This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Lapatinib effect on lapatinib-resistant ErbB2-positive cell line: dose response |
| Accession | GSE38376 |
| Summary | Analysis of lapatinib-resistant ErbB2-positive cells treated with 0.1 or 1 uM lapatinib. Lapatinib is an EGFR/ErbB2 inhibitor used to treat ErbB2‐positive advanced or metastatic breast cancer. Results provide insight into the mechanisms underlying the development of resistance to lapatinib. |
| Organism | Homo sapiens |
| Platform | GPL6947 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Lapatinib |
| Smiles | CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl |
| Drugbank_id | DB01259 |
| Pubchem_cid | 208908 |
| Cell_type | lapatinib-sensitive ErbB2-positive cells treated with 0.1 uM lapatinib |
| Organism | human |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
