotoluene | A dinitrotoluene in which the methyl group is ortho to one of the nitro groups and para to the other. It is the most common isomer of dinitrotoluene. |
| myristoylated autocamtide-2-related inhibitory peptide | |
| Protons | |
| pyridine N-oxide | The pyridine N-oxide derived from the parent pyridine. It is a drug metabolite of the antihypertensive agent pinacidil. |
| Doxorubicin | An anthracycline antibiotic that has formula C27H29NO11. |
| 7-benzylidenenaltrexone | |
| tricarbonylchloro(glycinato)ruthenium(II) | |
| Peroxisome Proliferators | |
| 5-pregnene-3,20-diol | |
| 15R-methyl prostaglandin D2 | |
| 6-hydroxywarfarin | |
| N,N''-1,4-butanediylbis(N'-(3-isothiocyanatophenyl))thiourea | |
| cicloprofen | |
| Indoramin | |
| 6-deoxy-6-bromoascorbic acid | |
| cinnamyl anthranilate | A benzoate ester that has formula C16H15NO2. |
| 1-acyl-2-(12-((7-nitrobenz-2-oxa-1,3-diazol-4-yl)amino)dodecanoyl)phosphatidylcholine | |
| 3-toluidine | |
| (5-fluoro-2-methyl-1-(4-pyridyl)methylene-3-(N-benzyl)-indene)-acetamide hydrochloride | |
| Oxyquinoline | |
| MK 473 | |
| 7-hydroxy-N-(1-((4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl)methyl)-2-methylbutyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide dihydrochloride | |
| Doxepin | A dibenzooxepine that is 6,11-dihydrodibenzo[b,e]oxepine substituted by a 3-(dimethylamino)propylidene group at position 11. It is used as an antidepressant drug. |
| molinate sulfoxide | |
| cardamonin | |
| 1,3-dihydro-1-(1-((4-(6-phenyl-1H-imidazo(4,5-g)quinoxalin-7-yl)phenyl)methyl)-4-piperidinyl)-2H-benzimidazol-2-one | |
| 2,2',4,4',5-brominated diphenyl ether | |
| Mexiletine | An aromatic ether which is 2,6-dimethylphenyl ether of 2-aminopropan-1-ol. |
| 2-heptenal | |
| 7-monohydroxyethylrutoside | |
| 1-oleoyl-2-acetoyl-sn-glycerol | |
| romidepsin | |
| Bepridil | |
| Oxytocin | A cyclic nonapeptide hormone with amino acid sequence CYIQNCPLG that also acts as a neurotransmitter in the brain; the principal uterine-contracting and milk-ejecting hormone of the posterior pituitary. Together with the neuropeptide vasopressin, it is believed to influence social cognition and behaviour. |
| myrtenol | A monoterpenoid that has formula C10H16O. |
| N-(4-O-glycerol-3-methoxybenzyl)nonivamide | |
| pafuramidine | |
| Poly(amidoamine) | A polymer composed of amino (-NH2) and amido (-C(=O)NH-) units. |
| XAV939 | A thiopyranopyrimidine in which a 7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidine skeleton is substituted at C-4 by a hydroxy group and at C-2 by a para-(trifluoromethyl)phenyl group. |
| BRL 15572 | |
| 2-(3-estrone-N-ethyl-piperazine-methyl)tetracycline | |
| 17 alpha,20 beta-dihydroxypregn-4-en-3-one | |
| PF-04254644 | |
| 2-(morpholin-4-yl)benzo(h)chromen-4-one | |
| Histamine | A 1H-imidazol-4-yl group substituted at position C-4 by a 2-aminoethyl group. |
| margatoxin | |
| 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | |
| monobromobimane | A pyrazolopyrazole that consists of 1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione bearing three methyl substituents at positions 2, 5 and 6 as well as a bromomethyl substituent at the 3-position. |
| ammodytin L | |
| 3-(2'-phosphonomethyl(1,1'-biphenyl)-3-yl)alanine | |
| Lead | |
| 6-methoxy-3-(4-methylphenyl)coumarin | |
| ethylparaoxon | |
| GR 65630 | |
| acetyl triethyl citrate | |
| Pam(3)CSK(4) peptide | |
| 1,6-dimethylnaphthalene | A dimethylnaphthalene that has formula C12H12. |
| Atenolol | An ethanolamine compound having a (4-carbamoylmethylphenoxy)methyl group at the 1-position and an N-isopropyl substituent. |
| 4-nitrobenzofurazan | |
| 3,5-di-tert-butylchalcone 4'-carboxylic acid | |
| quercetin 3'-O-glucoside | |
| tris(1,10-phenanthroline)chromium(III) chloride | |
| oxybutynin | An acetylenic compound that has formula C22H31NO3. |
| 4-hydroxy-2-hexenal | |
| 3-(2-(3-guanidino-2-methyl-3-oxo-propenyl)-5-methylphenyl)-N-isopropylidene-2-methyl-acrylamide dihydrochloride | |
| Enflurane | An ether in which the oxygen atom is connected to 2-chloro-1,1,2-trifluoroethyl and difluoromethyl groups. |
| 2-Naphthylamine | A naphthylamine that has formula C10H9N. |
| 2',3',4',5'-tetrachloro-4-biphenylol | A tetrachlorobenzene that has formula C12H6Cl4O. |
| Arsenicals | |
| pantoprazole | A member of the class of benzimidazoles that is 1H-benzimidazole substituted by a difluoromethoxy group at position 5 and a [(3,4-dimethoxypyridin-2-yl)methyl]sulfinyl group at position 2. |
| Tacrine | |
| SCH 351591 | An aromatic amide resulting from the formal condensation of the carboxy group of 8-methoxy-2-(trifluoromethyl)quinoline-5-carboxylic acid with the primary amino group of 3,5-dichloropyridin-4-amine 1-oxide. It is a potent inhibitor of phosphodiesterase IV (PDE4). |
| Dipyrone | |
| 3-((2-methyl-1,3-thiazol-4-yl)ethynyl)pyridine | |
| N-Nitrosopyrrolidine | A pyrrolidine that has formula C4H8N2O. |
| 2-oxothiazolidine-4-carboxylic acid | |
| FK 706 | |
| 1-((1-O-octadecyl-2-O-methylglycero)phospho)-3-deoxy-myo-inositol | |
| mipomersen | |
| tolserine | |
| dehydroepiandrosterone-bovine serum albumin | |
| 2,3,5-trimethyl-6-(12-hydroxy-5,10-dodecadiynyl)-1,4-benzoquinone | |
| 4-aminoethylamino-emodin | |
| Isoprostanes | |
| TBE 31 | |
| Acetic Acid | A simple monocarboxylic acid containing two carbons. |
| bis(2-chloroethoxy)methane | |
| fumigaclavine C | An ergot alkaloid produced by the fungus Aspergillus fumigatus that is ergoline which is substituted by a 2-methylbut-3-en-2-yl group at position 2, methyl groups at the 6 and 8beta positions, and by an acetoxy group at the 9beta position. |
| Phenobarbital | A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
| thermozymocidin | |
| tralomethrin | A carboxylic ester resulting from the formal condensation between (1R)-cis-2,2-dimethyl-3-(1,2,2,2-tetrabromoethyl)cyclopropanecarboxylic acid and the alcoholic hydroxy group of (2S)-hydroxy(3-phenoxyphenyl)acetonitrile. |
| 2-aminofluorene | |
| CHOP protocol | |
| 2,5-dihydro-2,4,5-trimethylthiazoline | |
| tigecycline | |
| 5,6-dihydroxy-2-indolylcarboxylic acid | |
| beta-lapachone | A benzochromenone that is 3,4-dihydro-2H-benzo[h]chromene-5,6-dione substituted by geminal methyl groups at position 2. Isolated from Tabebuia avellanedae, it exhibits antineoplastic and anti-inflammatory activities. |
| 1,2-dipalmitoylphosphatidylglycerol | |
| Boric Acids | Hydroxy boron compounds of general formula BxOyHz. |
| vesnarinone | |
| C60-bis(N,N-dimethylpyrrolidinium) | |
| 2,2'-dichlorobiphenyl | |
| Aldehydes | A compound RC(=O)H, in which a carbonyl group is bonded to one hydrogen atom and to one R group. |
| 7-hydroxyflavanone | A monohydroxyflavanone that is flavanone substituted by a hydroxy group at position 7. |
| Ginkgo biloba extract 761 | |
| Maprotiline | |
| N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine | |
| Gabexate | |
| 2,4-diaminopyridine | A diaminopyridine that has formula C5H7N3. |
| spermine nitric oxide complex | |
| NSC 689534 | |
| ginsenoside Rf | A ginsenoside found in Panax ginseng and Panax japonicus var. major that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions, in which the hydroxy group at position 6 has been converted to the corresponding beta-D-glucopyranosyl-(1->2)-beta-D-glucopyranoside, and in which a double bond has been introduced at the 24-25 position. |
| saccharic acid-1,4-lactone | |
| ginsenoside Rd | A ginsenoside found in Panax ginseng and Panax japonicus var. major that is (20S)-ginsenoside Rg3 in which the hydroxy group at position 20 has been converted to its beta-D-glucopyranoside. |
| ginsenoside Re | A ginsenoside found in Panax ginseng that is dammarane which is substituted by hydroxy groups at the 3beta, 6alpha, 12beta and 20 pro-S positions, in which the hydroxy groups at positions 6 and 20 have been converted to the corresponding alpha-L-rhamnopyranosyl-(1->2)-beta-D-glucopyranoside and beta-D-glucopyranoside respectively, and in which a double bond has been introduced at the 24-25 position. |
| CI 1044 | |
| 1,3-dicyclohexylurea | |
| ZD 9331 | |
| ginsenoside Ro | A triterpenoid saponin that has formula C48H76O19. |
| alpha-methylepinine | |
| 4-benzylphenol | |
| razaxaban | |
| 13-cis-12-(3'-carboxyphenyl)retinoic acid | |
| amiridine | |
| fenarimol | A racemate comprising equimolar amounts of (R)- and (S)-fenarimol. A sterol demethylation inhibitor, it is used as a fungicide for the treatment of blackspot, mildew and rust in tomatoes, peppers and melons, but is not approved for use within the European Union. |
| fenazaquin | A quinazoline that has formula C20H22N2O. |
| tanespimycin | A 19-membered macrocyle comprising geldanamycin with its 17-methoxy substituent replaced by an allylamino group. It is a potent inhibitor of heat shock protein 90 (Hsp90). A less toxic analogue than geldanamycin, it induces apoptosis and displays antitumor effects. |
| Hempa | |
| hydroxyphenytoin | |
| 1-((4-cyano-4-pyridin-2-ylpiperidin-1-yl)methyl)-4-oxo-4H-quinolizine-3-carboxylic acid | |
| 4-isopropylcatechol | |
| 1-palmitoyl-2-(epoxyisoprostane-E2)-sn-glycero-3-phosphocholine | |
| Methylprednisolone | |
| fumaric acid | A butenedioic acid in which the C=C double bond has E geometry. It is an intermediate metabolite in the citric acid cycle. |
| 4-toluenesulfonyl fluoride | |
| bimoclomol | |
| Hydroxyacetylaminofluorene | |
| acetylsalicylic acid lysinate | |
| S-sulindac | |
| B3(Fv)-PE38KDEL recombinant immunotoxin | |
| tetrahydroxy-5-cholan-24-oic acid | |
| BRL 44408 | |
| 2-Chloroadenosine | |
| 4-phenylbutyric acid | A monocarboxylic acid the structure of which is that of butyric acid substituted with a phenyl group at C-4. It is a histone deacetylase inhibitor that displays anticancer activity. It inhibits cell proliferation, invasion and migration and induces apoptosis in glioma cells. It also inhibits protein isoprenylation, depletes plasma glutamine, increases production of foetal haemoglobin through transcriptional activation of the gamma-globin gene and affects hPPARgamma activation. |
| hexachlorobutadiene | |
| 3-((2-fluorothiazol-4-yl)ethynyl)benzonitrile | |
| Chlorogenic Acid | A cinnamate ester obtained by formal condensation of the carboxy group of trans-caffeic acid with the 3-hydroxy group of quinic acid. It is an intermediate metabolite in the biosynthesis of lignin. |
| Taurine | An amino sulfonic acid that is the 2-amino derivative of ethanesulfonic acid. It is a naturally occurring amino acid derived from methionine and cysteine metabolism. |
| Sulfapyridine | |
| 1,2-oleoylphosphatidylcholine | |
| panaxatriol | |
| SNX 2112 | |
| kenpaullone | |
| luteolin-7-glucoside | |
| GFX 109203x | |
| benzenearsonic acid | |
| herbimycin | A 19-membered macrocyle incorporating a benzoquinone ring and a lactam functionality. It is an ansamycin antibiotic that induces apoptosis and displays antitumour effects. |
| Buserelin | |
| 2-aminomethyl-2-tricyclo(3.3.1.1(1,7))decaneacetic acid hydrochloride | |
| sergliflozin | |
| Bupranolol | |
| tetramethylammonium | The simplest quaternary ammonium cation, comprising a central nitrogen linked to four methyl groups. |
| KT 5720 | |
| methylxanthine | |
| Tacrolimus | |
| 12-hydroxyellipticine | |
| chromium mesoporphyrin | |
| digeranyl bisphosphonate | |
| GSK343 | |
| (2-(5-amino-2-(4-fluorophenyl)-1,6-dihydro-6-oxo-1-pyrimidinyl)-N-(1-((5-methoxycarbonyl-2-benzoxazolyl)carbonyl)-2-phenylethyl)acetamide) | |
| tegaserod | |
| iniparib | |
| Citrates | |
| A 78773 | |
| 1-palmitoyl-2-(epoxycyclopentenone)-sn-glycero-3-phosphocholine | |
| S-nitrosocysteine | |
| tetrabutyltin | |
| aminocarb | A carbamate ester that is phenyl methylcarbamate substituted by a dimethylamino group at position 4 and a methyl group at position 3. |
| 9-mono-N'-methylnorharman | |
| Uridine Triphosphate | |
| Diethylnitrosamine | |
| 3'-O-(4-benzoyl)benzoyladenosine 5'-triphosphate | |
| pralidoxime | A pyridinium ion that is 1-methylpyridinium substituted by a (hydroxyimino)methyl group at position 2. |
| dinitrobenzenesulfonic acid | |
| loreclezole | |
| Pentagastrin | |
| fludarabine | |
| zorubicin | |
| FG 9041 | |
| saxagliptin | |
| Thromboxane B2 | A member of the class of thromboxanes B that is (5Z,13E)-thromboxa-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. |
| SR 144528 | |
| Oxyphenbutazone | |
| NSC 674495 | |
| 2,6-xylidine | |
| edelfosine | A racemate comprising equimolar amounts of (R)- and (S)-edelfosine. |
| Methionine Sulfoximine | A non-proteinogenic alpha-amino acid that is the sulfoximine derivative of methionine . |
| Propidium | A phenanthridine that has formula C27H34N4. |
| AMG 009 | |
| 2-methoxy-3-O-sulfamoyl-17-cyanomethylestra-1,3,5(10)-triene | |
| 1,2-dithiol-3-thione | |
| Bongkrekic Acid | A tricarboxylic acid that is docosa-2,4,8,10,14,18,20-heptaenedioic acid substituted at positions 2 ,5 and 17 by methyl groups, at positions 6 by a methoxy group and at position 20 by a carboxymethyl group. |
| linsidomine | |
| levormeloxifene | |
| Tellurium | A chalcogen that has formula Te. |
| nifekalant | |
| Dilazep | |
| Sodium Cyanide | A cyanide salt that has formula CNNa. |
| Ergotamine | A peptide ergot alkaloid that is dihydroergotamine in which a double bond replaces the single bond between positions 9 and 10. |
| 1,3-dipropyl-8-cyclopentylxanthine | |
| 4-methyl-2,4-bis(4-hydroxyphenyl)pent-1-ene | |
| eupatorin-5-methyl ether | |
| acetylthiocholine iodide | |
| tributyltin | |
| VL-0395 | |
| 2-amino-9H-pyrido(2,3-b)indole | A pyridoindole that has formula C11H9N3. |
| 4-(2-chloro-4-(2-piperidin-1-ylethoxy)phenyl)-5-(2,6-dichloro-4-hydroxyphenyl)-2-imidazoline | |
| 4-benzylpyridine | |
| calcium heparin | |
| chrysene-5,6-oxide | |
| TO-901317 | |
| 5,6,7,8-tetrahydrofolic acid | A tetrahydrofolic acid that has formula C19H23N7O6. |
| 3-phenoxybenzylalcohol | |
| N-tert-butyl-alpha-(4-nitrophenyl)nitrone | |
| Phorbol Esters | |
| nickel sulfate | |
| Clemastine | 2-[(2R)-1-Methylpyrrolidin-2-yl]ethanol in which the hydrogen of the hydroxy group is substituted by a 1-(4-chlorophenyl)-1-phenylethyl group (R configuration). An antihistamine with antimuscarinic and moderate sedative properties, it is used as its fumarate salt for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
| corilagin | An ellagitannin with a hexahydroxydiphenoyl group bridging over the 3-O and 6-O of the glucose core. |
| Coenzyme A | A thiol comprising a panthothenate unit in phosphoric anhydride linkage with a 3',5'-adenosine diphosphate unit; and an aminoethanethiol unit. |
| dexamethasone 21-methanesulfonate | |
| CP 288886 | |
| Polyphenols | Members of the class of phenols that contain 2 or more benzene rings each of which is substituted by at least one hydroxy group. |
| phosphomannopentaose sulfate | |
| drospirenone and ethinyl estradiol combination | |
| thunberginol A | |
| thunberginol B | |
| retinol acetate | |
| ethylphenidate | |
| 2,6-di-tert-butylphenol | |
| olesoxime | |
| 8-azapurine | |
| NC 174 | |
| periodate-oxidized adenosine 5'-triphosphate | |
| methylazoxymethanol | An azoxy compound that has formula C2H6N2O2. |
| acylcarnitine | |
| RS 17053 | |
| ethofenprox | |
| N-(4-cyanophenyl)-2-(4-(2,3,6,7-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)-phenoxy)acetamide | |
| Iloprost | |
| benzyl isothiocyanate | An isothiocyanate that has formula C8H7NS. |
| Aluminum Silicates | |
| 3-O-acetylspectaline | |
| Semaxinib | |
| creosol | |
| Bromcresol Purple | |
| Hair Dyes | |
| Acenaphthenes | Any member of the class of acenaphthylenes based on a acenaphthene skeleton and its derivatives. |
| Amodiaquine | |
| kinamycin F | A kinamycin that has formula C18H14N2O7. |
| androstan-17-ol | |
| 2,3-butylene glycol | |
| Propanols | |
| demethoxycurcumin | A beta-diketone that is curcumin in which one of the methoxy groups is replaced by hydrogen. It is found in Curcuma zedoaria and Etlingera elatior. |
| xylometazoline | |
| leptophos oxon | |
| 5-fluorowillardiine | |
| epibatidine | An alkaloid that has formula C11H13ClN2. |
| iron protoporphyrin IX | |
| Contraceptives, Oral, Combined | |
| 2-methylcyclopentadienyl manganese tricarbonyl | |
| Bicuculline | Bicuculline is a light-sensitive competitive antagonist of GABAA receptors. It was originally identified in 1932 in plant alkaloid extracts and has been isolated from Dicentra cucullaria, Adlumia fungosa, Fumariaceae, and several Corydalis species. |
| Pentosan Sulfuric Polyester | |
| Maleates | |
| Cardenolides | Any steroid lactone that is a C23 steroid with a five-membered lactone ring at C-17 and its substituted derivatives. They form the aglycone constituents of cardiac glycosides. |
| LU 135252 | |
| mebeverine | |
| hydroxytamoxifen | |
| 2-(3-(4-ethoxybenzyl)-4-chlorophenyl)-6-hydroxymethyltetrahydro-2H-pyran-3,4,5-triol | |
| 5,6,7-trimethoxyflavone | A trimethoxyflavone that is the 5,6,7-trimethyl ether derivative of baicalein. It has been isolated from the plant Callicarpa japonica and has been shown to exhibit antiviral activity. |
| 3-acetyldeoxynivalenol | |
| bromopyruvate | |
| tofacitinib | |
| Aflatoxin B1 | An aflatoxin having a tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene skeleton with oxygen functionality at positions 1, 4 and 11. |
| N-(2-hydroxybenzoyl)tyramine | |
| dabequin | |
| quercetin 3,7,3',4'-tetrasulfate | |
| caryophyllene | |
| 1-(4-((4-phenyl-5-trifluoromethyl-2-thienyl)methoxy)benzyl)azetidine-3-carboxylic acid | |
| Vaticanol B | |
| Ergothioneine | A L-histidine derivative that is N(alpha),N(alpha),N(alpha)-trimethyl-L-histidine in which the hydrogen at position 2 on the imdazole ring is replaced by a mercapto group. A naturally occurring metabolite of histidine with antioxidant properties; abundant in most plants and animals, obtained in animals through the diet. |
| Hydroxyestrones | |
| cyanuric acid | The enol tautomer of isocyanuric acid. |
| thioxolone | |
| gallium arsenide | |
| isorhapontigenin | |
| 1-naphthylethyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | |
| 7-(hydroxyimino)cyclopropan(b)chromen-1a-carbxoylic acid ethyl ester | |
| cholest-8(14)-en-3-ol-15-one | |
| 7,8-dihydromethysticin | |
| nordy | |
| 1,1-dichloro-1-fluoroethane | |
| quinupristin-dalfopristin | An organic molecular entity that has formula C53H67N9O10S.C34H50N4O9S. |
| JTE 607 | |
| fullerene C60 | |
| Phloretin | A member of the class of dihydrochalcones that is dihydrochalcone substituted by hydroxy groups at positions 4, 2', 4' and 6'. |
| Leukotriene C4 | A leukotriene that contains cysteine in their structure. |
| isobutyronitrile | A nitrile that has formula C4H7N. |
| 3-phenylpropionic acid | A monocarboxylic acid that is propionic acid substituted at position 3 by a phenyl group. |
| Lanosterol | A tetracyclic triterpenoid that is lanosta-8,24-diene substituted by a beta-hydroxy group at position 3. It is the compound from which all steroids are derived. |
| perfluorononanoic acid | A fluoroalkanoic acid that is nonanoic acid in which all of the hydrogens in the alkyl chain are replaced by fluorines. |
| Vanadium | |
| 1,4-bis(2-(3,5-dichloropyridyloxy))benzene | |
| 4'-chloroflavone | |
| 9-methoxy-2-methylellipticinium acetate | |
| mustard oil | |
| Quinolones | |
| Digoxigenin | A hydroxy steroid that consists of 5beta-cardanolide having a double bond at the 20(22)-position as well as hydroxy groups at the 3beta-, 12beta- and 14beta-positions. It has been isolated from the plant species of the genus Digitalis. |
| 1,25-dihydroxy-26,27-dimethylcholecalciferol | |
| alloin | |
| Ginsenosides | |
| scalaradial | A scalarane sesterterpenoid that has formula C27H40O4. |
| Flunarizine | |
| methyl isocyanate | Methane modified by a single isocyanato substituent. |
