This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Resveratrol (resVida) effect on obese men: vastus lateralis muscle biopsies |
| Accession | GSE32357 |
| Summary | Analysis of vastus lateralis muscle from obese men after 30 days of resveratrol supplementation. Resveratrol, a calorie restriction mimetic, significantly reduced sleeping and resting metabolic rate. Results provide insight into molecular mechanisms underlying the metabolic effects of resveratrol. |
| Organism | Homo sapiens |
| Platform | GPL11532 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | resveratrol |
| Smiles | Oc1ccc(cc1)/C=C/c1cc(O)cc(c1)O |
| Drugbank_id | DB02709 |
| Cell_type | vastus lateralis muscle |
| Organism | human |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
