This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Estrogen effect on male and female haematopoietic stem cells |
| Accession | GSE52711 |
| Summary | Comparison of male and female haematopoietic stem cells (HSCs) treated with estrogen. Results provide insight into the differences between the molecular response of male and female HSCs to sex hormones. |
| Organism | Mus musculus |
| Platform | GPL6246 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Estradiol |
| Smiles | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
| Drugbank_id | DB00783 |
| Pubchem_cid | 5757 |
| Cell_type | Haematopoietic stem cells (male) |
| Organism | mouse |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