| Triamcinolone | A C21-steroid hormone that is 1,4-pregnadiene-3,20-dione carrying four hydroxy substituents at positions 11beta, 16alpha, 17alpha and 21 as well as a fluoro substituent at position 9. Used in the form of its 16,17-acetonide to treat various skin infections. |
| Hydralazine | The 1-hydrazino derivative of phthalazine; a direct-acting vasodilator that is used as an antihypertensive agent. |
| bromadiolone | A diarylheptanoid that has formula C30H23BrO4. |
| 1-iodo-2,4-dinitrobenzene | Iodobenzene substituted at C-2 and -4 with nitro groups. |
| cis-9, trans-11-conjugated linoleic acid | |
| L 708714 | |
| Botulinum Toxins, Type A | |
| ethinyl estradiol glucuronide | |
| butylidenephthalide | |
| Kaolin | |
| 15-deoxy-delta(12,14)-prostaglandin J2 | A prostaglandin J derivative comprising prostaglandin J2 lacking the 15-hydroxy group and having C=C double bonds at the 12- and 14-positions. |
| Thiocarbamates | |
| Lidocaine | The monocarboxylic acid amide resulting from the formal condensation of N,N-diethylglycine with 2,6-dimethylaniline. |
| amitraz | |
| Butylscopolammonium Bromide | |
| NO 756 | |
| ranirestat | |
| 2-methoxyestrone | A 17-oxo steroid that is estrone in which the hydrogen at position 2 is substituted by a methoxy group. |
| Mycoplasma arthritidis mitogen | |
| 680C91 | |
| NVP-TAE684 | |
| zomepirac | |
| PLX4032 | |
| Poly G | |
| Yttrium | A rare earth metal atom that has formula Y. |
| kavain | |
| glucosamine 6-O-sulfate | |
| dicumyl peroxide | |
| 1,2,3,4,4a,5,10,10a-octahydro-6-methoxy-1-methylbenz(g)quinoline-3-carboxylic acid 4-(4-nitrophenyl)piperazine amide | |
| 2-ethyl-5-methoxy-N,N-dimethyltryptamine | |
| butyloxycarbonyl-phenylalanyl-leucyl-phenylalanyl-leucyl-phenylalanine | |
| Methylphenidate | A racemate comprising equimolar amounts of the two threo isomers of methyl phenyl(piperidin-2-yl)acetate. A central stimulant and indirect-acting sympathomimetic, is used (generally as the hydrochloride salt) in the treatment of hyperactivity disorders in children and for the treatment of narcolepsy. |
| 2-aminophenol | The aminophenol which has the single amino substituent located ortho to the phenolic -OH group. |
| sulfoquinovosyl diglyceride | |
| Dichlororibofuranosylbenzimidazole | |
| 1-nitrosocyclohexyl acetate | |
| Ro 24-5531 | |
| Glycosaminoglycans | |
| 2,4-dinitrophenyl-S-(N-acetylcysteine) | |
| ganoderol B | |
| Anthocyanins | Any flavonoid that is a glycoside derivative of anthocyanidin. They are water-souluble plant pigments that generally occur as acidic salts exhibiting bright colours. |
| Crack Cocaine | |
| Diiodothyronines | |
| phenethylamine | |
| Ketolides | |
| Sealapex | |
| Indolapril | |
| aflatoxin B2 | An aflatoxin having a hexahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene skeleton with oxygen functionality at positions 1, 4 and 11. |
| Vanilmandelic Acid | |
| benzo(a)pyrene-3,6-quinol | |
| S-(4-nitrophenacyl)glutathione | |
| Benzoylcholine | |
| manoalide | A sesterterpenoid isolated from the marine sponge Luffariella variabilis and which has been shown to exhibit inhibitory activity towards phospholipase A2. |
| baccharin | |
| cyclo(Trp-Asp-Pro-Val-Leu) | |
| bromerguride | |
| Endotoxins | |
| PFL protocol | |
| polyestradiol phosphate | |
| Dihydro-beta-Erythroidine | An organic heterotetracyclic compound resulting from the partial hydrogenation of the 1,3-diene moiety of beta-erythroidine to give the corresponding 2-ene. |
| 3-aminobenzamide | A substituted aniline that is benzamide in which one of the meta- hydrogens is replaced by an amino group. |
| 2,2'-biphenol | |
| N-(3-nitratopivaloyl)cysteine ethyl ester | |
| 3,5-dichlorobiphenyl | A dichlorobiphenyl that is 1,3-dichlorobenzene in which the hydrogen at position 5 has been replaced by a phenyl group. |
| norelgestromin | |
| septilin | |
| valsartan | |
| tauroursodeoxycholic acid | A bile acid taurine conjugate that has formula C26H45NO6S. |
| carbendazim | A member of the class of benzimidazoles that is 2-aminobenzimidazole in which the primary amino group is substituted by a methoxycarbonyl group. A fungicide, carbendazim controls Ascomycetes, Fungi Imperfecti, and Basidiomycetes on a wide variety of crops, including bananas, cereals, cotton, fruits, grapes, mushrooms, ornamentals, peanuts, sugarbeet, soybeans, tobacco, and vegetables. |
| trestolone acetate | |
| N-(2-(p-methoxyphenyl)ethyl)-N-ethyl-2-(1-pyrrolidinyl)ethylamine | |
| betamethasone-17,21-dipropionate | |
| 6-bromoacetyl-2-dimethylaminonaphthalene | |
| RNA Cap Analogs | |
| 4-(5-benzo(1,3)dioxol-5-yl-4-pyridin-2-yl-1H-imidazol-2-yl)benzamide | |
| Pyrethrins | The active insecticidal constituents of Chrysanthemum cinerariifolium flowers. |
| propiconazole | The cyclic ketal obtained by formal condensation of 1-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone with pentane-1,2-diol. A triazole fungicide, it is used commercially as a diastereoisomeric mixture on soft fruit (including apricots, peaches, nectarines, plums and prunes), nuts (including peanuts, pecans and almonds), mushrooms, and grasses grown for seeds. |
| N-methyltropan-3-yl 2-(4-bromophenyl)propionate | |
| naphthalene | An aromatic hydrocarbon comprising two fused benzene rings. It occurs in the essential oils of numerous plant species e.g. magnolia. |
| 1,5-diaminonaphthalene | |
| Ionophores | |
| Sulfur Dioxide | |
| Vinyl Chloride | |
| estrone-3-O-sulfamate | |
| Phenylurea Compounds | |
| BXL628 | |
| Bumetanide | A member of the class of benzoic acids that is 4-phenoxybenzoic acid in which the hydrogens ortho to the phenoxy group are substituted by butylamino and sulfamoyl groups. Bumetanide is a diuretic, and is used for treatment of oedema associated with congestive heart failure, hepatic and renal disease. |
| 1,2,4,5-tetrachlorobenzene | A tetrachlorobenzene carrying chloro groups at positions 1, 2, 4 and 5. |
| Spiperone | An azaspiro compound that is 1,3,8-triazaspiro[4.5]decane which is substituted at positions 1, 4, and 8 by phenyl, oxo, and 4-(p-fluorophenyl)-4-oxobutyl groups, respectively. |
| ritalinic acid | A monocarboxylic acid that is phenylacetic acid substituted by a piperidin-2-yl group at position 2. It is a metabolite of the drug methylphenidate. |
| benzo(g)chrysene | |
| N-(2-chlorophenylpropyl)-1-(3-methoxyphenyl)ethylamine | |
| astringin | |
| benzyloxycarbonyl-isoleucyl-glutamyl(O-tert-butyl)-alanyl-leucinal | |
| m-trifluoromethyl-diphenyl diselenide | |
| N-acetylserotonin | A member of the class of hydroxyindoles that is the N-acetyl derivative of serotonin. |
| 7,8-diacetoxy-4-methylthiocoumarin | |
| indanofan | An indanone that has formula C20H17ClO3. |
| dinitrophenyl-human serum albumin conjugate | |
| KH 1060 | |
| N-nitrosomorpholine | A nitrosamine that is morpholine in which the hydrogen attached to the nitrogen is replaced by a nitroso group. A carcinogen and mutagen, it is found in snuff tobacco. |
| bisdesmethoxycurcumin | |
| Lanthanum | A scandium group element atom that has formula La. |
| 4-(methylthio)-3-butenyl isothiocyanate | |
| phenylacetaldehyde | An aldehyde that consists of acetaldehyde bearing a methyl substituent; the parent member of the phenylacetaldehyde class of compounds. |
| Zirconium | A titanium group element atom that has formula Zr. |
| Pentolinium Tartrate | The bitartrate salt of pentolinium. |
| perrhenate | |
| Nitric Oxide | A nitrogen oxide which is a free radical, each molecule of which consists of one nitrogen and one oxygen atom. |
| 2-(2-oxo-2-((3,7,11-trimethyl-2,6,10-dodecatrienyl)oxy)aminoethyl)phosphonic acid, (2,2-dimethyl-1-oxopropoxy)methyl ester sodium | |
| Ivermectin | A mixture consisting of >= 90% 22,23-dihydroavermectin B1a (R = Me) and <= 10% 22,23-dihydroavermectin B1b (R = H). A semi-synthetic derivative of abamectin, it is used as a broad-spectrum antiparasite medication, particularly against worms (except tapeworms), although it is also effective against most mites and some lice. |
| Nefopam | |
| thallium nitrate | |
| 20,21-epoxyresibufogenin-3-formate | |
| irinotecan | |
| hydroxygenkwanin | |
| salinomycin | A diterpene glycoside that has formula C42H70O11. |
| Furocoumarins | |
| 2-bromoethylamine | |
| rottlerin | A chromenol that is 2,2-dimethyl-2H-chromene substituted by hydroxy groups at positions 5 and 7, a 3-acetyl-2,4,6-trihydroxy-5-methylbenzyl group at position 6 and a (1E)-3-oxo-1-phenylprop-1-en-3-yl group at position 8. A potassium channel opener, it is isolated from Mallotus philippensis. |
| corticosteroid methanetriol mixture | |
| 4-(4-(4-fluorophenoxy)benzenesulfonylamino)tetrahydropyran-4-carboxylic acid hydroxyamide | |
| 2-(2-chloro-4-iodophenylamino)-N-cyclopropylmethoxy-3,4-difluorobenzamide | |
| Clomipramine | A dibenzoazepine that is 10,11-dihydro-5H-dibenzo[b,f]azepine which is substituted by chlorine at position 3 and in which the hydrogen attached to the nitrogen is replaced by a 3-(dimethylamino)propyl group. One of the more sedating tricyclic antidepressants, it is used as the hydrochloride salt for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
| methylethyl ketone | |
| cacalol | |
| Salmonella Vaccines | |
| valproyl-coenzyme A | |
| 3-nitrobenzo(a)pyrene | |
| dysidenin | |
| chan su | |
| 1,2,3,4-tetrahydroisoquinoline | |
| Adenosine Monophosphate | |
| Naphthyridines | |
| 2-methyl-3-(2-((4-nitrooxybutyloxy)carbonyl)vinyl)phenyl ursodeoxycholic acid ester | |
| bombesin (6-14), Tpi(6)-Leu(13)-psi(CH2NH)-Leu(14)- | |
| Serotonin Uptake Inhibitors | |
| 3-nitrobenzanthrone | |
| diisobutyl phthalate | A phthalate ester that is the diester obtained by the formal condensation of the carboxy groups of phthalic acid with two molecules of isobutanol. |
| closantel | A racemate comprising equimolar amounts of (R)- and (S)-clostanel. An anthelmintic, it is used (as the dihydrate of the sodium salt) in veterinary medicine for the treatment of fluke and nematode infections. |
| Silver Compounds | |
| physcione | |
| 15,16-dihydrotanshinone I | |
| fluoranthene | An ortho- and peri-fused polycyclic arene consisting of a naphthalene and benzene unit connected by a five-membered ring. |
| p-Dimethylaminoazobenzene | |
| phenolphthalein glucuronide | |
| carboxyatractyloside | |
| Spironolactone | A steroid lactone that is 17alpha-pregn-4-ene-21,17-carbolactone substituted by an oxo group at position 3 and an alpha-acetylsulfanyl group at position 7. |
| 2-hydroxyethyl disulfide | |
| pyrazole | A monocyclic heteroarene that is a five-membered organic heterocycle containing two nitrogen atoms at positions 1 and 2. |
| Loxapine | A dibenzoxazepine that has formula C18H18ClN3O. |
| rhodotorulic acid | A member of the class of 2,5-diketopiperazines obtained by cyclodimerisation of N(5)-acetyl-N(5)-hydroxy-L-ornithine. |
| N-(7-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-3-(2-(piperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)acrylamide | |
| (6-(4-(2-piperidin-1-ylethoxy)phenyl))-3-pyridin-4-ylpyrazolo(1,5-a)pyrimidine | A pyrazolopyrimidine that is pyrazolo[1,5-a]pyrimidine which is substituted at positions 3 and 6 by pyridin-4-yl and p-[2-(piperidin-1-yl)ethoxy]phenyl groups, respectively. It is a potent, selective, reversible, and ATP-competitive inhibitor of AMPK (AMP-activated protein kinase, EC 2.7.11.31) and a selective inhibitor of bone morphogenetic protein (BMP) signaling. |
| diacetylmonoxime | A ketoxime that has formula C4H7NO2. |
| N-methyl-3-(1-(4-(piperazin-1-yl)phenyl)-5-(4'-(trifluoromethyl)-(1,1'-biphenyl)-4-yl)-1H-pyrazol-3-yl)propanamide | |
| Carbon Tetrachloride | |
| 1,5-diaminoanthraquinone | |
| JTE 013 | |
| Devazepide | An indolecarboxamide obtained by formal condensation of the carboxy group of indole-2-carboxylic acid with the exocyclic amino group of (3S)-3-amino-1-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one. A cholecystokinin antagonist used for treatment of gastrointestinal disorders. |
| 2-cresol | |
| L 744832 | |
| carbonyl 3-chlorophenylhydrazone | |
| scoparone | A coumarin that has formula C11H10O4. |
| 2-((4-(1-methyl-4-pyridin-4-yl-1H-pyrazol-3-yl)phenoxy)methyl)quinoline | |
| desisobutyrylciclesonide | |
| Eugenol | |
| estradiol-bovine serum albumin | |
| Harmaline | A harmala alkaloid in which the harman skeleton is methoxy-substituted at C-7 and has been reduced across the 3,4 bond. |
| isoalloxazine | A benzo[g]pteridine-2,4-dione that has formula C10H6N4O2. |
| 2-(3-mercaptopropyl)pentanedioic acid | |
| azelastine | A phthalazine compound having an oxo substituent at the 1-position, a 1-methylazepan-4-yl group at the 2-position and a 4-chlorobenzyl substituent at the 4-position. |
| 2,2',4,4',5-pentachlorobiphenyl | |
| 3-(2-hydroxy-4-(1,1-dimethylheptyl)phenyl)-4-(3-hydroxypropyl)cyclohexanol | |
| Acetaldehyde | The aldehyde formed from acetic acid by reduction of the carboxy group. It is the most abundant carcinogen in tobacco smoke. |
| pivaloylcarnitine | |
| homosalate | |
| Quinpirole | A pyrazoloquinoline that is (4aR,8aR)-4,4a,5,6,7,8,8a,9-octahydro-1H-pyrazolo[3,4-g]quinoline substituted by a propyl group at position 5. It acts as a dopamine agonist. |
| Benzene Derivatives | |
| pro-diazepam | |
| NGB 2904 | |
| n-butylbenzene | |
| Toluene 2,4-Diisocyanate | A toluene meta-diisocyanate in which the isocyanato groups are at positions 2 and 4 relative to the methyl group on the benzene ring. |
| indacrinone | |
| Lysophosphatidylcholines | A compound resulting from partial hydrolysis of a phosphatidylcholine which removes one of the fatty acid groups. |
| Dihydroalprenolol | |
| cresolphthalein | |
| 2,2-bis(4-glycidyloxyphenyl)propane | |
| 11-hydroxy-5,8,12,14-eicosatetraenoic acid | |
| dibutyl maleate | |
| Sincalide | |
| dihydroartemisinin | A sesquiterpenoid compound which is used as a drug for treatment of malaria. |
| nobiletin | A flavonoid that has formula C21H22O8. |
| Astemizole | |
| 1,3-bis(4-hydroxyphenyl)-4-methyl-5-(4-(2-piperidinylethoxy)phenol)-1H-pyrazole | |
| tyrphostin A23 | |
| Nisoldipine | |
| 5-acetylneuraminyl-(2-3)-galactosyl-(1-4)-(fucopyranosyl-(1-3))-N-acetylglucosamine | |
| perilla alcohol | |
| 4-amino-4'-hydroxylaminodiphenylsulfone | |
| fluphenazine-N-mustard | |
| Atropine | A racemate composed of equimolar concentrations of (S)- and (R)-atropine . It is obtained from deadly nightshade (Atropa belladonna) and other plants of the family Solanaceae. |
| Phytochemicals | |
| alpha-conotoxin ImI | |
| MK 287 | |
| Carbidopa | The hydrate of 3-(3,4-dihydroxyphenyl)propanoic acid in which the hydrogens alpha- to the carboxyl group are substituted by hydrazinyl and methyl groups (S-configuration). Carbidopa is a dopa decarboxylase inhibitor, so prevents conversion of levodopa to dopamine. It has no antiparkinson activity by itself, but is used in the management of Parkinson's disease to reduce peripheral adverse effects of levodopa. |
| trandolapril | |
| WR 1065 | An alkanethiol that is the N-3-aminopropyl derivative of cysteamine. Used as the S-phosphorylated prodrug, amifostine, for cytoprotection in cancer chemotherapy and radiotherapy. |
| stigmatellin | |
| Soman | A phosphonic ester that has formula C7H16FO2P. |
| Hydrazones | Compounds having the structure R2C=NNR2, formally derived from aldehydes or ketones by replacing =O by =NNH2 (or substituted analogues). |
| fenpyroximate | A pyrazole acaricide that has formula C24H27N3O4. |
| pyridaben | A pyridazinone that has formula C19H25ClN2OS. |
| secomilbemycin D | |
| Environmental Pollutants | |
| sulfamic acid | The simplest of the sulfamic acids consisting of a single sulfur atom covalently bound by single bonds to hydroxy and amino groups and by double bonds to two oxygen atoms. |
| quercetagetin | A hexahydroxyflavone that is flavone substituted by hydroxy groups at positions 3, 5, 6, 7, 3' and 4' respectively. |
| Phenalenes | |
| Silymarin | |
| ethinyl estradiol, levonorgestrel drug combination | |
| imidaprilat | |
| 9,10-dihydrobenzo(a)pyrene | |
| Epirubicin | |
| costunolide | A germacranolide with anthelminthic, antiparasitic and antiviral activities. |
| leukotriene B5 | |
| dimefox | A phosphoramide that has formula C4H12FN2OP. |
| Phenanthrenes | Any benzenoid aromatic compound that consists of a phenanthrene skeleton and its substituted derivatives thereof. |
| 2-5,6,7,8,4'-pentamethoxyflavanone | |
| shikonin | A naphthoquinone that has formula C16H16O5. |
| benzo(a)fluorene | A fluorene that has formula C17H12. |
| Lasalocid | |
| Diosgenin | A sapogenin that is spirostan which is substituted by a hydroxy group at the 3beta position, contains a double bond at the 5-6 position, and has R- configuration at position 25. A natural product found in Dioscorea (wild yam) species, it is used as the starting point for the commercial synthesis of a number of steroids, including cortisone, pregnenolone and progesterone. |
| zinc chromate | |
| Diphenhydramine | An ether that is the benzhydryl ether of 2-(dimethylamino)ethanol. It is a H1-receptor antagonist used as a antipruritic and antitussive drug. |
| Antimony | |
| tangeretin | A pentamethoxyflavone flavone with methoxy groups at positions 4', 5, 6 , 7 and 8. |
| Copper Sulfate | |
| Flutamide | A (trifluoromethyl)benzene that has formula C11H11F3N2O3. |
| Acetylmuramyl-Alanyl-Isoglutamine | Muramyl dipeptide is a peptidoglycan constituent of both Gram positive and Gram negative bacteria. It is composed of N-acetylmuramic acid linked by its lactic acid moiety to the N-terminus of the dipeptide L-alanyl-D-isoglutamine. |
| 1-chloropyrene | |
| pirimiphos methyl | An organic thiophosphate that is O,O-dimethyl O-pyrimidin-4-yl phosphorothioate substituted by a methyl group at position 6 and a diethylamino group at position 2. |
| o-Aminoazotoluene | |
| 2,4,6-trichlorophenylhydrazine | |
| Ketosteroids | |
| GW 6471 | An amphetamine that has formula C35H36F3N3O5. |
| 6,7-dichloro-1H-indole-2,3-dione 3-oxime | |
| 8,5'-cyclo-2'-deoxyadenosine | |
| CF101 | |
| N,N'-p-xylene-bis-((2,2'-hydroxyiminomethyl)pyridinium) dibromide | |
| nabilone | |
| ethyl 2-amino-6-bromo-4-(1-cyano-2-ethoxy-2-oxoethyl)-4H-chromene-3-carboxylate | |
| mitoquinol | |
| NSC 366140 | |
| tris(2,3-dibromopropyl)phosphate | A trialkyl phosphate that has formula C9H15Br6O4P. |
| A 419259 | |
| emamectin benzoate | |
| 2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-7H-purin-7-yl)-N-(4-isopropylphenyl)acetamide | |
| docetaxel | |
| CGP 77675 | |
| chymostatin | A peptide that has formula C31H41N7O6. |
| Thiopental | A barbiturate, the structure of which is that of 2-thiobarbituric acid substituted at C-5 by ethyl and sec-pentyl groups. |
| Taxoids | |
| meprednisone | |
| omega-conotoxin-MVIIC | |
| Nitrous Oxide | |
| CP 199331 | |
| CP 199330 | |
| diguanosine tetraphosphate | |
| pipermethystine | |
| JM 3100 | |
| Naltrexone | An organic heteropentacyclic compound that is 4,5-epoxymorphinan-6-one substituted by a cyclopropylmethyl group at position 17 and hydroxy groups at positions 3 and 14. A mu-opioid receptor antagonist, it is used to treat alcohol dependence. |
| heptanal | A fatty aldehyde that has formula C7H14O. |
| tocotrienol, delta | |
| epicatechin gallate | |
| zacopride | |
| Holmium | A lanthanoid atom that has formula Ho. |
| 3-nitrobenzaldehyde | |
| IMM 125 | |
| Fats | |
| daidzein | A member of the class of 7-hydroxyisoflavones that is 7-hydroxyisoflavone substituted by an additional hydroxy group at position 4'. |
| pepstatin | A peptide that has formula C34H63N5O9. |
| nociceptin | |
| Fonofos | An organothiophosphate insecticide that has formula C10H15OPS2. |
| Leukotriene A4 | A leukotriene that is the (5S,6S)-epoxy derivative of (7E,9E,11Z,14Z)-icosa-7,9,11,14-tetraenoic acid. |
| KJM 429 | |
