This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Maternal diabetes effect on developing embryo |
| Accession | GSE4028 |
| Summary | Analysis of diabetes-exposed, E10.5 whole embryos. Diabetes was induced in FVB females (aged 7-9 wks) by streptozotocin. Maternal diabetes is a well-known risk factor for birth defects, such as neural tube defects. Results provide insight into the causative molecular mechanisms in developing embryo. |
| Organism | rat |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Diethylstilbestrol |
| Smiles | CCC(=C(CC)C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
| Drugbank_id | DB00255 |
| Pubchem_cid | 448537 |
| Cell_type | aci |
| Organism | rat |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
