This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Fibroblast growth factor receptor 3 depletion effect on bladder cancer cell line RT112 |
| Accession | GSE41035 |
| Summary | Analysis of bladder cancer cell line RT112 subjected to doxycycline-inducible, shRNA knockdown of FGFR3. Knockdown of FGFR3 in RT112 cells significantly attenuates tumor growth in vitro and in vivo. Results provide insight into the molecular mechanisms underlying FGFR3-driven bladder cancer. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Doxycycline |
| Smiles | CC1C2C(C3C(C(=O)C(=C(N)O)C(=O)C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)N(C)C)O |
| Drugbank_id | DB00254 |
| Pubchem_cid | 5281011 |
| Cell_type | RT112 cancer cell line (FGFR3 knocked down with shRNA 2-4) |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