| thrombin receptor-activating peptide SFLLRNPNDKY | |
| acanthoic acid | |
| 1,1-bis(3'-indolyl)-1-(4-hydroxyphenyl)methane | |
| phosphatidylethanolamine | |
| hyodeoxycholic acid | A member of the class of 5beta-cholanic acids that is (5beta)-cholan-24-oic acid substituted by alpha-hydroxy groups at positions 3 and 6. |
| Vitamin B 6 | |
| Paclitaxel | A tetracyclic diterpenoid isolated originally from the bark of the Pacific yew tree, Taxus brevifolia. It is a mitotic inhibitor used in cancer chemotherapy. Note that the use of the former generic name 'taxol' is now limited, as Taxol is a registered trade mark. |
| 4-(2-pyridylazo)resorcinol | |
| 5-((3-cyclobutyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)oxy)-N-methyl-2-pyrazinecarboxamide | |
| lithospermate B | |
| MSX 3 compound | |
| acetyl methyl tetramethyl tetralin | |
| Anti-Asthmatic Agents | |
| MHY966 | |
| Estriol | |
| 2-hydroxypyridine | |
| Metalloporphyrins | |
| Coproporphyrins | |
| chloropicrin | A C-nitro compound that is nitromethane in which all three hydrogens are replaced by chlorines. It is a severe irritant, and can cause immediate, severe inflammation of the eyes, nose and throat, and significant injuries to the upper and lower respiratory tract. Formerly stockpiled as a chemical warfare agent, it has been widely used in the US as a soil fumigant, particularly for strawberry crops. It is not approved for use within the European Union. |
| 7-nitroindazole | |
| englitazone | |
| 10-(6'-ubiquinonyl)decyltriphenylphosphonium bromide | |
| ICI 198615 | |
| Tranylcypromine | An alkylamine that has formula C9H11N. |
| Tetrachloroethylene | |
| benzylamine | A primary amine compound having benzyl as the N-substituent. It has been isolated from Moringa oleifera (horseradish tree). |
| lubiprostone | |
| modafinil | |
| UAMC00039 | |
| Freund's Adjuvant | |
| dioxinodehydroeckol | |
| N(2)-(2-aminocyclohexyl)-N(6)-(3-chlorophenyl)-9-ethyl-9H-purine-2,6-diamine | |
| Tetanus Toxin | |
| 15-deoxyprostaglandin J2 | |
| 3-deoxyestrone | A steroid that has formula C18H22O. |
| acetylenedicarboxylic acid dimethyl ester | |
| Arecoline | A tetrahydropyridine that is 1,2,5,6-tetrahydropyridine with a methyl group at position 1, and a methoxycarbonyl group at position 3. An alkaloid found in the areca nut, it acts as an agonist of muscarinic acetylcholine. |
| S 2366 | |
| 2-amino-1-phenylethanol | The simplest member of the class of phenylethanolamines that is 2-aminoethanol bearing a phenyl substituent at the 1-position. The parent of the phenylethanolamine class. |
| diisopropyl 1,3-dithiol-2-ylidenemalonate | |
| GW 4064 | A stilbenoid that has formula C28H22Cl3NO4. |
| ethyl-p-hydroxybenzoate | |
| 2H-Benzo(a)quinolizin-2-ol, 2-Ethyl-1,3,4,6,7,11b-hexahydro-3-isobutyl-9,10-dimethoxy- | |
| ginsan | |
| BGC638 | |
| Chlordiazepoxide | A benzodiazepine that is 3H-1,4-benzodiazepine 4-oxide substituted by a chloro group at position 7, a phenyl group at position 5 and a methylamino group at position 2. |
| Barbital | |
| ethyl 8-oxo-8H-acenaphtho(1,2-b)pyrrole-9-carboxylate | |
| testosterone-3-carboxymethyloxime-bovine serum albumin conjugate | |
| 3,3-dimethylallyl pyrophosphate | |
| dehydrodiisoeugenol | |
| mibolerone | An androgen that is nalandrone carrying two methyl substituents at positions 7alpha and 17. |
| 2',5'-dideoxyadenosine | |
| Agmatine | A primary amino compound that has formula C5H14N4. |
| Gentian Violet | |
| 2-(3,4-dimethoxyphenyl)-5-fluorobenzothiazole | |
| 17-phenyltrinorprostaglandin E2 | |
| Ro 19-8022 | |
| NPLC 0393 | |
| S-allylcysteine | An S-hydrocarbyl-L-cysteine that is L-cysteine in which the hydrogen attached to the sulphur is replaced by a prop-2-enyl group. It commonly occurs in garlic and has been found to exhibit antineoplastic activity. |
| 10-decarbamoylmitomycin C | |
| Dipeptides | |
| Cannabinol | |
| Benzoic Acid | A compound comprising a benzene ring core carrying a carboxylic acid substituent. |
| RS194B | |
| beta-damascenone | A cyclic monoterpene ketone that is 2,6,6-trimethylcyclohexa-1,3-diene substituted at position 1 by a crotonoyl group. |
| peginterferon alfa-2b | |
| SRT1720 | |
| Oils, Volatile | |
| norbolethone | |
| 8-methoxymethyl-3-isobutyl-1-methylxanthine | |
| 2,4-hexadienal | A fatty aldehyde that has formula C6H8O. |
| Vascular Endothelial Growth Factors | |
| Xanthones | Any member of the class of xanthenes based on a xanthone skeleton. |
| Nickel | Chemical element (nickel group element atom) with atomic number 28. |
| bu-zhong-yi-qi-tang | |
| terutroban | |
| Thioctic Acid | |
| N-(2-methyl-3-hydroxyphenyl)-5,8,11,14-eicosatetraenamide | |
| muricholic acid | |
| Levallorphan | |
| Fluphenazine | A member of the class of phenothiazines that is 10H-phenothiazine having a trifluoromethyl subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. |
| 5-(2,2-difluorobenzo(1,3)dioxol-5-ylmethylene)thiazolidine-2,4-dione | |
| Gasoline | |
| Oximes | Compounds of structure R2C=NOH derived from condensation of aldehydes or ketones with hydroxylamine. Oximes from aldehydes may be called aldoximes; those from ketones may be called ketoximes. |
| 3,4-dihydroxyphenylethanol | |
| Penicillamine | |
| topiramate | A hexose derivative that is 2,3:4,5-di-O-isopropylidene-beta-D-fructopyranose in which the hydroxy group has been converted to the corresponding sulfamate ester. It blocks voltage-dependent sodium channels and is used as an antiepileptic and for the prevention of migraine. |
| Trihalomethanes | |
| eupatorin | |
| decitabine | |
| ginsenoside Rb1 | A ginsenoside found in Panax ginseng and Panax japonicus var. major that is ginsenoside Rd in which the beta-D-glucopyranoside group at position 20 is replaced by a beta-D-glucopyranosyl-beta-D-glucopyranoside group. |
| tariquidar | |
| brequinar | |
| ginsenoside Rb2 | A ginsenoside found in Panax ginseng that is dammarane which is substituted by hydroxy groups at the 3beta, 12beta and 20 pro-S positions, in which the hydroxy groups at positions 3 and 20 have been converted to the corresponding beta-D-glucopyranosyl-(1->2)-beta-D-glucopyranoside and alpha-L-arabinopyranosyl-(1->6)-beta-D-glucopyranoside respectively, and in which a double bond has been introduced at the 24-25 position. |
| Antibodies, Antineutrophil Cytoplasmic | |
| technetium Tc 99m 1,2-bis(bis(2-ethoxyethyl)phosphino)ethane | |
| N-n-propylnorapomorphine | |
| BQ 788 | |
| CGP 42112A | |
| cholest-4-en-3-one | A cholestanoid that is cholest-4-ene substituted by an oxo group at position 3. |
| rhein | An anthracene that has formula C15H8O6. |
| myrtecaine | |
| 3-(4-azidobenzoyl)-6-hydroxy-2-(4-hydroxyphenyl)benzo(b)thiophene | |
| dimemorfan | |
| Vasodilator Agents | A drug used to cause dilation of the blood vessels. |
| FK 565 | |
| acetoacetyl CoA | A 3-oxoacyl-CoA that results from the formal condensation of the thiol group of coenzyme A with the carboxy group of acetoacetic acid. |
| 3-(2,4-dimethoxybenzylidene)anabaseine | |
| GABA Modulators | A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| oxamflatin | |
| Bisecurin I | |
| GW 7604 | |
| HS 1200 | |
| hachimijiogan | |
| 2-thiomalic acid | |
| binospirone mesylate | |
| phosphatidylinositol 4-phosphate | A phosphatidylinositol monophosphate carrying the phosphate group at the 4-position. |
| 1-hexacosanol | |
| Anticoagulants | An agent that prevents blood clotting. |
| pregabalin | |
| dimethomorph | A mixture of (E)- and (Z)-dimethomorph in an unspecified ratio. It is used as a systemic fungicide used on vines, potatoes, and greenhouse crops; only the Z isomer has fungicidal activity. |
| alpha-hydroxyalprazolam | |
| Butylhydroxybutylnitrosamine | |
| chloroacetamide | |
| vinyl carbamate | A carbamate ester that has formula C3H5NO2. |
| 9-ethynylphenanthrene | |
| RS 8359 | |
| mangostin | |
| beta-tricalcium phosphate | |
| 25-hydroxycholesterol | A 25-hydroxy steroid that has formula C27H46O2. |
| Adjuvants, Immunologic | |
| isofagomine | |
| ethyl 4-(4-((2-hydroxy-3-(4-hydroxy-3-((methylsulfonyl)amino)phenoxy)propyl)amino)cyclohexyl)benzoate | |
| Phytosterols | |
| bendamustine | |
| Haloperidol | A compound composed of a central piperidine structure with hydroxy and p-chlorophenyl substituents at position 4 and an N-linked p-fluorobutyrophenone moiety. |
| Blood Glucose | |
| anpirtoline | |
| (4-(5-(4-fluorophenyl)-2-methylsulfanyl-3H-imidazol-4-yl)pyridin-2-yl)-(1-phenylethyl)amine | |
| benzoylmesaconine | |
| isonicotinamide | A pyridinecarboxamide that is the monocarboxylic acid amide derivative of isonicotinic acid. |
| 2,4,5-trihydroxyphenylalanine quinone | |
| 3'-dimethylaminoflavone | |
| isothiazolidinone | |
| Hydrolyzable Tannins | A tannin that yields gallic or ellagic acids upon acid hydrolysis. |
| protoporphyrin IX | |
| Zinostatin | |
| mocetinostat | |
| N-(4-methoxybenzyl)-N'-(5-nitro-1,3-thiazol-2-yl)urea | |
| Heptachlor Epoxide | An oxane that has formula C10H5Cl7O. |
| (1R-(exo,exo))-3-(4-fluorophenyl)-8-methyl-8- azabicyclo(3.2.1)octane-2-carboxylic acid, methyl ester | |
| disodium (R,R)-5-(2-((2-(3-chlorophenyl)-2-hydroxyethyl)-amino)propyl)-1,3-benzodioxole-2,3-dicarboxylate | |
| Mequindox | |
| Industrial Waste | |
| N-acetyl-S-(2-carbamoylethyl)cysteine | |
| butylparaben | |
| Amlodipine | A fully substituted dialkyl 1,4-dihydropyridine-3,5-dicarboxylate derivative, which is used for the treatment of hypertension, chronic stable angina and confirmed or suspected vasospastic angina. |
| B 581 | A dipeptide obtained from the tetrapeptide Cys-Val-Phe-Met by reduction of the amide carbonyl groups of the Cys and Val residues. |
| 2,6-dichloro-4-nitrophenol | |
| 4-diphenylacetoxy-N-methylpiperidine methobromide | |
| 5-iodo-3-((3,5-dibromo-4-hydroxyphenyl)methylene)-2-indolinone | |
| Hydroquinones | Benzenediol compounds having the hydroxy substituents in the 1- and 4-positions. |
| tungsten carbide | |
| Memantine | |
| 7-ketolithocholic acid | |
| Acids | |
| 3-thiomethyl-5,6-(dimethoxyphenyl)-1,2,4-triazine | |
| E 5842 | |
| Dichloroacetic Acid | An organochlorine compound comprising acetic acid carrying two chloro substituents at the 2-position. It occurs in nature in seaweed, Asparagopsis taxiformis. |
| pyridine | An azaarene comprising a benzene core in which one -CH group is replaced by a nitrogen atom. It is the parent compound of the class pyridines. |
| hydroxycitronellal | The tertiary alcohol arising from addition of water across the C=C double bond of citronellal. |
| irosustat | |
| 2,3-dinitrophenol | A dinitrophenol that has formula C6H4N2O5. |
| Cyproterone Acetate | A chlorinated steroid that has formula C24H29ClO4. |
| Iodine | A monoatomic iodine that has formula I. |
| darifenacin | |
| memoquin | |
| 2,3-dihydroxybenzoic acid | A dihydroxybenzoic acid that is benzoic acid substituted by hydroxy groups at positions 2 and 3. It occurs naturally in Phyllanthus acidus and in the aquatic fern Salvinia molesta. |
| BCH 2763 | |
| PP242 | |
| Terazosin | A piperazine that has formula C19H25N5O4. |
| Desogestrel | |
| benzamide | An aromatic amide that consists of benzene bearing a single carboxamido substituent. The parent of the class of benzamides. |
| methylphosphonfluoridate | |
| (5,6-dimethoxyindan-2-yl)dipropylamine | |
| Calcium Channel Blockers | One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| pipecolic acid | A piperidinemonocarboxylic acid in which the carboxy group is located at position C-2. |
| periciazine | |
| Butoxamine | |
| astragaloside A | A pentacyclic triterpenoid that is cycloastragenol having beta-D-xylopyranosyl and beta-D-glucopyranosyl residues attached at positions O-3 and O-6 respectively. It is isolated from Astragalus membranaceus var mongholicus. |
| abamectin | Mixture of 80% avermectin B1a and 20% avermectin B1b. |
| RTI 55 | |
| Phellinus linteus extract | |
| CP 47497 | |
| Dibutyl Phthalate | |
| Rifampin | |
| Dihydroxyphenylalanine | |
| 1,2,3,6,7,8-hexachlorodibenzodioxin | A dibenzodioxine that has formula C12H2Cl6O2. |
| GW 274150 | |
| Chitosan | |
| hydroxybupropion | |
| bifeprunox | |
| aplidine | |
| O(6)-benzyl-2'-deoxyguanosine | |
| AG-041R | |
| 3'-dehydrolutein | |
| flavone | The simplest member of the class of flavones that consists of 4H-chromen-4-one bearing a phenyl substituent at position 2. |
| 2-hydroxy-9-cis-octadecenoic acid | |
| dihydrolipoamide | A dithiol that has formula C8H17NOS2. |
| glycyrol | A coumestan that has formula C21H18O6. |
| 4-hydroxychalcone | |
| 7-(3-(3-hydroxy-4-(4'-iodophenoxy)-1-butenyl)-7-oxabicyclo(2.2.1)heptan-2-yl)-5-heptenoic acid | |
| baohuoside I | |
| S-phenyl-N-acetylcysteine | |
| Amsacrine | |
| 14-O-methyloxymorphone | |
| Molindone | |
| benzo(a)pyrene-3,6-quinone | |
| Heterocyclic Compounds, 1-Ring | |
| vinyl fluoride | |
| apocarotenal | |
| dehydroandrographolide | |
| 4-(1-benzenesulfonyl-1H-indol-2-yl)-4-hydroxycyclohexa-2,5-dienone | |
| Linolenic Acids | Any of two trienoic essential fatty acids; a nutrient essential to the formation of prostaglandins. Also used in making paints and synthetic resins. |
| ampelopsin | |
| N-(4-(4-(3-aminocarbonyl-phenyl)-piperazin-1-yl)-butyl)-4-bromo-benzamide | |
| dimethyl-W84 | |
| Metipranolol | 3-(Propan-2-ylamino)propane-1,2-diol in which the hydrogen of the primary hydroxy group is substituted by a 4-acetoxy-2,3,5-trimethylphenoxy group. A non-cardioselective beta-blocker, it is used to lower intra-ocular pressure in the management of open-angle glaucoma. |
| potassium bromate | A bromate salt that has formula BrKO3. |
| FPL 64176 | 1H-Pyrrole substituted at C-2 and -5 by methyl groups, at C-3 by methoxycarbonyl and at C-4 by a 2-benzylbenzoyl group. |
| neosolaniol | |
| Amines | A compound formally derived from ammonia by replacing one, two or three hydrogen atoms by hydrocarbyl groups. |
| ayanin | |
| dichlofenthion | An organic thiophosphate that has formula C10H13Cl2O3PS. |
| olodaterol | A member of the class of benzoxazine that is 6-hydroxy-1,4-benzoxazin-3-one in which the hydrogen at position 4 is replaced by a (1R)-1-hydroxy-2-{[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino}ethyl group. Used (as its hydrochloride salt) for long-term treatment of airflow obstruction in patients with chronic obstructive pulmonary disease including chronic bronchitis and/or emphysema. |
| Butylated Hydroxytoluene | |
| casiopeina II-glycine | |
| Vinca Alkaloids | |
| Retinaldehyde | |
| SB 218078 | |
| d,d-T80-prallethrin | |
| benidipine | |
| aniracetam | |
| methyl isothiocyanate | An isothiocyanate having a methyl group attached to the nitrogen. |
| Dextropropoxyphene | The (1S,2R)-(+)-diastereoisomer of propoxyphene. |
| BBR 3464 | |
| punicic acid | A 9,11,13-octadecatrienoic acid having its double bonds in cis, trans and cis configurations, respectively. It has been isolated from pomegranate (Punica granatum). |
| Estrogens, Catechol | |
| 4,4,',4'',4'''-(carbonylbis(imino-5,1,3-benzenetriylbis(carbonylimino)))tetrakis(benzene-1,3-disulfonate) | |
| Toxic Actions | |
| rifapentine | |
| Mecamylamine | |
| gentiopicroside | |
| Benzoflavones | |
| propionylcholine | |
| nootkatone | A sesquiterpenoid that has formula C15H22O. |
| N'-((2-hydroxyphenyl)carbonothioyl)pyridine-2-carbohydrazide | |
| 2-phenyl-4-(3-pyridin-2-yl-1H-pyrazol-4-yl)pyridine | |
| cetrorelix | |
| nimetazepam | A nitrazepam which is substituted at positions 1 by a methyl groups. It is used as an anticonvulsant and as a hypnotic for the short-term management of insomnia. |
| 4-O-decyl-gabosine D | |
| 4,4 -(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bis(phenol) | |
| 17-alpha-hydroxy-progesterone caproate | |
| 1,2-diamino-4-nitrobenzene | |
| SB 206553 | A pyrroloindole that has formula C17H16N4O. |
| 2-chloro-4'-methoxychalcone | |
| gadodiamide | A non-ionic gadolinium chelate having a macrocyclic triamine framework. It is used as a paramagnetic contrast agent in magnetic resonance imaging (MRI). |
| adenosine 5'-tetraphosphate | An organophosphate oxoanion that is the pentaanionic form of adenosine 5'-tetraphosphate. |
| Ginkgolides | |
| Thioacetamide | A thiocarboxamide consiting of acetamide having the oxygen replaced by sulfur. |
| Etodolac | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl moiety. A preferential inhibitor of cyclo-oxygenase 2 and non-steroidal anti-inflammatory, it is used for the treatment of rheumatoid arthritis and osteoarthritis, and for the alleviation of postoperative pain. Administered as the racemate, only the (S)-enantiomer is active. |
| Saralasin | |
| O(6)-benzyl-N-acetylguanosine | |
| chromous chloride | |
| isomenthone | |
| Ephedrine | A phenethylamine alkaloid that is 2-phenylethanamine substituted by a methyl group at the amino nitrogen and a methyl and a hydroxy group at position 2 and 1 respectively. |
| JP8 aviation fuel | |
| vinclozolin | A racemate comprising equimolar amounts of (R)- and (S)-vinclozolin. A fungicide used mainly on oilseed rape, vines, fruit and vegetables to control Botrytis, Sclerotinia and Monilia spp. |
| dibenzoanthracene-1,2-dihydrodiol | |
| 5-alpha-Dihydroprogesterone | |
| 2-methoxyoestrone-3-O-sulphamate | |
| N,N'-bis(2-hydroxybenzyl)ethylenediamine-N,N'-diacetic acid | |
| 6-methylsulfinylhexyl isothiocyanate | |
| calcitonin gene-related peptide (8-37) | |
| Atracurium | A diester compound consisting of pentane-1,5-diol with both hydroxyls bearing 3-[1-(3,4-dimethoxybenzyl)-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolinium-2(1H)-yl]propanoyl groups. |
| glucogallin | |
| 13,14-dihydro-15-ketoprostaglandin D2 | A prostaglandins D that has formula C20H32O5. |
| hexafluoroisopropanol glucuronide | |
| Flecainide | |
| Adenine Nucleotides | |
| isoliquiritigenin | A member of the class of chalcones that is trans-chalcone hydroxylated at C-2', -4 and -4'. |
| copper (N-2-hydroxyacetophenone)glycinate | |
| bisnaphthalimidopropylspermidine | |
| Ornidazole | |
| nitazoxanide | |
| Butylated Hydroxyanisole | |
| N-(2-(m-methoxyphenyl)ethyl)-N-ethyl-2-(1-pyrrolidinyl)ethylamine | |
| S 145 | |
| Dicyclomine | The ester resulting from the formal condensation of 1-cyclohexylcyclohexanecarboxylic acid with 2-(diethylamino)ethanol. An anticholinergic, it is used as the hydrochloride to treat or prevent spasm in the muscles of the gastrointestinal tract, particularly that associated with irritable bowel syndrome. |
| Sulfamethoxazole | An isoxazole (1,2-oxazole) compound having a methyl substituent at the 5-position and a 4-aminobenzenesulfonamido group at the 3-position. |
| N-hydroxy-N'-(4-butyl-2-methylphenyl)formamidine | |
| Sulfanilamides | |
| 3-Pyridinecarboxylic acid, 1,4-dihydro-2,6-dimethyl-5-nitro-4-(2-(trifluoromethyl)phenyl)-, Methyl ester | |
| 3-(4-((2,6-dichloropyridin-4-yl)ethynyl)phenyl)propanoic acid | |
| Monocrotaline | A pyrrolizidine alkaloid that has formula C16H23NO6. |
| ferric pyrophosphate | |
| delphinidin 3-O-glucopyranoside | |
| NSC 680410 | |
| Kainic Acid | A pyrrolidinecarboxylic acid that has formula C10H15NO4. |
| Desmodium gangeticum extract | |
| hexafluoron | |
| 4-(3-(2-propyl-3-hydroxy-4-acetyl)phenoxy)propyloxyphenoxy acetic acid | |
| piperine | A N-acylpiperidine that is piperidine substituted by a (1E,3E)-1-(1,3-benzodioxol-5-yl)-5-oxopenta-1,3-dien-5-yl group at the nitrogen atom. It is an alkaloid isolated from the plant Piper nigrum. |
| senecionine | A pyrrolizidine alkaloid isolated from the plant species of the genus Senecio. |
| Oxazepam | A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a chloro group at position 7, a hydroxy group at position 3 and phenyl group at position 5. |
| Ketorolac | |
| alachlor | An aromatic amide that is N-(2,6-diethylphenyl)acetamide substituted by a methoxymethyl group at at the nitrogen atom while one of the hydrogens of the methyl group has been replaced by a chlorine atom. |
