This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Celecoxib induced transcriptional alterations in gastric cancer cells |
| Accession | GSE54657 |
| Summary | Celecoxib is recognized to have chemopreventive and anti-cancer property beyond its anti-inflammatory function. Celelcoxib treatment in AGS cells down regulates Wnt/β-catenin, STAT3, RXR and ERK/MAPK signaling pathways. Transcriptional profiling after celecoxib shows differential regulation of oncogenic pathway regulated genes. |
| Organism | Homo sapiens |
| Platform | GPL6244 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Celecoxib |
| Smiles | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
| Drugbank_id | DB00482 |
| Pubchem_cid | 2662 |
| Cell_type | AGS cells |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
