This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | T cell leukemia cell response to human herpesvirus 6 infection: time course |
| Accession | GSE1676 |
| Summary | Analysis of an adult T cell leukemia cell line (TaY) following infection with human herpesvirus type 6B strain OK. Cells examined up to 5 days post-infection. Chronically-infected TaY cells were also examined. Results identify candidate genes that regulate the immune response during viral infection. |
| Organism | human |
| Platform | GPL201 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | neocarzinostatin |
| Smiles | CC1C(C(C(C(O1)OC2C3CC#CC4C(O4)(C#CC3=CC2OC(=O)C5=C(C=CC6=C(C=C(C=C65)OC)C)O)C7COC(=O)O7)NC)O)O |
| Pubchem_cid | 5282473 |
| Cell_type | HEK293 |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