| 4-(4-(3-(pyridin-2-yl)-1H-pyrazol-4-yl)pyridin-2-yl)-N-(tetrahydro-2H-pyran-4-yl)benzamide | |
| methyl methanethiosulfonate | |
| Azacitidine | |
| 2,6-diaminohexanoic acid (4-(5-fluorobenzothiazol-2-yl)-2-methylphenyl)amide | |
| Phosphatidylcholines | A glycerophosphocholine compound having O-acyl substituents at both the 1- and 2-positions of the glycerol. It is a major constituent of cell membranes. |
| N-hydroxy-4-acetylaminobiphenyl | A hydroxamic acid that is biphenyl-4-amine bearing N-hydroxy and N-acetyl substituents. |
| 2-(2-chloro-4-iodophenylamino)-N-cyclopropylmethoxy-3,4-difluoro-5-bromobenzamide | |
| Cocaine | A tropane alkaloid obtained from leaves of the South American shrub Erythroxylon coca. |
| 14-phenylpropoxymetopon | |
| Putrescine | A four-carbon alkane-alpha,omega-diamine. It is obtained by the breakdown of amino acids and is responsible for the foul odour of putrefying flesh. |
| phosphoaspirin | |
| 3,4,8-trimethylimidazo(4,5-f)quinoxalin-2-amine | |
| 6-(1-(4-fluoro-2-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)-2H-1,4-benzoxazin-3(4H)-one | |
| 4-phenylbenzoic acid | |
| fludioxonil | A member of the class of benzodioxoles that is 2,2-difluoro-1,3-benzodioxole substituted at position 4 by a 3-cyanopyrrol-4-yl group. A fungicide seed treatment for control of a range of diseases including Fusarium, Rhizoctonia and Alternaria. |
| N-(3-(2-dimethylamino)ethoxy-4-methoxyphenyl)-2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)-(1,1'-biphenyl)-4-carboxamide | |
| tizanidine | 2,1,3-Benzothiadiazole substituted at C-4 by a Delta(1)-imidazolin-2-ylamino group and at C-4 by a chloro group. It is an agonist at alpha2-adrenergic receptor sites. |
| fipexide | |
| Antigens, Dermatophagoides | |
| Citric Acid | A tricarboxylic acid that is propane-1,2,3-tricarboxylic acid bearing a hydroxy substituent at position 2. It is an important metabolite in the pathway of all aerobic organisms. |
| formosanin C | |
| MK0626 | |
| kappa-casein glycomacropeptide | |
| 3-hydroxy-17-(1H-1,2,3-triazol-1-yl)androsta-5,16-diene | |
| E 4021 | |
| keyhole-limpet hemocyanin | |
| 9-(3-hydroxy-2-phosphonylmethoxypropyl)adenine | |
| Physostigmine | An indole alkaloid that has formula C15H21N3O2. |
| Xylenes | |
| 1,2,5,6-dibenzanthracene | |
| methylmercury sulfide | |
| 7-(N,N-dipropylamino)-5,6,7,8-tetrahydronaphtho(2,3-b)dihydro-2,3-furan | |
| bromperidol | |
| Barium Sulfate | |
| lignoceric acid | A C24 straight-chain saturated fatty acid. |
| Allyl Compounds | |
| 2,2',3,3',4,4',6,6'-octabromodiphenyl ether | |
| Pteroylpolyglutamic Acids | |
| IRL 1620 | |
| 5-(N,N-hexamethylene)amiloride | A member of the class of pyrazines that is amiloride in which the two amino hydrogens at position N-5 are replaced by a hexamethylene moiety, resulting in the formation of an azepane ring. |
| ethylene dimethanesulfonate | |
| sirtinol | A benzamide obtained by formal condensation of the carboxy group of 2-{[(2-hydroxy-1-naphthyl)methylene]amino}benzoic acid with the amino group of 1-phenylethylamine. |
| JK184 | |
| HCV 796 | |
| Cys(11)-Cys(15)-endothelin-1 (11-21) | |
| benzo(f)quinoline | |
| Farnesol | |
| trimethyltin hydroxide | |
| benz(a)anthracene | |
| FR 139317 | |
| Nimustine | An organochlorine compound that is urea in which the two hydrogens on one of the amino groups are replaced by nitroso and 2-chloroethyl groups and one hydrogen from the other amino group is replaced by a 4-amino-2-methylpyrimidin-5-ylmethyl] group. An antineoplastic agent especially effective against malignant brain tumors. |
| nateglinide | |
| didecyl phthalate | |
| 4-methoxyamphetamine | |
| Indoprofen | A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(1-oxo-1,3-dihydroisoindol-2-yl)phenyl group. Initially used as an anti-inflammatory and analgesic, it was withdrawn from the market due to causing severe gastrointestinal bleeding. It has been subsequently found to increase production of the survival motor neuron protein. |
| urushiol | |
| dauricine | A member of the class of isoquinolines resulting from the formal oxidative dimerisation of 4-{[(1R)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl}phenol by attachment of the phenolic oxygen of one molecule to the benzene ring of the second (ortho to the phenolic hydroxy group of the latter). |
| Tetracaine | A benzoate ester in which 4-N-butylbenzoic acid and 2-(dimethylamino)ethanol have combined to form the ester bond; a local ester anaesthetic (ester caine) used for surface and spinal anaesthesia. |
| CQA 206-291 | |
| Ethylene Oxide | |
| 5,7-dihydroxy-3-(3-hydroxy-4-methoxybenzyl)-6-methoxychroman-4-one | |
| BO-1012 | |
| 9-cis-retinal | A retinal in which the double bond at position 9 has cis configuration, whilst the remaining acyclic double bonds have trans configuration. |
| 2-methoxy-N-(3-(4-((3-methyl-4-((6-methyl-3-pyridinyl)oxy)phenyl)amino)-6-quinazolinyl)-2-propenyl)acetamide | |
| FD137 nitrosourea | |
| torsemide | |
| hydratropic acid | A 2-arylpropionic acid carrying a phenyl group at position 2. It is a metabolite of alpha-methylstyrene (AMS), a volatile hydrocarbon. |
| Y 27632 | A monocarboxylic acid amide that is trans-[(1R)-1-aminoethyl]cyclohexanecarboxamide in which one of the nitrogens of the aminocarbony group is substituted by a pyridine nucleus. It has been shown to exhibit inhibitory activity against Rho-associated protein kinase (ROCK) enzyme. |
| wortmannin | A delta-lactone that has formula C23H24O8. |
| PD 198306 | |
| Deoxyglucose | A deoxyhexose comprising glucose having at least one hydroxy group replaced by hydrogen. |
| N-oleoyldopamine | A fatty amide that has formula C26H43NO3. |
| 5,5'-bis(8-(phenylamino)-1-naphthalenesulfonate) | |
| Triclosan | An aromatic ether that is phenol which is substituted at C-5 by a chloro group and at C-2 by a 2,4-dichlorophenoxy group. It is widely used as a preservative and antimicrobial agent in personal care products such as soaps, skin creams, toothpaste and deodorants as well as in household items such as plastic chopping boards, sports equipment and shoes. |
| orantinib | |
| lead nitrate | A lead coordination entity that has formula N2O6Pb. |
| T-2 Toxin | A trichothecene that has formula C24H34O9. |
| bioallethrin | |
| titanium dioxide | A titanium molecular entity that has formula O2Ti. |
| gamma-Tocopherol | A tocopherol in which the chroman-6-ol core is substituted by methyl groups at positions 7 and 8. It is found particularly in maize (corn) oil and soya bean (soybean) oils. |
| roxatidine acetate | |
| azadiradione | A tetracyclic triterpenoid that is 4,4,8-trimethylandrosta-1,14-diene substituted by oxo groups at positions 3 and 16, an acetoxy group at position 7 and a furan-3-yl group at position 17. Isolated from Azadirachta indica, it exhibits antimycobacterial and anti-inflammatory activities. |
| venlafaxine | A tertiary amino compound that is N,N-dimethylethanamine substituted at position 1 by a 1-hydroxycyclohexyl and 4-methoxyphenyl group. |
| Naphthoquinones | A polycyclic aromatic ketone metabolite of naphthalene. |
| melagatran | A member of the class of azetidines that is (2S)-azetidine 2-carboxylic acid in which the carboxylic acid has been converted to the amide corresponding to formal condensation with 4-(aminomethyl)benzenecarboximidamide and in which the hydrogen attached to the azetidine nitrogen is replaced by a (2R)-2-cyclohexyl-2-[(carboxymethyl)amino]acetyl group. |
| pemetrexed | |
| chong-myung-tang | |
| Hemin | |
| Phosphatidic Acids | |
| Tamoxifen | A stilbenoid that has formula C26H29NO. |
| AN 238 | |
| Thiostrepton | A heterodetic cyclic peptide, in which the cyclisation step involves a formal lactonisation between the carboxy group of a quinaldic acid-based residue and a secondary alcohol. An antibiotic that inhibits bacterial protein synthesis. Also acts as an antitumor agent. |
| Xanthenes | |
| Phenylephrine | A member of the class of the class of phenylethanolamines that is 2-(methylamino)ethanol substituted by a 3-hydroxyphenyl group at position 1. |
| reboxetine | |
| imirestat | |
| alclofenac | An aromatic ether in which the ether oxygen links an allyl group to the 4-position of (3-chlorophenyl)acetic acid.A non-steroidal anti-inflammatory drug, it was withdrawn from the UK market in 1979 due to concerns with its association with vasculitis and rash. |
| uranyl acetate | |
| 1,3-dipropyl-8-(2-amino-4-chlorophenyl)xanthine | |
| fucoxanthin | A natural product found in Sporochnus comosus. |
| 8-((4-chlorophenyl)thio)cyclic-3',5'-AMP | |
| asarone | A phenylpropanoid that is benzene substituted by methoxy groups at positions 1, 2 and 4 and a propen-1-yl group at position 5. It has been isolated from Acorus. |
| glycolamide | |
| 3-(2-methoxybenzylamino)-2-phenylpiperidine | |
| 2-(4-morpholino)ethyl-1-phenylcyclohexane-1-carboxylate | |
| Raclopride | |
| benzo(e)pyrene | An ortho- and peri-fused polycyclic arene consisting of five fused benzene rings. It is listed as a Group 3 carcinogen by the IARC. |
| cotylenin A | |
| chromium nitrate | |
| Glycerol | A triol with a structure of propane substituted at positions 1, 2 and 3 by hydroxy groups. |
| suxibuzone | A member of the class of pyrazolidines that is phenylbutazone which is substituted by a 3-carboxypropanoylmethyl group at the 4-position. Suxibuzone is a prodrug for phenylbutazone and is commonly used as an anti-inflammatory drug in horses. |
| Hydroxysteroids | |
| 2,5-dimethylcelecoxib | |
| triflumizol | |
| pioglitazone | A member of the class of thiazolidenediones that is 1,3-thiazolidine-2,4-dione substituted by a benzyl group at position 5 which in turn is substituted by a 2-(5-ethylpyridin-2-yl)ethoxy group at position 4 of the phenyl ring. It exhibits hypoglycemic activity. |
| diethylene glycol | A hydroxyether that has formula C4H10O3. |
| carbazeran | |
| STX 213 | |
| 2-iodo-7,8-dibromodibenzo-1,4-dioxin | |
| 6-N,N-diethyl-beta,gamma-dibromomethylene-D-ATP | |
| Nucleotides | |
| 4-nitrophenethyl bromide | |
| Selenic Acid | A selenium oxoacid that has formula H2O4Se. |
| sildenafil | |
| cidofovir | |
| Aroclor 1016 | |
| Anisoles | |
| hexabromodiphenyl ether 154 | |
| Cytotoxins | |
| linalool | A monoterpenoid that is octa-1,6-diene substituted by methyl groups at positions 3 and 7 and a hydroxy group at position 3. It has been isolated from plants like Ocimum canum. |
| belinostat | A hydroxamic acid-type histone deacetylase (HDAC) inhibitor with antineoplastic activity. |
| Uridine Diphosphate | |
| epoxiconazole | A racemate composed of equimolar amounts of (2S,3R)- and (2R,3S)-epoxiconazole. A broad-spectrum fungicide for control of diseases caused by Ascomycetes, Basidiomycetes and Deuteromycetes. Epoxiconazole is moderately toxic to birds, honeybees, earthworms and most aquatic organisms. |
| E 3040 | A benzothiazole that has formula C16H17N3OS. |
| Selenium | A chalcogen that has formula Se. |
| silver chloride | |
| p-Aminohippuric Acid | An N-acylglycine that is the 4-amino derivative of hippuric acid; used as a diagnostic agent in the measurement of renal plasma flow. |
| picolinic acid | |
| gamma-resorcylic acid | |
| Petroleum | |
| epigallocatechin gallate | |
| LY 290042 | |
| dioscin | A spirostanyl glycoside that consists of the trisaccharide alpha-L-Rha-(1->4)-[alpha-L-Rha-(1->2)]-beta-D-Glc attached to position 3 of diosgenin via a glycosidic linkage. |
| 4-(3-pentylamino)-2,7-dimethyl-8-(2-methyl-4-methoxyphenyl)pyrazolo(1,5-a)pyrimidine | |
| 9-deaza-9-(3-thienylmethyl)guanine | |
| Tolbutamide | An N-sulfonylurea that consists of 1-butylurea having a tosyl group attached at the 3-position. |
| Recombivax HB | |
| Streptozocin | |
| omega-agatoxin-Aa4b | |
| 2,4,6-tribromophenol | A bromophenol that is phenol substituted by bromo groups at positions 2, 4 and 6. It is commonly used as a fungicide and in the preparation of flame retardants. |
| Ethanol | A primary alcohol that is ethane in which one of the hydrogens is substituted by a hydroxy group. |
| Coloring Agents | |
| Silver | A copper group element atom that has formula Ag. |
| fluorescein glucuronide | |
| fomesafen | An aromatic ether that has formula C15H10ClF3N2O6S. |
| OM99-2 | |
| dactolisib | An imidazoquinoline that is 3-methyl-2-oxo-2,3-dihydro-1H-imidazo[4,5-c]quinoline substituted at position 1 by a 4-(1-cyanoisopropyl)phenyl group and at position 8 by a quinolin-3-yl group. A dual PI3K/mTOR inhibitor used in cancer treatment. |
| DMU-212 | |
| THRX 165724 | |
| Nicotinic Acids | |
| copper histidine | |
| Xylitol | |
| imisopasem manganese | |
| undecanoic acid | A straight-chain, eleven-carbon saturated medium-chain fatty acid found in body fluids; the most fungitoxic of the C7:0 - C18:0 fatty acid series. |
| salsolinol | An isoquinoline that has formula C10H13NO2. |
| nimbolide | |
| Alprenolol | |
| Iohexol | A benzenedicarboxamide compound having N-(2,3-dihydroxypropyl)carbamoyl groups at the 1- and 3-positions, iodo substituents at the 2-, 4- and 6-positions and an N-(2,3-dihydroxypropyl)acetamido group at the 5-position. |
| 6-hydroxychrysene | |
| Fluoxetine | A aromatic ether consisting of 4-trifluoromethylphenol substituted on oxygen by a 3-(methylamino)-1-phenylpropyl group. |
| zirconium oxide | |
| palytoxin | |
| LAQ824 | |
| Azinphosmethyl | A member of the class of benzotriazines that is 1,2,3-benzotriazine substituted by an oxo group at position 4 and a [(dimethoxyphosphorothioyl)sulfanyl]methyl group at position 3. |
| taxifolin | |
| Thiosemicarbazones | |
| Cefotaxime | A cephalosporin compound having acetoxymethyl and [2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino side groups. |
| 4-(acetoxymethylnitrosamino)-1-(3-pyridyl)-1-butanone | |
| efaroxan | |
| isepamicin | |
| Mercuric Chloride | |
| formoterol | |
| ceric oxide | An inorganic oxide with formula CeO2. It is used for polishing glass, in coatings for infra-red filters to prevent reflection, and as an oxidant and catalyst in organic synthesis. |
| chloric acid | A chlorine oxoacid that has formula ClHO3. |
| juvenile hormone III | A member of the juvenile hormone family of compounds that is the methyl ester of (2E,6E)-9-[(2R)-3,3-dimethyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoic acid. Juvenile hormone III is found in most insect species. |
| EKB 569 | |
| laromustine | |
| oligofructose | |
| T 113242 | |
| MK 2206 | An organic heterotricyclic compound that is [1,2,4]triazolo[3,4-f][1,6]naphthyridin-3(2H)-one substituted at positions 8 and 9 respectively by 4-(1-aminocyclobutyl)phenyl and phenyl groups. |
| Barbiturates | Members of the class of pyrimidones consisting of pyrimidine-2,4,6(1H,3H,5H)-trione (barbituric acid) and its derivatives. Largest group of the synthetic sedative/hypnotics, sharing a characteristic six-membered ring structure. |
| Chromans | |
| Cyclofenil | |
| 3,4-dichloroaniline | A dichloroaniline having the two chloro-substituents at the 3- and 4-positions. |
| prometone | |
| Dietary Fats, Unsaturated | |
| fluanisone | |
| 1,3-butylene glycol | |
| sciadopitysin | A biflavonoid that is a 7, 4', 4'''-trimethyl ether derivative of amentoflavone. |
| U 0126 | |
| Ceftizoxime | |
| Quinazolinones | |
| 1-((4-fluorobenzoylamino)ethyl)-4-(7-methoxy-1-naphthyl)piperazine hydrochloride | |
| Talc | |
| 2-anthramine | |
| mono-n-butyltin | |
| Erythropoietin | |
| Trifluoroethanol | |
| BP 2-94 | |
| 6-methylbenzo(a)pyrene | |
| Uric Acid | An oxopurine that is the final oxidation product of purine metabolism. |
| verteporfin | |
| Ketamine | A member of the class of cyclohexanones in which one of the hydrogens at position 2 is substituted by a 2-chlorophenyl group, while the other is substituted by a methylamino group. |
| 10,11-dihydro-10-hydroxycarbamazepine | |
| brimonidine | A quinoxaline derivative that has formula C11H10BrN5. |
| CGP 12177 | A benzimidazole that is benzimidazol-2-one substituted at position 4 by a 3-(tert-butylamino)-2-hydroxypropoxy group. |
| 7,12-dimethylbenz(a)anthracene-3,4-dihydrodiol | |
| Latex | A milky usually white fluid that is produced by cells of various seed plants (as of the milkweed, spurge, and poppy families) and is the source of rubber, gutta-percha, chicle, and balata. |
| Gramicidin | |
| Amoxicillin-Potassium Clavulanate Combination | |
| beta-penta-O-galloyl-glucose | |
| Pyrogallol | A benzenetriol carrying hydroxy groups at positions 1, 2 and 3. |
| coomassie Brilliant Blue | |
| Thimerosal | An alkylmercury compound (approximately 49% mercury by weight) used as an antiseptic and antifungal agent. |
| 4-Nitroquinoline-1-oxide | A quinoline N-oxide carrying a nitro substituent at position 4. |
| 4,5,6,7-tetrabromo-2-azabenzimidazole | |
| ethylene dichloride | |
| oxantel pamoate | |
| acipimox | |
| 2-(2,3-dicarboxycyclopropyl)glycine | |
| Homovanillic Acid | A monocarboxylic acid that is the 3-O-methyl ether of (3,4-dihydroxyphenyl)acetic acid. It is a catecholamine metabolite. |
| cumene | An alkylbenzene that is benzene carrying an isopropyl group. |
| muscarinic toxin 7 | |
| gambogic acid | A pyranoxanthone that has formula C38H44O8. |
| soluble tachyzoite antigen, Toxoplasma gondii | |
| alniditan | |
| versalide | |
| Dexamethasone | A fluorinated steroid that is 9-fluoropregna-1,4-diene substituted by hydroxy groups at positions 11, 17 and 21, a methyl group at position 16 and oxo groups at positions 3 and 20. It is a synthetic member of the class of glucocorticoids. |
| 1-Butanol | |
| acifran | |
| BCH 1393 | |
| Allopurinol | A bicyclic structure comprising a pyrazole ring fused to a hydroxy-substituted pyrimidine ring. |
| 2-(3-pyridinyl)-1-hydroxyethylidene-1,1-phosphonocarboxylic acid | |
| Manganese Compounds | |
| mometasone furoate | A 2-furoate ester that has formula C27H30Cl2O6. |
| 2'-O-methyl-8-(4-chlorophenylthio)cAMP | |
| ifenprodil | |
| Cholesterol, LDL | |
| momordin II (Oleanolic Acid) | |
| Scutellaria barbata extract | |
| FG 0041 | |
| isoxanthohumol | |
| zinc chloride | |
| beta-solamarine | |
| colesevelam | |
| 25-hydroxyvitamin D | |
| Flavins | A derivative of the dimethylisoalloxazine (7,8-dimethylbenzo[g]pteridine-2,4(3H,10H)-dione) skeleton, with a substituent on the 10 position. |
| Metformin | A member of the class of guanidines that is the 1,1-dimethyl derivative of biguanide. |
| iron(II)-ascorbic acid complex | |
| brevetoxin 2 | |
| 2-selenium-bridged beta-cyclodextrin | |
| butaprost | |
| Anthracenes | Compounds containing an anthracene skeleton. |
| NCQ 298 | |
| 5-dimethylamiloride | |
| 7-oxozeanol | |
| Mifepristone | |
| Hexachlorobenzene | A member of the class of chlorobenzenes that is benzene in which all of the hydrogens are replaced by chlorines. An agricultural fungicide introduced in the mid-1940s and formerly used as a seed treatment, its use has been banned since 1984 under the Stockholm Convention on Persistent Organic Pollutants. |
| sephadex | |
| Clonidine | |
| MRS 2211 | |
| 2-(2-(4-(4-nitrobenzyloxy)phenyl)ethyl)isothiourea methanesulfonate | |
| subecholine | |
| Glutaral | |
| galangin | A 7-hydroxyflavonol with additional hydroxy groups at positions 3 and 5 respectively. |
| brevetoxin B | A ciguatoxin that has formula C50H70O14. |
| labedipinedilol A | |
| 2,6-diisopropyl-4-(3-(3-methyl-3H-diazirin-3-yl)propyl)phenol | |
| polycyclic aromatic hydrocarbons-DNA adduct | |
| 4-(1H-imidazol-1-yl)retinoic acid | |
| brucine | A monoterpenoid indole alkaloid that has formula C23H26N2O4. |
| perfluorobutane | |
| aluminum chloride | |
| 13-hydroxyellipticine | |
| Plicamycin | |
| fusarenon-X | A trichothecene that has formula C17H22O8. |
| otenzepad | |
| 2-acetamidoethanethiol | |
