This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | EphB2-selected populations of intestinal crypt cells |
| Accession | GSE4514 |
| Summary | Analysis of intestinal epithelial cells FACS-sorted according to high, medium or low EphB2 receptor levels. Intestinal stem cells (ISC) highly express EphB2 receptor which becomes gradually silenced as cells differentiate. Results provide insight into a molecular program specific for normal ISCs. |
| Organism | rat |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Mehp |
| Smiles | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)O |
| Pubchem_cid | 20393 |
| Cell_type | Testes (prepubertal) - 6 Hours |
| Organism | rat |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
