This is a permanent results page for your analyzed data. Please save the link in your browser's address bar.
| Title / Description | Methotrexate-resistant HT29 colon adenocarcinoma cell line |
| Accession | GSE11440 |
| Summary | Analysis of HT29 colon cancer cells sensitive or resistant to methotrexate (MTX). MTX is used in the treatment of cancer. Chemotherapy effectiveness in cancer cells is compromised by development of drug resistance. Results provide insight into molecular mechanisms associated with drug resistance. |
| Organism | Homo sapiens |
| Platform | GPL570 |
| Normalized | False |
| Parsed SOFT file |
| Differential expression method | Characteristic Direction |
| Cutoff | 500 |
| Drug_name | Methotrexate |
| Smiles | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |
| Drugbank_id | DB00563 |
| Pubchem_cid | 126941 |
| Cell_type | HT29 colon adenocarcinoma cell line |
| Organism | human |
| Principal Component Analysis | |
| Hierarchical clustering |
| Gene lists | Enrichr | L1000CDS2 | PAEA | Crowdsourcing | |
| Up |
|
||||
| Down |
|
||||
| Combined |
|
|
|
|