| acetyl-valyl-isoleucyl-aspartyl-aldehyde | |
| 3-nitrofluoranthene | A nitronaphthalene that has formula C16H9NO2. |
| 6-carboxyfluorescein | A monocarboxylic acid that has formula C21H12O7. |
| 4-iodoaniline | |
| 1-anilino-8-naphthalenesulfonate | |
| Pentachlorophenol | A chlorophenol that is phenol substituted by 5 chloro groups. |
| 12-methylbenzanthracene | |
| GR 46611 | |
| tolvaptan | |
| Dieldrin | An organochlorine insecticide that has formula C12H8Cl6O. |
| brotizolam | |
| tertiapin | |
| Chlorodiphenyl (54% Chlorine) | A mixture of polychlorobiphenyls of unspecified composition, containing 54% chlorine (X = Cl or H). |
| 1,2,3,4,6,7,8-heptachlorodibenzodioxin | A dibenzodioxine that has formula C12HCl7O2. |
| Methyl Chloride | |
| Keratan Sulfate | A sulfated glycosaminoglycan, a linear polymer that consists of the repeating disaccharide [3)-beta-Gal-(1->4)-beta-GlcNAc-(1->] and containing sulfo groups located at random positions. |
| tyrphostin AG825 | An organic sulfide that consists of 1,3-benzothiazole-2-thiol in which the hydrogen attached to the sulfur atom is replaced by a 5-[(1E)-3-amino-2-cyano-3-oxoprop-1-en-1-yl]-2-hydroxy-3-methoxybenzyl group. It acts as an epidermal growth factor receptor antagonist. |
| Ticagrelor | |
| quinoline-val-asp(OMe)-CH2-OPH | |
| mefenacet | A benzothiazole that has formula C16H14N2O2S. |
| dironyl | |
| Aminophylline | |
| alpinumisoflavone | An isoflavanone that has formula C20H16O5. |
| Sialic Acids | Any of the N-acylneuraminic acids and their esters and other derivatives of the alcoholic hydroxy groups. |
| 4'-cyanobiphenyl-4-sulfonic acid (6-aminopyridin-2-yl)amide | |
| 2,6-dimethyl-3,5-bis(2'-propoxyethoxycarbonyl)-4-(2''-difluoromethoxyphenyl)-1,4-dihydropyridine | |
| plastochromanol 8 | |
| azaspirane | |
| benzo(a)pyrene-DNA adduct | |
| Selenium Compounds | |
| 3-(difluoromethyl)-1-(4-methoxyphenyl)-5-(4-(methylsulfinyl)phenyl)pyrazole | |
| 2-cyano-3,12-dioxooleana-1,9(11)-dien-28-oic acid ethyl amide | |
| ON 01910 | |
| chiglitazar | |
| xestospongin C | |
| xestospongin B | |
| glycolaldehyde | The glycolaldehyde derived from ethylene glycol. The parent of the class of glycolaldehydes. |
| Hydrogen Sulfide | A sulfur hydride consisting of s single sulfur atom bonded to two hydrogen atoms. A highly poisonous, flammable gas with a characteristic odour of rotten eggs, it is often produced by bacterial decomposition of organic matter in the absence of oxygen. |
| Nicardipine | |
| 4-methylumbelliferyl sulfate | |
| 9-hydroxyellipticine | |
| Nitroprusside | An iron coordination entity that has formula C5FeN6O. |
| Picrotoxin | |
| Oxypurinol | |
| urovision | |
| ramosetron | |
| bromobenzene | The simplest member of the class of bromobenzenes, that is benzene in which a single hydrogen has been substituted by a bromine. A liquid at room temperature (m.p. -30degreeC; b.p.760 156degreeC), it is used as a solvent, particularly for large-scale crystallisations, and for the introduction of phenyl groups in organic synthesis. |
| zosuquidar trihydrochloride | |
| naphthalene 1,2-oxide | An arene epoxide that has formula C10H8O. |
| mono(2-ethyl-5-oxohexyl)phthalate | |
| buthionine | |
| benzoquinone | |
| propanethiol | |
| trimethyltin chloride | |
| bosutinib | |
| estradiol valerate | A steroid ester that has formula C23H32O3. |
| Triamterene | |
| N-(3-chloro-4-morpholin-4-yl) phenyl-N'-hydroxyimido formamide | |
| 3-((O-6-deoxymannopyranosyl-1-2-O-(xylopyranosyl-1-3)arabinopyranosyl)oxy)-21-glucopyranosyloxy-20-hydroxydammar-24-en-19-al | |
| Miconazole | A racemate composed of equimolar amounts of (R)- and (S)-miconazole. Used (as its nitrate salt) to treat skin infections such as athlete's foot, jock itch, ringworm and other fungal skin infections. It inhibits the synthesis of ergosterol, a critical component of fungal cell membranes. |
| Cardiac Glycosides | |
| tauropyrone | |
| Methohexital | A barbiturate, the structure of which is that of barbituric acid substituted at N-1 by a methyl group and at C-5 by allyl and 1-methylpent-2-ynyl groups. |
| WAY-362450 | |
| tetrazolium violet | An organic chloride salt having tetrazolium violet(1+) as the counterion. |
| erdosteine | |
| 4,5-dihydropyrazole-1,5-dicarboxylic acid 1-((4-chlorophenyl)-amide) 5-(2-oxo-2H-(1,3')bipyridinyl-6'-yl)-amide | |
| Penicillins | |
| 5-2-(4-((ethylmethylamino)carbonyl)-3-fluorophenyl)-alpha,alpha-dimethyl-N-1,3,4-thiadiazol-2-yl-5H-(1)benzopyrano(2,3-b)pyridin-5-acetamide | |
| potassium iodate | |
| Dioxolanes | |
| clindamycin phosphate | An amino sugar phosphate that has formula C18H34ClN2O8PS. |
| anacetrapib | |
| imidacloprid | |
| Cyclophosphamide | A phosphorodiamide that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by two 2-chloroethyl groups at the amino nitrogen atom. |
| yu ping feng san | |
| Methylphenazonium Methosulfate | |
| parthenin | A sesquiterpene lactone that has formula C15H18O4. |
| 2,4-diaminopyrimidine | |
| Cholesterol Esters | |
| Heparan Sulfate Proteoglycans | |
| fenpropathrin | A cyclopropanecarboxylate ester obtained by formal condensation between 2,2,3,3-tetramethylcyclopropanecarboxylic acid and cyano(3-phenoxyphenyl)methanol. |
| N-(2-(o-methoxyphenyl)ethyl)-N-ethyl-2-(1-pyrrolidinyl)ethylamine | |
| 4-ipomeanol | |
| sevoflurane | An ether compound having fluoromethyl and 1,1,1,3,3,3-hexafluoroisopropyl as the two alkyl groups. |
| CY 208-243 | |
| 26,26,26,27,27,27-hexafluoro-1,25-dihydroxyvitamin D3 | |
| N-Formylmethionine Leucyl-Phenylalanine | |
| 17alpha-ethynylestr-5(10)-ene-3alpha,17beta-diol | |
| fenamiphos | An organophosphate nematicide that has formula C13H22NO3PS. |
| toltrazuril | |
| sulforafan | |
| 1,1,1-trichloro-2-(4-hydroxyphenyl)-2-(4-methoxyphenyl)ethane | A diarylmethane that has formula C15H13Cl3O2. |
| Dimethoate | A monocarboxylic acid amide that is N-methylacetamide in which one of the hydrogens of the methyl group attached to the carbonyl moiety is replaced by a (dimethoxyphosphorothioyl)sulfanediyl group. |
| ropinirole | An indolone that has formula C16H24N2O. |
| camphoroquinone | |
| 16 alpha-bromo-17 beta-estradiol | A 3-hydroxy steroid that has formula C18H23BrO2. |
| 3-O-methyl-DOPA | A L-tyrosine derivative that is the 3-methoxy derivative of L-dopa. |
| 2-butenal | |
| NU2058 | |
| PX-866 | An organic heterotetracyclic compound that is obtained from wortmanin via aminolysis of its furan ring by diallyl amine. |
| 8-bromoadenosine-3',5'-cyclic monophosphorothioate | |
| Inosine | A purine nucleoside in which hypoxanthine is attached to ribofuranose via a beta-N(9)-glycosidic bond. |
| 4-aminobutyraldehyde | |
| alizarin 1-methyl ether | |
| lepirudin | |
| Ritanserin | A thiazolopyrimidine that is 5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one which is substituted at position 7 by a methyl group and at position 6 by a 2-{4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl}ethyl group. A potent and long-acting seratonin (5-hydroxytryptamine, 5-HT) antagonist of the subtype 5-HT2 (Ki = 0.39 nM), it is used in the treatment of a variety of disorders including anxiety, depression and schizophrenia. It has little sedative action. |
| phosphatidylinositol 3,4,5-triphosphate | |
| 1,2-epoxy-4-vinylcyclohexane | |
| benzamidoxime | A member of the class of amidoximes obtained by formal condensation of the carbonyl group of benzamide with hydroxylamine. |
| alatrofloxacin | |
| N-(2,4-dichloro-5-(4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl)phenyl)methanesulfonamide | |
| 1-(3',4'-dichloro-2-fluoro(1,1'-biphenyl)-4-yl)cyclopropanecarboxylic acid | |
| U 73343 | |
| bis(2-ethylhexyl) 2,3,4,5-tetrabromophthalate | |
| 4-hydroxy-2-nonenal | |
| Docosahexaenoic Acids | |
| roridin A | A trichothecene that has formula C29H40O9. |
| chloroacetaldehyde | Acetaldehyde substituted at C-2 by chlorine. |
| apple polyphenol extract | |
| Baclofen | A monocarboxylic acid that is butanoic acid substituted by an amino group at position 4 and a 4-chlorophenyl group at position 3. It acts as a central nervous system depressant, GABA agonist and muscle relaxant. |
| GSK0660 | |
| 7-(3,4-difluorophenoxy)-4-(1H-imidazol-1-ylmethyl)-2H-chromen-2-one | |
| terbutylazine | A diamino-1,3,5-triazine that is N-tert-butyl-N'-methyl-1,3,5-triazine-2,4-diamine substituted by a chloro group at position 6. |
| methacrylonitrile | |
| arsenic trichloride | A arsenic molecular entity that consists of a single arsenic atom bearing three chloro substituents. |
| Glycyrrhetinic Acid | |
| Burimamide | An imidazole that has formula C9H16N4S. |
| dutasteride | Finasteride in which the tert-butyl group is replaced by a 2,5-bis(trifluoromethyl)phenyl group. A synthetic 4-azasteroid, dutasteride is a selective inhibitor of both the type 1 and type 2 isoforms of steroid 5alpha-reductase, an intracellular enzyme that converts testosterone to 5alpha-dihydrotestosterone. Dutasteride is used for the treatment of symptomatic benign prostatic hyperplasia in men with an enlarged prostate gland. |
| (2,3,5,6-tetrafluoro-4-methoxymethylphenyl)methyl-2,2-dimethyl-3-(1-propenyl)cyclopropanecarboxylate | |
| tephrosin | A member of the class of rotenones that is 13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one substituted with geminal methyl groups at position 3, hydroxy group at position 7a and methoxy groups at positions 9 and 10 (the 7aR,13aR stereoisomer). It is isolated from the leaves and twigs of Antheroporum pierrei and exhibits antineoplastic and pesticidal activities. |
| tynorphin | |
| pterostilbene | A stilbenol that consists of trans-stilbene bearing a hydroxy group at position 4 as well as two methoxy substituents at positions 3' and 5'. |
| biochanin A | A member of the class of 7-hydroxyisoflavones that is 7-hydroxyisoflavone substituted by an additional hydroxy groups at position 5 and a methoxy group at position 4'. |
| sitaxsentan | |
| ethyl acetate | |
| MDV 3100 | |
| Chloroprene | A chloroolefin that has formula C4H5Cl. |
| Clofibrate | A carboxylic ester that is the ethyl ester of clofibric acid. |
| iberiotoxin | |
| monophosphoryl lipid A | |
| tricarbonyldichlororuthenium (II) dimer | |
| 5-dihydrocortisone | |
| YH 439 | |
| Cibacron Blue F 3GA | |
| Hydrocarbons, Fluorinated | |
| cefpodoxime | A third-generation cephalosporin antibiotic with methoxymethyl and (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamino substituents at positions 3 and 7, respectively, of the cephem skeleton. Given by mouth as its proxetil ester prodrug, it is used to treat acute otitis media, pharyngitis, and sinusitis. |
| malvidin-3-glucoside | |
| omapatrilat | |
| ciclopirox | 1-Hydroxypyridin-2(1H)-one in which the hydrogens at positions 4 and 6 are substituted by methyl and cyclohexyl groups, repectively. A broad spectrum antigfungal agent, it also exhibits antibacterial activity against many Gram-positive and Gram-negative bacteria, and has anti-inflammatory properties. It is used a a topical treatment of fungal skin and nail infections. |
| Cholesterol, VLDL | |
| 1-(2,3-dihydrobenzo(b)(1,4)dioxin-6-yl)-4-((6-fluoropyridin-3-yl)methyl)piperazine | |
| N,N'-bis(2-1(piperidino)-ethyl)-3,4,9,10-perylene-tetracarboxylic diimide | |
| 2,6-dimethylnaphthalene | A dimethylnaphthalene carrying methyl groups at positions 2 and 6. |
| Uranium | |
| 3-(5-(2-(1H-tetrazol-5-yl)phenyl)-2,3-dihydro-1H-inden-1-yl)-2-ethyl-5-isobutyl-7-methyl-3H-imidazo(4,5-b)pyridine | |
| Inositol 1,4,5-Trisphosphate | |
| 3-(4-methylpiperazin)-8-oxo-8H-acenaphtho(1,2-b)pyrrole-9-carbonitrile | |
| Labetalol | A secondary amino compound formally derived from ammonia by replacing two of the hydrogens by 2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl and 4-phenylbutan-2-yl groups. It is an adrenergic antagonist used to treat high blood pressure. |
| AGN 195183 | |
| resmethrin | |
| 1-naphthol | A naphthol carrying a hydroxy group at position 1. |
| manganese (III) meso-tetrakis(N-ethylpyridinium-2-yl)porphyrin | |
| 4-hydroxy-2-decenal | |
| 1-(3',5'-dihydroxyphenoxy)-7-(2'',4'',6''-trihydroxyphenoxy)-2,4,9-trihydroxydibenzo-1,4,-dioxin | |
| sulindac sulfone | A sulfone metabolite of sulindac that inhibits cell growth by inducing apoptosis independently of cyclooxygenase inhibition. It inhibits the development and induces regression of premalignant adenomatous polyps. Lipoxygenase and Cox-2 inhibitor. |
| disodium hexachloroplatinate | |
| N-cyano-1-((3,4-dimethoxyphenyl)methyl)-3,4-dihydro-6,7-dimethoxy-N'-octyl-2(1H)-isoquinoline-carboximidamide | |
| Antimony Sodium Gluconate | |
| glucose tolerance factor | |
| Emetine | |
| GGTI 2147 | |
| 1-aminoanthraquinone | |
| GSK525762A | |
| Gallium | A metallic element predicted as eka-aluminium by Mendeleev in 1870 and discovered by Paul-Emile Lecoq de Boisbaudran in 1875. Named in honour of France (Latin Gallia) and perhaps also from the Latin gallus cock, a translation of Lecoq. |
| acetyl-leucyl-glutamyl-histidyl-aspartal | |
| zosterin | |
| Raloxifene | A benzothiophene that has formula C28H27NO4S. |
| Sodium Cholate | A cholate salt that has formula C24H39NaO5. |
| enkephalin-Leu, Ala(2)-Arg(6)- | |
| abexinostat | |
| naftopidil | |
| Pyrantel | |
| nobotanin B | |
| eptifibatide | |
| LY 518674 | |
| 2,4,6-tribromoanisole | |
| 4'-N-benzoylstaurosporine | |
| 6-(1,1-dimethylallyl)naringenin | |
| Lipid A | The glycolipid moiety of bacterial lipopolysaccharide. |
| Pralidoxime Compounds | |
| Fluvoxamine | A 5-methoxyvalerophenone O-(2-aminoethyl)oxime that has formula C15H21F3N2O2. |
| Salicylates | Any salt or ester arising from reaction of the carboxy group of salicylic acid, or any ester resulting from the condensation of the phenolic hydroxy group of salicylic acid with an organic acid. |
| isoborneol | |
| haloxon | |
| thiazopyr | |
| WJ1398-1 | |
| methamidophos | A phosphoramide that has formula C2H8NO2PS. |
| 6-methylbenz(a)anthracene | |
| WP1066 | |
| brucine N-oxide | |
| pobilukast | |
| JAI-51 | |
| aflatoxicol | A furanocoumarin that has formula C17H14O6. |
| Fatty Acids, Unsaturated | |
| iomeprol | A benzenedicarboxamide compound having N-substituted carbamoyl groups at the 1- and 3-positions, iodo substituents at the 2-, 4- and 6-positions and a glycoloyl(methyl)amino group at the 5-position. |
| Triethylenephosphoramide | |
| chlorophacinone | A diarylmethane that has formula C23H15ClO3. |
| Pyrrolidines | Any of a class of heterocyclic amines having a saturated five-membered ring. |
| naloxone benzoylhydrazone | |
| 5-butyl-7-chloro-6-hydroxybenzo(c)quinolizinium | |
| 1-ethylpyrene | |
| rabeprazole-thioether | |
| N6-(((4-(4-(acetylamino)benzyl)phenyl)amino)carbonyl)lysine | |
| bis(4-hydroxyphenyl)sulfone | |
| Estazolam | A triazolo[4,3-a][1,4]benzodiazepine having a phenyl group at position 6 and a chloro substituent at position 8. A short-acting benzodiazepine with general properties similar to diazepam, it is given by mouth as a hypnotic in the short-term management of insomnia. |
| green tea extract AR25 | |
| Prolyl-Hydroxylase Inhibitors | |
| 2-acetylbenzothiophene-S-oxide | |
| JWH-073 | |
| 3-chloro-4-(4-((2-(3-pyridyl)pyrrolidin-1-yl)methyl)phenoxy)benzamide | |
| ulimorelin | |
| technetium 99m tricarbonyl 4-((2-methoxyphenyl)piperazin-1-yl)dithioformate | |
| cafestol | A naphthofuran that has formula C20H28O3. |
| 4-hydroxycoumarin | A hydroxycoumarin that is coumarin in which the hydrogen at position 4 is replaced by a hydroxy group. |
| manidipine | |
| osteum | |
| Glucans | |
| Chlorpropamide | An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is substituted by 4-chlorobenzenesulfonyl group and a hydrogen attached to the other nitrogen is substituted by propyl group. Chlorpropamide is a hypoglycaemic agent used in the treatment of type 2 (non-insulin-dependent) diabetes mellitus not responding to dietary modification. |
| dehydroretinal | |
| mepanipyrim | A member of the class of aminopyrimidines that is N-phenylpyrimidin-2-amine carrying additional methyl and 1-propynyl substituents at positions 4 and 6 respectively. A fungicide used to control a wide range of diseases including grey mould on strawberries, tomatoes and cucumabers, and scab on apples and pears. |
| thiodipropionic acid | |
| BAEC protocol | |
| diphenyliodonium | |
| S-methyl-N-butylthiocarbamate sulfoxide | |
| 1-methylnaphthalene | A methylnaphthalene carrying a methyl substituent at position 1. |
| Adenosine Diphosphate | |
| Antineoplastic Agents, Alkylating | |
| 3-(4-hydroxyphenyl)-4,5-dihydro-5-isoxazoleacetic acid methyl ester | |
| 1H-(1,2,4)oxadiazolo(4,3-a)quinoxalin-1-one | |
| N-benzyloxycarbonylprolylprolinal | |
| 5,10-methylenetetrahydrofolic acid | A methylenetetrahydrofolic acid that has formula C20H23N7O6. |
| Guanfacine | |
| etoricoxib | |
| clozapine N-oxide | |
| fialuridine | |
| prednylidene | |
| tcdA protein, Clostridium difficile | |
| Edotreotide | |
| trimethyltin | An organotin compound that consists of stannane in which three of the four hydrogens are substituted by methyl groups. |
| indimitecan | |
| acetonitrile | A nitrile that is hydrogen cyanide in which the hydrogen has been replaced by a methyl group. |
| Razoxane | |
| N(1)-methylnicotinamide | |
| casopitant | |
| Androstenes | |
| Methylenebis(chloroaniline) | |
| N'-nitrosoanatabine | A bipyridine that has formula C10H11N3O. |
| Cannabidiol | An organic molecular entity that has formula C21H30O2. |
| L-pyroglutamyl-L-histidyl-3,3-dimethylprolinamide | |
| Vaccines, Virus-Like Particle | |
| N-(2-(3H-indol-3-yl)ethyl)-9-isopropyl-2-(5-methyl-3-pyridyl)purin-6-amine | |
| SKF 82957 | |
| Benz(a)Anthracenes | |
| delta-tocopherol | A tocopherol in which the chroman-6-ol core is substituted by a methyl group at position 8. It is found particularly in maize (corn) oil and soya bean (soybean) oils. |
| Polyphosphates | Any phosphate that is a salt or an ester of polyphosphoric acid or its chalcogen analogues. |
| boswellic acid | |
| nickel chloride | |
| cholesteryl sulfate | |
| calpain inhibitor III | |
| 11,15-dioxo-9-hydroxy-2,3,4,5-tetranorprostan-1,20-dioic acid | |
| Allylestrenol | |
| secoisolariciresinol | |
| delapril | |
| isopropamide iodide | |
| 3,4-Dihydroxyphenylacetic Acid | A dihydroxyphenylacetic acid having the two hydroxy substituents located at the 3- and 4-positions. It is a metabolite of dopamine. |
| Oncostatin M | |
| Niclosamide | |
| tubeimoside I | A triterpenoid that has formula C63H98O29. |
| ST 1435 | |
| rutamarin | A furanocoumarin that has formula C21H24O5. |
| 8,9-epoxyeicosatrienoic acid | |
| gamma-Linolenic Acid | A C18, omega-6 acid fatty acid comprising a linolenic acid having cis- double bonds at positions 6, 9 and 12. |
| 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid | An organochlorine compound that has formula C8H10Cl2O2. |
| 1,2-Dimethylhydrazine | A member of the class of hydrazines that is hydrazine in which one of the hydrogens attached to each nitrogen is replaced by a methyl group. A powerful DNA alkylating agent and carcinogen, it is used to induce colon cancer in laboratory rats and mice. |
| Singlet Oxygen | |
| HU 211 | |
| Ficusin | |
| Drugs, Chinese Herbal | |
| rifaximin | |
| licochalcone B | |
| 1,2-naphthoquinone | A naphthoquinone that has formula C10H6O2. |
| licochalcone A | |
| pramipexole | A member of the class of benzothiazoles that is 4,5,6,7-tetrahydro-1,3-benzothiazole in which the hydrogens at the 2 and 6-pro-S-positions are substituted by amino and propylamino groups, respectively. |
| metiprenaline | |
| Idarubicin | An anthracycline antibiotic that has formula C26H27NO9. |
| tungstate | A divalent inorganic anion obtained by removal of both protons from tungstic acid. |
