This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Uterine fibroid and normal myometrial tissue |
| Accession | GSE484 |
| Summary | Comparison of normal myometrium and uterine leiomyomas obtained from fibroid afflicted patients. |
| Organism | mouse |
| Platform | GPL81 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Tretinoin |
| Smiles | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| Drugbank_id | DB00755 |
| Pubchem_cid | 444795 |
| Cell_type | NA |
| Organism | mouse |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
