This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Bisphenol A effect on endometrial cell line: time course and dose response |
| Accession | GSE17624 |
| Summary | Temporal analysis of Ishikawa endometrial cells treated with various concentrations of bishpenol A (BPA). BPA is a very weak environmental estrogen given its low estrogen receptor affinity. Ishikawa cells represent a model to study the endometrial epithelium response to estrogen exposure in vitro. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Bisphenol A |
| Smiles | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| Pubchem_cid | 6623 |
| Cell_type | Ishikawa endometrial cells - 48 Hours 1uM |
| Organism | human |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
