This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Metastatic prostate cancer (HG-U95C) |
| Accession | GSE2547 |
| Summary | Analysis of metastatic prostate tumors and primary prostate tumors. Normal tissue adjacent to the tumor and normal donor tissue also examined. Metastasis reflects the most adverse clinical outcome. Results provide insight into the molecular mechanisms underlying the metastatic process. |
| Organism | rat |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | olanzapine |
| Smiles | CC1=CC2=C(NC3=CC=CC=C3N=C2S1)N4CCN(CC4)C |
| Pubchem_cid | 4585 |
| Cell_type | brain frontal cortex tissue |
| Organism | rat |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
