This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Angiotensin II type 1 receptor antagonist effect on brain microvessels of hypertensive animals |
| Accession | GSE2739 |
| Summary | Analysis of brain microvessels from hypertensive SHR males treated with candesartan, an angiotensin II type 1 receptor (AT1) antagonist, daily for 4 weeks. Blockade of angiotensin II AT1 receptors in cerebral microvessels protects against brain ischemia and inflammation. |
| Organism | Rattus norvegicus |
| Platform | GPL85 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Candesartan |
| Smiles | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NNN=N5)C(=O)O |
| Drugbank_id | DB00796 |
| Pubchem_cid | 2541 |
| Cell_type | NA |
| Organism | rat |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
