This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Clear cell renal cell carcinoma (HG-U133A) |
| Accession | GSE2880 |
| Summary | Analysis of patient matched normal and stage 1 or stage 2 clear cell renal cell carcinoma (cRCC) tumors. Results provide insight into the molecular pathogenesis of cRCC. |
| Organism | rat |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Phenytoin |
| Smiles | C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=CC=C3 |
| Drugbank_id | DB00252 |
| Pubchem_cid | 1775 |
| Cell_type | brainstem |
| Organism | rat |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
