This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Aplidin and cytarabine effect on diffuse large B cell lymphoma cell line |
| Accession | GSE5681 |
| Summary | Analysis of diffuse large B cell lymphoma SKI-DLCL cells treated with Aplidin, cytarabine (AraC), or both anticancer drugs. The effect of the drugs on animals with SKI-DLCL cell-derived tumors also examined. Results provide insight into the action of Aplidin alone and in combination with AraC. |
| Organism | Homo sapiens |
| Platform | GPL571 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Aplidin |
| Smiles | CCC(C)C1C(CC(=O)OC(C(=O)C(C(=O)NC(C(=O)N2CCCC2C(=O)N(C(C(=O)OC(C(C(=O)N1)NC(=O)C(CC(C)C)N(C)C(=O)C3CCCN3C(=O)C(=O)C)C)CC4=CC=C(C=C4)OC)C)CC(C)C)C)C(C)C)O |
| Pubchem_cid | 56928089 |
| Cell_type | diffuse large B cell lymphoma SKI-DLCL cells |
| Organism | human |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
