This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Intestinal epithelium response to ursodeoxycholic acid |
| Accession | GSE21266 |
| Summary | Analysis of normal colon epithelium of C57BL/6J females fed a standard diet containing 0.4% ursodeoxycholic acid (UDCA). UDCA mitigates colon carcinogenesis in humans and in animal models. Results provide insight into the molecular mechanisms underlying the anticarcinogenic action of UDCA. |
| Organism | Mus musculus |
| Platform | GPL8321 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Ursodeoxycholic acid |
| Smiles | CC(CCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |
| Drugbank_id | DB01586 |
| Pubchem_cid | 31401 |
| Cell_type | colon epithelium |
| Organism | mouse |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
