This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | None |
| Accession | GSE33606 |
| Organism | human |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | VX |
| Smiles | CCOP(=O)(C)SCCN(C(C)C)C(C)C |
| Pubchem_cid | 39793 |
| Cell_type | hNHEPS Hepatocytes - 6 Hours after exposure with 0.1 μM |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
