This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Radiation chimera model: Trp53-null mammary tumors arising from irradiated, wildtype hosts |
| Accession | GSE4768 |
| Summary | Analysis of Trp53-null mammary tumors arising from WT hosts cleared of mammary gland epithelium, irradiated, then transplanted with nonmalignant Trp53-null mammary tissue. Results provide insight into the influence of the radiation response of the microenvironment on the carcinogenic process. |
| Organism | mouse |
| Platform | GPL1261 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Decitabine |
| Smiles | C1C(C(OC1N2C=NC(=NC2=O)N)CO)O |
| Drugbank_id | DB01262 |
| Pubchem_cid | 451668 |
| Cell_type | fibroblasts |
| Organism | mouse |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
