This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Tamoxifen effect on SRC-1-deficient endocrine-resistant breast cancer cell line LY2 |
| Accession | GSE28645 |
| Summary | Analysis of endocrine-resistant LY2 breast cancer cells depleted of p160 steroid coactivator protein SRC-1 and treated with tamoxifen. SRC-1 is central to the development of the endocrine resistant phenotype. Results provide insight into the molecular basis of endocrine resistant breast cancer. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Tamoxifen |
| Smiles | CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3 |
| Drugbank_id | DB00675 |
| Pubchem_cid | 2733526 |
| Cell_type | NA |
| Organism | human |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
