This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Liver response to various toxins |
| Accession | GSE5509 |
| Summary | Analysis of livers of animals 48 hours after exposure to the toxin alpha-naphthylisothiocyanate (ANIT), dimethylnitrosamine (DMN), or n-methylformamide (NMF). Results provide insight into the mechanism of toxicity of each compound. |
| Organism | Rattus norvegicus |
| Platform | GPL1355 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | rosiglitazone |
| Smiles | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC=CC=N3 |
| Pubchem_cid | 77999 |
| Cell_type | Livers - 48 hours after exposure |
| Organism | rat |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
