This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Lymphoblastoid cell lines from monozygotic twin pairs discordant for bipolar disorder |
| Accession | GSE7036 |
| Summary | Analysis of lymphoblastoid cell lines derived from 3 monozygotic twin pairs discordant for bipolar disorder. Results provide insight into the molecular pathogenesis of bipolar disorder. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Citalopram |
| Smiles | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F |
| Drugbank_id | DB00215 |
| Pubchem_cid | 2771 |
| Cell_type | lymphoblastoid cells |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
