This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Fra-1 deficient lung response to fibrotic agent bleomycin |
| Accession | GSE43695 |
| Summary | Analysis of lungs from Fra-1 deficient mutants 5 days following intratracheal administration of bleomycin to induce lung fibrosis. Fra-1 is a b-ZIP transcription factor. Results provide insight into the molecular mechanisms by which Fra-1 protects against bleomycin-induced lung injury. |
| Organism | Mus musculus |
| Platform | GPL6246 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Bleomycin |
| Smiles | CC1=C(N=C(N=C1N)C(CC(=O)N)NCC(C(=O)N)N)C(=O)NC(C(C2=CN=CN2)OC3C(C(C(C(O3)CO)O)O)OC4C(C(C(C(O4)CO)O)OC(=O)N)O)C(=O)NC(C)C(C(C)C(=O)NC(C(C)O)C(=O)NCCC5=NC(=CS5)C6=NC(=CS6)C(=O)NCCC[S+](C)C)O |
| Drugbank_id | DB00290 |
| Pubchem_cid | 5360373 |
| Cell_type | Lung (Fra-1 deficient mutants) |
| Organism | mouse |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
