This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Expression data of cystic fibrosis and non-cystic fibrosis airway cell lines under oxidative stress |
| Accession | GSE39843 |
| Summary | CF's physiopathology is poorly explained by the mutation alone. The oxydative stress could be a major factor of this illness . Study its impact on transcriptome's CF cell line could be ameliorate our understanding of the evolution of cystic fibrosis. we used microarray technology to evaluate under oxydative stress, the transcriptional state of an epithelial lung cell issued from a human with cystic fibrosis and to identify a set of modulated genes associated to survival cell processes. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | 2,3-dimethoxy-1,4-naphtoquinone (DMNQ) |
| Smiles | COC1=C(C(=O)C2=CC=CC=C2C1=O)OC |
| Pubchem_cid | 3136 |
| Cell_type | epithelial lung cells |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
