This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Cirrhotic liver response to the antiangiongenic agent Sunitinib |
| Accession | GSE6929 |
| Summary | Analysis of cirrhotic livers from animals treated with antioangeogenic agent Sunitinib. In cirrhosis, pathological processes such as inflammation and pathological angiogenesis are closely integrated. Results provide insight into the utility of targeting angiogenesis in the treatment of cirrhosis. |
| Organism | Rattus norvegicus |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Sunitinib |
| Smiles | CCN(CC)CCNC(=O)C1=C(NC(=C1C)C=C2C3=C(C=CC(=C3)F)NC2=O)C |
| Drugbank_id | DB01268 |
| Pubchem_cid | 5329102 |
| Cell_type | liver tissue |
| Organism | rat |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
