This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Imatinib treatment of chronic myeloid leukemia cell lines: KU-812, KCL-22 and JURL-MK1 |
| Accession | GSE24493 |
| Summary | Analysis of CML cell lines (KU-812, KCL-22, and JURL-MK1) treated with tyrosine kinase inhibitor imatinib. Imatinib inhibits oncogenic BCR-ABL1, a tyrosine kinase present in most CML patients. Results provide insight into molecular mechanisms underlying imatinib inhibition of CML. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Imatinib |
| Smiles | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5 |
| Drugbank_id | DB00619 |
| Pubchem_cid | 5291 |
| Cell_type | NA |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