| Streptomycin | A amino cyclitol glycoside that consists of streptidine having a disaccharyl moiety attached at the 4-position. The parent of the streptomycin class |
| talinolol | |
| NVP-AEW541 | |
| 3-fluoro-3-(3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl)-N-(2-methylpropyl)cyclobutanecarboxamide | |
| bradykinin, des-Arg(9)- | |
| Erythromycin Estolate | An erythromycin derivative that has formula C40H71NO14.C12H26O4S. |
| harman | An indole alkaloid fundamental parent with a structure of 9H-beta-carboline carrying a methyl substituent at C-1. It has been isolated from the bark of Sickingia rubra, Symplocus racemosa, Passiflora incarnata, Peganum harmala, Banisteriopsis caapi and Tribulus terrestris, as well as from tobacco smoke. It is a specific, reversible inhibitor of monoamine oxidase A. |
| Trifluoroacetic Acid | A monocarboxylic acid that is the trifluoro derivative of acetic acid. |
| cariporide | |
| beta-methylcholine | |
| 2-nitrosofluorene | |
| Phenacetin | |
| monomethylarsonous acid | |
| peginterferon alfa-2a | |
| Herbicides | A substance used to destroy plant pests. |
| Prazosin | A member of the class of piperazines that is piperazine substituted by a furan-2-ylcarbonyl group and a 4-amino-6,7-dimethoxyquinazolin-2-yl group at positions 1 and 4 respectively. |
| Dichlorodiphenyldichloroethane | |
| deoxynivalenol | |
| oxidized-L-alpha-1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphorylcholine | |
| Phosphites | |
| Silicon Dioxide | A silicon oxide made up of linear triatomic molecules in which a silicon atom is covalently bonded to two oxygens. |
| 7-(deoxyadenosin-N(6)-yl)aristolactam I | |
| Cantharidin | |
| N-(1-((4-(2-(((2,4-dichlorophenyl)sulfonyl)amino)-3-hydroxypropanoyl)-1-piperazinyl)carbonyl)-3-methylbutyl)-1-benzothiophene-2-carboxamide | |
| Epoxy Compounds | Any ether in which the oxygen atom forms part of a ring. |
| 5,6,7,8-tetrahydroxy-4-oxooctanal | |
| Agglutinins | |
| Albendazole | |
| BH30sucMan | |
| 2,3,4,4'5-pentachlorobiphenyl | |
| 6-methyl-2-(phenylethynyl)pyridine | |
| clobazam | |
| Enoxaparin | |
| succinylacetone | |
| molybdenum chloride | |
| LY 134046 | |
| chromium trioxide | A chromium oxide composed of a single chromium bound (oxidation state +6) to three oxygens; the acidic anhydride of chromic acid. |
| Sulbactam | A penicillanic acid that has formula C8H11NO5S. |
| Norpregnenes | |
| tetrapentylammonium | A quaternary ammonium ion that has formula C20H44N. |
| sazetidine-A | |
| Remoxipride | |
| 10-hydroxywarfarin | |
| alpha-hexylcinnamaldehyde | |
| Bungarotoxins | |
| nefazodone | A triazole that has formula C25H32ClN5O2. |
| poly(N-isopropylacrylamide-N-tert-butylacrylamide)copolymer | |
| 2-phenylphenol | |
| tris(2-butoxyethyl) phosphate | A trialkyl phosphate in which the alkyl group specified is 2-butoxyethyl. |
| Gold Compounds | |
| Dantrolene | The hydrazone resulting from the formal condensation of 5-(4-nitrophenyl)furfural with 1-aminohydantoin. |
| L-335677 | |
| dichlorfop-methyl | |
| repaglinide | |
| bis(allixinato)oxovanadium(IV) | |
| O-desmethylangolensin | |
| 2-(beta-(3-iodo-4-hydroxyphenyl)ethylaminomethyl)tetralone | |
| vadimezan | A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is replaced by a 5,6-dimethyl-9-oxoxanthen-4-yl group. |
| (E)-4-(ethoxymethylene)-2-phenyloxazol-5(4H)-one | |
| Nicotinamide Mononucleotide | |
| endosulfan sulfate | |
| vinpocetine | |
| pentabromodiphenyl ether | |
| tocopheryloxybutyric acid | |
| alginic acid | |
| 3-hydroxybenzo(a)pyrene | An ortho- and peri-fused polycyclic arene that has formula C20H12O. |
| 1-(2-chloroethyl)-1-nitrosourea | |
| vardenafil | The sulfonamide resulting from formal condensation of the sulfo group of 4-ethoxy-3-(5-methyl-7-propylimidazo[5,1-f][1,2,4]triazin-4(1H)-one-2-yl)benzenesulfonic acid and the secondary amino group of 4-ethylpiperazine. |
| 5'-hydroxythalidomide | |
| 4-nitrophenylglucuronide | |
| nonane | A straight chain alkane composed of 9 carbon atoms. |
| furegrelate | |
| mitozolomide | |
| Fluo-3 | A xanthene dye that has formula C36H30Cl2N2O13. |
| 3-hydrogenkwadaphnin | |
| Cinnarizine | |
| O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphate | |
| acenaphthenequinone | |
| 7-tosylcyclonovobiocic acid | |
| Lopinavir | |
| 4(G)-alpha-glucopyranosyl-rutin | |
| spinorphin | |
| 4-bromo-2-chlorophenol | A halophenol that is phenol in which the hydrogens at positions 2 and 4 have been replaced by chlorine and bromine, respectively. |
| Pyrroles | An azole that includes only one N atom and no other heteroatom as a part of the aromatic skeleton. |
| acylfulvene | |
| sampatrilat | |
| ethylene dimethacrylate | |
| 4-oxoretinaldehyde | |
| furafylline | |
| Dipyridamole | A pyrimidopyrimidine that is 2,2',2'',2'''-(pyrimido[5,4-d]pyrimidine-2,6-diyldinitrilo)tetraethanol substituted by piperidin-1-yl groups at positions 4 and 8 respectively. A vasodilator agent, it inhibits the formation of blood clots. |
| AG-012986 | |
| adenosine diphosphate-ferric chelate | |
| danggui buxue decoction | |
| Hexachlorophene | |
| 2,2-diphenyl-1-picrylhydrazyl | |
| phenoxodiol | |
| kallidin, des-Arg(10)- | |
| PD 0325901 | |
| alfacalcidol | |
| tropacocaine | A benzoate ester that has formula C15H19NO2. |
| n-butyl mercaptan | |
| BmK IT2 scorpion toxin | |
| 2,4-dichlorophenol | A dichlorophenol that is phenol carrying chloro substituents at positions 2 and 4. |
| 2-hexenal | A hexenal having the double bond at the 2-position. |
| 2-aminoethyl diphenylborinate | |
| glucoerucin | A thia-alkylglucosinolic acid that consists of 1-thio-beta-D-glucopyranose having a 5-(methylsulfanyl)-N-(sulfooxy)pentanimidoyl group attached to the anomeric sulfur. |
| pyralene | |
| CT 50547 | |
| Ethionamide | A thiocarboxamide that is pyridine-4-carbothioamide substituted by an ethyl group at position 2. |
| Mineral Waters | |
| Coptidis rhizoma extract | |
| nafamostat | |
| exochelins | |
| Hexestrol | A stilbenoid that has formula C18H22O2. |
| Tetradecanoylphorbol Acetate | |
| clomacran | |
| 2,2-dichloro-1,1,1-trifluoroethane | |
| YU101 | |
| oxyhyponitrite | |
| triethyl phosphate | A trialkyl phosphate that is the triethy ester derivative of phosphoric acid. |
| 2-(4'-chlorophenyl)benzothiazole | |
| 1,2-benzisothiazoline-3-one | |
| dihydroethidine | |
| N-(2-(4-bromocinnamylamino)ethyl)-5-isoquinolinesulfonamide | |
| Diclofenac | A monocarboxylic acid consisting of phenylacetic acid having a (2,6-dichlorophenyl)amino group at the 2-position. |
| monoisononylphthalate | |
| boric acid | A member of the boric acids that has formula BH3O3. |
| 2-anisidine | |
| Buthionine Sulfoximine | |
| Vanadates | |
| SB 203347 | |
| FTI 277 | |
| alpha-terpineol | A terpineol that is propan-2-ol substituted by a 4-methylcyclohex-3-en-1-yl group at position 2. |
| sairei-to | |
| NADP | |
| Hydrocarbons, Chlorinated | |
| lysophosphatidylinositol | A glycerophosphoinositol resulting from partial hydrolysis of a phosphatidyl-1D-myo-inositol, which removes one of the fatty acid groups. The structure is depicted in the image where R(1) = acyl, R(2) = H or where R(1) = H, R(2) = acyl. |
| Sodium Benzoate | |
| magnolol | A biphenyl that has formula C18H18O2. |
| Prostaglandins E | |
| Prostaglandins F | |
| Gonadotropins | |
| dimethyladipate | A fatty acid methyl ester that has formula C8H14O4. |
| Thiophanate | A member of the class of thioureas that is the diethyl ester of (1,2-phenylenedicarbamothioyl)biscarbamic acid. A fungicide effective against a broad spectrum of diseases in fruit, vegetables, turf and other crops including eyespot, scab, powdery mildew and grey mould. |
| Cefaclor | A cephalosporin bearing chloro and (R)-2-amino-2-phenylacetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
| satratoxin G | |
| SC 560 | A member of the class of pyrazoles that is 1H-pyrazole which is substituted at positions 1, 3 and 5 by 4-methoxyphenyl, trifluoromethyl and 4-chlorophenyl groups, respectively. Unlike many members of the diaryl heterocycle class of cyclooxygenase (COX) inhibitors, SC-560 is selective for COX-1. |
| AG 1879 | |
| satratoxin H | |
| N,N-diacetylcystine | |
| tepoxalin | A hydroxamic acid obtained by formal condensation of the carboxy group of 3-[5-(4-chlorophenyl)-1-(4-methoxyphenyl)pyrazol-3-yl]propanoic acid with the amino group of N-methylhydroxylamine. It is used in veterinary medicine for the control of pain and inflammation caused by musculoskeletal disorders such as hip dysplasia and arthritis in dogs. |
| N-(n-butyl)-(bis-fluorophenyl)methoxytropane | |
| Aptamers, Nucleotide | |
| Purine Nucleosides | |
| chlorite | A chlorine oxoanion that has formula ClO2. |
| 5-(4-ethylbenzylidene)-2-thioxothiazolidin-4-one | |
| Oxotremorine | A N-alkylpyrrolidine that has formula C12H18N2O. |
| 2'-hydroxy-2,3',4,5'-tetrabromodipheyl ether | |
| benoxaprofen glucuronide | |
| protolichesterinic acid | |
| Chlorzoxazone | A member of the class of 1,3-benzoxazoles that is 1,3-benzoxazol-2-ol in which the hydrogen atom at position 5 is substituted by chlorine. A centrally acting muscle relaxant with sedative properties, it is used for the symptomatic treatment of painful muscle spasm. |
| Poly Adenosine Diphosphate Ribose | A biomacromolecule that is composed of ADP-D-ribose units linked through glycosidic ribose-ribose 1''->2' bonds. Branching may also occur. |
| Tetanus Toxoid | |
| cyclopentenone | |
| cafenstrole | A benzene that has formula C16H22N4O3S. |
| copper (II) diacetyl-di(N(4)-methylthiosemicarbazone) | |
| phosphatidylinositol dimannoside | A glycosylphosphatidylinositol having two D-mannosyl groups as the glycosyl moieties; obtained via extraction of the cell wall of Mycobacterium bovis. |
| arachidonyl-2-chloroethylamide | |
| Thiocholine | |
| bunitrolol | |
| Lomustine | |
| 2,4-dinitroimidazole-1-ethanol | |
| 4-nitroquinolone-1-oxide | |
| 2-methyl-1,4-benzoquinone | |
| 5-O-methyl-(E)-resveratrol 3-O-beta-D-glucopyranoside | |
| N-benzoyl-12-nitrodehydroabietylamine-7-one | |
| Isoxazoles | Oxazoles in which the N and O atoms are adjacent. |
| propyl ether | |
| cefdinir | A cephalosporin compound having 7beta-2-(2-amino-thiazol-4-yl)-2-[(Z)-hydroxyimino]-acetylamino- and 3-vinyl side groups. |
| 3'-hydroxy-genistein | |
| tri-xylenyl phosphate | |
| Chalcones | A ketone that is 1,3-diphenylpropenone (benzylideneacetophenone), ArCH=CH(=O)Ar, and its derivatives formed by substitution. |
| 3-((5-(6-((3-chlorophenyl)amino)pyrazinyl)-3-pyridinyl)amino)-1-propanol | |
| salicylaldehyde isonicotinoyl hydrazone | |
| bifenox | |
| B 4146 | |
| 5-hexyloxy-3',4'-dihydroxy-6,7-dimethoxyflavone 4'-phosphate | |
| vanadium pentoxide | |
| Carboplatin | A platinum coordination entity with cis square-planar geometry in which platinum(II) is coordinated to two ammonia ligands and a bidentate cyclobutane-1,1-dicarboxylate ligand. |
| glycitein | A methoxyisoflavone that is isoflavone substituted by a methoxy group at position 6 and hydroxy groups at positions 7 and 4'. It has been isolated from the mycelia of the fungus Cordyceps sinensis. |
| NSC 354646 | |
| 4,4'-thiobis(6-tert-butyl-3-cresol) | |
| 2-cyano-3,12-dioxoolean-1,9-dien-28-oic acid | |
| G(M2) Ganglioside | |
| brinzolamide | |
| Hexamethonium | A quaternary ammonium salt that has formula C12H30N2. |
| amprenavir | |
| 9-methylanthracene | |
| Aminoimidazole Carboxamide | |
| tert-butyl-2-(4,5-dihydrogen-4,4,5,5-tetramethyl-3-O-1H-imidazole-3-cationic-1-oxyl-2-pyrrolidine-1-carboxylic ester) | |
| cinobufotalin | A steroid lactone that has formula C26H34O7. |
| di-n-pentyl phthalate | |
| alpha-iso-cubebenol | |
| mitragynine | A monoterpenoid indole alkaloid that has formula C23H30N2O4. |
| Piribedil | |
| buflomedil | |
| 5-(2,4-dihydroxybenzylidene)-2-(phenylimino)-1,3-thiazolidin | |
| Angiotensin-Converting Enzyme Inhibitors | An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| N-desisopropylpropranolol | |
| diethylglyoxime | |
| Bacitracin | A mixture of at least nine closely related homodetic cyclic peptides produced by Bacillus subtilis and B. licheniformis, which is particularly active against Gram-positive bacteria. |
| 2-ethylidene-1,5-dimethyl-3,3-diphenylpyrrolidine | A diarylmethane that has formula C20H23N. |
| 2,6-dichlorobiphenyl | A dichlorobiphenyl that is 1,3-dichlorobenzene in which the hydrogen at position 2 is replaced by a phenyl group. |
| Dioxins | Oxanthrene (formerly dibenzo[b,e][1,4]dioxine) and its derivatives. |
| calphostin C | |
| 4-hydroxyvalproate | |
| BO-1051 | |
| 3-amino-1-methyl-5H-pyrido(4,3-b)indole | A pyridoindole that has formula C12H11N3. |
| Ciprofloxacin | A quinolone that is quinolin-4(1H)-one bearing cyclopropyl, carboxylic acid, fluoro and piperazin-1-yl substituents at positions 1, 3, 6 and 7, respectively. |
| nickel subsulfide | |
| 12-HPETE | |
| herbal compound 861 | |
| Sesame Oil | |
| temocaprilat | An alpha-amino acid that has formula C21H24N2O5S2. |
| Phenytoin | A imidazolidine-2,4-dione that consists of hydantoin bearing two phenyl substituents at position 5. |
| nicotinamide-beta-riboside | |
| citronellyl acetate | A carboxylic ester that has formula C12H22O2. |
| acyline | |
| 2-oxo-clopidogrel | |
| 3-hydroxybiphenyl | |
| Danazol | A 17beta-hydroxy steroid that has formula C22H27NO2. |
| Spiro Compounds | A compound having one atom as the only common member of two rings. |
| CAY 10499 | |
| (2-cyano-3,12-dioxooleana-1,9-dien-28-oic acid) trifluoroethylamide | |
| farnesyl pyrophosphate | |
| propetamphos | A phosphoramidate ester that has formula C10H20NO4PS. |
| menadione epoxide | |
| 3-(4'-hydroxy-3'-adamantylbiphenyl-4-yl)acrylic acid | |
| Asbestos, Amphibole | |
| 6-amino-N-cyclohexyl-N,3-dimethylthiazolo(3,2-a)benzimidazole-2-carboxamide | |
| 2-amino-4,6-dinitrotoluene | An amino-nitrotoluene that is 4,6-dinitrotoluene substituted at position 2 by an amino group. |
| Hydantoins | |
| 2-(4-(2-(((1,2)-2-hydroxy-2-(4-hydroxyphenyl)-1-methylethyl)amino)ethyl)phenoxy)-2-methylpropionic acid | |
| andrographolide | A labdane diterpenoid isolated from the leaves and roots of Andrographis paniculata that exhibits anti-HIV, anti-inflammatory and antineoplastic properties. |
| trapoxin B | |
| 2,3-N-octanoylsphingosine | |
| Tunicamycin | A mixture of antiviral nucleoside antibiotics produced by Streptomyces lysosuperificus. It contains at least 10 homologues comprising uracil, N-acetylglucosamine, an 11-carbon aminodialdose called tunicamine, and a fatty acid linked to the amino group of the tunicamine. The homologues vary in the composition of the fatty acid moiety. |
| Benztropine | |
| 6,7-dimethoxy-2-phenylquinoxaline | |
| toosendanin | |
| Cyclamates | |
| Chlorpheniramine | |
| Benomyl | A member of the class of benzimidazoles that is the methyl ester of [1-(butylcarbamoyl)-1H-benzimidazol-2-yl]carbamic acid. A foliar fungicide used to control a wide range of Ascomycetes and Fungi Imperfecti in a wide range of crops. |
| bryostatin 1 | |
| methylparaben | |
| 6,7-dihydroxyflavone | |
| syringic acid | An organic molecular entity that has formula C9H10O5. |
| XLF-III-43 | |
| S 28463 | |
| Phenindione | |
| ilimaquinone | A prenylquinone that has formula C22H30O4. |
| Tosylphenylalanyl Chloromethyl Ketone | |
| 1,12-benzoperylene | |
| thymidine 5'-diphosphate | |
| mumbaistatin | |
| esculetin | Umbelliferone in which the hydrogen at position 6 is substituted by a hydroxy group. It is used in filters for absorption of ultraviolet light. |
| Isonicotinic Acids | |
| Papaverine | A benzylisoquinoline alkaloid that is isoquinoline substituted by methoxy groups at positions 6 and 7 and a 3,4-dimethoxybenzyl group at position 1. It has been isolated from Papaver somniferum. |
| 1,2-bis(2-aminophenoxy)ethane N,N,N',N'-tetraacetic acid acetoxymethyl ester | |
| Allergens | |
| 2,2-dichloro-12-(p-chlorophenyl)-dodecanoic acid | |
| albendazole sulfoxide | |
| 6',7'-dihydroxybergamottin | |
| adolapin | |
| inchinko-to | |
| 3-nitrophenol | A mononitrophenol that is phenol substituted by a nitro substituent at position 3. |
| arachidonyl dopamine | |
| 5-iodosalicylic acid | |
| pro-thyrotropin releasing hormone | |
| Fullerenes | A compound composed solely of an even number of carbon atoms, which form a cage-like fused-ring polycyclic system with twelve five-membered rings and the rest six-membered rings. The term has been broadened to include any closed cage structure consisting entirely of three-coordinate carbon atoms. |
| 20-O-(beta-D-glucopyranosyl)-20(S)-protopanaxadiol | |
| 4,5-dihydroxy-4,5-dihydrobenzo(a)pyrene | |
| onapristone | |
| Thiomalates | |
| 3-(6-isobutyl-9-methoxy-1,4-dioxo-1,2,3,4,6,7,12,12a-octahydropyrazino(1',2'-1,6)pyrido(3,4-b)indol-3-yl)propionic acid tert-butyl ester | |
| N-(3-chlorophenyl)-2-(4-((2,4-dioxothiazolidin-5-ylidene)methyl)phenoxy)acetamide | |
| N-phenyl-7-(hydroxyimino)cyclopropa(b)chromen-1a-carboxamide | |
| norisoboldine | |
| cobaltous chloride | |
| 5-androstene-16-fluoro-17-one | |
| TRAM 34 | An organochlorine compound that has formula C22H17ClN2. |
| FR 118487 | |
| 4-aminophenol | An amino phenol (one of the three possible isomers) which has the single amino substituent located para to the phenolic -OH group. |
| declopramide | |
| MCC-257 | |
| 5-methoxy-1,2-dimethyl-3-((4-nitrophenoxy)methyl)indole-4,7-dione | |
| alpha-Tocopherol | |
| ME 3229 | |
| Endosulfan | A cyclic sulfite ester that is 1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepine 3-oxide substituted by chloro groups at positions 6, 7, 8, 9, 10 and 10. |
| aurin | A diarylmethane that has formula C19H14O3. |
| hexanoyl-coenzyme A | |
| Morphine | A morphinane alkaloid that is a highly potent opiate analgesic psychoactive drug. Morphine acts directly on the central nervous system (CNS) to relieve pain but has a high potential for addiction, with tolerance and both physical and psychological dependence developing rapidly. Morphine is the most abundant opiate found in Papaver somniferum (the opium poppy). |
| 4-(4-chloro-2-methylphenoxy)-N-hydroxybutanamide | |
| dimethyl mercaptosuccinate | |
| ((5Z)5-(1,3-benzodioxol-5-yl)methylene-2-phenylamino-3,5-dihydro-4H-imidazol-4-one) | |
| 1,4-dihydropyridine | |
| caloxin 1b1 | |
| Quinolinic Acid | A pyridinedicarboxylic acid that is pyridine substituted by carboxy groups at positions 2 and 3. It is a metabolite of tryptophan. |
| citraconic acid | A dicarboxylic acid consisting of maleic acid having a methyl substituent at the 2-position. |
| loxoprofen | |
| hydrazine | An azane that has formula H4N2. |
| 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea | |
| monocrotaline pyrrole | |
| norcisapride | |
| N(6)-benzoyl-cyclic AMP | |
| SIB 1893 | |
| Emodin | A member of the class of hydroxyanthraquinones that is 9,10-anthraquinone which is substituted by hydroxy groups at positions 1, 3, and 8 and by a methyl group at position 6. It is present in the roots and barks of numerous plants (particularly rhubarb and buckthorn), moulds, and lichens. It is an active ingredient of various Chinese herbs. |
| Corticotropin-Releasing Hormone | |
| CMI 392 | |
| p-Methoxy-N-methylphenethylamine | |
| dibenzofuran | A mancude organic heterotricyclic parent that consists of a furan ring flanked by two benzene rings ortho-fused across the 2,3- and 4,5-positions. |
| Pyruvates | |
| bromophos | |
| LG 268 | |
| diacetyldichlorofluorescein | |
| Mercury Compounds | |
| L 685458 | A peptide and carboxamide that is L-leucyl-L-phenylalaninamide, L-Leu-L-Phe-NH2, which has been acylated on the N-terminus by a Phe-Phe hydroxyethylene dipeptide isotere, 2R-benzyl-5S-tert-butoxycarbonylamino-4R-hydroxy-6-phenylhexanoic acid. Compounds based on the structure of L-685,458 are potent inhibitors of gamma-secretase, which mediates the final catalytic step that generates the amyloid beta-peptide (Abeta), which assembles into the neurotoxic aggregates in the brains of sufferers of Alzheimer's disease. |
