This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Lapatinib-resistant HER2-positive breast tumor cells |
| Accession | GSE16179 |
| Summary | Analysis of BT474 (lapatinib-sensitive) and BT474-J4 (acquired lapatinib-resistance) HER2+ breast cancer cells treated with lapatinib, foretinib or both. Foretinib restored lapatinib-sensitivity in BT474-J4. Results provide insight into molecular basis of acquired lapatinib-resistance in BC cells. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | foretinib |
| Smiles | COC1=CC2=C(C=CN=C2C=C1OCCCN3CCOCC3)OC4=C(C=C(C=C4)NC(=O)C5(CC5)C(=O)NC6=CC=C(C=C6)F)F |
| Pubchem_cid | 42642645 |
| Cell_type | BT474-J4 (acquired lapatinib-resistance) HER2+ breast cancer cells |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
