This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Psoriasis mouse models |
| Accession | GSE27628 |
| Summary | Analysis of psoriatic skin from back, ear from five psoriasis models (K5-Tie2, imiquimod, K14-AREG, K5-Stat3C and K5-TGFbeta1). Psoriasis is a chronic autoimmune disease characterized by patches of red, often scaly skin. Results provide insight into molecular mechanisms underlying psoriasis. |
| Organism | Mus musculus |
| Platform | GPL1261 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Imiquimod |
| Smiles | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
| Drugbank_id | DB00724 |
| Pubchem_cid | 57469 |
| Cell_type | psoriatic skin from back |
| Organism | mouse |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