| rebamipide | |
| Butyrophenones | |
| diethoxyphosphoryloxymethyl butanoate | |
| 3-(4-benzoyl-1-methyl-1H-2-pyrrolyl)-N-hydroxy-2-propenamide | |
| BIII 890 CL | |
| K075 compound | |
| Misonidazole | |
| Phloroglucinol | |
| titanium(IV) transferrin | |
| 4,4',4''-(4-propyl-((1)H)-pyrazole-1,3,5-triyl) tris-phenol | |
| Nafcillin | A penicillin that has formula C21H22N2O5S. |
| sulfamethoxazole hydroxylamine | A sulfonamide compound having a 4-hydroxylaminophenyl group attached to the sulfur atom and a 1,2-oxazol-3-yl group attached to the nitrogen atom. |
| 2,2-di(4-methacryloxyphenyl)propane | A bisphenol that is bisphenol A condensed with two molecules of methacrylic acid. |
| Flucytosine | An organofluorine compound that has formula C4H4FN3O. |
| dehydroxymethylepoxyquinomicin | |
| 5-(3-(4-benzylpiperidin-1-yl)prop-1-ynyl)-1,3-dihydrobenzoimidazol-2-((11)C)one | |
| Aldicarb | The oxime carbamate resulting from the addition of 2-methyl-2-(methylsulfanyl)propanaldoxime to methyl isocyanate. A member of the class of oxime carbamate insecticides, aldicarb is a mixture of E and Z isomers; it is not known which isomer is more active. |
| N(4)-hydroxycytosine | |
| lead chloride | |
| ajulemic acid | |
| CVT 313 | |
| 5,10,15,20-tetrakis(N-methyl-4'-pyridyl)porphyrinato-iron(III) | |
| Chlorpropham | A carbamate ester that is the isopropyl ester of 3-chlorophenylcarbamic acid. |
| Lysergic Acid Diethylamide | An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. |
| 1-hydroxy-1-hydroperoxynonane | |
| hypericin | A carbopolycyclic compound that has formula C30H16O8. |
| 7-benzylamino-5-(2-(hydroxymethyl)propyl)amino-3-isopropyl-1(2)H-pyrazolo(4,3-d)pyrimidine | |
| Albuterol | A member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). |
| benzo(a)pyrene 7,8-dihydrodiol | |
| 1-Deoxynojirimycin | |
| 8-(4-chloro-phenylthio)-2'-O-methyladenosine-3'-5'-cyclic monophosphate | |
| Vasopressins | |
| adenophostin A | A disaccharide phosphate that has formula C16H26N5O18P3. |
| Imipramine | A dibenzoazepine that is 5H-dibenzo[b,f]azepine substituted by a 3-(dimethylamino)propyl group at the nitrogen atom. |
| butafenacil | |
| Xamoterol | |
| Octreotide | A homodetic cyclic peptide that has formula C49H66N10O10S2. |
| hydrastine | |
| 3'-deamino-3'-(3-cyano-4-morpholinyl)doxorubicin | |
| polyserine | |
| ciproxifan | |
| tolmetin glucuronide | |
| adrenic acid | |
| liquiritin | A flavonoid that has formula C21H22O9. |
| 4-cresol | |
| 5-nitro-6,7,8,9-tetrahydrobenzo(G)indole-2,3-dione-3-oxime | |
| Pyrilamine | |
| Rifamycins | |
| cytotoxic necrotizing factor type 1 | |
| Promazine | |
| disprocynium 24 | |
| dibenzo(a,l)pyrene | An ortho- and peri-fused polycyclic arene that has formula C24H14. |
| 1-Octanol | |
| ipriflavone | |
| 1,3-diacetoxytetradeca-6,12-dien-8,10-diyne | |
| 1-aminopyrene | |
| Cyproheptadine | The product resulting from the formal oxidative coupling of position 5 of 5H-dibenzo[a,d]cycloheptene with position 4 of 1-methylpiperidine resulting in the formation of a double bond between the two fragments. It is a sedating antihistamine with antimuscarinic and calcium-channel blocking actions. It is used (particularly as the hydrochloride sesquihydrate) for the relief of allergic conditions including rhinitis, conjunctivitis due to inhalant allergens and foods, urticaria and angioedema, and in pruritic skin disorders. Unlike other antihistamines, it is also a seratonin receptor antagonist, making it useful in conditions such as vascular headache and anorexia. |
| 2-(4-(2-carboxyethyl)phenethylamino)-5'-N-ethylcarboxamidoadenosine | |
| Terphenyl Compounds | |
| 1-phenylimidazole | |
| 4-(6-hydroxy-2-naphthyl)-1,3-benzenediol | |
| Thiazides | Heterocyclic compound with sulfur and nitrogen in the ring. |
| 1-oleoyl lysophosphatidylcholine | |
| alpha,beta-methyleneadenosine 5'-triphosphate | |
| FEC protocol | |
| Cystamine | An organic disulfide obtgained by oxidative dimerisation of cysteamine. |
| acacetin | |
| galaxolide | An organic heterotricyclic compound that is 1,3,4,6,7,8-hexahydrocyclopenta[g]isochromene substituted by methyl groups at positions 4, 6, 6, 7, 8 and 8 respectively. It is a synthetic musk used as a fragrance in cosmetics. |
| tolcapone | |
| methaneselenol | An organoselenium compound that is a selenium analogue of methanol, comprising a methyl group covalently bound to a selenol group. |
| molybdenum trioxide | A molybdenum oxide that has formula MoO3. |
| tert-butyl-2-(6-((2-(acetylamino)-1,3-benzothiazol-4-yl)oxy)pyrimidin-4-yl)-5-(trifluoromethyl)phenylcarbamate | |
| pomalidomide | An aromatic amine that is thalidomide substituted at position 4 on the isoindole ring system by an amino group. Used for the treatment of multiple myeloma in patients who failed to respond to previous therapies. |
| Benserazide | |
| norethindrone acetate | |
| Thiohydantoins | |
| 4-hydroxypyrazole | |
| 3-chloro-4-(dichloromethyl)-5-hydroxy-2(5H)-furanone | A butenolide that has formula C5H3Cl3O3. |
| ammonium ferrous sulfate | |
| ((1S,2S,4R)-4-(4-((1S)-2,3-dihydro-1H-inden-1-ylamino)-7H-pyrrolo(2,3-d)pyrimidin-7-yl)-2-hydroxycyclopentyl)methyl sulphamate | |
| alopestatin | |
| desoxypeganine 1 | |
| Organoplatinum Compounds | A compound containing at least one carbon-platinum bond. |
| guanidinopropionic acid | |
| ronnel | An organic thiophosphate that has formula C8H8Cl3O3PS. |
| 4-hydroxybenzoic acid | A monohydroxybenzoic acid that is benzoic acid carrying a hydroxy substituent at C-4 of the benzene ring. |
| estradiol dipropionate | A steroid ester that has formula C24H32O4. |
| bisphenol F diglycidyl ether | |
| 1-indanol | |
| dienogest | |
| oxyfluorofen | |
| N,N-dimethylaniline | A tertiary amine that is aniline in which the amino hydrogens are replaced by two methyl groups. |
| hexadecafluoro-nonanoic acid | Any derivative of nonanoic acid carrying sixteen fluoro substituents. |
| Adenosine Triphosphate | |
| Topotecan | A pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks. |
| antimycin | |
| Imiloxan | |
| Mesoporphyrins | Any porphyrin compound produced from a protoporphyrin by the addition of a hydrogen to the double bond of each of the vinyl groups. |
| apicularen A | |
| 1,2,4,5-benzenetetraamine | |
| lazabemide | |
| 1'-acetoxychavicol acetate | An acetate ester that is chavicol acetate substituted by an acetoxy group at position 1'. |
| gypenoside | |
| Pregnenolone | |
| Phosphates | Salts and esters of phosphoric and oligophosphoric acids and their chalcogen analogues. In inorganic chemistry, the term is also used to describe anionic coordination entities with phosphorus as central atom. |
| quinoline | The simplest member of the quinoline class of compounds, comprising a benzene ring ortho fused to C-2 and C-3 of a pyridine ring. |
| 3-hydroxybisphenol A | |
| thiocoraline | A peptide that has formula C48H56N10O12S6. |
| omega-Conotoxin GVIA | |
| huachansu | |
| Cholestanols | |
| CAY10415 | |
| gastrin 17 | One of the primary forms of gastrin that is a 17-membered peptide consisting of Glp, Gly, Pro, Trp, Leu, Glu, Glu, Glu, Glu, Glu, Ala, Tyr, Gly, Trp, Met, Asp and Phe-NH2 residues joined in sequence. |
| Glutathione Disulfide | A glutathione derivative that has formula C20H32N6O12S2. |
| 1-nonanol | |
| 1,2-bis(2-aminophenoxy)ethane-N,N,N',N'-tetraacetic acid | |
| 2,6-diamino-4-hydroxy-5-formamidopyrimidine | |
| NC 1900 | |
| Phentolamine | |
| Ribose | Any aldopentose where the open-chain form has all the hydroxy groups on the same side in the Fischer projection. Occurrs in two enantiomeric forms, D- and L-ribose, of which only the former is found in nature. |
| coumarin | |
| Perazine | |
| Antineoplastic Agents | A substance that inhibits or prevents the proliferation of neoplasms. |
| benzo(k)fluoranthene | A naphthalene that has formula C20H12. |
| adinazolam | A triazolo[4,3-a][1,4]benzodiazepine having a dimethylaminomethyl group at the 1-position, a phenyl group at the 6-position and a chloro substituent at the 8-position. |
| tenofovir | |
| 2,3'-dichlorobiphenyl | |
| tipifarnib | |
| SB 271046 | |
| 2-propyl-4-pentenoic acid | |
| Cuprizone | |
| Colforsin | |
| phorbolol myristate acetate | |
| Muscimol | A member of the class of isoxazoles that is 1,2-oxazol-3(2H)-one substituted by an aminomethyl group at position 5. It has been isolated from mushrooms of the genus Amanita. |
| Sulfonium Compounds | |
| Ethylmercuric Chloride | |
| Gliotoxin | A pyrazinoindole with a disulfide bridge spanning a dioxo-substituted pyrazine ring; mycotoxin produced by several species of fungi. |
| Go 6976 | |
| Tartrazine | |
| globotriaosylceramide | |
| 4-trifluoromethylumbelliferyl iduronide | |
| cnidiadin | |
| butane-2,3-dione thiosemicarbazone oxime | |
| 2-amino-5-nitrophenol | A C-nitro compound that has formula C6H6N2O3. |
| ipsapirone | |
| Aristolochic Acids | |
| Mycophenolic Acid | |
| 1-(3-trifluoromethylphenyl)piperazine | A N-arylpiperazine that is piperazine substituted by a 3-(trifluoromethyl)phenyl group at position 1. A serotonergic agonist used as a recreational drug. |
| Dienestrol | |
| denatonium benzoate | |
| Fatty Acids, Essential | |
| fluoroneplanocin A | |
| mono-benzyl phthalate | |
| O,O-diethylphosphorylcholine iodide | |
| mosapride | |
| triacsin C | |
| allicin | A sulfoxide that has formula C6H10OS2. |
| BMY 7378 | |
| 1,3-dinitropyrene | A pyrene that has formula C16H8N2O4. |
| Phenothiazines | |
| Oxprenolol | |
| Zeocin | |
| Pilocarpine | |
| CpG ODN 2006 | |
| Phosgene | An acyl chloride obtained by substitution of both hydrogens of formaldehyde by chlorine. |
| gnetin C | |
| phosphinothricin | A phosphinic acid that has formula C5H12NO4P. |
| putranjivain A | |
| exoenzyme C3, Clostridium botulinum | |
| Nandrolone | A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
| cocaethylene | |
| Phosmet | A phthalimide that has formula C11H12NO4PS2. |
| Linoleic Acid | An octadecadienoic acid in which the two double bonds are at positions 9 and 12 and have Z (cis) steeochemistry. |
| chrysin | A dihydroxyflavone in which the two hydroxy groups are located at positions 5 and 7. |
| 2-amino-4-hydroxy-6-formylpteridine | |
| ethyl caffeate | A hydroxycinnamic acid that has formula C11H12O4. |
| Pregnadienes | |
| helenalin | A sesquiterpene lactone that is 3,3a,4,4a,7a,8,9,9a-octahydroazuleno[6,5-b]furan-2,5-dione substituted by a hydroxy group at position 4, methyl groups at positions 4a and 8 and a methylidene group at position 3 (the 3aS,4S,4aR,7aR,8R,9aR stereoisomer). |
| marimastat | A tricarboxylic acid triamide that has formula C15H29N3O5. |
| Bacterial Toxins | |
| GH-RH(1-29), desaminotyrosyl(1)-ornithyl(12,21)-alpha-aminobutryic acid(15)-norleucyl(27)-aspartyl(28)-agmatine(29)- | |
| SPD-304 | |
| Ondansetron | |
| Nitrendipine | |
| Acetyl Coenzyme A | |
| Potassium, Dietary | |
| Acridines | |
| cobalt oxide | |
| SSR180575 | |
| arsenic pentoxide | |
| 1-propyl-5-(3-p-tolylisoxazol-5-yl)-1,2,3,6-tetrahydropyridine | |
| 4-benzyl-2-methyl-1,2,4-thiadiazolidine-3,5-dione | |
| rimonabant | |
| cyanidin 3-O-glucoside | |
| ginsenoside M1 | |
| treprostinil | |
| Dihydrotestosterone | |
| Coumestrol | A member of the class of coumestans that is coumestan with hydroxy substituents at positions 3 and 9. |
| 2-(acetyloxy)benzoic acid 6-(nitrooxymethyl)-2-phenylmethyl ester | |
| catalase-polyethylene glycol | |
| 2-xylene | |
| Isoquinolines | A class of organic heteropolycyclic compound consisting of isoquinoline and its substitution derivatives. |
| variegin protein, Amblyomma variegatum | |
| Flurothyl | |
| SM 21 | |
| Guanosine 5'-O-(3-Thiotriphosphate) | |
| Linuron | A member of the class of ureas that is N-methyl urea substituted by a methoxy group at position 1 and a 3,4-dichlorophenyl group at position 3. |
| Loratadine | |
| 8-hydroxywarfarin | |
| sulglicotide | |
| Nitric Oxide Donors | An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. |
| paclobutrazol | A triazole derivative that acts as a plant-growth retardant and fungicide via inhibition of gibberellin biosynthesis. |
| betulinic acid | A pentacyclic triterpenoid that is lupane having a double bond at position 20(29) as well as 3beta-hydroxy and 28-carboxy substituents. It is found in the bark and other plant parts of several species of plants including Syzygium claviflorum. It exhibits anti-HIV, antimalarial, antineoplastic and anti-inflammatory properties. |
| clofilium | An organic amino compound that has formula C21H37ClN. |
| antofine | |
| soterenol | |
| Organometallic Compounds | A compound having bonds between one or more metal atoms and one or more carbon atoms of an organyl group. |
| 2,6-dimethyl-1,4-benzoquinone | |
| Folfox protocol | |
| 2,3,5,6-tetrachlorohydroquinone | |
| Methylnitrosourea | |
| Diphenylamine | |
| potassium hexachloropalladate(IV) | |
| zinc hematoporphyrin | |
| gemfibrozil 1-O-acylglucuronide | |
| igmesine | |
| Loperamide | A synthetic piperidine derivative, effective against diarrhoea resulting from gastroenteritis or inflammatory bowel disease. |
| schizandrin A | |
| schizandrin B | |
| BP-PM6 | |
| YM 511 | |
| 4-nitroanisole | A member of the class of 4-nitroanisoles that is anisole in which one the hydrogen meta to the methoxy group is replaced by a nitro group. |
| Benzydamine | |
| valyl-prolyl-aspartyl-prolyl-arginine | |
| 2-(1H-indazol-4-yl)-6-(4-methanesulfonylpiperazin-1-ylmethyl)-4-morpholin-4-ylthieno(3,2-d)pyrimidine | |
| Imines | |
| Cycloserine | |
| ICI 89406 | |
| monocyte locomotion inhibitory factor | |
| Bithionol | Diphenyl sulfide in which each phenyl group is substituted at position 2 by hydroxy and at positions 3 and 5 by chlorine. A fungicide and anthelmintic, it was used in various topical drug products for the treatment of liver flukes, but withdrawn after being shown to be a potent photosensitizer with the potential to cause serious skin disorders. |
| WIN 51708 | |
| ASTM F-75 implant alloy | |
| icatibant | |
| SB 216763 | |
| iodosulpride | |
| chlamydocin | |
| DAPI | An indole that has formula C16H15N5. |
| Adipates | |
| zingerone | A ketone that is 4-phenylbutan-2-one in which the phenyl ring is substituted at positions 3 and 4 by methoxy and hydroxy groups respectively. The major pungent component in ginger. |
| oryzalin | A sulfonamide that is benzenesulfonamide substituted at positions 3 and 5 by nitro groups and at position 4 by a dipropylamino group. |
| penconazole | A racemate comprising equal amounts of (R)- and (S)-penconazole. A fungicide used to control powdery mildew, scab and other pathogenic Ascomycetes, Basidiomycetes and Deuteromycetes. |
| Isoflurane | An organofluorine compound that has formula C3H2ClF5O. |
| Isoproterenol | |
| gamma-Glu-S-BzCys-PhGly diethyl ester | |
| 6-hydroxyluteolin | A pentahydroxyflavone that is luteolin with an additional hydroxy group at position 6. |
| 1,6-hexamethylene diisocyanate | |
| SK&F 82958 | |
| 4-(4-(2,3-dihydrobenzo(1,4)dioxin-6-yl)-5-pyridin-2-yl-1H-imidazol-2-yl)benzamide | |
| 2,8-dichlorodibenzo-4-dioxin | |
| Amphotericin B | A macrolide antibiotic used to treat potentially life-threatening fungal infections. |
| beta-hexachlorocyclohexane | The beta-isomer of hexachlorocyclohexane. |
| deltanit | |
| 3-O-methylgallic acid | A member of the class of benzoic acids that is gallic acid in which the phenolic hydroxy group at position 3 is converted to the corresponding methyl ether. |
| Ramipril | A dipeptide that is the prodrug for ramiprilat, the active metabolite obtained by hydrolysis of the ethyl ester group. An angiotensin-converting enzyme (ACE) inhibitor, used to treat high blood pressure and congestive heart failure. |
| chlorocresol | |
| efavirenz | |
| ricinoleic acid | A straight-chain, 18:1, long-chain fatty acid having a cis- double bond at position 9 and an R-oriented hydroxy group at position 12. |
| dibutyldichlorotin | |
| quercetin 3'-sulfate | A quercetin sulfate with a sulfo group at position 3. |
| N''-cyano-N-(6-amino-3,4-dihydro-3-hydroxy-2-methyl-2-dimethoxymethyl-2H-benzopyran-4-yl)-N'-benzylguanidine | |
| 19-hydroxy-5,8,11,14-eicosatetraenoic acid | |
| thieno(2,3-c)isoquinolin-5-one | |
| RG108 | |
| L 663536 | |
| 4-methylcatechol | A methylcatechol having a single methyl substituent at the 4-position. It has been isolated from Picea abies. |
| 5-Methoxytryptamine | |
| estradiol 3-benzoate | |
| dodecanedioic acid | An alpha,omega-dicarboxylic acid that is dodecane in which the methyl groups have been oxidised to the corresponding carboxylic acids. |
| Adenylate Cyclase Toxin | |
| Enkephalin, D-Penicillamine (2,5)- | |
| 1,1,4-tris(acetyloxy)-2-nonene | |
| Hydrogen Peroxide | An inorganic peroxide that has formula H2O2. |
| Phenol | An organic hydroxy compound that consists of benzene bearing a single hydroxy substituent. The parent of the class of phenols. |
| allyl disulfide | |
| Chloroquine | An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
| CNB 001 | |
| N(4)-hydroxycytidine | |
| maltodextrin | |
| N-(3-methoxyphenyl)-4-chlorocinnamanilide | |
| hydroperoxyisophosphamide | |
| fomepizole | A member of the class of pyrazoles that is 1H-pyrazole substituted by a methyl group at position 4. |
| ((dihydroindenyl)oxy)alkanoic acid | |
| Clodronic Acid | |
| 5-fluorocytidine | A cytidine that has formula C9H12FN3O5. |
| 3-hydroxy-4-prenyl-5-methoxystilbene-2-carboxylic acid | |
| immunomycin | |
| 1-ethynylpyrene | |
| Mitotane | |
| ((2-n-butyl-6,7-dichloro-2-cyclopentyl-2,3-dihydro-1-oxo-1H-inden-5-yl)oxy)acetic acid | |
| N-((4-(5,9-diethoxy-6-oxo-6,8-dihydro-7H-pyrrolo(3,4-g)quinolin-7-yl)-3-methylbenzyl)sulfonyl)-2-(2-methoxyphenyl)acetamide | |
| bathocuproine | |
| xanthone | The parent compound of the xanthone class consisting of xanthene bearing a single oxo substituent at position 9. |
| monomethyl phthalate | |
| 4-(benzothiazol-2-yl)-4-hydroxy-2,5-cyclohexadien-1-one | |
| 2-tert-butylhydroquinone | A member of the class of hydroquinones in which one of the ring hydrogens of hydroquinone is replaced by a tert-butyl group. |
| pyrithione zinc | |
| Saquinavir | |
| manganese tetrakis-(N-ethyl-2 pyridyl) porphyrin | |
| noladin ether | |
| MEN91507 | |
| spantide II | |
| 1 alpha-hydroxyergocalciferol | |
| 5-(N,N-dimethylaminomethyl)-3-(4-nitrophenyl)-4,5-dihydroisoxazole | |
| Organophosphorus Compounds | |
| Trehalose | |
| bathocuproine sulfonate | |
| 4-trifluoromethylsalicylic acid | |
| Angiotensin Receptor Antagonists | A hormone antagonist that blocks angiotensin receptors. |
| glutathione-C4 | |
| heyneanol A | |
| 2-(4-chlorophenoxy)propionic acid | |
| 7-methylguanine | A methylguanine that is guanine substituted by a methyl group at position 7. It is a metabolite obtained during the methylation of DNA. |
| benz(a)anthracene-3,4-dione | |
| cerous chloride | |
| Vitamin B 12 | |
| tripchlorolide | |
| sulfotepp | |
| Nylidrin | |
| acivicin | An L-alpha-amino acid that is L-alanine in which the methyl group is replaced by a (5S)-3-chloro-4,5-dihydro-1,2-oxazol-5-yl group. A glutamine analogue antimetabolite, it interferes with glutamate metabolism and several glutamate-dependent synthetic enzymes. It is obtained as a fermentation product of Streptomyces sviceus bacteria. |
| Chromones | A chromenone that consists of a 1,4-benzopyrone skeleton and its substituted derivatives thereof. |
| bromotriethylstannane | |
| 7-methyl-6,7,8,9,14,15-hexahydro-5H-benz(d)indolo(2,3-g)azecine | |
| Withanolides | Any steroid lactone that is a C28 steroid with a modified side chain forming a lactone ring and its substituted derivatives. |
| iroxanadine | |
