This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Rosiglitazone effect on PRDM16-deficient inguinal white adipose tissue: stromal-vascular cells |
| Accession | GSE35011 |
| Summary | Analysis of SV cells isolated from PRDM16-depleted inguinal white adipose tissue (WAT) treated with rosiglitazone. Antidiabetic PPARγ ligand drugs, such as rosiglitazone, activate a browning of WAT. Results provide insight into molecular mechanisms underlying white-to-brown fat conversion. |
| Organism | Mus musculus |
| Platform | GPL8321 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Rosiglitazone effect on PRDM16-deficient inguinal white adipose tissue |
| Smiles | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3 |
| Pubchem_cid | 77999 |
| Cell_type | stromal-vascular cells |
| Organism | mouse |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
