This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Retinal pigment epithelium development |
| Accession | GSE2964 |
| Summary | Analysis of retinal pigment epithelia (RPE) of E7 to E18 embryos. The RPE regulates transport between the neural retina and fenestrated capillaries of the choroid, a vascular layer between the retina and sclera. Results provide insight into the extent of remodeling of the RPE during development. |
| Organism | human |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | ZINC ACETATE |
| Smiles | CC(=O)[O-].CC(=O)[O-].[Zn+2] |
| Pubchem_cid | 11192 |
| Cell_type | Ramos B-cell lymphoma line - 50 uM |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