| tetramethrin | A phthalimide insecticide that has formula C19H25NO4. |
| pristane | A norterpene that is an acyclic saturated hydrocarbon derived from phytane by loss of its C-16 terminal methyl group. |
| cyclopiazonic acid | |
| 2,3-diaminotoluene | |
| Pentylenetetrazole | |
| 2-methylarachidonyl-2'-fluoroethylamide | |
| E804 bisindole | |
| Scopolamine Hydrobromide | |
| Oxycodone | An organic heteropentacyclic compound that has formula C18H21NO4. |
| Acebutolol | An ether that is the 2-acetyl-4-(butanoylamino)phenyl ether of the primary hydroxy group of 3-(propan-2-ylamino)propane-1,2-diol. |
| Strychnine | |
| benzonaphthyridone | |
| dihydromyricetin | |
| benzyloxycarbonylleucyl-leucyl-leucine aldehyde | |
| PD 180988 | |
| limonin | A hexacyclic triterpenoid that has formula C26H30O8. |
| dihydroptychantol A | |
| 3-((2-iodothiazol)-4-ethynyl)-5-fluorobenzonitrile | |
| beta-conglycinin protein, Glycine max | |
| Ditiocarb | |
| cortivazol | |
| CGP 57380 | |
| hydramethylnon | A member of the class of hydrazones that is used as an insecticide for control of ants and cockroaches. |
| 2'-C-methylcytidine | |
| RU 5135 | A 11-oxo steroid that has formula C18H28N2O2. |
| geranyl pyrophosphate | |
| Chlorine | A monoatomic chlorine that has formula Cl. |
| 2,6-Dichloroindophenol | A quinone imine that is indophenol substituted by chloro groups at positions 2 and 6. |
| isoproturon | A member of the class of ureas that is 1,1-dimethylurea substituted by a p-cumenyl group at position 3. |
| Iodoquinol | |
| 1,3-dihydroxypropan-2-yl 11-(2-hexyl-5-hydroxyphenoxy)undecanoate | |
| dimethyl sulfone | |
| Nanotubes, Carbon | |
| S110 compound | |
| Cymarine | |
| 4-hydroxy-2',3',4'-5'-tetrachlorobiphenyl | |
| 103D5R | |
| 3-butylidene-4,5,6,7-tetrahydro-6,7-dihydroxy-1(3H)-isobenzofuranone | |
| Cilazapril | |
| 1-Sarcosine-8-Isoleucine Angiotensin II | |
| 2-Methyl-4-chlorophenoxyacetic Acid | |
| Charybdotoxin | |
| adenosine 5'-O-(3-thiotriphosphate) | |
| salicylamide | The simplest member of the class of salicylamides derived from salicylic acid. |
| dimethoxycurcumin | |
| 2-amino-6-borono-2-methylhexanoic acid | |
| Dexfenfluramine | |
| loxoribine | |
| iodopravadoline | |
| 5-(4-((6-(allyloxy)-2,5,7,8-tetramethylchroman-2-yl)methoxy)-3-methoxybenzylidene)thiazolidine-2,4-dione | |
| Bromthymol Blue | |
| trimethyl phosphate | A trialkyl phosphate that is the trimethyl ester of phosphoric acid. |
| 1,4-anthraquinone | |
| 12-dehydrogingerdione | |
| 1-benzylpiperidine | |
| Diamide | |
| Proguanil | |
| aminoindanol | |
| kaempferol 7-O-glucoside | |
| GSK 650394 | |
| pinocembrin | A dihydroxyflavanone in which the two hydroxy groups are located at positions 5 and 7. A natural product found in Piper sarmentosum and Cryptocarya chartacea. |
| geranyl diphosphate | The diphosphate of the polyprenol compound geraniol. |
| Diltiazem | A 5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate in which both stereocentres have S configuration. A calcium-channel blocker and vasodilator, it is used as the hydrochloride in the management of angina pectoris and hypertension. |
| Cystathionine | A modified amino acid generated by enzymic means from homocysteine and serine. |
| Roflumilast | |
| CPG-oligonucleotide | |
| morniflumate | |
| Fludrocortisone | A mineralocorticoid that has formula C21H29FO5. |
| nimesulide | |
| dimethyl maleate | A maleate ester resulting from the formal condensation of both carboxy groups of maleic acid with methanol. It is commonly used as a dienophile for Diels-Alder-type cycloaddition reactions in organic synthesis. |
| Adenine | |
| calpeptin | An amino acid amide that has formula C20H30N2O4. |
| calphostin complex | |
| cyclo(Gln-Trp-Phe-Gly-Leu-Met) | |
| 1,6-diaminohexane | |
| 4-nitrophenol | A mononitrophenol having the nitro group placed at the 4-position. |
| cimoxatone | |
| 2-(2-(3,4-dichlorophenyl)-2,3-dihydro-1H-isoindol-5-ylamino)nicotinic acid | |
| ametryne | |
| trimellitic anhydride | A 2-benzofuran compound having oxo groups at the 1- and 3-positions and a carboxy substituent at the 5-position; the cyclic anhydride formed from the carboxy groups at the 1- and 2-positions of trimellitic acid. |
| monomethylpropion | |
| 3-tritylthio-L-alanine | |
| 6,2',4'-trimethoxyflavone | |
| Phenolsulfonphthalein | |
| propyl pyrazole triol | |
| GGTI-2133 | |
| 1-(2-methyl-4-methoxyphenyl)-4-((2-hydroxyethyl)amino)-6-trifluoromethoxy-2,3-dihydropyrrolo(3,2-c)quinoline | |
| Sch 28080 | |
| 6-cyano-4-(N-ethylsulfonyl-N-methylamino)-3-hydroxy-2,2-dimethylchromane | |
| rosiglitazone | |
| Technetium Tc 99m Sestamibi | |
| 3'-methoxy-4'-nitroflavone | |
| indoxam | |
| benzo(a)pyrene-7,8-dione | |
| cucurbitacin B | A cucurbitacin in which a lanostane skeleton is multi-substituted with hydroxy, methyl and oxo substituents, with unsaturation at positions 5 and 23; a hydroxy function at C-25 is acetylated. |
| Cephalothin | |
| cucurbitacin I | A cucurbitacin that is 9,10,14-trimethyl-4,9-cyclo-9,10-secocholesta-2,5,23-triene substituted by hydroxy groups at positions 2, 16, 20 and 25 and oxo groups at positions 1, 11 and 22. |
| sodium bisulfite | |
| N-((2'-(((4,5-dimethyl-3-isoxazolyl)amino)sulfonyl)-4-(2-oxazolyl)(1,1'-biphenyl)-2-yl)methyl)-N,3,3-trimethylbutanamide | |
| 2-ethylhexyl 2,3,4,5-tetrabromobenzoate | |
| N-(2'-(dimethylamino)ethyl)acridine-4-carboxamide | |
| zonisamide | A 1,2-benzoxazole compound having a sulfamoylmethyl substituent at the 3-position. |
| SNX 482 | |
| tetrahydrozoline | |
| Sodium Hypochlorite | |
| acid chrome blue K | |
| Panax notoginseng extract | |
| SRM 1597 | |
| dibenzo(aj)anthracene | |
| ptaquiloside | A glycoside that has formula C20H30O8. |
| Mitoxantrone | A hydroxyanthraquinone that has formula C22H28N4O6. |
| Patulin | A furopyran and lactone that is 2H-pyran-3(6H)-ylidene)acetic acid which is syubstituted by hydroxy groups at positions 2 and 4 and in which the hydroxy group at position 4 has condensed with the carboxy group to give the corresponding bicyclic lactone. A mycotoxin produced by several species of Aspergillus and Penicillium, it has antibiotic properties but has been shown to be carcinogenic and mutagenic. |
| 2,3-dihydroxynaphthalene | |
| pentabromophenol | |
| 3,5-diethoxycarbonyl-1,4-dihydrocollidine | A dihydropyridine that is 2,4,6-trimethyl-1,4-dihydropyridine substituted by ethoxycarbonyl groups at positions 3 and 5. |
| Benzene | A six-carbon aromatic annulene in which each carbon atom donates one of its two 2p electrons into a delocalised pi system. A toxic, flammable liquid byproduct of coal distillation, it is used as an industrial solvent. Benzene is a carcinogen that also damages bone marrow and the central nervous system. |
| N-(4-O-(2-methoxy,phenoxyethylaminobutyl)-3-methoxybenzyl)nonamide | |
| 3,4-Dichloro-N-methyl-N-(2-(1-pyrrolidinyl)-cyclohexyl)-benzeneacetamide, (trans)-Isomer | |
| Pyrimidinones | |
| luzindole | |
| N-(1,3-benzodioxol-5-ylmethyl)-2,6-dichlorobenzamide | |
| isocytisoside | |
| orazipone | |
| CID755673 | |
| Chlorpyrifos | An organic thiophosphate that is O,O-diethyl hydrogen phosphorothioate in which the hydrogen of the hydroxy group has been replaced by a 3,5,6-trichloropyridin-2-yl group. |
| dimethocaine | |
| Enterotoxins | |
| Org 34850 | |
| Trimethoprim | An aminopyrimidine antibiotic whose structure consists of pyrimidine 2,4-diamine and 1,2,3-trimethoxybenzene moieties linked by a methylene bridge. |
| ethyl N-allyl-N-(2-methyl-3-(4-(4-amidinophenoxycarbonyl)phenyl)propenoyl)aminoacetate methanesulfonate | |
| manumycin | |
| mivacurium | |
| Trifluralin | A substituted aniline that is N,N-dipropylaniline substituted by a nitro groups at positions 2 and 6 and a trifluoromethyl group at position 4. It is an agrochemical used as a pre-emergence herbicide. |
| methyl-beta-cyclodextrin | |
| Bresol | |
| Prenalterol | An aromatic ether that has formula C12H19NO3. |
| acteoside | |
| nonylphenol | |
| malachite green | |
| Deanol | |
| AM 1241 | |
| genkwanin | A monomethoxyflavone that is apigenin in which the hydroxy group at position 7 is methylated. |
| dicyclohexyl phthalate | A 2-hydroxyisophthalic acid that has formula C20H26O4. |
| N-(1-ethylpropyl)-(3-methoxy-5-(2-methoxy-4-trifluoromethoxyphenyl)-6-methyl-pyrazin-2-yl)amine | |
| Amobarbital | |
| androsta-5,16-dien-3 beta-ol | |
| darinaparsin | |
| lanatoside C | |
| isosafrole | A benzodioxole that has formula C10H10O2. |
| 2,3,4',6-tetrachlorobiphenyl | |
| Medetomidine | |
| lysomustine | |
| S-dimethylaminoarsino-thiosuccinic acid | |
| CB 403 | |
| 13-cis-retinal | A retinal in which the double bond alpha- to the aldehyde group has cis configuration, whilst the remaining acyclic double bonds have trans configuration. |
| (1'S, 2S)-4-amino-N-(1'-carbamoyl-2'-phenylethyl)-2-(4''-methyl-1''-naphthalenesulfonylamino)butanamide | |
| Milrinone | A member of the class of bipyridines that is 2-pyridone which is substituted at positions 3, 5, and 6 by cyano, pyrid-4-yl, and methyl groups, respectively. It is used (particularly intravenously, as the lactate) for the short-term management of severe heart failure. |
| prulifloxacin | |
| aluminum phosphide | |
| Nitrogen Oxides | |
| hexarelin | |
| retene | |
| phenthoate | An organic thiophosphate that is ethyl mandelate in which the hydroxy group has been replaced by a (dimethoxyphosphorothioyl)sulfanediyl group. |
| naratriptan | A heteroarylpiperidine that has formula C17H25N3O2S. |
| 4-OH-2',3,3',4',5'-pentachlorobiphenyl | |
| sphingosine phosphorylcholine | |
| lipopolysaccharide, Escherichia coli 0111 B4 | A lipopolysaccharide that is produced by E. coli strain 0111 B4. |
| Peroxides | Compounds of structure ROOR'. |
| fostriecin | |
| Isosorbide | |
| astragalin | |
| Meclizine | |
| temsirolimus | |
| Lidoflazine | |
| TDP 665759 | |
| 8-(dicyclopropylmethyl)-1,3-dipropylxanthine | |
| olmesartan medoxomil | |
| cholesterol-3-beta,5-alpha, 6-beta-triol | |
| cangrelor | |
| EM703 | |
| ciclesonide | |
| Vindesine | |
| Platinum Compounds | |
| flusilazole | A organosilicon compound that is dimethylsilane in which the hydrogens attached to the silicon are replaced by p-fluorophenyl groups and a hydrogen attached to one of the methyl groups is replaced by a 1H-1,2,4-triazol-1-yl group. It is a broad-sepctrum fungicide used to protect a variety of crops. |
| Mephenytoin | |
| 7-(benzylamino)-1,3,4,8-tetrahydropyrrolo(4,3,2-de)quinolin-8(1H)-one | |
| Gallic Acid | A trihydroxybenzoic acid in which the hydroxy groups are at positions 3, 4, and 5. |
| connective tissue-activating peptide | |
| deuterohemin-alanyl-histidyl-threonyl-valyl-glutamyl-lysine | |
| equiguard | |
| Lutein | A carotenol that has formula C40H56O2. |
| Pyrrolizidine Alkaloids | An alkaloid based on the structure of pyrrolizidine. |
| isobutylparaben | |
| disodium quercetin-7,4'-disulfate | |
| 6,8-diallyl 5,7-dihydroxy 2-(2-allyl 3-hydroxy 4-methoxyphenyl)1-H benzo(b)pyran-4-one | |
| Boron | |
| Dithionite | A sulfur oxide that has formula O4S2. |
| aroclor 1248 | |
| zolmitriptan | |
| Sucrose | Sucrose is a disaccharide formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. |
| Protriptyline | An organic tricyclic compound that has formula C19H21N. |
| 2,3-bis(4-nitrophenyl)acrylonitrile | |
| Fatty Acids, Omega-3 | |
| CAF protocol | |
| 8-methylbenzanthracene | |
| Vancomycin | A complex glycopeptide from Streptomyces orientalis. It inhibits a specific step in the synthesis of the peptidoglycan layer in the Gram-positive bacteria Staphylococcus aureus and Clostridium difficile. |
| Doxapram | A member of the class of pyrrolidin-2-ones that is N-ethylpyrrolidin-2-one in which both of the hydrogens at the 3 position (adjacent to the carbonyl group) are substituted by phenyl groups, and one of the hydrogens at the 4 position is substituted by a 2-(morpholin-4-yl)ethyl group. A central and respiratory stimulant with a brief duration of action, it is used (generally as the hydrochloride or the hydrochloride hydrate) as a temporary treatment of acute respiratory failure, particularly when superimposed on chronic obstructive pulmonary disease, and of postoperative respiratory depression. It has also been used for treatment of postoperative shivering. |
| imidazenil | |
| 2,5,3'-trichlorobiphenyl | |
| maxacalcitol | |
| iberin | |
| KMUP 1 | |
| avarol | |
| Ziram | A dithiocarbamate salt that is the zinc salt of dimethyldithiocarbamic acid. It is a broad-spectrum fungicide that is also used to accelerate the vulcanisation of rubber. |
| Alloxan | A member of the class of pyrimidones, the structure of which is that of perhydropyrimidine substituted at C-2, -4, -5 and -6 by oxo groups. |
| 2,3-pentanedione | |
| Mangifera indica extract | |
| ar-turmerone | |
| 3,4-dichlorophenol | A dichlorophenol that has formula C6H4Cl2O. |
| Niacin | |
| bis(2-guanidinoethyl)disulfide | |
| EBVP protocol | |
| Bilirubin | A member of the class of biladienes that is a linear tetrapyrrole, product of heme degradation. It is produced in the reticuloendothelial system by the reduction of biliverdin and transported to the liver as a complex with serum albumin. |
| Proteoglycans | A glycoprotein in which the carbohydrate units are polysaccharides that contain amino sugars. The protein is glycosylated by one or more (up to about 100) glycosaminoglycans. |
| xylulose-5-phosphate | A xylulose phosphate carrying a phospahte group at position 5. It is an intermediate metabolite in the pentose phosphate pathway. |
| Benzphetamine | Dextroamphetamine in which the the hydrogens attached to the amino group are substituted by a methyl and a benzyl group. A sympathomimetic agent with properties similar to dextroamphetamine, it is used as its hydrochloride salt in the treatment of obesity. |
| ruscogenin | |
| 2,3-diethyl-4,5-dipropyl-6-phenylpyridine-3-thiocarboxylate-5-carboxylate | |
| indole | Either of two isomeric forms comprising a benzene ring fused to a pyrrole ring. |
| Bromosuccinimide | |
| ferric citrate | |
| Citalopram | A racemate comprising equimolar amounts of (R)-citalopram and its enantiomer, escitalopram. It is used as an antidepressant, although only escitalopram is active. |
| 1-benzyl-1,4-dihydronicotinamide | |
| 2,3,7,8-tetrachlorodibenzofuran | A chlorin that has formula C12H4Cl4O. |
| kuwanon G | |
| kuwanon H | |
| Lactic Acid | |
| maphosphamide | |
| clorprenaline | |
| 1,4-bis(2-hydroxyiminomethylpyridinium)butane | |
| bifenthrin | A carboxylic ester obtained by formal condensation of cis-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropanecarboxylic acid and [(2-methyl-1,1'-biphenyl)-3-yl]methanol. |
| morphine-3-glucuronide | A morphinane alkaloid that has formula C23H27NO9. |
| 4'-hydroxychalcone | |
| 9,10-dihydro-2,5-dimethoxyphenanthrene-1,7-diol | |
| CDRI-97-78 | |
| (N-propargyl-(3R) aminoindan-5-yl)-ethyl methyl carbamate | |
| LY2603618 | |
| 1-phenyl-6,7-dihydroxy-isochroman | |
| norbinaltorphimine | An isoquinoline that has formula C40H43N3O6. |
| 16-hydroxyestrone | |
| 1,2-diaminobenzene | |
| WHI P131 | |
| estradiol valerate-dienogest | |
| acrylodan | |
| Dimethadione | |
| Medroxyprogesterone | A 3-oxo Delta(4)-steroid that is pregn-4-ene-3,20-dione substituted by an alpha-hydroxy group at position 17 and a methyl group at position 6. |
| Excitatory Amino Acid Agonists | An agent that binds to and activates excitatory amino acid receptors. |
| Cephradine | A cephalosporin with a methyl substituent at position 3, and a (2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetamido substituent at position 7, of the cephem skeleton. |
| aprepitant | |
| Mineral Fibers | |
| Remifemin | |
| 1-(methylimino-N-oxy)-6-(2-morpholinoethoxy)-3-phenyl-1H-indene-2-carboxylic acid ethyl ester | |
| Dust | |
| 2-(4-amino-3-methylphenyl)-5-fluorobenzothiazole | |
| 1-(1-methylethyl)-4-((1-(6-(trifluoromethyl)-3-pyridinyl)-4-piperidinyl)carbonyl)hexahydro-1H-1,4-diazepine | |
| tetraarsenic tetrasulfide | |
| 2,2-bis(3-chloro-4-hydroxyphenyl)propane | |
| Cefazolin | A cephalosporin compound having [(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]methyl and (1H-tetrazol-1-ylacetyl)amino side-groups. |
| Alprostadil | |
| peroxovanadate | |
| 4-bromoaniline | |
| beta-ionone | An ionone that is but-3-en-2-one substituted by a 2,6,6-trimethylcyclohex-1-en-1-yl group at position 4. |
| Ethoxzolamide | 1,3-Benzothiazole substituted a sulfonamide and an ethoxy group at positions 2 and 6, respectively. A carbonic anhydrase inhibitor, it has been used in the treatment of glaucoma, and as a diuretic. |
| ethylphenylpropiolate | |
| Sulfonylurea Compounds | |
| gamma-glutamylcysteine | |
| BMS 754807 | |
| nickel ferrite | |
| angelicae sinensis extract | |
| 2,3,4,5-Tetrahydro-7,8-dihydroxy-1-phenyl-1H-3-benzazepine | |
| 6-methyl-1,3,8-trichlorodibenzofuran | |
| Gold | |
| 4-chlorophenylbiguanide | |
| Tea | |
| lanostenol | |
| Diethylhexyl Phthalate | |
| cyclopentanone | A cyclic ketone that consists of cyclopentane bearing a single oxo substituent. |
| lysophosphatidic acid | |
| 2,3-hexanedione | |
| crotylsarin | |
| Chromium | A chromium group element atom that has formula Cr. |
| 2,6-di-tert-butyl-4-hydroperoxy-4-methyl-2,5-cyclohexadienone | |
| epinastine | A benzazepine that is 6,11-dihydro-5H-dibenzo[b,e]azepine in which the azepine ring is fused to the e side of 4,5-dihydro-1H-imidazol-2-amine. |
| Glipizide | |
| EUK-189 | |
| Pyruvaldehyde | |
| moxifloxacin | A quinolone that consits of 4-oxo-1,4-dihydroquinoline-3-carboxylic acid bearing a cyclopropyl substituent at position 1, a fluoro substitiuent at position 6, a (4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl group at position 7 and a methoxy substituent at position 8. A member of the fluoroquinolone class of antibacterial agents. |
| orlistat | |
| 3-(4-(1,2-diphenylbut-1-enyl)phenyl)acrylic acid | |
| Lithium | An alkali metal atom that has formula Li. |
| indoline | An indole that has formula C8H9N. |
| Tetrazoles | An azole in which the five-membered heterocyclic aromatic skeleton contains four N atoms and one C atom. |
| Demecolcine | A secondary amino compound that is (S)-colchicine in which the N-acetyl group is replaced by an N-methyl group. Isolable from the autumn crocus, Colchicum autumnale, it is less toxic than colchicine and is used as an antineoplastic. |
| beta-Lactams | |
| Trichloroacetic Acid | A monocarboxylic acid that is acetic acid in which all three methyl hydrogens are substituted by chlorine. |
| Bromazepam | |
| CGK 733 | |
| xanthatin | A sesquiterpene lactone that has formula C15H18O3. |
| N-(2-(2-methoxy-6H-dipyrido(2,3-a-3,2-e)pyrrolizin-11-yl)ethyl)-2-furamide | |
| 11-dehydrocorticosterone | An 11-oxo steroid that is corticosterone in which the hydroxy substituent at the 11beta position has been oxidised to give the corresponding ketone. |
| 1,2-dichloroethylene | |
| tribromoethanol | |
| 4-hydroxybenzophenone | A benzophenone that has formula C13H10O2. |
| ovatodiolide | |
| Procarbazine | |
| cannogenin thevetoside | |
| tris(1,3-dichloro-2-propyl)phosphate | |
| tricetin | Flavone hydroxylated at positions 3', 4', 5, 5' and 7. |
| monotributyltin trichloride | |
| trichlorosucrose | |
| tamsulosin | A sulfonamide that has formula C20H28N2O5S. |
| 2-(1-hydroxy-4-oxocyclohexa-2,5-dienyl)pyran-4-one | |
| Sodium Oxybate | |
| Etomidate | The ethyl ester of 1-[(1R)-1-phenylethyl]-1H-imidazole-5-carboxylic acid. It is an intravenous general anaesthetic with no analgesic activity. |
| Sulfoglycosphingolipids | |
| ethyl-3-(4'-geranyloxy-3'-methoxyphenyl)-2-propenoate | |
| propargylglycine | |
| cyromazine | A triamino-1,3,5-triazine that has formula C6H10N6. |
| sodium nitrate | |
| Sulfinic Acids | |
| delta(4)-tibolone |
